CentOS Buildlogs Mirror
This server contains a mix of raw/unsigned packages and/or build logs
It should be used mainly for testing purposes
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[DIR]](/icons/folder.gif){kind=icon} | 0-NOARCH/ | 2019-03-19 22:40 | - | |
| 0ad-data/ | 2018-08-26 01:08 | - | |
| 0ad/ | 2019-02-20 21:35 | - | |
| 0install/ | 2017-08-02 15:59 | - | |
| 2ping/ | 2016-08-10 23:19 | - | |
| 3proxy/ | 2016-08-10 23:22 | - | |
| 4diac-forte/ | 2018-08-26 01:29 | - | |
| 90-Second-Portraits/ | 2018-08-26 01:42 | - | |
| 389-admin-console/ | 2017-07-25 16:42 | - | |
| 389-admin/ | 2017-07-25 16:38 | - | |
| 389-adminutil/ | 2016-08-10 23:21 | - | |
| 389-console/ | 2017-08-02 12:48 | - | |
| 389-ds-console/ | 2017-08-02 12:48 | - | |
| 389-ds/ | 2017-07-25 16:51 | - | |
| 389-dsgw/ | 2017-07-25 16:58 | - | |
| 2048-cli/ | 2016-08-10 23:18 | - | |
| Agda/ | 2019-03-19 22:46 | - | |
| AntTweakBar/ | 2016-08-10 23:49 | - | |
| BEDTools/ | 2017-07-25 22:42 | - | |
| BackupPC-XS/ | 2017-08-02 12:48 | - | |
| BackupPC/ | 2017-08-02 12:48 | - | |
| BareBonesBrowserLaunch/ | 2016-08-11 00:23 | - | |
| BibTool/ | 2016-08-11 00:31 | - | |
| CBFlib/ | 2017-08-02 12:48 | - | |
| CGSI-gSOAP/ | 2019-02-21 01:40 | - | |
| CUnit/ | 2016-08-11 02:36 | - | |
| Canna/ | 2016-08-11 01:09 | - | |
| CharLS/ | 2016-08-11 01:27 | - | |
| Coin2/ | 2016-08-11 01:55 | - | |
| Coin3/ | 2017-07-26 05:06 | - | |
| ColPack/ | 2016-08-11 02:00 | - | |
| CutyCapt/ | 2019-02-21 05:50 | - | |
| DivFix++/ | 2019-02-21 06:51 | - | |
| FlightCrew/ | 2016-08-11 04:46 | - | |
| FoXlibf/ | 2017-07-27 00:52 | - | |
| GMT/ | 2019-02-28 06:09 | - | |
| GarminPlugin/ | 2019-02-21 10:14 | - | |
| GeographicLib/ | 2018-08-31 20:48 | - | |
| GitPython/ | 2018-08-27 08:46 | - | |
| GraphicsMagick/ | 2019-02-22 01:27 | - | |
| GtkAda/ | 2017-07-27 23:28 | - | |
| GtkAda3/ | 2016-08-11 09:09 | - | |
| HepMC/ | 2019-02-22 03:15 | - | |
| Judy/ | 2017-07-29 14:31 | - | |
| Lmod/ | 2019-02-22 12:47 | - | |
| MUMPS/ | 2018-08-28 17:23 | - | |
| MySQL-zrm/ | 2018-08-28 17:52 | - | |
| NLopt/ | 2016-08-11 21:01 | - | |
| NaturalDocs/ | 2016-08-11 20:37 | - | |
| NetworkManager-fortisslvpn/ | 2019-03-21 04:40 | - | |
| NetworkManager-l2tp/ | 2018-08-28 18:53 | - | |
| NetworkManager-openconnect/ | 2018-08-28 18:58 | - | |
| NetworkManager-openvpn/ | 2019-02-28 15:47 | - | |
| NetworkManager-pptp/ | 2019-02-22 18:46 | - | |
| NetworkManager-strongswan/ | 2019-02-22 18:51 | - | |
| NetworkManager-vpnc/ | 2018-08-28 19:03 | - | |
| OCE/ | 2017-08-02 12:49 | - | |
| OpenColorIO/ | 2019-03-21 05:47 | - | |
| OpenImageIO/ | 2019-03-21 05:49 | - | |
| OpenLP/ | 2016-08-12 03:55 | - | |
| OpenMolcas/ | 2019-02-22 22:26 | - | |
| OpenStego/ | 2018-08-29 03:07 | - | |
| PEGTL/ | 2017-07-31 19:15 | - | |
| PackageKit-Qt/ | 2016-08-12 04:15 | - | |
| Pound/ | 2016-08-12 17:09 | - | |
| PragmARC/ | 2016-08-12 17:13 | - | |
| ProDy/ | 2018-09-02 05:53 | - | |
| PyDrive/ | 2018-09-02 07:37 | - | |
| PyQt4-webkit/ | 2019-02-25 18:21 | - | |
| PyQuante/ | 2018-09-02 07:59 | - | |
| PyXB/ | 2018-10-17 04:13 | - | |
| QuantLib/ | 2016-08-13 01:22 | - | |
| R-RInside/ | 2019-02-27 02:59 | - | |
| R-RUnit/ | 2019-02-27 03:12 | - | |
| R-Rcpp/ | 2019-02-27 02:51 | - | |
| R-highlight/ | 2019-02-27 01:53 | - | |
| R-inline/ | 2019-02-27 02:02 | - | |
| R-littler/ | 2019-02-27 02:11 | - | |
| R-qtl/ | 2019-02-27 02:38 | - | |
| R-rlecuyer/ | 2019-02-27 03:05 | - | |
| R/ | 2019-03-14 03:21 | - | |
| R2spec/ | 2016-08-13 01:33 | - | |
| RBTools/ | 2018-10-17 13:33 | - | |
| RabbIT/ | 2016-08-13 01:34 | - | |
| RackTables/ | 2018-10-17 12:41 | - | |
| RdRand/ | 2016-08-13 01:52 | - | |
| ReviewBoard/ | 2019-02-27 01:51 | - | |
| SDL2/ | 2019-02-27 04:47 | - | |
| SDL2_gfx/ | 2018-10-17 23:59 | - | |
| SDL2_image/ | 2019-02-27 04:52 | - | |
| SDL2_mixer/ | 2019-02-27 04:55 | - | |
| SDL2_net/ | 2018-10-18 00:09 | - | |
| SDL2_ttf/ | 2019-02-27 04:59 | - | |
| SDL_Pango/ | 2016-08-13 06:03 | - | |
| SDL_gfx/ | 2016-08-13 06:02 | - | |
| SDL_image/ | 2018-10-18 00:15 | - | |
| SDL_mixer/ | 2018-10-18 00:18 | - | |
| SDL_net/ | 2018-10-18 00:21 | - | |
| SDL_sound/ | 2019-02-27 05:03 | - | |
| SDL_ttf/ | 2016-08-13 06:05 | - | |
| SIMVoleon/ | 2018-10-18 01:52 | - | |
| ShellCheck/ | 2019-03-21 12:27 | - | |
| SoQt/ | 2018-10-18 03:38 | - | |
| SocketW/ | 2016-08-13 07:08 | - | |
| StarCluster/ | 2016-08-13 08:04 | - | |
| SuperLU/ | 2018-10-18 06:08 | - | |
| SuperLUMT/ | 2019-03-21 13:03 | - | |
| TeXmacs/ | 2016-08-13 11:06 | - | |
| Thunar/ | 2019-03-21 13:11 | - | |
| TurboGears/ | 2018-10-18 11:11 | - | |
| TurboGears2/ | 2018-10-18 11:15 | - | |
| VMDKstream/ | 2016-08-13 13:55 | - | |
| VirtualGL/ | 2018-10-18 14:28 | - | |
| WALinuxAgent/ | 2018-10-18 15:33 | - | |
| Xaw3d/ | 2016-08-13 15:20 | - | |
| Zim/ | 2019-02-27 13:03 | - | |
| a52dec/ | 2017-07-25 16:06 | - | |
| aalib/ | 2016-08-10 23:23 | - | |
| abc/ | 2017-07-25 17:02 | - | |
| abcde/ | 2016-08-10 23:23 | - | |
| abduco/ | 2016-08-10 23:24 | - | |
| abi-compliance-checker/ | 2018-08-26 01:53 | - | |
| abi-dumper/ | 2018-08-26 02:07 | - | |
| abi-tracker/ | 2018-08-26 02:09 | - | |
| abook/ | 2018-08-26 02:12 | - | |
| abrt-addon-python3/ | 2019-02-20 21:50 | - | |
| abrt-server-info-page/ | 2018-08-26 02:16 | - | |
| ack/ | 2018-08-26 02:19 | - | |
| acme-tiny/ | 2018-08-26 02:23 | - | |
| activemq-cpp/ | 2017-07-25 17:23 | - | |
| adapta-backgrounds/ | 2019-02-20 21:52 | - | |
| adapta-gtk-theme/ | 2019-02-20 21:54 | - | |
| admesh/ | 2016-08-10 23:26 | - | |
| adobe-source-code-pro-fonts/ | 2018-10-08 22:59 | - | |
| adobe-source-han-sans-cn-fonts/ | 2016-08-10 23:29 | - | |
| adobe-source-han-sans-twhk-fonts/ | 2016-08-10 23:30 | - | |
| adobe-source-sans-pro-fonts/ | 2018-08-26 02:29 | - | |
| adplug/ | 2019-02-20 22:02 | - | |
| advancecomp/ | 2016-08-13 18:11 | - | |
| aesh/ | 2017-07-25 17:35 | - | |
| aespipe/ | 2016-08-10 23:32 | - | |
| afflib/ | 2016-08-10 23:32 | - | |
| afpfs-ng/ | 2016-08-10 23:33 | - | |
| afuse/ | 2016-08-10 23:34 | - | |
| agedu/ | 2018-08-26 02:34 | - | |
| aggregate/ | 2016-08-10 23:35 | - | |
| aha/ | 2019-02-20 22:08 | - | |
| aime/ | 2018-10-08 23:07 | - | |
| airinv/ | 2019-03-19 22:48 | - | |
| airnef/ | 2018-08-26 02:44 | - | |
| airrac/ | 2019-02-20 22:12 | - | |
| airtsp/ | 2019-02-20 22:19 | - | |
| aisleriot/ | 2018-08-26 02:50 | - | |
| akmods/ | 2018-08-26 02:55 | - | |
| alembic/ | 2018-08-26 02:58 | - | |
| alex/ | 2019-03-19 22:50 | - | |
| alglib/ | 2016-08-10 23:37 | - | |
| alien/ | 2017-08-02 12:48 | - | |
| alignak/ | 2019-02-20 22:28 | - | |
| almas-mongolian-title-fonts/ | 2016-08-10 23:38 | - | |
| alpine/ | 2018-08-26 03:08 | - | |
| altermime/ | 2016-08-10 23:41 | - | |
| am-utils/ | 2018-08-26 03:19 | - | |
| amarok/ | 2019-02-27 16:55 | - | |
| amavisd-milter/ | 2018-08-26 03:14 | - | |
| amavisd-new/ | 2019-02-20 22:32 | - | |
| amiri-fonts/ | 2017-07-25 18:09 | - | |
| amqp/ | 2017-07-25 18:12 | - | |
| amtterm/ | 2017-08-02 12:48 | - | |
| android-tools/ | 2016-08-10 23:45 | - | |
| anet/ | 2017-07-25 18:28 | - | |
| anjuta/ | 2019-02-20 22:35 | - | |
| ann/ | 2017-07-25 18:32 | - | |
| ansible-inventory-grapher/ | 2018-08-26 03:43 | - | |
| ansible-lint/ | 2018-08-26 03:46 | - | |
| ansible-openstack-modules/ | 2016-08-10 23:48 | - | |
| ansible-review/ | 2018-08-26 03:49 | - | |
| ansible/ | 2019-02-20 22:45 | - | |
| ansible1.9/ | 2016-08-10 23:47 | - | |
| ansifilter/ | 2016-08-10 23:49 | - | |
| anthy/ | 2017-07-25 18:45 | - | |
| apache-commons-chain/ | 2017-08-02 12:48 | - | |
| apache-commons-csv/ | 2017-07-25 18:57 | - | |
| apache-commons-discovery/ | 2016-08-10 23:51 | - | |
| apache-commons-fileupload/ | 2017-08-02 12:48 | - | |
| apache-james-project/ | 2017-07-25 19:09 | - | |
| apache-mime4j/ | 2017-07-25 19:15 | - | |
| apachetop/ | 2016-08-10 23:53 | - | |
| apbs/ | 2016-08-13 18:18 | - | |
| apcupsd/ | 2017-08-02 12:48 | - | |
| apg/ | 2017-07-25 19:28 | - | |
| apiextractor/ | 2016-08-10 23:54 | - | |
| apigen/ | 2017-08-02 18:58 | - | |
| apiviz/ | 2017-07-25 19:34 | - | |
| apper/ | 2017-07-25 19:40 | - | |
| apt-cacher-ng/ | 2018-08-26 03:52 | - | |
| apvlv/ | 2018-08-26 03:55 | - | |
| aqbanking/ | 2017-08-02 12:48 | - | |
| arc-gui-clients/ | 2019-03-19 22:52 | - | |
| arc-theme/ | 2018-08-26 04:04 | - | |
| archaius/ | 2016-08-10 23:56 | - | |
| archimedes/ | 2018-08-26 04:01 | - | |
| archmage/ | 2017-07-25 19:54 | - | |
| arduino/ | 2019-02-20 22:58 | - | |
| argbash/ | 2019-02-20 23:01 | - | |
| argon2/ | 2018-08-26 04:13 | - | |
| argparse-manpage/ | 2018-08-26 04:15 | - | |
| argtable/ | 2016-08-10 23:57 | - | |
| argus/ | 2017-07-25 19:59 | - | |
| ari-backup/ | 2016-08-11 00:00 | - | |
| aria2/ | 2016-08-10 23:58 | - | |
| arj/ | 2016-08-11 00:01 | - | |
| armadillo/ | 2018-08-26 04:18 | - | |
| arp-scan/ | 2017-08-02 12:48 | - | |
| arpack/ | 2016-08-11 00:02 | - | |
| arprec/ | 2018-08-26 04:21 | - | |
| arts/ | 2017-07-25 20:07 | - | |
| artwiz-aleczapka-fonts/ | 2016-08-11 00:04 | - | |
| ascii-design/ | 2017-07-25 20:15 | - | |
| ascii/ | 2017-07-25 20:12 | - | |
| asciinema/ | 2019-02-20 23:05 | - | |
| asio/ | 2017-08-02 12:48 | - | |
| aspell-en/ | 2016-08-11 00:05 | - | |
| aspell-sk/ | 2016-08-11 00:06 | - | |
| assertj-core/ | 2017-08-02 12:48 | - | |
| assimp/ | 2017-08-02 12:48 | - | |
| ast/ | 2017-07-25 20:25 | - | |
| astigmatic-grand-hotel-fonts/ | 2017-07-25 20:30 | - | |
| astronomy-menus/ | 2019-02-20 23:07 | - | |
| atari++/ | 2016-08-11 00:08 | - | |
| atasm/ | 2016-08-11 00:09 | - | |
| atomic-reactor/ | 2018-08-26 05:13 | - | |
| atomicapp/ | 2017-07-25 20:35 | - | |
| atool/ | 2017-08-02 12:48 | - | |
| atop/ | 2018-08-26 05:16 | - | |
| atoum/ | 2017-07-25 20:43 | - | |
| atril/ | 2018-08-26 05:18 | - | |
| audacious-plugins/ | 2019-02-20 23:14 | - | |
| audacious/ | 2019-02-20 23:09 | - | |
| audacity/ | 2019-02-20 23:22 | - | |
| auter/ | 2019-02-20 23:34 | - | |
| autoconf-archive/ | 2017-07-25 21:01 | - | |
| autodownloader/ | 2017-07-25 21:03 | - | |
| autojump/ | 2019-02-20 23:37 | - | |
| autossh/ | 2016-08-11 00:13 | - | |
| autotest-framework/ | 2016-08-11 00:13 | - | |
| autotrash/ | 2016-08-11 00:14 | - | |
| autowrap/ | 2019-02-20 23:39 | - | |
| avl/ | 2016-08-11 00:15 | - | |
| avogadro2-libs/ | 2019-03-19 22:56 | - | |
| avogadro2/ | 2019-03-19 22:54 | - | |
| avr-binutils/ | 2017-07-25 21:16 | - | |
| avr-gcc/ | 2017-07-25 21:29 | - | |
| avr-libc/ | 2017-07-25 21:46 | - | |
| avrdude/ | 2017-07-25 21:22 | - | |
| awscli/ | 2018-08-25 11:56 | - | |
| awstats/ | 2018-08-26 05:49 | - | |
| axel/ | 2017-07-25 22:01 | - | |
| babeltrace/ | 2016-08-11 00:17 | - | |
| backintime/ | 2019-02-20 23:45 | - | |
| backup-manager/ | 2016-08-11 00:18 | - | |
| backupninja/ | 2019-02-20 23:47 | - | |
| bakefile/ | 2016-08-11 00:20 | - | |
| bam/ | 2016-08-11 00:20 | - | |
| bandwidthd/ | 2016-08-11 00:21 | - | |
| banner/ | 2017-07-25 22:12 | - | |
| bannergrab/ | 2016-08-11 00:21 | - | |
| banshee/ | 2019-03-19 22:59 | - | |
| barcode/ | 2017-07-25 22:17 | - | |
| bash-argsparse/ | 2016-08-11 00:23 | - | |
| bash-completion-extras/ | 2017-07-25 22:22 | - | |
| bashdb/ | 2016-08-11 00:25 | - | |
| bashmount/ | 2016-08-11 00:25 | - | |
| batctl/ | 2018-08-26 05:55 | - | |
| bats/ | 2016-08-11 00:26 | - | |
| bcrypt/ | 2017-07-25 22:28 | - | |
| bdii/ | 2016-08-11 00:27 | - | |
| beaker/ | 2019-02-20 23:52 | - | |
| beakerlib-libraries/ | 2018-10-09 00:00 | - | |
| beakerlib/ | 2018-08-26 06:01 | - | |
| bean-validation-api/ | 2017-07-25 22:36 | - | |
| beanstalkd/ | 2018-08-26 06:05 | - | |
| beecrypt/ | 2018-08-31 14:51 | - | |
| beesu/ | 2016-08-11 00:29 | - | |
| beets/ | 2017-07-25 22:46 | - | |
| bgpq3/ | 2018-08-26 06:12 | - | |
| biblesync/ | 2016-08-11 00:31 | - | |
| bibutils/ | 2019-02-27 17:23 | - | |
| bindfs/ | 2019-02-20 23:55 | - | |
| bionetgen/ | 2019-02-20 23:58 | - | |
| bip/ | 2016-08-11 00:33 | - | |
| bird/ | 2019-02-21 00:01 | - | |
| bird2/ | 2019-02-21 00:05 | - | |
| bitlbee-facebook/ | 2018-08-26 06:17 | - | |
| bitlbee-steam/ | 2017-07-25 23:01 | - | |
| bitlbee/ | 2017-08-02 12:48 | - | |
| bitmap/ | 2016-08-11 00:34 | - | |
| bitstream/ | 2017-07-25 23:05 | - | |
| bitten/ | 2016-08-11 00:34 | - | |
| bkhive/ | 2016-08-11 00:35 | - | |
| blacs/ | 2016-08-11 00:35 | - | |
| bleachbit/ | 2017-07-25 23:08 | - | |
| blender/ | 2019-03-19 23:01 | - | |
| blis/ | 2019-03-19 23:03 | - | |
| blosc/ | 2019-02-21 00:14 | - | |
| blt/ | 2016-08-11 00:37 | - | |
| blueberry/ | 2018-08-26 06:23 | - | |
| bluefish/ | 2017-07-25 23:19 | - | |
| bluez-tools/ | 2018-08-26 06:26 | - | |
| bmon/ | 2019-03-19 23:05 | - | |
| bodhi/ | 2019-02-21 00:24 | - | |
| boinc-client/ | 2019-02-21 00:32 | - | |
| bonnie++/ | 2017-07-25 23:36 | - | |
| boost-python3/ | 2019-03-19 23:10 | - | |
| boost148/ | 2016-08-11 00:42 | - | |
| boost169/ | 2019-03-19 23:07 | - | |
| borgbackup/ | 2019-03-19 23:12 | - | |
| borgmatic/ | 2019-03-19 23:14 | - | |
| botan/ | 2018-08-26 06:38 | - | |
| bouncycastle-pkix/ | 2017-08-02 12:48 | - | |
| bouncycastle/ | 2018-08-26 06:44 | - | |
| boxes/ | 2017-07-25 23:59 | - | |
| bpython/ | 2016-08-11 00:49 | - | |
| breathe/ | 2016-08-11 00:51 | - | |
| breeze-icon-theme/ | 2019-02-21 00:47 | - | |
| brightnessctl/ | 2018-08-26 12:39 | - | |
| bro/ | 2017-07-26 00:07 | - | |
| btest/ | 2016-08-11 00:54 | - | |
| bti/ | 2017-07-26 00:26 | - | |
| btkbdd/ | 2016-08-11 00:55 | - | |
| btrbk/ | 2018-08-26 12:42 | - | |
| bubblewrap/ | 2018-08-26 12:44 | - | |
| bucardo/ | 2017-08-02 12:48 | - | |
| bugwarrior/ | 2019-02-21 00:52 | - | |
| bugyou/ | 2017-08-02 12:48 | - | |
| bugyou_plugins/ | 2017-07-26 00:37 | - | |
| bullet/ | 2016-08-11 00:57 | - | |
| burp/ | 2018-08-26 12:49 | - | |
| bwa/ | 2019-03-19 23:16 | - | |
| bwm-ng/ | 2016-08-11 00:59 | - | |
| byobu/ | 2016-08-11 00:59 | - | |
| bzrtools/ | 2016-08-11 01:00 | - | |
| c3p0/ | 2017-07-26 00:43 | - | |
| cAudio/ | 2017-07-26 01:59 | - | |
| cabal-dev/ | 2019-03-19 23:18 | - | |
| cabal-install/ | 2019-03-19 23:20 | - | |
| cabal-rpm/ | 2019-03-19 23:22 | - | |
| cabextract/ | 2016-08-13 19:18 | - | |
| cacti-spine/ | 2019-03-19 23:24 | - | |
| cacti/ | 2019-02-21 01:03 | - | |
| cadaver/ | 2016-08-11 01:03 | - | |
| caddy/ | 2019-03-19 23:30 | - | |
| caja-actions/ | 2019-02-21 01:11 | - | |
| caja-extensions/ | 2018-08-26 13:05 | - | |
| caja-terminal/ | 2016-08-11 01:05 | - | |
| caja/ | 2017-08-03 01:13 | - | |
| cajun-jsonapi/ | 2016-08-11 01:05 | - | |
| calamaris/ | 2016-08-11 01:06 | - | |
| calc/ | 2017-07-26 01:12 | - | |
| calendar/ | 2017-07-26 01:16 | - | |
| calligra-l10n/ | 2016-08-11 01:06 | - | |
| calligra/ | 2019-03-19 23:33 | - | |
| cambozola/ | 2017-07-26 01:22 | - | |
| camotics/ | 2019-02-21 01:23 | - | |
| canl-c++/ | 2016-08-11 01:07 | - | |
| canl-c/ | 2017-07-26 01:27 | - | |
| canl-java/ | 2018-08-26 13:15 | - | |
| capnproto/ | 2017-07-26 01:42 | - | |
| capstats/ | 2016-08-11 01:11 | - | |
| capstone/ | 2018-10-09 00:37 | - | |
| carbon-c-relay/ | 2017-08-02 12:48 | - | |
| carbonate/ | 2017-08-02 12:48 | - | |
| caribou0/ | 2019-02-21 01:31 | - | |
| castget/ | 2018-08-26 13:24 | - | |
| catch/ | 2018-08-26 13:26 | - | |
| catdoc/ | 2017-07-26 01:56 | - | |
| cbootimage/ | 2018-08-26 13:29 | - | |
| ccache/ | 2017-07-26 02:04 | - | |
| cciss_vol_status/ | 2018-08-26 13:32 | - | |
| ccrypt/ | 2016-08-11 01:16 | - | |
| ccze/ | 2016-08-11 01:16 | - | |
| cd-discid/ | 2016-08-11 01:17 | - | |
| cdac-sakal-marathi-fonts/ | 2016-08-11 01:17 | - | |
| cdbs/ | 2017-08-02 12:48 | - | |
| cdk/ | 2016-08-11 01:18 | - | |
| cdlabelgen/ | 2016-08-11 01:18 | - | |
| cdpr/ | 2017-07-26 02:11 | - | |
| cego/ | 2017-08-02 12:48 | - | |
| centerim/ | 2016-08-11 01:19 | - | |
| ceph-deploy/ | 2017-08-02 12:48 | - | |
| ceph/ | 2017-08-02 12:48 | - | |
| cereal/ | 2017-07-26 02:19 | - | |
| ceres-solver/ | 2018-10-09 00:41 | - | |
| certbot/ | 2019-02-21 01:37 | - | |
| certmaster/ | 2017-07-26 02:31 | - | |
| cf-sorts-mill-goudy-fonts/ | 2016-08-11 01:24 | - | |
| cfitsio/ | 2018-08-26 13:38 | - | |
| cfv/ | 2016-08-11 01:24 | - | |
| cgdb/ | 2016-08-11 01:25 | - | |
| cgit/ | 2018-08-26 13:41 | - | |
| cgnslib/ | 2016-08-13 19:24 | - | |
| check-mk/ | 2019-03-19 23:35 | - | |
| checksec/ | 2017-08-02 12:48 | - | |
| chemtool/ | 2016-08-11 01:30 | - | |
| cherrytree/ | 2019-02-21 01:46 | - | |
| chicken/ | 2019-03-19 23:37 | - | |
| chirp/ | 2019-02-21 01:50 | - | |
| chm2pdf/ | 2016-08-11 01:32 | - | |
| chmlib/ | 2016-08-11 01:32 | - | |
| chromaprint/ | 2016-08-11 01:33 | - | |
| chromium/ | 2019-03-19 23:39 | - | |
| cinch/ | 2019-02-21 01:55 | - | |
| cinnamon-control-center/ | 2019-03-19 23:44 | - | |
| cinnamon-desktop/ | 2019-02-21 02:02 | - | |
| cinnamon-menus/ | 2019-03-19 23:46 | - | |
| cinnamon-screensaver/ | 2019-03-19 23:48 | - | |
| cinnamon-session/ | 2019-02-21 02:12 | - | |
| cinnamon-settings-daemon/ | 2019-03-19 23:51 | - | |
| cinnamon-themes/ | 2018-08-26 14:19 | - | |
| cinnamon-translations/ | 2019-02-21 02:20 | - | |
| cinnamon/ | 2019-03-19 23:42 | - | |
| ciphertest/ | 2016-08-11 01:38 | - | |
| cjdns/ | 2019-02-21 02:24 | - | |
| cjs/ | 2019-02-21 02:27 | - | |
| ck/ | 2017-07-26 03:28 | - | |
| ckeditor/ | 2016-08-11 01:39 | - | |
| ckermit/ | 2016-08-11 01:40 | - | |
| cl-asdf/ | 2016-08-11 01:42 | - | |
| clamav-unofficial-sigs/ | 2019-02-21 02:39 | - | |
| clamav/ | 2019-03-19 23:53 | - | |
| clamsmtp/ | 2019-03-19 23:59 | - | |
| classification-banner/ | 2018-08-31 15:58 | - | |
| classmate/ | 2017-07-26 03:45 | - | |
| clatd/ | 2018-08-26 14:41 | - | |
| clearlooks-phenix/ | 2018-08-26 14:44 | - | |
| clearsilver/ | 2019-03-20 00:01 | - | |
| cli-parser/ | 2017-07-26 04:01 | - | |
| clide/ | 2016-08-11 01:42 | - | |
| clinfo/ | 2017-08-03 05:42 | - | |
| clipper/ | 2017-08-02 12:48 | - | |
| cln/ | 2016-08-11 01:43 | - | |
| cloc/ | 2017-07-26 04:07 | - | |
| clojure/ | 2016-08-11 01:44 | - | |
| cloud-init/ | 2016-08-11 01:46 | - | |
| cloud-utils/ | 2019-03-20 00:05 | - | |
| clucene09/ | 2016-08-11 01:47 | - | |
| clustal-omega/ | 2016-08-11 01:47 | - | |
| clustershell/ | 2019-02-21 02:50 | - | |
| clusterssh/ | 2017-08-02 12:48 | - | |
| cmake-fedora/ | 2018-08-26 14:56 | - | |
| cmake3/ | 2019-03-20 00:12 | - | |
| cmap-resources/ | 2017-07-26 04:45 | - | |
| cmark/ | 2016-08-11 01:51 | - | |
| cminpack/ | 2016-08-11 01:51 | - | |
| cmocka/ | 2019-03-20 00:14 | - | |
| cmockery2/ | 2016-08-11 01:52 | - | |
| cmrt/ | 2018-08-31 16:12 | - | |
| cntlm/ | 2017-07-26 04:51 | - | |
| cobbler/ | 2019-03-20 00:16 | - | |
| coccinelle/ | 2019-03-20 00:18 | - | |
| codeblocks/ | 2019-02-21 03:01 | - | |
| codec2/ | 2018-08-31 16:17 | - | |
| coffee-script/ | 2018-09-04 14:55 | - | |
| coin-or-CoinUtils/ | 2016-08-13 19:48 | - | |
| coin-or-Ipopt/ | 2018-08-26 15:11 | - | |
| coin-or-Sample/ | 2017-07-26 05:18 | - | |
| collada-dom/ | 2017-07-26 05:21 | - | |
| collectd/ | 2019-02-21 03:18 | - | |
| collectl/ | 2017-08-02 12:48 | - | |
| colm/ | 2017-07-26 05:34 | - | |
| colordiff/ | 2016-08-11 01:59 | - | |
| colorize/ | 2016-08-11 02:00 | - | |
| combblas/ | 2019-03-20 00:24 | - | |
| comic-neue-fonts/ | 2016-08-11 02:01 | - | |
| common-lisp-controller/ | 2016-08-11 02:02 | - | |
| commoncpp2/ | 2016-08-11 02:02 | - | |
| compat-gtkhtml314/ | 2016-08-11 02:03 | - | |
| compat-guile18/ | 2017-07-26 05:37 | - | |
| compat-qpid-cpp/ | 2017-08-02 12:48 | - | |
| compat-tidy/ | 2017-07-26 05:43 | - | |
| compat-wxGTK3-gtk2/ | 2019-03-20 00:26 | - | |
| compface/ | 2016-08-11 02:07 | - | |
| composer/ | 2019-02-21 03:27 | - | |
| conakry-fonts/ | 2017-07-26 05:52 | - | |
| condor/ | 2019-03-01 17:36 | - | |
| configsnap/ | 2019-02-21 03:33 | - | |
| conky-manager/ | 2016-08-11 02:07 | - | |
| conky/ | 2017-07-26 06:00 | - | |
| connect-proxy/ | 2017-07-26 06:05 | - | |
| connman/ | 2016-08-11 02:08 | - | |
| conntrack-tools/ | 2016-08-11 02:09 | - | |
| conserver/ | 2017-07-26 06:08 | - | |
| console-bridge/ | 2016-08-11 02:09 | - | |
| conspy/ | 2017-07-26 06:11 | - | |
| containerd/ | 2019-03-20 00:28 | - | |
| containernetworking-cni/ | 2019-03-20 00:30 | - | |
| copr-builder/ | 2017-07-26 06:17 | - | |
| copr-cli/ | 2018-10-09 01:53 | - | |
| copr-dist-git/ | 2018-09-04 15:08 | - | |
| copy-jdk-configs/ | 2016-08-11 02:10 | - | |
| corrida/ | 2016-08-11 02:11 | - | |
| courier-unicode/ | 2017-07-26 06:25 | - | |
| cowsay/ | 2017-08-02 12:48 | - | |
| cpanspec/ | 2016-08-11 02:11 | - | |
| cpdup/ | 2017-07-26 06:31 | - | |
| cppcheck/ | 2019-03-05 18:07 | - | |
| cppformat/ | 2016-08-11 02:13 | - | |
| cpphs/ | 2019-03-20 00:32 | - | |
| cproto/ | 2019-02-21 03:53 | - | |
| cptutils/ | 2016-08-11 02:15 | - | |
| cpuid/ | 2016-08-11 02:15 | - | |
| cpulimit/ | 2016-08-11 02:16 | - | |
| createrepo_c/ | 2017-07-26 06:50 | - | |
| cronolog/ | 2016-08-11 02:17 | - | |
| cross-binutils/ | 2018-08-26 15:53 | - | |
| cross-gcc/ | 2019-03-20 00:34 | - | |
| crudini/ | 2017-07-26 07:59 | - | |
| cryptacular/ | 2017-07-26 08:02 | - | |
| cryptlib/ | 2017-07-26 08:08 | - | |
| cryptopp/ | 2017-07-26 08:14 | - | |
| cscppc/ | 2019-02-21 05:33 | - | |
| csdiff/ | 2019-02-21 05:39 | - | |
| csmock/ | 2019-02-21 05:44 | - | |
| csnappy/ | 2016-08-11 02:28 | - | |
| csslint/ | 2017-07-26 08:33 | - | |
| csvcat/ | 2016-08-11 02:29 | - | |
| cswrap/ | 2019-03-20 02:12 | - | |
| ctemplate/ | 2016-08-11 02:32 | - | |
| ctpl/ | 2016-08-11 02:33 | - | |
| ctstream/ | 2018-10-09 03:40 | - | |
| cube/ | 2017-07-26 08:43 | - | |
| cups-bjnp/ | 2016-08-11 02:37 | - | |
| cups-pdf/ | 2016-08-11 02:38 | - | |
| cups-x2go/ | 2016-08-11 02:40 | - | |
| curlftpfs/ | 2016-08-11 02:41 | - | |
| cvechecker/ | 2018-08-26 18:28 | - | |
| cvsgraph/ | 2016-08-11 02:44 | - | |
| cxxtest/ | 2016-08-11 02:46 | - | |
| cycle/ | 2017-07-26 09:05 | - | |
| czmq/ | 2019-03-20 02:15 | - | |
| d-din-fonts/ | 2018-08-26 19:06 | - | |
| d-feet/ | 2017-07-26 10:39 | - | |
| dSFMT/ | 2016-08-11 03:38 | - | |
| daala/ | 2019-02-21 05:55 | - | |
| daemonize/ | 2016-08-11 02:50 | - | |
| daq/ | 2019-03-20 02:17 | - | |
| dar/ | 2019-02-21 06:02 | - | |
| darcs/ | 2019-03-20 02:20 | - | |
| darkhttpd/ | 2016-08-11 02:52 | - | |
| darkstat/ | 2016-08-11 02:52 | - | |
| darktable/ | 2019-03-20 02:22 | - | |
| dash/ | 2019-02-21 06:11 | - | |
| datagrepper/ | 2018-08-26 18:45 | - | |
| datamash/ | 2018-08-26 18:48 | - | |
| datanommer-commands/ | 2017-08-02 12:48 | - | |
| datefudge/ | 2019-02-21 06:13 | - | |
| davfs2/ | 2016-08-11 02:55 | - | |
| davix/ | 2019-03-05 20:10 | - | |
| dayjournal/ | 2018-08-26 18:55 | - | |
| dbench/ | 2016-08-11 02:56 | - | |
| dbmail/ | 2016-08-13 20:03 | - | |
| dbus-c++/ | 2016-08-11 02:57 | - | |
| dbus-sharp-glib/ | 2019-03-20 02:26 | - | |
| dbus-sharp/ | 2019-03-20 02:24 | - | |
| dbusmenu-qt5/ | 2017-08-02 12:48 | - | |
| dc3dd/ | 2016-08-11 02:59 | - | |
| dcap/ | 2018-08-31 18:38 | - | |
| dcfldd/ | 2016-08-11 03:00 | - | |
| dcw-gmt/ | 2016-08-11 03:01 | - | |
| dd_rescue/ | 2018-08-26 19:09 | - | |
| ddclient/ | 2017-07-26 09:59 | - | |
| ddd/ | 2016-08-11 03:02 | - | |
| ddpt/ | 2016-08-11 03:02 | - | |
| ddrescue/ | 2017-08-03 16:05 | - | |
| ddupdate/ | 2019-02-21 06:24 | - | |
| debbuild/ | 2018-08-26 19:14 | - | |
| debconf/ | 2019-02-21 06:26 | - | |
| debhelper/ | 2019-02-21 06:29 | - | |
| debian-keyring/ | 2018-08-26 19:18 | - | |
| debmirror/ | 2019-02-21 06:31 | - | |
| debootstrap/ | 2019-02-21 06:33 | - | |
| dehydrated/ | 2018-08-26 19:26 | - | |
| deja-dup/ | 2017-07-26 10:25 | - | |
| denyhosts/ | 2016-08-11 03:06 | - | |
| derrick/ | 2017-08-02 12:48 | - | |
| dev86/ | 2016-08-11 03:07 | - | |
| devilspie2/ | 2018-08-26 19:28 | - | |
| devio/ | 2016-08-11 03:08 | - | |
| devscripts/ | 2019-03-20 02:28 | - | |
| dex/ | 2017-07-26 10:36 | - | |
| dh-autoreconf/ | 2017-07-26 10:44 | - | |
| dh-make/ | 2019-02-21 06:38 | - | |
| dhcping/ | 2016-08-11 03:09 | - | |
| dia/ | 2017-07-26 10:49 | - | |
| dib-utils/ | 2017-08-02 12:48 | - | |
| dibbler/ | 2016-08-13 20:09 | - | |
| dictd/ | 2018-08-26 19:36 | - | |
| did/ | 2019-02-21 06:41 | - | |
| dieharder/ | 2016-08-11 03:10 | - | |
| diffmark/ | 2016-08-11 03:11 | - | |
| diffuse/ | 2016-08-11 03:13 | - | |
| digikam/ | 2019-02-27 20:47 | - | |
| digitemp/ | 2016-08-11 03:14 | - | |
| dillo/ | 2017-08-02 12:48 | - | |
| dirac/ | 2016-08-11 03:14 | - | |
| discount/ | 2018-10-09 04:10 | - | |
| diskimage-builder/ | 2018-08-26 19:41 | - | |
| disktype/ | 2016-08-11 03:16 | - | |
| dislocker/ | 2018-08-26 19:44 | - | |
| disper/ | 2016-08-11 03:17 | - | |
| disruptor/ | 2017-07-26 11:18 | - | |
| dist-git/ | 2019-02-21 06:46 | - | |
| distcc/ | 2019-03-20 02:30 | - | |
| distgen/ | 2018-10-09 04:12 | - | |
| distribution-gpg-keys/ | 2019-02-21 06:48 | - | |
| djvulibre/ | 2017-07-26 11:41 | - | |
| dkms/ | 2018-08-26 19:56 | - | |
| dl/ | 2017-07-26 11:50 | - | |
| dl_poly/ | 2019-02-21 06:55 | - | |
| dmenu/ | 2017-07-26 11:57 | - | |
| dmlite/ | 2019-03-20 02:41 | - | |
| dmtcp/ | 2018-08-26 20:00 | - | |
| dnf-langpacks/ | 2016-08-11 03:21 | - | |
| dnf-plugins-core/ | 2017-08-02 12:48 | - | |
| dnf/ | 2017-07-26 12:06 | - | |
| dnscrypt-proxy/ | 2017-08-03 16:32 | - | |
| dnsdist/ | 2019-02-21 07:02 | - | |
| dnsenum/ | 2016-08-11 03:23 | - | |
| dnsjava/ | 2016-08-11 03:23 | - | |
| dnsmap/ | 2016-08-11 03:24 | - | |
| dnstop/ | 2016-08-11 03:25 | - | |
| docbook2X/ | 2016-08-11 03:25 | - | |
| docco/ | 2017-08-02 12:48 | - | |
| dock/ | 2017-07-26 12:21 | - | |
| docker-compose/ | 2019-02-21 07:08 | - | |
| dogtail/ | 2016-08-11 03:26 | - | |
| dojo/ | 2016-08-11 03:27 | - | |
| dosbox/ | 2019-02-27 21:14 | - | |
| double-conversion/ | 2016-08-13 20:19 | - | |
| dpkg/ | 2019-03-20 02:43 | - | |
| dpm-contrib-admintools/ | 2018-08-26 20:08 | - | |
| dpm-dsi/ | 2019-03-20 02:48 | - | |
| dpm-xrootd/ | 2019-03-20 02:50 | - | |
| dragonegg/ | 2019-03-20 02:52 | - | |
| drawtiming/ | 2016-08-11 03:29 | - | |
| drbdlinks/ | 2018-08-26 20:17 | - | |
| drobo-utils/ | 2016-08-11 03:31 | - | |
| dropbear/ | 2017-08-02 12:48 | - | |
| drupal7-active_tags/ | 2017-08-02 12:48 | - | |
| drupal7-addressfield/ | 2017-08-02 12:48 | - | |
| drupal7-admin_menu/ | 2017-08-02 12:48 | - | |
| drupal7-admin_theme/ | 2017-08-02 12:48 | - | |
| drupal7-advanced_help/ | 2016-08-11 03:34 | - | |
| drupal7-backup_migrate/ | 2018-08-26 20:21 | - | |
| drupal7-block_class/ | 2017-08-02 12:48 | - | |
| drupal7-chosen/ | 2017-07-26 13:03 | - | |
| drupal7-ckeditor/ | 2017-07-26 13:06 | - | |
| drupal7-context/ | 2017-07-26 13:09 | - | |
| drupal7-crumbs/ | 2018-08-26 20:24 | - | |
| drupal7-ctools/ | 2017-08-02 12:48 | - | |
| drupal7-date/ | 2017-07-26 13:17 | - | |
| drupal7-date_ical/ | 2017-07-26 13:20 | - | |
| drupal7-diff/ | 2017-07-26 13:23 | - | |
| drupal7-domain/ | 2017-07-26 13:26 | - | |
| drupal7-domain_locale/ | 2018-08-26 20:26 | - | |
| drupal7-drafty/ | 2018-08-26 20:29 | - | |
| drupal7-ds/ | 2017-07-26 13:32 | - | |
| drupal7-email/ | 2017-08-02 12:48 | - | |
| drupal7-entity/ | 2017-07-26 13:37 | - | |
| drupal7-entity_translation/ | 2018-08-26 20:31 | - | |
| drupal7-eva/ | 2018-08-26 20:34 | - | |
| drupal7-features/ | 2017-07-26 13:46 | - | |
| drupal7-feeds/ | 2018-08-26 20:36 | - | |
| drupal7-field_permissions/ | 2017-07-26 13:52 | - | |
| drupal7-file_entity/ | 2017-07-26 13:55 | - | |
| drupal7-fivestar/ | 2017-07-26 13:58 | - | |
| drupal7-google_analytics/ | 2018-08-26 20:39 | - | |
| drupal7-honeypot/ | 2017-07-26 14:03 | - | |
| drupal7-i18n/ | 2017-07-26 14:06 | - | |
| drupal7-job_scheduler/ | 2018-08-26 20:41 | - | |
| drupal7-jquery_update/ | 2017-08-02 12:48 | - | |
| drupal7-l10n_update/ | 2018-08-26 20:43 | - | |
| drupal7-lang_dropdown/ | 2018-08-26 20:46 | - | |
| drupal7-language_cookie/ | 2017-07-26 14:18 | - | |
| drupal7-libraries/ | 2017-07-26 14:21 | - | |
| drupal7-link/ | 2017-07-26 14:23 | - | |
| drupal7-login_destination/ | 2017-07-26 14:26 | - | |
| drupal7-markdown/ | 2017-07-26 14:29 | - | |
| drupal7-mediawiki_api/ | 2017-07-26 14:32 | - | |
| drupal7-menu_token/ | 2017-07-26 14:35 | - | |
| drupal7-metatag/ | 2017-07-29 01:57 | - | |
| drupal7-module_filter/ | 2017-08-02 12:48 | - | |
| drupal7-panels/ | 2017-07-26 14:44 | - | |
| drupal7-potx/ | 2017-07-26 14:47 | - | |
| drupal7-profiler/ | 2018-08-26 20:48 | - | |
| drupal7-rules/ | 2017-07-26 14:50 | - | |
| drupal7-site_map/ | 2017-08-02 12:48 | - | |
| drupal7-taxonomy_access_fix/ | 2018-08-26 20:51 | - | |
| drupal7-theme-adaptivetheme/ | 2017-07-26 14:58 | - | |
| drupal7-theme-zen/ | 2017-07-26 15:01 | - | |
| drupal7-title/ | 2017-07-26 15:04 | - | |
| drupal7-tmgmt/ | 2017-07-26 15:07 | - | |
| drupal7-token/ | 2017-07-26 15:10 | - | |
| drupal7-translation_overview/ | 2017-07-26 15:13 | - | |
| drupal7-uuid/ | 2017-07-26 15:16 | - | |
| drupal7-variable/ | 2017-07-26 15:18 | - | |
| drupal7-views/ | 2018-08-26 20:53 | - | |
| drupal7-views_bulk_operations/ | 2017-07-26 15:25 | - | |
| drupal7-views_slideshow/ | 2017-07-26 15:27 | - | |
| drupal7-votingapi/ | 2017-07-26 15:30 | - | |
| drupal7-webform/ | 2017-07-26 15:33 | - | |
| drupal7/ | 2019-02-21 07:23 | - | |
| drush/ | 2017-07-26 15:36 | - | |
| dsniff/ | 2017-07-26 15:39 | - | |
| dspam/ | 2018-08-26 20:56 | - | |
| dssp/ | 2016-08-11 03:39 | - | |
| duperemove/ | 2019-03-20 02:55 | - | |
| duplicity/ | 2019-02-21 07:27 | - | |
| duply/ | 2017-07-26 15:46 | - | |
| dvdauthor/ | 2017-08-02 12:48 | - | |
| dvdbackup/ | 2016-08-11 03:42 | - | |
| dvdisaster/ | 2016-08-11 03:43 | - | |
| dvisvgm/ | 2016-08-13 20:33 | - | |
| dwarves/ | 2017-07-26 15:52 | - | |
| dymo-cups-drivers/ | 2019-02-21 07:30 | - | |
| dynafed/ | 2019-03-20 02:57 | - | |
| dzen2/ | 2017-07-26 15:58 | - | |
| e3/ | 2017-07-26 16:01 | - | |
| easy-rsa/ | 2018-08-26 21:04 | - | |
| easymock3/ | 2017-07-26 16:04 | - | |
| easytag/ | 2017-08-02 12:48 | - | |
| eb/ | 2017-07-26 16:19 | - | |
| ebtree/ | 2017-07-26 16:22 | - | |
| ecdsautils/ | 2016-08-13 20:34 | - | |
| eclipse-filesystem/ | 2017-07-26 16:25 | - | |
| ecryptfs-utils/ | 2017-07-26 16:28 | - | |
| edg-gridftp-client/ | 2019-03-01 20:18 | - | |
| edg-mkgridmap/ | 2017-07-26 16:36 | - | |
| edk2/ | 2016-08-11 03:47 | - | |
| efl/ | 2019-03-20 02:59 | - | |
| eggdrop/ | 2016-08-11 03:47 | - | |
| egl-wayland/ | 2019-03-20 03:05 | - | |
| eglexternalplatform/ | 2018-10-09 04:44 | - | |
| eigen3/ | 2018-10-09 04:49 | - | |
| elastic-curator/ | 2017-08-02 12:48 | - | |
| elasticdump/ | 2017-08-02 12:48 | - | |
| elektra/ | 2016-08-13 20:36 | - | |
| elementary/ | 2019-03-20 03:07 | - | |
| elixir/ | 2019-02-21 07:47 | - | |
| elk/ | 2017-07-26 16:54 | - | |
| elmon/ | 2017-07-26 18:12 | - | |
| elog/ | 2017-07-26 18:15 | - | |
| elpa/ | 2017-08-02 12:48 | - | |
| emacs-haskell-mode/ | 2016-08-11 03:52 | - | |
| emacs-rpm-spec-mode/ | 2016-08-11 03:53 | - | |
| emacs-yaml-mode/ | 2016-08-11 03:54 | - | |
| enca/ | 2018-08-26 21:14 | - | |
| enet/ | 2016-08-11 03:55 | - | |
| engauge-digitizer/ | 2019-02-21 07:49 | - | |
| engrampa/ | 2017-08-03 17:09 | - | |
| enki/ | 2019-02-21 07:57 | - | |
| entr/ | 2017-07-26 19:48 | - | |
| eom/ | 2017-07-26 19:51 | - | |
| epel-release/ | 2018-08-26 21:26 | - | |
| epel-rpm-macros/ | 2018-08-26 21:28 | - | |
| epson-inkjet-printer-escpr/ | 2018-08-26 21:31 | - | |
| epstool/ | 2016-08-11 03:58 | - | |
| epylog/ | 2016-08-11 03:58 | - | |
| erfa/ | 2017-07-26 20:07 | - | |
| ergo/ | 2018-08-26 21:34 | - | |
| erlang-edown/ | 2019-03-20 03:09 | - | |
| erlang-emmap/ | 2019-03-20 03:11 | - | |
| erlang-epgsql/ | 2019-03-20 03:13 | - | |
| erlang-eradius/ | 2019-03-20 03:15 | - | |
| erlang-erlando/ | 2019-03-20 03:17 | - | |
| erlang-erlsom/ | 2019-03-20 03:19 | - | |
| erlang-erlsyslog/ | 2019-03-20 03:22 | - | |
| erlang-ibrowse/ | 2019-03-20 03:24 | - | |
| erlang-jiffy/ | 2019-03-20 03:26 | - | |
| erlang-meck/ | 2019-03-20 03:28 | - | |
| erlang-oauth/ | 2019-03-20 03:30 | - | |
| erlang-rebar/ | 2019-03-20 03:34 | - | |
| erlang-rpm-macros/ | 2016-08-11 04:05 | - | |
| erlang-sd_notify/ | 2019-03-20 03:36 | - | |
| erlang-skerl/ | 2019-03-20 03:38 | - | |
| erlang-snappy/ | 2019-03-20 03:40 | - | |
| erlang-xmlrpc/ | 2019-03-20 03:42 | - | |
| erlang/ | 2019-03-20 03:32 | - | |
| esound/ | 2016-08-11 04:07 | - | |
| espresso/ | 2019-03-20 03:44 | - | |
| etckeeper/ | 2018-08-26 22:37 | - | |
| ethstatus/ | 2016-08-11 04:09 | - | |
| euca2ools/ | 2018-08-26 22:39 | - | |
| evemu/ | 2018-08-26 22:42 | - | |
| eventlog/ | 2016-08-11 04:10 | - | |
| exaile/ | 2016-08-11 04:11 | - | |
| examiner/ | 2016-08-11 04:11 | - | |
| exciting/ | 2017-07-26 21:09 | - | |
| exim/ | 2019-02-21 08:39 | - | |
| exo/ | 2019-03-20 03:47 | - | |
| exodusii/ | 2017-08-03 18:07 | - | |
| exonerate/ | 2016-08-11 04:12 | - | |
| expresso/ | 2017-08-02 12:48 | - | |
| extra-cmake-modules/ | 2019-02-21 08:45 | - | |
| extundelete/ | 2016-08-11 04:15 | - | |
| eyesight/ | 2017-08-02 12:48 | - | |
| ezstream/ | 2017-07-26 22:23 | - | |
| f2c/ | 2018-08-31 19:51 | - | |
| f3/ | 2018-08-26 22:59 | - | |
| f22-backgrounds/ | 2016-08-11 04:17 | - | |
| fabric/ | 2018-08-26 23:02 | - | |
| facter/ | 2016-08-11 04:20 | - | |
| faience-icon-theme/ | 2016-08-11 04:21 | - | |
| fail2ban/ | 2019-02-21 08:51 | - | |
| fakeroot/ | 2016-08-11 04:22 | - | |
| fann/ | 2017-07-26 22:29 | - | |
| fasd/ | 2016-08-11 04:23 | - | |
| fastd/ | 2017-08-03 18:22 | - | |
| fasterxml-oss-parent/ | 2016-08-11 04:24 | - | |
| fastlz/ | 2016-08-11 04:25 | - | |
| fatresize/ | 2017-07-26 22:35 | - | |
| fcgi/ | 2017-07-26 22:38 | - | |
| fcgiwrap/ | 2019-02-21 08:54 | - | |
| fcitx-anthy/ | 2018-08-26 23:14 | - | |
| fcitx-cloudpinyin/ | 2018-08-26 23:18 | - | |
| fcitx-configtool/ | 2018-08-26 23:22 | - | |
| fcitx-qt5/ | 2018-08-26 23:27 | - | |
| fcitx/ | 2018-08-26 23:08 | - | |
| fdupes/ | 2017-07-26 22:47 | - | |
| fedfind/ | 2019-02-21 08:57 | - | |
| fedmsg/ | 2018-08-26 23:33 | - | |
| fedora-easy-karma/ | 2018-08-26 23:36 | - | |
| fedora-gnat-project-common/ | 2016-08-11 04:28 | - | |
| fedora-packager/ | 2017-07-26 22:59 | - | |
| fedora-repo-zdicts/ | 2019-02-21 08:59 | - | |
| fedora-review-plugin-java/ | 2016-08-11 04:29 | - | |
| fedora-review/ | 2017-07-26 23:02 | - | |
| fedpkg-minimal/ | 2017-07-26 23:08 | - | |
| fedpkg/ | 2019-02-21 09:02 | - | |
| fedrepo-req/ | 2018-08-26 23:41 | - | |
| fedwatch/ | 2017-08-02 12:48 | - | |
| ferm/ | 2016-08-11 04:31 | - | |
| fernflower/ | 2019-02-21 09:05 | - | |
| fetch-crl/ | 2017-07-26 23:14 | - | |
| fex/ | 2017-07-26 23:17 | - | |
| fftw2/ | 2016-08-11 04:32 | - | |
| fido/ | 2016-08-13 21:26 | - | |
| fig2ps/ | 2016-08-11 04:34 | - | |
| figlet/ | 2016-08-11 04:34 | - | |
| filezilla/ | 2019-02-21 09:09 | - | |
| findbugs-bcel/ | 2017-07-26 23:23 | - | |
| fio/ | 2018-08-26 23:45 | - | |
| firebird/ | 2018-10-09 06:10 | - | |
| firefox-pkcs11-loader/ | 2018-08-26 23:48 | - | |
| firehol/ | 2016-08-11 04:36 | - | |
| fish/ | 2019-03-20 03:48 | - | |
| fishpoll/ | 2017-07-27 00:00 | - | |
| flamp/ | 2017-08-02 12:48 | - | |
| flann/ | 2016-08-11 04:39 | - | |
| flashrom/ | 2018-08-26 23:53 | - | |
| flatpak-module-tools/ | 2019-02-21 09:17 | - | |
| flcluster/ | 2018-08-26 23:55 | - | |
| fldigi/ | 2018-10-09 06:36 | - | |
| fleet-commander-admin/ | 2018-10-09 06:42 | - | |
| fleet-commander-client/ | 2018-08-27 00:07 | - | |
| flickcurl/ | 2016-08-11 04:45 | - | |
| fllog/ | 2018-08-27 00:10 | - | |
| flnet/ | 2018-08-27 00:13 | - | |
| florence/ | 2017-08-02 12:48 | - | |
| flow-tools/ | 2016-08-11 04:51 | - | |
| flrig/ | 2019-03-20 03:51 | - | |
| fluid-soundfont/ | 2017-08-02 12:48 | - | |
| fluid/ | 2017-07-27 00:27 | - | |
| fluidsynth/ | 2017-08-03 18:46 | - | |
| fluxbox/ | 2017-08-02 12:48 | - | |
| fluxcapacitor/ | 2018-08-31 20:06 | - | |
| flwkey/ | 2018-08-27 00:22 | - | |
| flxmlrpc/ | 2018-08-27 00:25 | - | |
| fmf/ | 2019-02-21 09:24 | - | |
| fmt/ | 2018-08-27 00:30 | - | |
| fntsample/ | 2016-08-11 04:57 | - | |
| fontawesome-fonts/ | 2016-08-11 04:57 | - | |
| fontdump/ | 2016-08-11 04:58 | - | |
| fontopia/ | 2018-08-27 00:34 | - | |
| fortune-mod/ | 2016-08-11 04:58 | - | |
| fotoxx/ | 2019-03-20 03:55 | - | |
| fpaste/ | 2018-08-27 00:36 | - | |
| fping/ | 2016-08-11 05:01 | - | |
| fpm2/ | 2017-07-27 00:58 | - | |
| fprobe-ulog/ | 2017-07-27 01:02 | - | |
| freealut/ | 2017-07-27 01:05 | - | |
| freecad/ | 2019-03-20 04:01 | - | |
| freeciv/ | 2019-02-21 09:31 | - | |
| freecolor/ | 2016-08-11 05:01 | - | |
| freedv/ | 2019-02-21 09:37 | - | |
| freeimage/ | 2016-08-11 05:02 | - | |
| freeipa-desktop-profile/ | 2018-08-27 00:45 | - | |
| freeradius-client/ | 2016-08-11 05:03 | - | |
| freerouting/ | 2016-08-11 05:03 | - | |
| freetds/ | 2016-08-11 05:04 | - | |
| freexl/ | 2018-08-27 00:48 | - | |
| freeze/ | 2017-07-27 01:17 | - | |
| freight/ | 2017-07-27 01:20 | - | |
| frepple/ | 2017-08-02 12:48 | - | |
| freshmaker/ | 2019-02-27 22:31 | - | |
| frobby/ | 2016-08-11 05:07 | - | |
| fs_mark/ | 2016-08-11 05:09 | - | |
| fslint/ | 2017-07-27 01:29 | - | |
| fstransform/ | 2018-08-27 00:53 | - | |
| fstrm/ | 2018-08-27 00:55 | - | |
| ftgl/ | 2016-08-11 05:10 | - | |
| ftplib/ | 2017-07-27 01:36 | - | |
| fts-monitoring/ | 2019-02-21 09:47 | - | |
| fts-rest/ | 2019-02-21 09:49 | - | |
| fts/ | 2019-03-20 04:03 | - | |
| func/ | 2017-07-27 01:47 | - | |
| funionfs/ | 2016-08-11 05:12 | - | |
| fuse-encfs/ | 2019-02-21 09:51 | - | |
| fuse-python/ | 2016-08-11 05:13 | - | |
| fuse-sshfs/ | 2018-09-04 18:52 | - | |
| fusioninventory-agent/ | 2018-08-27 01:07 | - | |
| future/ | 2019-02-21 09:55 | - | |
| fvwm/ | 2017-08-03 19:12 | - | |
| fwknop/ | 2016-08-11 05:16 | - | |
| g2clib/ | 2016-08-11 05:17 | - | |
| ga/ | 2019-03-20 04:05 | - | |
| gajim/ | 2017-07-27 02:19 | - | |
| galera/ | 2017-07-27 02:23 | - | |
| gambit-c/ | 2016-08-11 05:19 | - | |
| game-music-emu/ | 2019-03-01 21:28 | - | |
| gammu/ | 2019-03-20 04:11 | - | |
| ganglia/ | 2017-07-27 02:35 | - | |
| garcon/ | 2017-07-27 02:40 | - | |
| garmindev/ | 2016-08-11 05:21 | - | |
| garmintools/ | 2016-08-11 05:24 | - | |
| gasnet/ | 2018-08-27 01:31 | - | |
| gaupol/ | 2016-08-11 05:25 | - | |
| gball/ | 2016-08-13 21:36 | - | |
| gccxml/ | 2016-08-11 05:27 | - | |
| gdal/ | 2018-08-27 01:48 | - | |
| gdata-sharp/ | 2019-03-20 04:23 | - | |
| gdb-exploitable/ | 2018-08-27 02:06 | - | |
| gdl/ | 2019-02-27 22:57 | - | |
| geany-plugins/ | 2019-02-21 10:21 | - | |
| geany-themes/ | 2016-08-11 05:33 | - | |
| geany/ | 2018-08-27 02:11 | - | |
| gearmand/ | 2017-07-27 03:22 | - | |
| gecode/ | 2016-08-13 21:40 | - | |
| gen-oath-safe/ | 2018-08-27 02:23 | - | |
| genders/ | 2016-08-11 05:35 | - | |
| generatorrunner/ | 2016-08-11 05:38 | - | |
| gengetopt/ | 2016-08-11 05:39 | - | |
| geolite2/ | 2019-02-21 10:29 | - | |
| geos/ | 2016-08-11 05:42 | - | |
| geronimo-ejb/ | 2017-07-27 03:36 | - | |
| geronimo-interceptor/ | 2017-07-27 03:43 | - | |
| geronimo-jpa/ | 2017-07-27 03:49 | - | |
| geronimo-validation/ | 2016-08-11 05:43 | - | |
| getdns/ | 2018-08-27 02:30 | - | |
| getmail/ | 2019-02-21 10:32 | - | |
| gf2x/ | 2016-08-11 05:46 | - | |
| gfal2-python/ | 2019-03-20 04:27 | - | |
| gfal2-util/ | 2019-02-21 10:39 | - | |
| gfal2/ | 2019-03-20 04:25 | - | |
| gfalFS/ | 2019-03-20 04:29 | - | |
| gflags/ | 2017-07-27 04:11 | - | |
| gfm/ | 2019-03-01 21:52 | - | |
| gftp/ | 2019-02-21 10:45 | - | |
| ggz-base-libs/ | 2017-07-27 04:17 | - | |
| ggz-gtk-client/ | 2017-07-27 04:20 | - | |
| ghc-Diff/ | 2019-03-20 05:40 | - | |
| ghc-HTTP/ | 2019-03-20 06:44 | - | |
| ghc-HUnit/ | 2019-03-20 06:50 | - | |
| ghc-IfElse/ | 2019-03-20 06:52 | - | |
| ghc-JuicyPixels/ | 2019-03-20 06:56 | - | |
| ghc-MissingH/ | 2019-03-20 07:13 | - | |
| ghc-MonadCatchIO-transformers/ | 2019-03-20 07:17 | - | |
| ghc-QuickCheck/ | 2019-03-20 07:56 | - | |
| ghc-SHA/ | 2019-03-20 08:28 | - | |
| ghc-STMonadTrans/ | 2019-03-20 08:46 | - | |
| ghc-SafeSemaphore/ | 2019-03-20 08:17 | - | |
| ghc-X11-xft/ | 2019-03-20 09:51 | - | |
| ghc-X11/ | 2019-03-20 09:49 | - | |
| ghc-aeson-pretty/ | 2019-03-20 04:36 | - | |
| ghc-aeson/ | 2019-03-20 04:33 | - | |
| ghc-ansi-terminal/ | 2019-03-20 04:38 | - | |
| ghc-ansi-wl-pprint/ | 2019-03-20 04:40 | - | |
| ghc-async/ | 2019-03-20 04:42 | - | |
| ghc-attoparsec/ | 2019-03-20 04:44 | - | |
| ghc-base-unicode-symbols/ | 2019-03-20 04:48 | - | |
| ghc-base64-bytestring/ | 2019-03-20 04:46 | - | |
| ghc-blaze-builder-conduit/ | 2019-03-20 04:52 | - | |
| ghc-blaze-builder/ | 2019-03-20 04:50 | - | |
| ghc-blaze-html/ | 2019-03-20 04:54 | - | |
| ghc-blaze-markup/ | 2019-03-20 04:56 | - | |
| ghc-bloomfilter/ | 2019-03-20 04:58 | - | |
| ghc-boxes/ | 2019-03-20 05:00 | - | |
| ghc-cairo/ | 2019-03-20 05:02 | - | |
| ghc-case-insensitive/ | 2019-03-20 05:05 | - | |
| ghc-cautious-file/ | 2019-03-20 05:07 | - | |
| ghc-cereal/ | 2019-03-20 05:09 | - | |
| ghc-cmdargs/ | 2019-03-20 05:11 | - | |
| ghc-cmdtheline/ | 2019-03-20 05:13 | - | |
| ghc-concrete-typerep/ | 2019-03-20 05:15 | - | |
| ghc-conduit-extra/ | 2019-03-20 05:19 | - | |
| ghc-conduit/ | 2019-03-20 05:17 | - | |
| ghc-crypto-api/ | 2019-03-20 05:21 | - | |
| ghc-cryptohash/ | 2019-03-20 05:23 | - | |
| ghc-data-default/ | 2019-03-20 05:25 | - | |
| ghc-data-hash/ | 2019-03-20 05:29 | - | |
| ghc-dataenc/ | 2019-03-20 05:27 | - | |
| ghc-date-cache/ | 2019-03-20 05:31 | - | |
| ghc-dbus/ | 2019-03-20 05:33 | - | |
| ghc-deepseq-generics/ | 2019-03-20 05:35 | - | |
| ghc-derive/ | 2019-03-20 05:38 | - | |
| ghc-digest/ | 2019-03-20 05:42 | - | |
| ghc-dlist/ | 2019-03-20 05:44 | - | |
| ghc-edit-distance/ | 2019-03-20 05:46 | - | |
| ghc-entropy/ | 2019-03-20 05:48 | - | |
| ghc-exceptions/ | 2019-03-20 05:50 | - | |
| ghc-extensible-exceptions/ | 2019-03-20 05:52 | - | |
| ghc-fast-logger/ | 2019-03-20 05:54 | - | |
| ghc-filemanip/ | 2019-03-20 05:56 | - | |
| ghc-fsnotify/ | 2019-03-20 05:58 | - | |
| ghc-geniplate/ | 2019-03-20 06:00 | - | |
| ghc-ghc-mtl/ | 2019-03-20 06:03 | - | |
| ghc-ghc-paths/ | 2019-03-20 06:04 | - | |
| ghc-gio/ | 2019-03-20 06:07 | - | |
| ghc-glib/ | 2019-03-20 06:09 | - | |
| ghc-gtk/ | 2019-03-20 06:11 | - | |
| ghc-gtk3/ | 2019-03-20 06:13 | - | |
| ghc-haddock-library/ | 2019-03-20 06:15 | - | |
| ghc-happstack-server/ | 2019-03-20 06:17 | - | |
| ghc-hashable/ | 2019-03-20 06:19 | - | |
| ghc-hashed-storage/ | 2019-03-20 06:21 | - | |
| ghc-hashtables/ | 2019-03-20 06:23 | - | |
| ghc-haskeline/ | 2019-03-20 06:25 | - | |
| ghc-haskell-src-exts/ | 2019-03-20 06:27 | - | |
| ghc-highlighting-kate/ | 2019-03-20 06:29 | - | |
| ghc-hinotify/ | 2019-03-20 06:31 | - | |
| ghc-hint/ | 2019-03-20 06:33 | - | |
| ghc-hs-bibutils/ | 2019-03-20 06:36 | - | |
| ghc-hslogger/ | 2019-03-20 06:38 | - | |
| ghc-hslua/ | 2019-03-20 06:40 | - | |
| ghc-html/ | 2019-03-20 06:42 | - | |
| ghc-http-date/ | 2019-03-20 06:46 | - | |
| ghc-http-types/ | 2019-03-20 06:48 | - | |
| ghc-json/ | 2019-03-20 06:54 | - | |
| ghc-language-java/ | 2019-03-20 06:58 | - | |
| ghc-libffi/ | 2019-03-20 07:00 | - | |
| ghc-libxml-sax/ | 2019-03-20 07:02 | - | |
| ghc-lifted-base/ | 2019-03-20 07:04 | - | |
| ghc-lrucache/ | 2019-03-20 07:06 | - | |
| ghc-maccatcher/ | 2019-03-20 07:09 | - | |
| ghc-mime-types/ | 2019-03-20 07:11 | - | |
| ghc-mmap/ | 2019-03-20 07:15 | - | |
| ghc-monad-control/ | 2019-03-20 07:19 | - | |
| ghc-monad-loops/ | 2019-03-20 07:21 | - | |
| ghc-monad-unify/ | 2019-03-20 07:25 | - | |
| ghc-monads-tf/ | 2019-03-20 07:23 | - | |
| ghc-mtl/ | 2019-03-20 07:27 | - | |
| ghc-nats/ | 2019-03-20 07:29 | - | |
| ghc-network-conduit/ | 2019-03-20 07:33 | - | |
| ghc-network/ | 2019-03-20 07:31 | - | |
| ghc-optparse-applicative/ | 2019-03-20 07:35 | - | |
| ghc-pandoc-types/ | 2019-03-20 07:38 | - | |
| ghc-pango/ | 2019-03-20 07:39 | - | |
| ghc-parallel/ | 2019-03-20 07:42 | - | |
| ghc-parsec/ | 2019-03-20 07:44 | - | |
| ghc-pattern-arrows/ | 2019-03-20 07:46 | - | |
| ghc-pcre-light/ | 2019-03-20 07:48 | - | |
| ghc-polyparse/ | 2019-03-20 07:50 | - | |
| ghc-primitive/ | 2019-03-20 07:52 | - | |
| ghc-publicsuffixlist/ | 2019-03-20 07:54 | - | |
| ghc-random/ | 2019-03-20 07:58 | - | |
| ghc-reflection/ | 2019-03-20 08:00 | - | |
| ghc-regex-base/ | 2019-03-20 08:02 | - | |
| ghc-regex-compat/ | 2019-03-20 08:04 | - | |
| ghc-regex-posix/ | 2019-03-20 08:07 | - | |
| ghc-regex-tdfa/ | 2019-03-20 08:08 | - | |
| ghc-resourcet/ | 2019-03-20 08:11 | - | |
| ghc-rfc5051/ | 2019-03-20 08:13 | - | |
| ghc-rpm-macros/ | 2018-10-09 11:17 | - | |
| ghc-safe/ | 2019-03-20 08:15 | - | |
| ghc-scientific/ | 2019-03-20 08:19 | - | |
| ghc-semigroups/ | 2019-03-20 08:21 | - | |
| ghc-sendfile/ | 2019-03-20 08:23 | - | |
| ghc-setenv/ | 2019-03-20 08:25 | - | |
| ghc-shakespeare-js/ | 2019-03-20 08:32 | - | |
| ghc-shakespeare/ | 2019-03-20 08:30 | - | |
| ghc-shelly/ | 2019-03-20 08:34 | - | |
| ghc-simple-cmd/ | 2019-03-20 08:36 | - | |
| ghc-simple-sendfile/ | 2019-03-20 08:38 | - | |
| ghc-split/ | 2019-03-20 08:40 | - | |
| ghc-stm-chans/ | 2019-03-20 08:44 | - | |
| ghc-stm/ | 2019-03-20 08:42 | - | |
| ghc-streaming-commons/ | 2019-03-20 08:48 | - | |
| ghc-syb/ | 2019-03-20 08:50 | - | |
| ghc-system-fileio/ | 2019-03-20 08:53 | - | |
| ghc-system-filepath/ | 2019-03-20 08:55 | - | |
| ghc-tagged/ | 2019-03-20 08:57 | - | |
| ghc-tagsoup/ | 2019-03-20 08:59 | - | |
| ghc-tar/ | 2019-03-20 09:01 | - | |
| ghc-temporary/ | 2019-03-20 09:03 | - | |
| ghc-terminfo/ | 2019-03-20 09:05 | - | |
| ghc-texmath/ | 2019-03-20 09:07 | - | |
| ghc-text/ | 2019-03-20 09:09 | - | |
| ghc-tf-random/ | 2019-03-20 09:11 | - | |
| ghc-threads/ | 2019-03-20 09:13 | - | |
| ghc-transformers-base/ | 2019-03-20 09:18 | - | |
| ghc-transformers-compat/ | 2019-03-20 09:20 | - | |
| ghc-transformers/ | 2019-03-20 09:15 | - | |
| ghc-uniplate/ | 2019-03-20 09:22 | - | |
| ghc-unix-compat/ | 2019-03-20 09:24 | - | |
| ghc-unix-time/ | 2019-03-20 09:26 | - | |
| ghc-unordered-containers/ | 2019-03-20 09:28 | - | |
| ghc-utf8-string/ | 2019-03-20 09:30 | - | |
| ghc-uuid/ | 2019-03-20 09:32 | - | |
| ghc-vault/ | 2019-03-20 09:34 | - | |
| ghc-vector-binary-instances/ | 2019-03-20 09:38 | - | |
| ghc-vector/ | 2019-03-20 09:36 | - | |
| ghc-void/ | 2019-03-20 09:40 | - | |
| ghc-wai/ | 2019-03-20 09:43 | - | |
| ghc-warp/ | 2019-03-20 09:44 | - | |
| ghc-word8/ | 2019-03-20 09:47 | - | |
| ghc-xdg-basedir/ | 2019-03-20 09:53 | - | |
| ghc-xml-types/ | 2019-03-20 09:57 | - | |
| ghc-xml/ | 2019-03-20 09:55 | - | |
| ghc-xmonad-contrib/ | 2019-03-20 09:59 | - | |
| ghc-yaml/ | 2019-03-20 10:01 | - | |
| ghc-zip-archive/ | 2019-03-20 10:03 | - | |
| ghc-zlib/ | 2019-03-20 10:05 | - | |
| ghc/ | 2019-03-20 04:31 | - | |
| gifsicle/ | 2018-08-27 08:14 | - | |
| gilmsg/ | 2017-08-02 12:48 | - | |
| gimp-dds-plugin/ | 2016-08-11 07:02 | - | |
| gimp-gap/ | 2016-08-11 07:02 | - | |
| gimp-layer-via-copy-cut/ | 2017-07-27 12:02 | - | |
| gimp-luminosity-masks/ | 2018-09-01 02:34 | - | |
| gimp-save-for-web/ | 2017-07-27 12:05 | - | |
| gimpfx-foundry/ | 2018-08-27 08:16 | - | |
| ginac/ | 2017-07-27 12:11 | - | |
| ginfo/ | 2017-07-27 12:27 | - | |
| gio-sharp/ | 2019-03-20 10:07 | - | |
| gip/ | 2018-08-27 08:23 | - | |
| girara/ | 2016-08-11 07:06 | - | |
| git-annex/ | 2019-03-20 10:09 | - | |
| git-cal/ | 2016-08-11 07:10 | - | |
| git-cola/ | 2017-07-27 12:36 | - | |
| git-extras/ | 2019-02-21 16:26 | - | |
| git-lfs/ | 2019-03-20 10:12 | - | |
| git-publish/ | 2019-02-21 16:39 | - | |
| git-review/ | 2017-08-02 12:48 | - | |
| git-tools/ | 2018-08-27 08:49 | - | |
| git-xcleaner/ | 2017-07-27 12:57 | - | |
| git2cl/ | 2016-08-11 07:08 | - | |
| gitflow/ | 2016-08-11 07:13 | - | |
| gitg/ | 2019-02-21 16:28 | - | |
| github2fedmsg/ | 2018-08-27 08:33 | - | |
| gitolite/ | 2018-08-27 08:39 | - | |
| gitolite3/ | 2019-02-21 16:36 | - | |
| gitstats/ | 2016-08-11 07:16 | - | |
| gkermit/ | 2016-08-11 07:17 | - | |
| gkeyfile-sharp/ | 2019-03-20 10:14 | - | |
| gkrellm-top/ | 2018-08-27 08:57 | - | |
| gkrellm/ | 2018-08-27 08:53 | - | |
| gksu-polkit/ | 2016-08-11 07:18 | - | |
| gl2ps/ | 2016-08-11 07:19 | - | |
| glances/ | 2018-08-27 09:00 | - | |
| glassfish-saaj/ | 2017-07-27 13:11 | - | |
| glfw/ | 2017-07-27 13:18 | - | |
| glib/ | 2017-07-27 13:22 | - | |
| glide/ | 2019-03-20 10:16 | - | |
| glite-jobid-api-c/ | 2017-07-27 13:28 | - | |
| glite-jobid-api-cpp/ | 2016-08-11 07:20 | - | |
| glite-jobid-api-java/ | 2016-08-11 07:21 | - | |
| glite-lb-client-java/ | 2019-03-20 10:18 | - | |
| glite-lb-client/ | 2019-03-06 03:45 | - | |
| glite-lb-common/ | 2019-03-02 03:49 | - | |
| glite-lb-logger-msg/ | 2019-03-02 03:57 | - | |
| glite-lb-logger/ | 2019-03-02 03:53 | - | |
| glite-lb-server/ | 2019-03-06 03:54 | - | |
| glite-lb-state-machine/ | 2019-03-02 04:02 | - | |
| glite-lb-types/ | 2016-08-11 07:29 | - | |
| glite-lb-utils/ | 2019-03-06 03:59 | - | |
| glite-lb-ws-interface/ | 2019-02-21 17:04 | - | |
| glite-lbjp-common-db/ | 2018-08-27 09:14 | - | |
| glite-lbjp-common-gsoap-plugin/ | 2017-08-02 12:48 | - | |
| glite-lbjp-common-gss/ | 2017-08-02 12:48 | - | |
| glite-lbjp-common-jp-interface/ | 2018-08-27 09:16 | - | |
| glite-lbjp-common-log/ | 2017-08-04 02:09 | - | |
| glite-lbjp-common-maildir/ | 2016-08-11 07:26 | - | |
| glite-lbjp-common-server-bones/ | 2017-08-04 02:21 | - | |
| glite-lbjp-common-trio/ | 2016-08-11 07:27 | - | |
| glite-px-proxyrenewal/ | 2019-02-28 05:28 | - | |
| global/ | 2019-03-20 10:23 | - | |
| globus-authz-callout-error/ | 2019-03-20 10:28 | - | |
| globus-authz/ | 2019-03-20 10:25 | - | |
| globus-callout/ | 2019-03-20 10:32 | - | |
| globus-common/ | 2019-03-20 10:35 | - | |
| globus-ftp-client/ | 2019-03-20 10:39 | - | |
| globus-ftp-control/ | 2019-03-20 10:50 | - | |
| globus-gass-cache-program/ | 2019-03-02 04:10 | - | |
| globus-gass-cache/ | 2019-03-20 10:54 | - | |
| globus-gass-copy/ | 2019-03-20 10:58 | - | |
| globus-gass-server-ez/ | 2019-03-20 11:10 | - | |
| globus-gass-transfer/ | 2019-03-20 11:13 | - | |
| globus-gatekeeper/ | 2019-02-21 17:42 | - | |
| globus-gfork/ | 2019-02-21 17:45 | - | |
| globus-gram-audit/ | 2019-02-21 17:48 | - | |
| globus-gram-client-tools/ | 2019-02-21 17:53 | - | |
| globus-gram-client/ | 2019-03-20 11:17 | - | |
| globus-gram-job-manager-callout-error/ | 2019-03-20 18:59 | - | |
| globus-gram-job-manager-condor/ | 2019-02-21 18:01 | - | |
| globus-gram-job-manager-fork/ | 2019-02-21 18:04 | - | |
| globus-gram-job-manager-lsf/ | 2019-02-21 18:07 | - | |
| globus-gram-job-manager-pbs/ | 2019-02-21 18:10 | - | |
| globus-gram-job-manager-scripts/ | 2019-02-21 18:13 | - | |
| globus-gram-job-manager-sge/ | 2019-02-21 18:15 | - | |
| globus-gram-job-manager-slurm/ | 2019-02-21 18:19 | - | |
| globus-gram-job-manager/ | 2019-03-20 11:21 | - | |
| globus-gram-protocol/ | 2019-03-20 19:02 | - | |
| globus-gridftp-server-control/ | 2019-02-21 18:28 | - | |
| globus-gridftp-server/ | 2019-03-20 19:06 | - | |
| globus-gridmap-callout-error/ | 2019-03-20 19:09 | - | |
| globus-gridmap-eppn-callout/ | 2019-02-21 18:34 | - | |
| globus-gridmap-verify-myproxy-callout/ | 2019-02-21 18:37 | - | |
| globus-gsi-callback/ | 2019-03-20 19:13 | - | |
| globus-gsi-cert-utils/ | 2019-03-20 19:16 | - | |
| globus-gsi-credential/ | 2019-03-20 19:20 | - | |
| globus-gsi-openssl-error/ | 2019-03-20 19:23 | - | |
| globus-gsi-proxy-core/ | 2019-03-20 19:27 | - | |
| globus-gsi-proxy-ssl/ | 2019-03-20 19:30 | - | |
| globus-gsi-sysconfig/ | 2019-03-20 19:34 | - | |
| globus-gss-assist/ | 2019-03-20 19:44 | - | |
| globus-gssapi-error/ | 2019-03-20 19:37 | - | |
| globus-gssapi-gsi/ | 2019-03-20 19:41 | - | |
| globus-io/ | 2019-02-21 19:09 | - | |
| globus-net-manager/ | 2019-03-20 19:48 | - | |
| globus-openssl-module/ | 2019-03-20 19:51 | - | |
| globus-proxy-utils/ | 2019-02-21 19:18 | - | |
| globus-rsl/ | 2019-03-20 19:55 | - | |
| globus-scheduler-event-generator/ | 2019-03-20 19:58 | - | |
| globus-simple-ca/ | 2019-02-21 19:27 | - | |
| globus-usage/ | 2019-02-21 19:31 | - | |
| globus-xio-gridftp-driver/ | 2019-03-20 20:13 | - | |
| globus-xio-gridftp-multicast/ | 2019-02-28 06:06 | - | |
| globus-xio-gsi-driver/ | 2019-03-20 20:17 | - | |
| globus-xio-pipe-driver/ | 2019-02-21 19:54 | - | |
| globus-xio-popen-driver/ | 2019-02-21 19:56 | - | |
| globus-xio-rate-driver/ | 2019-02-21 19:59 | - | |
| globus-xio-udt-driver/ | 2019-02-21 20:02 | - | |
| globus-xio/ | 2019-03-20 20:01 | - | |
| globus-xioperf/ | 2019-02-21 19:51 | - | |
| glog/ | 2017-07-27 17:27 | - | |
| glogg/ | 2016-08-11 07:59 | - | |
| gloox/ | 2016-08-11 07:59 | - | |
| glpi/ | 2018-08-27 10:58 | - | |
| glpk/ | 2016-08-11 08:02 | - | |
| glue-schema/ | 2016-08-11 08:02 | - | |
| gmime/ | 2018-08-27 11:01 | - | |
| gmock/ | 2017-08-02 12:48 | - | |
| gmrun/ | 2016-08-11 08:05 | - | |
| gnokii/ | 2017-07-27 17:37 | - | |
| gnome-battery-bench/ | 2018-08-27 11:10 | - | |
| gnome-colors-icon-theme/ | 2016-08-11 08:06 | - | |
| gnome-desktop/ | 2017-07-27 17:45 | - | |
| gnome-python2-extras/ | 2017-08-02 12:48 | - | |
| gnome-screensaver/ | 2019-02-21 20:05 | - | |
| gnome-sharp/ | 2019-03-20 20:20 | - | |
| gnome-shell-extension-dash-to-dock/ | 2018-08-27 11:17 | - | |
| gnome-shell-extension-disconnect-wifi/ | 2018-08-27 11:19 | - | |
| gnome-shell-extension-freon/ | 2018-08-27 11:21 | - | |
| gnome-shell-extension-iok/ | 2016-08-11 08:11 | - | |
| gnome-shell-extension-no-topleft-hot-corner/ | 2018-08-27 11:24 | - | |
| gnome-shell-extension-openweather/ | 2018-08-27 11:26 | - | |
| gnome-shell-extension-panel-osd/ | 2017-07-27 18:15 | - | |
| gnome-shell-extension-pidgin/ | 2018-08-27 11:29 | - | |
| gnome-shell-extension-refresh-wifi/ | 2018-08-27 11:32 | - | |
| gnome-shell-extension-suspend-button/ | 2018-08-27 11:34 | - | |
| gnome-shell-extension-system-monitor-applet/ | 2019-02-21 20:13 | - | |
| gnome-shell-extension-unite/ | 2018-08-27 11:39 | - | |
| gnome-shell-extension-windowoverlay-icons/ | 2018-08-27 11:41 | - | |
| gnome-translate/ | 2017-08-02 12:48 | - | |
| gnu-smalltalk/ | 2017-07-27 18:44 | - | |
| gnubik/ | 2018-08-27 11:44 | - | |
| gnucash-docs/ | 2018-08-27 13:02 | - | |
| gnucash/ | 2019-02-21 20:16 | - | |
| gnuchess/ | 2018-08-27 13:05 | - | |
| gnudos/ | 2018-08-27 13:08 | - | |
| gnugo/ | 2018-10-09 14:47 | - | |
| gnulib/ | 2016-08-11 08:15 | - | |
| gnuradio/ | 2019-02-21 21:35 | - | |
| gnustep-base/ | 2017-07-27 18:54 | - | |
| gnustep-make/ | 2017-07-27 19:05 | - | |
| go-bindata/ | 2019-03-20 20:22 | - | |
| goaccess/ | 2018-08-27 13:12 | - | |
| gobby05/ | 2017-07-27 19:18 | - | |
| godot/ | 2018-10-09 14:54 | - | |
| goffice08/ | 2017-08-02 12:48 | - | |
| gogoc/ | 2016-08-11 08:23 | - | |
| golang-bazil-fuse/ | 2019-03-20 20:27 | - | |
| golang-bitbucket-kardianos-osext/ | 2016-08-11 08:25 | - | |
| golang-bitbucket-ww-goautoneg/ | 2019-03-20 20:29 | - | |
| golang-github-BurntSushi-toml/ | 2019-03-20 20:41 | - | |
| golang-github-Jeffail-gabs/ | 2019-03-20 21:05 | - | |
| golang-github-Masterminds-semver/ | 2019-03-20 21:17 | - | |
| golang-github-Masterminds-vcs/ | 2019-03-20 21:19 | - | |
| golang-github-SAP-go-hdb/ | 2019-02-22 00:04 | - | |
| golang-github-SermoDigital-jose/ | 2019-03-20 21:42 | - | |
| golang-github-Sirupsen-logrus/ | 2019-03-20 21:46 | - | |
| golang-github-VividCortex-ewma/ | 2019-03-20 22:05 | - | |
| golang-github-armon-go-proxyproto/ | 2019-03-20 20:31 | - | |
| golang-github-asaskevich-govalidator/ | 2019-03-20 20:33 | - | |
| golang-github-aws-aws-sdk-go/ | 2019-03-20 20:35 | - | |
| golang-github-billziss-gh-cgofuse/ | 2019-03-20 20:37 | - | |
| golang-github-boombuler-barcode/ | 2019-03-20 20:39 | - | |
| golang-github-codegangsta-cli/ | 2016-08-11 08:26 | - | |
| golang-github-coreos-go-log/ | 2016-08-11 08:27 | - | |
| golang-github-coreos-go-systemd/ | 2016-08-11 08:28 | - | |
| golang-github-cpuguy83-go-md2man/ | 2019-03-20 20:43 | - | |
| golang-github-davecgh-go-spew/ | 2019-03-20 20:45 | - | |
| golang-github-docopt-docopt-go/ | 2016-08-11 08:29 | - | |
| golang-github-duosecurity-duo_api_golang/ | 2019-03-20 20:48 | - | |
| golang-github-fatih-structs/ | 2019-03-20 20:50 | - | |
| golang-github-fsouza-go-dockerclient/ | 2016-08-11 08:31 | - | |
| golang-github-fullsailor-pkcs7/ | 2019-03-20 20:52 | - | |
| golang-github-godbus-dbus/ | 2016-08-11 08:32 | - | |
| golang-github-golang-glog/ | 2019-03-20 20:54 | - | |
| golang-github-golang-sys/ | 2019-03-20 20:56 | - | |
| golang-github-golang-time/ | 2019-03-20 20:58 | - | |
| golang-github-google-go-cmp/ | 2019-03-20 21:00 | - | |
| golang-github-google-go-genproto/ | 2019-02-21 23:12 | - | |
| golang-github-goraft-raft/ | 2016-08-11 08:33 | - | |
| golang-github-grpc-grpc-go/ | 2019-03-20 21:02 | - | |
| golang-github-jefferai-jsonx/ | 2019-03-20 21:07 | - | |
| golang-github-jlaffaye-ftp/ | 2019-03-20 21:09 | - | |
| golang-github-jtolds-gls/ | 2019-03-20 21:11 | - | |
| golang-github-kdar-factorlog/ | 2016-08-11 08:34 | - | |
| golang-github-keybase-go-crypto/ | 2019-03-20 21:13 | - | |
| golang-github-kr-fs/ | 2016-08-11 08:36 | - | |
| golang-github-kraman-libcontainer/ | 2016-08-11 08:35 | - | |
| golang-github-lucasb-eyer-colorful/ | 2019-02-21 23:27 | - | |
| golang-github-magiconair-properties/ | 2019-03-20 21:15 | - | |
| golang-github-mattn-go-runewidth/ | 2019-03-20 21:21 | - | |
| golang-github-mattn-shellwords/ | 2019-02-21 23:37 | - | |
| golang-github-michaelklishin-rabbit-hole/ | 2019-02-21 23:39 | - | |
| golang-github-mitchellh-go-testing-interface/ | 2019-03-20 21:23 | - | |
| golang-github-nsf-termbox-go/ | 2019-02-21 23:43 | - | |
| golang-github-openshift-go-json-rest/ | 2016-08-11 08:37 | - | |
| golang-github-openshift-go-systemd/ | 2016-08-11 08:38 | - | |
| golang-github-oschwald-maxminddb-golang/ | 2019-02-21 23:45 | - | |
| golang-github-patrickmn-go-cache/ | 2019-03-20 21:25 | - | |
| golang-github-pkg-errors/ | 2019-03-20 21:28 | - | |
| golang-github-pkg-sftp/ | 2019-03-20 21:30 | - | |
| golang-github-pmezard-go-difflib/ | 2019-03-20 21:32 | - | |
| golang-github-rackspace-gophercloud/ | 2019-03-20 21:34 | - | |
| golang-github-rfjakob-eme/ | 2019-03-20 21:36 | - | |
| golang-github-russross-blackfriday/ | 2019-03-20 21:38 | - | |
| golang-github-ryanuber-go-glob/ | 2019-03-20 21:40 | - | |
| golang-github-sethgrid-pester/ | 2019-03-20 21:44 | - | |
| golang-github-smartystreets-assertions/ | 2019-03-20 21:48 | - | |
| golang-github-smartystreets-goconvey/ | 2019-03-20 21:50 | - | |
| golang-github-spacemonkeygo-spacelog/ | 2019-02-22 00:16 | - | |
| golang-github-spf13-cobra/ | 2016-08-11 08:39 | - | |
| golang-github-spf13-pflag/ | 2019-03-20 21:53 | - | |
| golang-github-sstarcher-go-okta/ | 2019-02-22 00:20 | - | |
| golang-github-streadway-amqp/ | 2019-03-20 21:55 | - | |
| golang-github-stretchr-objx/ | 2019-03-20 21:57 | - | |
| golang-github-stretchr-testify/ | 2019-03-20 21:59 | - | |
| golang-github-syndtr-gocapability/ | 2016-08-11 08:40 | - | |
| golang-github-urfave-cli/ | 2019-03-20 22:01 | - | |
| golang-github-vbatts-tar-split/ | 2019-03-20 22:03 | - | |
| golang-google-golangorg-cloud/ | 2019-03-20 22:20 | - | |
| golang-googlecode-go-crypto/ | 2019-03-20 22:09 | - | |
| golang-googlecode-goauth2/ | 2019-03-20 22:07 | - | |
| golang-googlecode-gogoprotobuf/ | 2016-08-11 08:41 | - | |
| golang-googlecode-goprotobuf/ | 2019-03-20 22:11 | - | |
| golang-googlecode-net/ | 2019-03-20 22:13 | - | |
| golang-googlecode-text/ | 2019-03-20 22:16 | - | |
| golang-googlecode-tools/ | 2019-03-20 22:18 | - | |
| golang-gopkg-check/ | 2019-03-20 22:22 | - | |
| golang-gopkg-data-dog-sqlmock-1/ | 2019-02-22 00:51 | - | |
| golang-gopkg-yaml/ | 2019-03-20 22:24 | - | |
| golang/ | 2019-03-20 20:24 | - | |
| goldendict/ | 2019-02-22 00:55 | - | |
| goocanvas/ | 2017-07-27 20:23 | - | |
| goocanvas2/ | 2016-08-11 08:44 | - | |
| google-api-python-client/ | 2018-08-27 16:08 | - | |
| google-authenticator/ | 2018-08-27 16:10 | - | |
| google-droid-fonts/ | 2018-08-27 16:13 | - | |
| google-gson/ | 2019-02-22 01:01 | - | |
| google-noto-cjk-fonts/ | 2017-07-27 20:39 | - | |
| google-noto-emoji-fonts/ | 2017-07-27 20:49 | - | |
| google-roboto-fonts/ | 2018-08-27 16:16 | - | |
| google-roboto-mono-fonts/ | 2016-08-11 08:44 | - | |
| google-roboto-slab-fonts/ | 2016-08-11 08:45 | - | |
| gosnake/ | 2016-08-11 08:45 | - | |
| gparted/ | 2019-02-22 01:07 | - | |
| gpaste/ | 2019-03-20 22:26 | - | |
| gpaw-setups/ | 2016-08-11 08:48 | - | |
| gpaw/ | 2017-07-27 21:04 | - | |
| gperftools/ | 2016-08-11 08:49 | - | |
| gpredict/ | 2017-08-02 12:48 | - | |
| gprolog/ | 2016-08-11 08:51 | - | |
| gpsbabel/ | 2019-02-22 01:14 | - | |
| gpsd/ | 2017-08-02 12:48 | - | |
| gputils/ | 2016-08-11 08:52 | - | |
| gr-fcdproplus/ | 2019-02-22 01:49 | - | |
| gr-iqbal/ | 2019-02-22 01:55 | - | |
| gr-osmosdr/ | 2019-02-22 02:32 | - | |
| grace/ | 2019-02-22 01:18 | - | |
| grads/ | 2019-02-22 01:22 | - | |
| gramps/ | 2019-02-22 01:26 | - | |
| graphite-api/ | 2018-08-27 16:37 | - | |
| graphite-web/ | 2019-02-22 01:34 | - | |
| grass/ | 2019-02-22 01:37 | - | |
| greenwave/ | 2018-08-27 16:45 | - | |
| grib_api/ | 2017-08-04 05:05 | - | |
| gridsite/ | 2018-08-27 16:50 | - | |
| grin/ | 2017-07-27 22:02 | - | |
| grip/ | 2018-08-27 16:53 | - | |
| grive2/ | 2018-09-01 06:25 | - | |
| gromacs/ | 2019-03-20 22:28 | - | |
| grsync/ | 2018-08-27 17:10 | - | |
| grub-customizer/ | 2018-08-27 17:13 | - | |
| gshhg-gmt-nc4/ | 2016-08-11 09:01 | - | |
| gsi-openssh/ | 2019-03-20 22:59 | - | |
| gsmartcontrol/ | 2018-08-27 17:23 | - | |
| gsoap/ | 2019-03-20 23:05 | - | |
| gssntlmssp/ | 2017-07-27 23:03 | - | |
| gst123/ | 2016-08-11 09:03 | - | |
| gstreamer1-rtsp-server/ | 2016-08-11 09:04 | - | |
| gstreamer1-vaapi/ | 2018-10-09 18:15 | - | |
| gt/ | 2017-07-27 23:12 | - | |
| gtest/ | 2016-08-11 09:06 | - | |
| gthumb/ | 2018-08-27 17:36 | - | |
| gtk+/ | 2017-08-02 12:48 | - | |
| gtk-gnutella/ | 2018-08-27 17:45 | - | |
| gtk-murrine-engine/ | 2017-07-27 23:51 | - | |
| gtk-recordmydesktop/ | 2016-08-11 09:14 | - | |
| gtk-sharp-beans/ | 2019-03-20 23:20 | - | |
| gtk-sharp2/ | 2019-03-20 23:16 | - | |
| gtk-sharp3/ | 2019-03-20 23:18 | - | |
| gtk-unico-engine/ | 2016-08-11 09:19 | - | |
| gtk-xfce-engine/ | 2017-07-28 00:18 | - | |
| gtk2-engines/ | 2016-08-11 09:07 | - | |
| gtk2hs-buildtools/ | 2019-03-20 23:14 | - | |
| gtkdialog/ | 2016-08-13 23:53 | - | |
| gtkglarea2/ | 2016-08-11 09:10 | - | |
| gtkglext/ | 2017-08-02 12:48 | - | |
| gtkimageview/ | 2019-02-22 02:53 | - | |
| gtksourceview2/ | 2016-08-11 09:18 | - | |
| gtkwave/ | 2017-08-04 06:09 | - | |
| guacamole-client/ | 2016-08-11 09:21 | - | |
| guacamole-server/ | 2018-08-27 17:59 | - | |
| guake/ | 2017-08-02 12:48 | - | |
| gudev-sharp/ | 2019-03-20 23:23 | - | |
| gv/ | 2017-07-28 00:47 | - | |
| gwenhywfar/ | 2016-08-11 09:24 | - | |
| gyp/ | 2016-08-17 13:02 | - | |
| h5py/ | 2017-08-02 12:48 | - | |
| hackrf/ | 2018-08-27 18:05 | - | |
| halberd/ | 2016-08-11 09:26 | - | |
| halibut/ | 2017-07-29 12:20 | - | |
| hamlib/ | 2018-10-09 18:29 | - | |
| hamster-time-tracker/ | 2016-08-11 09:28 | - | |
| hans/ | 2018-08-27 18:14 | - | |
| happy/ | 2019-03-20 23:25 | - | |
| hardening-check/ | 2016-08-11 09:30 | - | |
| hardening-wrapper/ | 2017-07-28 00:59 | - | |
| hash-slinger/ | 2016-08-11 09:31 | - | |
| hashcat/ | 2019-03-20 23:27 | - | |
| haskell-platform/ | 2019-03-20 23:30 | - | |
| haveged/ | 2016-08-11 09:32 | - | |
| hawaii-widget-styles/ | 2017-08-02 12:48 | - | |
| hawkey/ | 2016-08-11 09:34 | - | |
| haxe/ | 2019-03-04 20:21 | - | |
| hd-idle/ | 2018-08-27 18:29 | - | |
| hddtemp/ | 2016-08-11 09:34 | - | |
| hdf/ | 2018-08-27 18:22 | - | |
| hdf5/ | 2018-09-01 06:49 | - | |
| hdhomerun/ | 2019-02-22 03:11 | - | |
| healpix/ | 2017-07-28 02:17 | - | |
| heimdal/ | 2018-08-27 18:31 | - | |
| heketi/ | 2018-08-25 11:56 | - | |
| herbstluftwm/ | 2016-08-11 09:54 | - | |
| hercstudio/ | 2017-07-28 02:35 | - | |
| hercules/ | 2018-08-27 18:50 | - | |
| hevea/ | 2019-02-22 03:18 | - | |
| hexchat/ | 2016-08-11 09:57 | - | |
| hg-git/ | 2019-02-22 03:24 | - | |
| hgsubversion/ | 2017-07-28 02:46 | - | |
| hgsvn/ | 2016-08-11 10:03 | - | |
| hibernate-commons-annotations/ | 2017-07-28 02:55 | - | |
| hibernate-jpa-2.0-api/ | 2017-07-28 03:02 | - | |
| hibernate-jpa-2.1-api/ | 2017-07-28 03:12 | - | |
| hid-replay/ | 2016-08-11 10:06 | - | |
| hidapi/ | 2016-08-11 10:05 | - | |
| hiera/ | 2016-08-11 10:08 | - | |
| hiredis/ | 2016-08-11 10:09 | - | |
| hitch/ | 2019-02-22 03:26 | - | |
| hlint/ | 2019-03-20 23:32 | - | |
| holland/ | 2019-02-22 03:31 | - | |
| homebank/ | 2019-02-22 03:35 | - | |
| horai-ume-fonts/ | 2017-07-28 03:42 | - | |
| hostapd/ | 2018-08-27 19:05 | - | |
| hping3/ | 2017-07-28 03:49 | - | |
| hsakmt/ | 2019-03-20 23:35 | - | |
| hscolour/ | 2019-03-20 23:37 | - | |
| hstr/ | 2016-08-11 10:15 | - | |
| html2text/ | 2017-07-28 04:02 | - | |
| html401-dtds/ | 2016-08-11 10:16 | - | |
| htmldoc/ | 2017-08-02 12:48 | - | |
| htop/ | 2019-02-22 03:43 | - | |
| http-parser/ | 2017-08-02 12:48 | - | |
| httpd-itk/ | 2018-08-27 19:15 | - | |
| httpie/ | 2017-07-28 04:19 | - | |
| httping/ | 2017-07-28 04:23 | - | |
| httpress/ | 2016-08-11 10:19 | - | |
| httpry/ | 2016-08-11 10:20 | - | |
| httrack/ | 2017-07-28 04:35 | - | |
| httraqt/ | 2016-08-13 23:59 | - | |
| hub/ | 2019-03-20 23:39 | - | |
| hugs98/ | 2017-07-28 04:48 | - | |
| hw-probe/ | 2019-02-22 03:50 | - | |
| hwinfo/ | 2019-02-28 09:19 | - | |
| hxtools/ | 2018-09-01 07:38 | - | |
| hydra/ | 2017-08-04 06:55 | - | |
| hylafax+/ | 2018-10-09 18:58 | - | |
| hypre/ | 2018-08-27 19:27 | - | |
| hystrix/ | 2017-08-02 12:48 | - | |
| i3/ | 2017-08-04 07:11 | - | |
| i3lock/ | 2017-08-04 07:27 | - | |
| i3status/ | 2017-07-28 05:40 | - | |
| i7z/ | 2017-08-02 12:48 | - | |
| ibus-anthy/ | 2017-08-02 12:48 | - | |
| ibus-handwrite/ | 2017-08-02 12:48 | - | |
| icat/ | 2018-09-01 07:41 | - | |
| icecast/ | 2019-02-22 03:53 | - | |
| icecream/ | 2018-08-27 19:40 | - | |
| icemon/ | 2018-08-27 19:44 | - | |
| icewm/ | 2017-08-02 12:48 | - | |
| id3lib/ | 2016-08-11 10:26 | - | |
| idm-console-framework/ | 2018-08-27 19:48 | - | |
| idris/ | 2019-03-20 23:41 | - | |
| iec16022/ | 2016-08-11 10:28 | - | |
| iftop/ | 2017-07-28 06:16 | - | |
| ignition-math/ | 2016-08-11 10:29 | - | |
| ignition/ | 2019-03-20 23:43 | - | |
| igraph/ | 2017-07-28 06:20 | - | |
| iguanaIR/ | 2016-08-11 10:30 | - | |
| iio-sensor-proxy/ | 2018-08-27 19:53 | - | |
| iipsrv/ | 2017-07-28 06:30 | - | |
| iksemel/ | 2016-08-11 10:31 | - | |
| ilbc/ | 2016-08-11 10:32 | - | |
| ima-evm-utils/ | 2018-08-27 19:56 | - | |
| imagefactory-plugins/ | 2016-08-11 10:33 | - | |
| imagefactory/ | 2017-07-28 06:46 | - | |
| imapfilter/ | 2018-08-27 20:00 | - | |
| imapsync/ | 2017-07-28 06:51 | - | |
| imaptest/ | 2018-08-27 20:03 | - | |
| imlib/ | 2017-07-28 07:03 | - | |
| imlib2/ | 2016-08-11 10:34 | - | |
| impallari-lobster-fonts/ | 2016-08-11 10:35 | - | |
| inchi/ | 2016-08-11 10:36 | - | |
| incron/ | 2019-02-22 04:00 | - | |
| indefero/ | 2016-08-11 10:37 | - | |
| inn/ | 2017-07-28 07:12 | - | |
| innotop/ | 2019-02-22 04:03 | - | |
| inotify-tools/ | 2016-08-11 10:38 | - | |
| intel-cmt-cat/ | 2017-07-28 07:25 | - | |
| inxi/ | 2019-02-22 04:06 | - | |
| iodine/ | 2016-08-11 10:39 | - | |
| ioping/ | 2018-10-09 19:07 | - | |
| ioprocess/ | 2017-07-28 07:45 | - | |
| iperf/ | 2019-02-22 04:08 | - | |
| iperf3/ | 2017-07-28 07:57 | - | |
| ipmiutil/ | 2018-08-27 20:11 | - | |
| ipsec-tools/ | 2017-07-28 08:08 | - | |
| ipv6calc/ | 2019-02-28 09:36 | - | |
| ipv6gen/ | 2017-07-28 08:21 | - | |
| ipython/ | 2017-08-02 12:48 | - | |
| irc-otr/ | 2017-07-28 08:38 | - | |
| irclog2html/ | 2016-08-11 10:44 | - | |
| irda-utils/ | 2017-07-28 08:42 | - | |
| irma_configuration/ | 2016-08-11 10:46 | - | |
| irrlicht/ | 2016-08-14 00:04 | - | |
| irssi-xmpp/ | 2017-08-04 07:45 | - | |
| is-interface/ | 2016-08-11 10:47 | - | |
| iscan-firmware/ | 2016-08-11 10:47 | - | |
| islamic-menus/ | 2016-08-11 10:48 | - | |
| isync/ | 2016-08-11 10:48 | - | |
| itcl/ | 2016-08-11 10:49 | - | |
| itk/ | 2017-07-28 08:53 | - | |
| iucode-tool/ | 2018-08-27 20:14 | - | |
| iverilog/ | 2018-08-27 20:16 | - | |
| ivykis/ | 2016-08-11 10:49 | - | |
| iwidgets/ | 2016-08-11 10:50 | - | |
| iwyu/ | 2016-08-14 00:06 | - | |
| iyfct/ | 2018-10-09 19:09 | - | |
| jFormatString/ | 2017-07-29 13:14 | - | |
| jabber-roster/ | 2016-08-11 10:52 | - | |
| jabberd/ | 2017-08-02 12:48 | - | |
| jabberpy/ | 2016-08-11 10:52 | - | |
| jack-audio-connection-kit/ | 2017-08-02 12:48 | - | |
| jackson-annotations/ | 2017-07-28 09:05 | - | |
| jackson-core/ | 2017-08-02 12:48 | - | |
| jackson-parent/ | 2017-08-02 12:48 | - | |
| jandex-maven-plugin/ | 2017-07-28 09:15 | - | |
| janino/ | 2017-07-28 09:21 | - | |
| jargs/ | 2018-08-27 20:21 | - | |
| jasmine-node/ | 2017-08-02 12:48 | - | |
| jasmine/ | 2017-07-28 09:31 | - | |
| java-dirq/ | 2017-07-28 09:42 | - | |
| java-oauth/ | 2017-07-28 09:49 | - | |
| java-runtime-decompiler/ | 2019-02-22 04:15 | - | |
| javaparser/ | 2017-07-28 09:59 | - | |
| javawriter/ | 2017-07-28 10:06 | - | |
| jbig2dec/ | 2017-07-28 10:16 | - | |
| jboss-annotations-1.2-api/ | 2017-07-28 10:20 | - | |
| jboss-batch-1.0-api/ | 2017-07-28 10:30 | - | |
| jboss-classfilewriter/ | 2017-07-28 10:37 | - | |
| jboss-common-beans/ | 2017-07-28 10:47 | - | |
| jboss-concurrency-1.0-api/ | 2017-07-28 10:56 | - | |
| jboss-connector-1.6-api/ | 2017-07-28 11:04 | - | |
| jboss-connector-1.7-api/ | 2017-07-28 11:12 | - | |
| jboss-ejb-3.2-api/ | 2017-07-28 11:19 | - | |
| jboss-ejb3-ext-api/ | 2017-07-28 11:27 | - | |
| jboss-el-3.0-api/ | 2017-07-28 11:34 | - | |
| jboss-iiop-client/ | 2017-07-28 11:42 | - | |
| jboss-interceptors-1.2-api/ | 2017-07-28 11:49 | - | |
| jboss-j2eemgmt-1.1-api/ | 2017-07-28 11:57 | - | |
| jboss-jacc-1.4-api/ | 2017-07-28 12:05 | - | |
| jboss-jacc-1.5-api/ | 2017-07-28 12:13 | - | |
| jboss-jaspi-1.0-api/ | 2017-07-28 12:21 | - | |
| jboss-jaspi-1.1-api/ | 2017-07-28 12:29 | - | |
| jboss-jaxb-2.2-api/ | 2017-07-28 12:36 | - | |
| jboss-jaxb-intros/ | 2017-07-28 12:45 | - | |
| jboss-jaxrs-2.0-api/ | 2017-07-28 12:54 | - | |
| jboss-jaxws-2.2-api/ | 2017-07-28 13:08 | - | |
| jboss-jms-2.0-api/ | 2017-07-28 13:22 | - | |
| jboss-jsf-2.1-api/ | 2017-08-02 12:48 | - | |
| jboss-jsp-2.2-api/ | 2017-07-28 13:52 | - | |
| jboss-jsp-2.3-api/ | 2017-07-28 14:07 | - | |
| jboss-jstl-1.2-api/ | 2017-07-28 14:22 | - | |
| jboss-logging-tools/ | 2017-07-28 15:09 | - | |
| jboss-logging-tools1/ | 2017-07-28 14:54 | - | |
| jboss-logging/ | 2017-07-28 14:37 | - | |
| jboss-logmanager/ | 2017-07-28 15:26 | - | |
| jboss-metadata/ | 2017-07-28 15:38 | - | |
| jboss-modules/ | 2017-07-28 15:51 | - | |
| jboss-saaj-1.3-api/ | 2017-07-28 16:06 | - | |
| jboss-servlet-3.1-api/ | 2017-07-28 16:19 | - | |
| jboss-stdio/ | 2017-07-28 16:33 | - | |
| jboss-threads/ | 2017-07-28 16:48 | - | |
| jboss-transaction-1.2-api/ | 2017-07-28 17:04 | - | |
| jboss-vfs/ | 2017-07-28 17:18 | - | |
| jboss-websocket-1.1-api/ | 2017-07-28 17:33 | - | |
| jchardet/ | 2016-08-11 10:58 | - | |
| jcip-annotations/ | 2017-07-28 17:49 | - | |
| jcodings/ | 2017-07-28 18:01 | - | |
| jctools/ | 2016-08-11 10:58 | - | |
| jcuber/ | 2016-08-11 11:00 | - | |
| jdeparser/ | 2017-07-29 12:57 | - | |
| jdeparser1/ | 2017-07-28 18:15 | - | |
| jdns/ | 2017-07-29 13:03 | - | |
| jemalloc/ | 2016-08-11 11:01 | - | |
| jetbrains-annotations/ | 2017-07-29 13:07 | - | |
| jetring/ | 2017-07-29 13:12 | - | |
| jfontchooser/ | 2016-08-11 11:02 | - | |
| jglobus/ | 2019-02-22 04:21 | - | |
| jhead/ | 2019-02-22 04:26 | - | |
| jimtcl/ | 2016-08-11 11:04 | - | |
| jitterentropy-rngd/ | 2017-07-29 13:23 | - | |
| jmake/ | 2017-07-29 13:25 | - | |
| jmock/ | 2017-07-29 13:31 | - | |
| jmtpfs/ | 2016-08-11 11:05 | - | |
| jnettop/ | 2018-08-27 20:26 | - | |
| joe/ | 2018-08-27 20:28 | - | |
| josm/ | 2019-02-22 04:29 | - | |
| jove/ | 2017-07-29 13:46 | - | |
| jp2a/ | 2018-08-27 20:37 | - | |
| jpeginfo/ | 2016-08-11 11:06 | - | |
| jpegoptim/ | 2018-08-27 20:40 | - | |
| jpf/ | 2019-02-22 04:35 | - | |
| jpfcodegen/ | 2017-08-02 12:48 | - | |
| jpype/ | 2019-03-20 23:45 | - | |
| jq/ | 2017-07-29 14:02 | - | |
| js-jquery-mousewheel/ | 2018-08-27 20:49 | - | |
| js-jquery-ui-touch-punch/ | 2018-08-27 20:52 | - | |
| js-jquery/ | 2017-07-29 14:09 | - | |
| js-jquery1/ | 2017-08-02 12:48 | - | |
| js-jsroot/ | 2019-02-22 04:42 | - | |
| js-respond/ | 2018-08-27 21:00 | - | |
| js-sizzle/ | 2017-08-02 12:48 | - | |
| jsl/ | 2016-08-11 11:09 | - | |
| json-c12/ | 2018-08-27 20:57 | - | |
| json-parser/ | 2017-07-29 14:20 | - | |
| json/ | 2019-03-20 23:47 | - | |
| json_simple/ | 2016-08-11 11:10 | - | |
| jsoncpp/ | 2017-07-29 14:17 | - | |
| jts/ | 2017-07-29 14:25 | - | |
| judy-fk/ | 2017-08-04 08:13 | - | |
| julietaula-montserrat-fonts/ | 2019-02-22 04:47 | - | |
| jumpnbump/ | 2019-02-22 04:50 | - | |
| jupp/ | 2019-02-22 04:54 | - | |
| jwhois/ | 2017-08-02 12:48 | - | |
| jxrlib/ | 2016-08-11 11:14 | - | |
| k4dirstat/ | 2016-08-11 11:14 | - | |
| kBuild/ | 2018-08-27 21:14 | - | |
| kabi-dw/ | 2018-08-27 21:10 | - | |
| kalibrate-rtl/ | 2016-08-14 00:16 | - | |
| kasumi/ | 2017-08-02 12:48 | - | |
| kbackup/ | 2016-08-11 11:17 | - | |
| kbibtex/ | 2019-02-22 04:57 | - | |
| kde-plasma-networkmanagement-extras/ | 2018-08-27 21:44 | - | |
| kde-plasma-redshift/ | 2017-07-29 15:11 | - | |
| kdelibs-webkit/ | 2019-02-22 05:04 | - | |
| kdelibs3/ | 2018-08-27 21:19 | - | |
| kdepim3/ | 2018-08-27 21:38 | - | |
| kdevelop/ | 2019-02-28 09:44 | - | |
| kdevplatform/ | 2019-02-22 05:16 | - | |
| kdiff3/ | 2016-08-11 11:23 | - | |
| kdocker/ | 2019-02-22 05:28 | - | |
| kea/ | 2017-08-02 12:48 | - | |
| keepass/ | 2019-03-20 23:49 | - | |
| keepassx/ | 2016-08-11 11:25 | - | |
| keepassx2/ | 2017-07-29 15:35 | - | |
| key-mon/ | 2016-08-11 11:27 | - | |
| keybinder/ | 2017-07-29 15:41 | - | |
| keychecker/ | 2018-08-27 21:59 | - | |
| keyrings-filesystem/ | 2017-07-29 15:45 | - | |
| kf5-attica/ | 2019-02-22 05:36 | - | |
| kf5-baloo/ | 2019-03-20 23:51 | - | |
| kf5-bluez-qt/ | 2019-02-22 05:42 | - | |
| kf5-frameworkintegration/ | 2019-03-20 23:53 | - | |
| kf5-gpgmepp/ | 2017-07-29 16:00 | - | |
| kf5-kactivities-stats/ | 2019-03-20 23:58 | - | |
| kf5-kactivities/ | 2019-03-20 23:56 | - | |
| kf5-kapidox/ | 2019-02-22 05:53 | - | |
| kf5-karchive/ | 2019-02-22 05:56 | - | |
| kf5-kauth/ | 2019-02-28 10:05 | - | |
| kf5-kbookmarks/ | 2019-03-06 16:55 | - | |
| kf5-kcmutils/ | 2019-03-21 00:00 | - | |
| kf5-kcodecs/ | 2019-02-22 06:06 | - | |
| kf5-kcompletion/ | 2019-03-04 20:57 | - | |
| kf5-kconfig/ | 2019-02-28 10:16 | - | |
| kf5-kconfigwidgets/ | 2019-03-04 21:01 | - | |
| kf5-kcoreaddons/ | 2019-02-22 06:16 | - | |
| kf5-kcrash/ | 2019-02-28 10:23 | - | |
| kf5-kdbusaddons/ | 2019-02-22 06:23 | - | |
| kf5-kdeclarative/ | 2019-03-21 00:02 | - | |
| kf5-kded/ | 2019-03-21 00:04 | - | |
| kf5-kdelibs4support/ | 2019-03-21 00:06 | - | |
| kf5-kdesignerplugin/ | 2019-03-21 00:08 | - | |
| kf5-kdesu/ | 2019-03-04 21:15 | - | |
| kf5-kdewebkit/ | 2019-03-21 00:10 | - | |
| kf5-kdnssd/ | 2019-02-22 06:39 | - | |
| kf5-kdoctools/ | 2019-02-28 10:40 | - | |
| kf5-kemoticons/ | 2019-03-04 21:21 | - | |
| kf5-kfilemetadata/ | 2019-02-28 10:47 | - | |
| kf5-kglobalaccel/ | 2019-03-04 21:26 | - | |
| kf5-kguiaddons/ | 2019-02-22 06:51 | - | |
| kf5-kholidays/ | 2019-02-22 06:55 | - | |
| kf5-khtml/ | 2019-03-21 00:12 | - | |
| kf5-ki18n/ | 2019-02-22 07:00 | - | |
| kf5-kiconthemes/ | 2019-03-04 21:33 | - | |
| kf5-kidletime/ | 2019-02-22 07:06 | - | |
| kf5-kimageformats/ | 2019-02-22 07:10 | - | |
| kf5-kinit/ | 2019-03-21 00:14 | - | |
| kf5-kio/ | 2019-03-21 00:16 | - | |
| kf5-kirigami/ | 2019-03-21 00:18 | - | |
| kf5-kirigami2/ | 2019-03-21 00:20 | - | |
| kf5-kitemmodels/ | 2019-02-22 07:22 | - | |
| kf5-kitemviews/ | 2019-02-22 07:25 | - | |
| kf5-kjobwidgets/ | 2019-02-28 11:06 | - | |
| kf5-kjs/ | 2019-02-28 11:10 | - | |
| kf5-kjsembed/ | 2019-02-28 11:15 | - | |
| kf5-kmediaplayer/ | 2019-03-21 00:22 | - | |
| kf5-knewstuff/ | 2019-03-21 00:25 | - | |
| kf5-knotifications/ | 2019-03-21 00:27 | - | |
| kf5-knotifyconfig/ | 2019-03-21 00:29 | - | |
| kf5-kpackage/ | 2019-02-28 11:28 | - | |
| kf5-kparts/ | 2019-03-21 00:31 | - | |
| kf5-kpeople/ | 2019-03-04 21:57 | - | |
| kf5-kplotting/ | 2019-02-22 07:49 | - | |
| kf5-kpty/ | 2019-02-22 07:53 | - | |
| kf5-kross/ | 2019-03-21 00:33 | - | |
| kf5-krunner/ | 2019-03-21 00:35 | - | |
| kf5-kservice/ | 2019-02-28 11:41 | - | |
| kf5-ktexteditor/ | 2019-03-21 00:37 | - | |
| kf5-ktextwidgets/ | 2019-03-04 22:08 | - | |
| kf5-kunitconversion/ | 2019-02-22 08:07 | - | |
| kf5-kwallet/ | 2019-03-21 00:39 | - | |
| kf5-kwayland/ | 2019-02-22 08:13 | - | |
| kf5-kwidgetsaddons/ | 2019-02-22 08:18 | - | |
| kf5-kwindowsystem/ | 2019-02-22 08:22 | - | |
| kf5-kxmlgui/ | 2019-03-04 22:15 | - | |
| kf5-kxmlrpcclient/ | 2019-03-21 00:41 | - | |
| kf5-libkcddb/ | 2019-03-21 00:43 | - | |
| kf5-modemmanager-qt/ | 2019-02-22 08:34 | - | |
| kf5-networkmanager-qt/ | 2019-02-22 08:39 | - | |
| kf5-plasma/ | 2019-03-21 00:45 | - | |
| kf5-prison/ | 2019-02-28 12:01 | - | |
| kf5-purpose/ | 2019-03-21 00:47 | - | |
| kf5-solid/ | 2019-02-22 08:51 | - | |
| kf5-sonnet/ | 2019-02-22 08:55 | - | |
| kf5-syndication/ | 2019-03-21 00:50 | - | |
| kf5-syntax-highlighting/ | 2019-02-22 09:01 | - | |
| kf5-threadweaver/ | 2019-02-22 09:06 | - | |
| kf5/ | 2019-02-22 05:34 | - | |
| kgb-bot/ | 2019-02-22 09:10 | - | |
| kicad/ | 2019-03-21 00:52 | - | |
| kile/ | 2017-07-29 19:01 | - | |
| kiss-fft/ | 2017-07-29 19:07 | - | |
| kmahjongg/ | 2017-07-29 19:10 | - | |
| kmines/ | 2017-08-02 12:48 | - | |
| kmodtool/ | 2018-08-28 01:22 | - | |
| kmymoney/ | 2019-03-21 00:54 | - | |
| knot-resolver/ | 2018-08-28 01:41 | - | |
| knot/ | 2019-02-22 09:16 | - | |
| kobo/ | 2018-08-28 01:44 | - | |
| kohsuke-pom/ | 2017-07-29 19:29 | - | |
| koji-containerbuild/ | 2017-07-29 19:37 | - | |
| koji/ | 2018-10-09 23:30 | - | |
| kompose/ | 2018-08-28 01:49 | - | |
| konversation/ | 2018-08-28 01:53 | - | |
| koschei/ | 2018-08-28 02:01 | - | |
| koules/ | 2016-08-11 12:05 | - | |
| kpat/ | 2017-08-02 12:48 | - | |
| kpcli/ | 2016-08-11 12:07 | - | |
| krb5-appl/ | 2016-08-11 12:07 | - | |
| krusader/ | 2016-08-11 12:08 | - | |
| kstars/ | 2019-03-21 00:56 | - | |
| kstart/ | 2018-08-28 02:07 | - | |
| ktoblzcheck/ | 2016-08-11 12:10 | - | |
| ktorrent/ | 2019-02-22 09:23 | - | |
| kubernetes-ansible/ | 2017-07-29 19:58 | - | |
| kwalletcli/ | 2017-07-29 20:00 | - | |
| kwebkitpart/ | 2019-02-22 09:33 | - | |
| kyotocabinet/ | 2016-08-11 12:11 | - | |
| ladspa-swh-plugins/ | 2016-08-11 12:12 | - | |
| lame/ | 2018-08-28 02:14 | - | |
| lammps/ | 2019-03-21 00:58 | - | |
| lash/ | 2017-07-29 20:10 | - | |
| lasi/ | 2016-08-11 12:14 | - | |
| lastpass-cli/ | 2018-08-28 02:19 | - | |
| laszip/ | 2016-08-11 12:17 | - | |
| latex2rtf/ | 2016-08-11 12:18 | - | |
| latexmk/ | 2017-07-29 20:17 | - | |
| lato-fonts/ | 2016-08-11 12:18 | - | |
| layla-fonts/ | 2017-07-29 20:19 | - | |
| lbd/ | 2017-07-29 20:21 | - | |
| lbzip2-utils/ | 2016-08-11 12:20 | - | |
| lbzip2/ | 2017-07-29 20:23 | - | |
| lcg-infosites/ | 2016-08-11 12:21 | - | |
| lcgdm-dav/ | 2019-03-21 01:00 | - | |
| lcgdm/ | 2019-02-28 12:17 | - | |
| lcmaps/ | 2019-03-21 01:03 | - | |
| lcov/ | 2018-08-28 02:29 | - | |
| ldapdiff/ | 2016-08-11 12:23 | - | |
| ldapvi/ | 2018-08-28 02:31 | - | |
| lde/ | 2017-07-29 20:31 | - | |
| leafnode/ | 2016-08-11 12:24 | - | |
| ledger/ | 2017-08-02 12:48 | - | |
| legion/ | 2019-03-21 01:05 | - | |
| lensfun/ | 2019-03-21 01:07 | - | |
| leptonica/ | 2016-08-11 12:25 | - | |
| lesstif/ | 2016-08-11 12:26 | - | |
| leveldb/ | 2017-07-29 20:37 | - | |
| levien-inconsolata-fonts/ | 2016-08-11 12:28 | - | |
| lfcbase/ | 2016-08-11 12:30 | - | |
| lfcxml/ | 2017-08-02 12:48 | - | |
| lhapdf/ | 2019-03-21 01:10 | - | |
| lib3ds/ | 2016-08-11 12:32 | - | |
| libASL/ | 2019-02-28 12:41 | - | |
| libAfterImage/ | 2016-08-11 12:33 | - | |
| libHX/ | 2018-08-28 03:48 | - | |
| libXNVCtrl/ | 2016-08-11 14:28 | - | |
| libabigail/ | 2019-02-22 09:54 | - | |
| libaec/ | 2019-03-04 22:51 | - | |
| libaesgm/ | 2016-08-11 12:33 | - | |
| libalkimia/ | 2016-08-11 12:34 | - | |
| libappindicator-sharp/ | 2019-03-21 01:14 | - | |
| libappindicator/ | 2019-03-21 01:12 | - | |
| libapreq2/ | 2018-08-28 02:54 | - | |
| libasr/ | 2016-08-11 12:36 | - | |
| libass/ | 2018-09-01 12:10 | - | |
| libb2/ | 2018-09-01 12:13 | - | |
| libbinio/ | 2017-07-29 20:55 | - | |
| libbs2b/ | 2016-08-11 12:37 | - | |
| libbsd/ | 2018-08-28 03:04 | - | |
| libbson/ | 2019-02-22 10:06 | - | |
| libburn1/ | 2019-02-22 10:09 | - | |
| libcaca/ | 2016-08-11 12:39 | - | |
| libccd/ | 2016-08-11 12:40 | - | |
| libccp4/ | 2016-08-14 01:06 | - | |
| libcdaudio/ | 2016-08-11 12:41 | - | |
| libcddb/ | 2016-08-11 12:42 | - | |
| libcec/ | 2017-08-04 13:31 | - | |
| libcint/ | 2019-03-21 01:16 | - | |
| libclaw/ | 2016-08-11 12:44 | - | |
| libcli/ | 2016-08-11 12:44 | - | |
| libcomps/ | 2017-07-29 21:04 | - | |
| libconfuse/ | 2016-08-11 12:45 | - | |
| libcrystalhd/ | 2016-08-11 12:46 | - | |
| libcsv/ | 2016-08-11 12:47 | - | |
| libcue/ | 2017-07-29 21:07 | - | |
| libcutl/ | 2016-08-11 12:48 | - | |
| libcxx/ | 2017-07-29 21:09 | - | |
| libdap/ | 2016-08-11 12:48 | - | |
| libdasm/ | 2018-09-01 12:18 | - | |
| libdb4/ | 2016-08-11 12:49 | - | |
| libdbusmenu/ | 2017-07-29 21:11 | - | |
| libdc1394/ | 2016-08-11 12:53 | - | |
| libdigidocpp/ | 2019-02-22 10:15 | - | |
| libdirq/ | 2018-08-28 03:20 | - | |
| libdiscid/ | 2017-07-29 21:19 | - | |
| libdkimpp/ | 2017-07-29 21:21 | - | |
| libdmtx/ | 2019-02-22 10:20 | - | |
| libdnet/ | 2018-08-28 03:24 | - | |
| libdvbpsi/ | 2018-09-01 12:25 | - | |
| libdxflib/ | 2017-07-29 21:29 | - | |
| libdxfrw/ | 2016-08-11 12:56 | - | |
| libebml/ | 2019-02-22 10:24 | - | |
| libebur128/ | 2018-08-28 03:30 | - | |
| libecb/ | 2017-07-29 21:35 | - | |
| libeio/ | 2016-08-11 12:57 | - | |
| libemu/ | 2018-09-01 12:29 | - | |
| libesedb/ | 2016-08-11 12:58 | - | |
| libev/ | 2016-08-11 12:58 | - | |
| libewf/ | 2016-08-11 12:59 | - | |
| libfaketime/ | 2018-09-01 12:32 | - | |
| libfap/ | 2017-07-29 21:37 | - | |
| libffado/ | 2016-08-14 01:07 | - | |
| libflatarray/ | 2016-08-11 13:01 | - | |
| libfli/ | 2016-08-11 13:02 | - | |
| libfm-qt/ | 2019-03-21 01:20 | - | |
| libfm/ | 2019-03-21 01:18 | - | |
| libftdi/ | 2016-08-11 13:02 | - | |
| libgda/ | 2016-08-11 13:03 | - | |
| libgdiplus/ | 2018-10-10 00:11 | - | |
| libgdl/ | 2016-08-11 13:06 | - | |
| libgeotiff/ | 2017-08-04 13:53 | - | |
| libgit2-glib/ | 2018-10-10 00:19 | - | |
| libgit2/ | 2018-10-10 00:15 | - | |
| libglvnd/ | 2018-09-01 12:41 | - | |
| libgsasl/ | 2017-07-29 21:58 | - | |
| libgta/ | 2016-08-11 13:09 | - | |
| libguess/ | 2017-07-29 22:01 | - | |
| libharu/ | 2016-08-11 13:10 | - | |
| libicns/ | 2017-07-29 22:03 | - | |
| libident/ | 2016-08-11 13:10 | - | |
| libidn2/ | 2019-02-28 13:00 | - | |
| libindi/ | 2018-08-28 03:54 | - | |
| libindicator/ | 2016-08-11 13:12 | - | |
| libinfinity/ | 2016-08-11 13:12 | - | |
| libinput/ | 2017-07-29 22:12 | - | |
| libint/ | 2017-07-29 22:15 | - | |
| libint2/ | 2017-07-30 01:52 | - | |
| libircclient/ | 2016-08-11 13:14 | - | |
| libirman/ | 2016-08-11 13:15 | - | |
| libisds/ | 2018-08-28 03:58 | - | |
| libisoburn/ | 2019-02-28 13:04 | - | |
| libisofs1/ | 2019-02-22 10:33 | - | |
| libitl/ | 2017-07-30 02:54 | - | |
| libjaylink/ | 2017-07-30 02:56 | - | |
| libjoedog/ | 2016-08-11 13:16 | - | |
| libkate/ | 2017-08-02 12:48 | - | |
| libkdegames/ | 2017-08-02 12:48 | - | |
| libkmahjongg/ | 2017-08-02 12:48 | - | |
| libkscreen-qt5/ | 2017-07-30 02:58 | - | |
| libktorrent/ | 2016-08-11 13:19 | - | |
| liblas/ | 2018-08-28 04:07 | - | |
| liblbfgs/ | 2016-08-11 13:21 | - | |
| liblinear/ | 2016-08-11 13:21 | - | |
| liblxi/ | 2018-08-28 04:11 | - | |
| liblxqt-mount/ | 2017-08-02 12:48 | - | |
| liblxqt/ | 2017-08-04 14:10 | - | |
| liblzf/ | 2016-08-11 13:22 | - | |
| libmacaroons/ | 2018-09-01 12:49 | - | |
| libmad/ | 2019-02-22 10:36 | - | |
| libmatekbd/ | 2017-08-02 12:48 | - | |
| libmatemixer/ | 2017-07-30 03:16 | - | |
| libmateweather/ | 2017-08-02 12:48 | - | |
| libmatroska/ | 2019-02-22 10:39 | - | |
| libmaxminddb/ | 2016-08-11 13:25 | - | |
| libmcrypt/ | 2016-08-11 13:26 | - | |
| libmediainfo/ | 2019-02-22 10:42 | - | |
| libmetalink/ | 2017-07-30 03:32 | - | |
| libmfx/ | 2018-08-28 04:18 | - | |
| libmikmod/ | 2016-08-11 13:27 | - | |
| libmkv/ | 2016-08-11 13:28 | - | |
| libmodbus/ | 2016-08-11 13:29 | - | |
| libmodplug/ | 2016-08-11 13:30 | - | |
| libmodsecurity/ | 2019-02-22 10:48 | - | |
| libmodulemd/ | 2018-10-10 00:28 | - | |
| libmongo-client/ | 2016-08-11 13:31 | - | |
| libmp4v2/ | 2016-08-11 13:31 | - | |
| libmspack/ | 2018-08-28 04:26 | - | |
| libnatpmp/ | 2016-08-11 13:32 | - | |
| libnatspec/ | 2016-08-11 13:33 | - | |
| libndn-cxx/ | 2017-07-30 03:36 | - | |
| libnet10/ | 2016-08-11 13:34 | - | |
| libnetfilter_cthelper/ | 2016-08-11 13:35 | - | |
| libnetfilter_cttimeout/ | 2016-08-11 13:35 | - | |
| libnetfilter_log/ | 2016-08-11 13:36 | - | |
| libnetfilter_queue/ | 2016-08-11 13:36 | - | |
| libnfs/ | 2018-09-01 13:01 | - | |
| libnftnl/ | 2017-08-04 15:07 | - | |
| libnids/ | 2016-08-11 13:37 | - | |
| libnova/ | 2016-08-11 13:38 | - | |
| libnss-mysql/ | 2016-08-11 13:39 | - | |
| libntirpc/ | 2016-08-11 13:39 | - | |
| libntlm/ | 2016-08-11 13:40 | - | |
| libodb-boost/ | 2017-08-04 15:21 | - | |
| libodb-mysql/ | 2017-08-04 15:34 | - | |
| libodb-pgsql/ | 2017-08-04 15:48 | - | |
| libodb-qt/ | 2017-08-04 16:02 | - | |
| libodb-sqlite/ | 2017-08-04 16:16 | - | |
| libodb/ | 2017-07-30 03:43 | - | |
| libofx/ | 2018-08-28 04:30 | - | |
| liboggz/ | 2016-08-11 13:43 | - | |
| liboping/ | 2016-08-11 13:44 | - | |
| libopkele/ | 2019-02-22 10:54 | - | |
| libopm/ | 2016-08-11 13:45 | - | |
| libosmo-dsp/ | 2016-08-11 13:47 | - | |
| libosmocore/ | 2016-08-11 13:46 | - | |
| libotr/ | 2016-08-11 13:48 | - | |
| libowfat/ | 2016-08-11 13:48 | - | |
| libp11/ | 2018-08-28 04:35 | - | |
| libpeas-loader-python3/ | 2019-03-21 01:22 | - | |
| libpgf/ | 2016-08-11 13:49 | - | |
| libplacebo/ | 2019-03-21 01:24 | - | |
| libpqxx/ | 2016-08-11 13:49 | - | |
| libprelude/ | 2019-03-21 01:26 | - | |
| libpreludedb/ | 2019-03-21 01:28 | - | |
| libprojectM/ | 2017-08-02 12:48 | - | |
| libpsl/ | 2016-08-11 13:51 | - | |
| libqalculate/ | 2016-08-11 13:51 | - | |
| libqtxdg-qt4/ | 2017-07-30 04:08 | - | |
| libqtxdg/ | 2018-09-01 13:14 | - | |
| libqxt/ | 2016-08-11 13:53 | - | |
| librabbitmq/ | 2016-08-11 13:54 | - | |
| libraqm/ | 2017-07-30 04:12 | - | |
| librcc/ | 2018-08-28 04:50 | - | |
| librcd/ | 2016-08-11 13:55 | - | |
| librdkafka/ | 2019-02-22 11:05 | - | |
| librecad/ | 2019-02-22 11:09 | - | |
| libreoffice-TexMaths/ | 2016-08-11 13:56 | - | |
| librepo/ | 2016-08-11 13:56 | - | |
| librsync/ | 2016-08-11 13:58 | - | |
| librx/ | 2016-08-11 13:58 | - | |
| libs3/ | 2017-07-30 04:18 | - | |
| libsass/ | 2018-08-28 04:59 | - | |
| libscrypt/ | 2016-08-11 13:59 | - | |
| libserf/ | 2018-08-28 05:02 | - | |
| libsidplayfp/ | 2017-07-30 04:24 | - | |
| libsieve/ | 2016-08-11 14:01 | - | |
| libsigsegv/ | 2016-08-11 14:02 | - | |
| libslz/ | 2017-07-30 04:26 | - | |
| libsmbios-cpp/ | 2018-08-28 05:08 | - | |
| libsmbios/ | 2019-03-21 01:30 | - | |
| libsodium/ | 2019-02-22 11:22 | - | |
| libsodium13/ | 2018-08-28 05:15 | - | |
| libspatialite/ | 2017-08-04 16:51 | - | |
| libspf2/ | 2016-08-14 01:20 | - | |
| libspnav/ | 2016-08-11 14:03 | - | |
| libsqlite3x/ | 2017-07-30 04:34 | - | |
| libssh/ | 2017-07-30 04:37 | - | |
| libstatgrab/ | 2017-07-30 04:40 | - | |
| libstemmer/ | 2016-08-11 14:04 | - | |
| libstroke/ | 2017-07-30 04:47 | - | |
| libsvm/ | 2018-10-10 00:45 | - | |
| libsysstat/ | 2017-08-02 12:48 | - | |
| libtelnet/ | 2016-08-11 14:06 | - | |
| libtermkey/ | 2019-02-22 11:26 | - | |
| libticables2/ | 2019-02-22 11:29 | - | |
| libticalcs2/ | 2019-02-28 13:19 | - | |
| libticonv/ | 2019-02-22 11:34 | - | |
| libtifiles2/ | 2019-02-22 11:37 | - | |
| libtiger/ | 2017-08-02 12:48 | - | |
| libtimidity/ | 2019-02-22 11:40 | - | |
| libtomcrypt/ | 2017-07-30 05:07 | - | |
| libtommath/ | 2017-07-30 05:14 | - | |
| libtorrent/ | 2017-07-30 05:20 | - | |
| libtranslate/ | 2016-08-11 14:08 | - | |
| libucil/ | 2017-08-04 17:20 | - | |
| libuecc/ | 2016-08-11 14:10 | - | |
| libunicap/ | 2017-07-30 05:26 | - | |
| libunicapgtk/ | 2017-08-04 17:35 | - | |
| libupnp/ | 2018-09-01 13:33 | - | |
| libuv/ | 2019-03-04 23:17 | - | |
| libva-intel-hybrid-driver/ | 2018-09-01 13:38 | - | |
| libva-utils/ | 2018-08-28 05:43 | - | |
| libva-vdpau-driver/ | 2018-08-28 05:46 | - | |
| libva/ | 2018-08-28 05:38 | - | |
| libvdpau-va-gl/ | 2018-08-28 05:49 | - | |
| libvdpau/ | 2016-08-11 14:13 | - | |
| libvmime/ | 2016-08-14 01:27 | - | |
| libvncserver/ | 2018-08-28 05:52 | - | |
| libvterm/ | 2017-07-30 05:45 | - | |
| libwebsockets/ | 2019-02-22 11:45 | - | |
| libwhirlpool/ | 2016-08-11 14:15 | - | |
| libwnck/ | 2016-08-11 14:16 | - | |
| libx86/ | 2016-08-11 14:18 | - | |
| libx86emu/ | 2019-02-22 11:48 | - | |
| libxc/ | 2016-08-11 14:19 | - | |
| libxfce4ui/ | 2019-03-21 01:34 | - | |
| libxfce4util/ | 2017-07-30 05:52 | - | |
| libxfcegui4/ | 2017-08-02 12:48 | - | |
| libxkbcommon/ | 2017-07-30 05:55 | - | |
| libxml++/ | 2016-08-11 14:26 | - | |
| libxmp/ | 2017-07-30 05:57 | - | |
| libxsmm/ | 2019-03-21 01:38 | - | |
| libykneomgr/ | 2016-08-11 14:30 | - | |
| libytnef/ | 2016-08-11 14:31 | - | |
| libyubikey/ | 2016-08-11 14:32 | - | |
| libyui-bindings/ | 2019-03-21 01:40 | - | |
| libyui-gtk/ | 2019-03-21 01:42 | - | |
| libyui-ncurses/ | 2019-03-21 01:44 | - | |
| libyui-qt/ | 2019-03-21 01:46 | - | |
| libyui/ | 2017-07-30 06:02 | - | |
| libyuv/ | 2016-08-11 14:37 | - | |
| libzdb/ | 2016-08-11 14:39 | - | |
| libzen/ | 2018-08-28 06:08 | - | |
| liferea/ | 2018-08-28 06:10 | - | |
| light-locker/ | 2016-08-11 14:43 | - | |
| lightdm-autologin-greeter/ | 2017-07-30 06:21 | - | |
| lightdm-gtk/ | 2017-08-04 18:18 | - | |
| lightdm-kde/ | 2017-08-04 18:33 | - | |
| lightdm-settings/ | 2018-08-28 06:20 | - | |
| lightdm/ | 2019-03-21 01:49 | - | |
| lighttpd/ | 2019-02-22 12:10 | - | |
| limnoria/ | 2018-08-28 06:26 | - | |
| linenoise/ | 2016-08-11 14:47 | - | |
| links/ | 2017-07-30 06:34 | - | |
| linode-cli/ | 2017-08-02 12:48 | - | |
| linsim/ | 2018-08-28 06:29 | - | |
| linux-libertine-fonts/ | 2016-08-11 14:49 | - | |
| linux-user-chroot/ | 2016-08-11 14:51 | - | |
| linux_logo/ | 2016-08-11 14:50 | - | |
| liquibase/ | 2016-08-11 14:52 | - | |
| lirc/ | 2019-03-21 01:53 | - | |
| litmus/ | 2016-08-11 14:55 | - | |
| lizardfs/ | 2018-08-28 06:35 | - | |
| lldpd/ | 2018-08-28 06:46 | - | |
| llvm/ | 2019-03-21 01:55 | - | |
| llvm3.9/ | 2017-07-30 06:45 | - | |
| llvm5.0/ | 2018-08-28 06:49 | - | |
| lmdb/ | 2018-09-01 14:04 | - | |
| lmfit/ | 2017-07-30 07:18 | - | |
| lnav/ | 2017-07-30 07:23 | - | |
| lnst/ | 2017-07-30 07:25 | - | |
| lockfile-progs/ | 2016-08-11 15:41 | - | |
| log4c/ | 2017-07-30 07:28 | - | |
| log4cplus/ | 2016-08-11 15:42 | - | |
| log4cpp/ | 2016-08-11 15:44 | - | |
| log4j-jboss-logmanager/ | 2017-07-30 07:30 | - | |
| log4net/ | 2019-03-21 02:25 | - | |
| logback/ | 2017-07-30 07:37 | - | |
| logcheck/ | 2016-08-11 15:45 | - | |
| loopabull/ | 2018-08-28 07:24 | - | |
| loudmouth/ | 2017-07-30 07:45 | - | |
| lout/ | 2017-07-30 07:47 | - | |
| love/ | 2019-02-22 12:54 | - | |
| lrzip/ | 2017-07-30 07:50 | - | |
| lshell/ | 2016-08-11 15:48 | - | |
| lsyncd/ | 2017-07-30 07:53 | - | |
| lttng-tools/ | 2017-08-02 12:48 | - | |
| lttng-ust/ | 2017-07-30 08:00 | - | |
| lua-alt-getopt/ | 2016-08-11 15:53 | - | |
| lua-argparse/ | 2016-08-11 15:54 | - | |
| lua-bit32/ | 2017-07-30 08:03 | - | |
| lua-bitop/ | 2016-08-11 15:55 | - | |
| lua-cyrussasl/ | 2017-07-30 08:05 | - | |
| lua-dbi/ | 2016-08-11 15:57 | - | |
| lua-expat/ | 2018-08-28 07:29 | - | |
| lua-filesystem/ | 2016-08-11 15:59 | - | |
| lua-fun/ | 2017-08-02 12:48 | - | |
| lua-json/ | 2017-08-02 12:48 | - | |
| lua-ldap/ | 2016-08-11 16:04 | - | |
| lua-lpeg/ | 2016-08-11 16:05 | - | |
| lua-lunit/ | 2016-08-11 16:06 | - | |
| lua-md5/ | 2017-07-30 08:07 | - | |
| lua-mpack/ | 2017-07-30 08:10 | - | |
| lua-posix/ | 2017-08-02 12:48 | - | |
| lua-sec/ | 2017-07-30 08:14 | - | |
| lua-socket/ | 2018-08-28 07:31 | - | |
| lua-term/ | 2016-08-11 16:10 | - | |
| luajit/ | 2016-08-11 16:01 | - | |
| luarocks/ | 2017-07-30 08:12 | - | |
| lugaru/ | 2019-02-22 12:58 | - | |
| lumina-desktop/ | 2017-07-30 08:18 | - | |
| lv/ | 2017-07-30 08:29 | - | |
| lv2/ | 2017-07-30 08:25 | - | |
| lxc/ | 2019-03-21 02:27 | - | |
| lxi-tools/ | 2018-08-28 07:39 | - | |
| lximage-qt/ | 2019-03-21 02:29 | - | |
| lxmenu-data/ | 2016-08-11 16:13 | - | |
| lxqt-about/ | 2017-08-04 19:37 | - | |
| lxqt-build-tools/ | 2017-07-30 08:37 | - | |
| lxqt-common/ | 2017-08-04 19:52 | - | |
| lxqt-config/ | 2018-08-28 07:42 | - | |
| lxqt-globalkeys/ | 2017-08-04 20:22 | - | |
| lxqt-l10n/ | 2017-08-04 20:38 | - | |
| lxqt-notificationd/ | 2017-08-04 20:51 | - | |
| lxqt-openssh-askpass/ | 2017-08-04 21:06 | - | |
| lxqt-panel/ | 2019-03-21 02:31 | - | |
| lxqt-policykit/ | 2017-08-04 21:23 | - | |
| lxqt-powermanagement/ | 2017-08-04 21:37 | - | |
| lxqt-qtplugin/ | 2018-08-28 07:48 | - | |
| lxqt-runner/ | 2019-03-21 02:33 | - | |
| lxqt-session/ | 2017-08-04 22:09 | - | |
| lxqt-sudo/ | 2017-08-04 22:24 | - | |
| lxqt-wallet/ | 2019-03-21 02:36 | - | |
| lynis/ | 2019-02-22 13:13 | - | |
| lyx/ | 2017-07-30 09:10 | - | |
| lz4/ | 2017-07-30 09:25 | - | |
| lzip/ | 2017-07-30 09:27 | - | |
| lziprecover/ | 2017-08-04 22:41 | - | |
| lzma-sdk/ | 2018-08-28 07:59 | - | |
| lzma-sdk457/ | 2017-07-30 09:31 | - | |
| mISDN/ | 2016-08-11 19:31 | - | |
| mMass/ | 2019-02-22 16:22 | - | |
| mac-encheez/ | 2018-08-28 08:01 | - | |
| mac-robber/ | 2016-08-11 16:23 | - | |
| macromilter/ | 2018-08-28 08:04 | - | |
| madplay/ | 2017-08-04 22:54 | - | |
| mahout-collection-codegen-plugin/ | 2016-08-11 16:24 | - | |
| mail-notification/ | 2017-08-02 12:48 | - | |
| mailgraph/ | 2018-08-28 08:06 | - | |
| mailman3-fedmsg-plugin/ | 2016-08-11 16:26 | - | |
| makedepf90/ | 2016-08-11 16:28 | - | |
| makeself/ | 2016-08-11 16:29 | - | |
| maloc/ | 2016-08-11 16:30 | - | |
| man-pages-de/ | 2016-08-11 16:32 | - | |
| man2html/ | 2016-08-11 16:31 | - | |
| mandoc/ | 2019-02-22 13:16 | - | |
| manifest-tool/ | 2019-03-21 02:38 | - | |
| mantle/ | 2019-03-21 02:40 | - | |
| marble/ | 2019-02-22 13:23 | - | |
| marco/ | 2019-02-22 13:33 | - | |
| marked/ | 2017-08-02 12:48 | - | |
| mash/ | 2016-08-11 16:38 | - | |
| masscan/ | 2017-07-30 09:51 | - | |
| mate-applets/ | 2019-02-22 13:38 | - | |
| mate-backgrounds/ | 2017-08-02 12:48 | - | |
| mate-calc/ | 2017-08-02 12:48 | - | |
| mate-common/ | 2017-07-30 09:58 | - | |
| mate-control-center/ | 2017-08-04 23:27 | - | |
| mate-desktop/ | 2017-08-02 12:48 | - | |
| mate-icon-theme-faenza/ | 2017-07-30 10:17 | - | |
| mate-icon-theme/ | 2017-07-30 10:10 | - | |
| mate-media/ | 2017-08-02 12:48 | - | |
| mate-menus/ | 2017-07-30 10:26 | - | |
| mate-netspeed/ | 2017-08-04 23:44 | - | |
| mate-notification-daemon/ | 2017-08-02 12:48 | - | |
| mate-panel/ | 2017-08-02 12:48 | - | |
| mate-polkit/ | 2017-07-30 10:43 | - | |
| mate-power-manager/ | 2019-02-22 13:46 | - | |
| mate-screensaver/ | 2017-08-02 12:48 | - | |
| mate-sensors-applet/ | 2017-08-05 00:19 | - | |
| mate-session-manager/ | 2017-08-02 12:48 | - | |
| mate-settings-daemon/ | 2017-08-02 12:48 | - | |
| mate-system-monitor/ | 2019-02-22 13:52 | - | |
| mate-terminal/ | 2018-08-28 08:18 | - | |
| mate-themes-extras/ | 2016-08-11 17:04 | - | |
| mate-themes/ | 2018-08-28 08:23 | - | |
| mate-user-guide/ | 2017-07-30 11:23 | - | |
| mate-utils/ | 2019-02-22 13:58 | - | |
| mathex/ | 2016-08-11 17:08 | - | |
| mathgl/ | 2019-03-21 02:42 | - | |
| mathjax/ | 2017-08-02 12:48 | - | |
| matio/ | 2017-07-30 11:31 | - | |
| maven-processor-plugin/ | 2017-07-30 11:36 | - | |
| mawk/ | 2016-08-11 17:11 | - | |
| maxima/ | 2019-03-21 02:53 | - | |
| mb2md/ | 2018-08-28 08:32 | - | |
| mbedtls/ | 2019-03-21 02:55 | - | |
| mbrowse/ | 2016-08-11 17:16 | - | |
| mbuffer/ | 2017-07-30 11:48 | - | |
| mcabber/ | 2018-08-28 08:37 | - | |
| mchange-commons/ | 2016-08-11 17:17 | - | |
| mcollective/ | 2016-08-11 17:20 | - | |
| mcrypt/ | 2017-07-30 11:50 | - | |
| md5deep/ | 2016-08-11 17:21 | - | |
| mdbtools/ | 2017-08-02 12:48 | - | |
| med/ | 2017-07-30 12:00 | - | |
| mediaconch/ | 2019-03-21 02:58 | - | |
| mediainfo/ | 2019-02-22 14:24 | - | |
| mediawiki123-HTTP302Found/ | 2016-08-11 17:24 | - | |
| mediawiki123-RSS/ | 2016-08-11 17:25 | - | |
| mediawiki123-intersection/ | 2016-08-11 17:25 | - | |
| mediawiki123/ | 2017-07-30 12:12 | - | |
| medusa/ | 2016-08-11 17:27 | - | |
| megatools/ | 2018-09-01 14:39 | - | |
| meld/ | 2017-07-30 12:15 | - | |
| memkind/ | 2019-03-21 03:02 | - | |
| memoryfilesystem/ | 2016-08-11 17:29 | - | |
| menu-cache/ | 2019-03-21 03:04 | - | |
| meson/ | 2019-02-22 14:35 | - | |
| meta-test-family/ | 2018-08-28 08:54 | - | |
| metadata-extractor2/ | 2017-08-02 12:49 | - | |
| metainf-services/ | 2017-07-30 12:23 | - | |
| metis/ | 2019-03-21 03:06 | - | |
| metslib/ | 2016-08-11 17:33 | - | |
| mftrace/ | 2017-07-30 12:28 | - | |
| mg/ | 2017-07-30 12:31 | - | |
| mhash/ | 2016-08-11 17:36 | - | |
| mhonarc/ | 2017-07-30 12:33 | - | |
| microdns/ | 2018-09-01 14:52 | - | |
| milter-greylist/ | 2019-02-22 14:39 | - | |
| milter-regex/ | 2016-08-11 17:39 | - | |
| mimedefang/ | 2018-08-28 09:02 | - | |
| mimepull/ | 2017-07-30 12:40 | - | |
| mimetex/ | 2016-08-11 17:41 | - | |
| mimetic/ | 2016-08-11 17:42 | - | |
| mine_detector/ | 2017-08-02 12:49 | - | |
| minetest/ | 2017-08-02 12:49 | - | |
| minetestmapper/ | 2017-07-30 13:00 | - | |
| mingw-SDL/ | 2017-08-05 21:22 | - | |
| mingw-SDL2/ | 2019-02-22 15:20 | - | |
| mingw-SDL2_image/ | 2019-02-22 15:26 | - | |
| mingw-SDL2_mixer/ | 2019-02-22 15:30 | - | |
| mingw-SDL_image/ | 2017-08-05 21:38 | - | |
| mingw-SDL_mixer/ | 2017-08-05 21:54 | - | |
| mingw-angleproject/ | 2017-08-05 01:08 | - | |
| mingw-atk/ | 2017-08-05 01:27 | - | |
| mingw-binutils/ | 2017-08-02 12:49 | - | |
| mingw-boost/ | 2017-08-05 01:41 | - | |
| mingw-bzip2/ | 2017-08-05 02:25 | - | |
| mingw-c-ares/ | 2018-08-28 09:05 | - | |
| mingw-cairo/ | 2017-08-05 02:40 | - | |
| mingw-cmocka/ | 2017-08-05 03:24 | - | |
| mingw-crt/ | 2017-08-05 03:39 | - | |
| mingw-curl/ | 2017-08-05 03:56 | - | |
| mingw-dbus/ | 2017-08-05 04:20 | - | |
| mingw-dlfcn/ | 2017-08-05 04:36 | - | |
| mingw-enchant/ | 2017-08-05 04:50 | - | |
| mingw-expat/ | 2017-08-05 05:05 | - | |
| mingw-filesystem/ | 2017-07-30 13:29 | - | |
| mingw-flac/ | 2017-08-05 05:19 | - | |
| mingw-fontconfig/ | 2017-08-05 05:34 | - | |
| mingw-freetype/ | 2017-08-05 05:49 | - | |
| mingw-gcc/ | 2017-08-02 12:49 | - | |
| mingw-gdb/ | 2017-08-05 06:04 | - | |
| mingw-gdk-pixbuf/ | 2018-08-28 09:15 | - | |
| mingw-gettext/ | 2017-08-05 06:41 | - | |
| mingw-glib-networking/ | 2017-08-05 07:25 | - | |
| mingw-glib2/ | 2018-08-28 09:20 | - | |
| mingw-gmp/ | 2017-08-05 07:40 | - | |
| mingw-gnutls/ | 2017-08-05 07:57 | - | |
| mingw-gsm/ | 2017-08-05 08:18 | - | |
| mingw-gstreamer1-plugins-base/ | 2017-08-05 08:48 | - | |
| mingw-gstreamer1/ | 2017-08-05 08:32 | - | |
| mingw-gtk2/ | 2017-08-05 09:06 | - | |
| mingw-gtk3/ | 2017-08-05 09:30 | - | |
| mingw-harfbuzz/ | 2017-08-05 09:53 | - | |
| mingw-headers/ | 2016-08-11 18:17 | - | |
| mingw-hunspell/ | 2017-08-05 10:10 | - | |
| mingw-icu/ | 2017-08-05 10:25 | - | |
| mingw-jasper/ | 2017-08-05 10:44 | - | |
| mingw-libffi/ | 2017-08-05 10:59 | - | |
| mingw-libgcrypt/ | 2017-08-05 11:13 | - | |
| mingw-libgpg-error/ | 2017-08-05 11:31 | - | |
| mingw-libidn/ | 2017-08-05 11:45 | - | |
| mingw-libidn2/ | 2018-08-28 09:32 | - | |
| mingw-libjpeg-turbo/ | 2017-08-05 12:17 | - | |
| mingw-libogg/ | 2017-08-05 12:32 | - | |
| mingw-libpng/ | 2017-08-05 12:46 | - | |
| mingw-libsoup/ | 2018-08-28 09:36 | - | |
| mingw-libssh2/ | 2017-08-05 13:19 | - | |
| mingw-libtasn1/ | 2017-08-05 13:34 | - | |
| mingw-libtheora/ | 2017-08-05 13:51 | - | |
| mingw-libtiff/ | 2017-08-05 14:08 | - | |
| mingw-libvorbis/ | 2017-08-05 14:24 | - | |
| mingw-libwebp/ | 2017-08-05 14:40 | - | |
| mingw-libxml2/ | 2017-08-05 14:54 | - | |
| mingw-libxslt/ | 2017-08-05 15:12 | - | |
| mingw-log4c/ | 2017-08-05 15:28 | - | |
| mingw-nettle/ | 2017-08-05 15:42 | - | |
| mingw-nsis/ | 2017-08-05 15:53 | - | |
| mingw-openssl/ | 2017-08-05 16:10 | - | |
| mingw-opus/ | 2017-08-05 16:40 | - | |
| mingw-p11-kit/ | 2017-08-05 16:55 | - | |
| mingw-pango/ | 2017-08-05 17:12 | - | |
| mingw-pcre/ | 2017-08-05 17:28 | - | |
| mingw-pdcurses/ | 2017-08-05 17:44 | - | |
| mingw-pixman/ | 2017-08-05 17:58 | - | |
| mingw-pkg-config/ | 2016-08-11 18:47 | - | |
| mingw-postgresql/ | 2017-08-05 18:12 | - | |
| mingw-qt/ | 2018-08-28 09:40 | - | |
| mingw-qt5-qt3d/ | 2019-02-22 14:43 | - | |
| mingw-qt5-qtactiveqt/ | 2019-02-22 14:45 | - | |
| mingw-qt5-qtbase/ | 2017-08-05 19:27 | - | |
| mingw-qt5-qtdeclarative/ | 2019-03-21 03:14 | - | |
| mingw-qt5-qtgraphicaleffects/ | 2019-02-22 14:49 | - | |
| mingw-qt5-qtimageformats/ | 2019-02-22 14:51 | - | |
| mingw-qt5-qtlocation/ | 2019-02-22 14:53 | - | |
| mingw-qt5-qtmultimedia/ | 2019-02-22 14:55 | - | |
| mingw-qt5-qtquick1/ | 2019-02-22 14:57 | - | |
| mingw-qt5-qtscript/ | 2019-02-22 14:59 | - | |
| mingw-qt5-qtsensors/ | 2019-02-22 15:01 | - | |
| mingw-qt5-qtsvg/ | 2019-02-22 15:04 | - | |
| mingw-qt5-qtsystems/ | 2019-02-22 15:06 | - | |
| mingw-qt5-qttools/ | 2019-03-21 03:16 | - | |
| mingw-qt5-qttranslations/ | 2019-02-22 15:10 | - | |
| mingw-qt5-qtwebkit/ | 2019-02-22 15:12 | - | |
| mingw-qt5-qtwebsockets/ | 2019-02-22 15:14 | - | |
| mingw-qt5-qtwinextras/ | 2019-02-22 15:16 | - | |
| mingw-qt5-qtxmlpatterns/ | 2019-02-22 15:18 | - | |
| mingw-readline/ | 2017-08-05 21:08 | - | |
| mingw-speex/ | 2017-08-05 22:10 | - | |
| mingw-sqlite/ | 2017-08-05 22:25 | - | |
| mingw-tcl/ | 2017-08-05 22:41 | - | |
| mingw-termcap/ | 2017-08-05 22:59 | - | |
| mingw-w64-tools/ | 2017-07-30 16:25 | - | |
| mingw-wavpack/ | 2018-08-28 14:30 | - | |
| mingw-webkitgtk/ | 2017-08-05 23:28 | - | |
| mingw-webkitgtk3/ | 2017-08-06 02:25 | - | |
| mingw-win-iconv/ | 2017-08-06 04:09 | - | |
| mingw-winpthreads/ | 2017-08-06 04:25 | - | |
| mingw-winstorecompat/ | 2017-08-06 04:43 | - | |
| mingw-xz/ | 2017-08-06 05:00 | - | |
| mingw-zlib/ | 2017-08-06 05:19 | - | |
| minipro/ | 2016-08-11 19:24 | - | |
| minised/ | 2016-08-11 19:25 | - | |
| miniupnpc/ | 2017-07-30 16:44 | - | |
| miniz/ | 2017-08-02 12:49 | - | |
| mint-themes-gtk3/ | 2018-08-28 14:38 | - | |
| mint-themes/ | 2019-02-22 15:36 | - | |
| mint-x-icons/ | 2019-02-22 15:38 | - | |
| mint-y-icons/ | 2019-02-22 15:42 | - | |
| mint-y-theme/ | 2019-02-22 15:45 | - | |
| mintlocale/ | 2019-02-22 15:33 | - | |
| mintmenu/ | 2016-08-11 19:29 | - | |
| mirmon/ | 2017-07-30 16:49 | - | |
| mirrorbrain/ | 2017-08-02 12:49 | - | |
| mirrormanager2/ | 2018-08-28 14:49 | - | |
| mkdocs/ | 2018-08-28 14:53 | - | |
| mktorrent/ | 2016-08-11 19:33 | - | |
| mkvtoolnix/ | 2019-03-21 03:18 | - | |
| mld2p4/ | 2019-02-22 15:49 | - | |
| mlmmj/ | 2017-07-30 16:57 | - | |
| mlpack/ | 2019-03-21 03:20 | - | |
| mlt/ | 2019-03-21 03:54 | - | |
| mlton/ | 2019-03-21 03:58 | - | |
| mmdb2/ | 2016-08-11 19:38 | - | |
| mmg3d/ | 2017-08-02 12:49 | - | |
| mmv/ | 2017-07-30 17:03 | - | |
| moarvm/ | 2019-02-22 16:26 | - | |
| mocha/ | 2017-07-30 17:07 | - | |
| mock-core-configs/ | 2019-02-22 16:30 | - | |
| mock/ | 2018-10-10 02:55 | - | |
| mockito/ | 2017-08-02 12:49 | - | |
| mod_auth_cas/ | 2017-07-30 17:18 | - | |
| mod_auth_ntlm_winbind/ | 2016-08-11 19:41 | - | |
| mod_auth_openid/ | 2019-02-22 16:32 | - | |
| mod_auth_token/ | 2019-03-05 01:13 | - | |
| mod_authnz_external/ | 2016-08-11 19:42 | - | |
| mod_evasive/ | 2016-08-11 19:44 | - | |
| mod_flvx/ | 2016-08-11 19:45 | - | |
| mod_form/ | 2017-07-30 17:23 | - | |
| mod_geoip/ | 2016-08-11 19:48 | - | |
| mod_gnutls/ | 2016-08-11 19:49 | - | |
| mod_limitipconn/ | 2016-08-11 19:51 | - | |
| mod_log_post/ | 2016-08-11 19:52 | - | |
| mod_perl/ | 2018-10-10 03:03 | - | |
| mod_qos/ | 2016-08-11 19:56 | - | |
| mod_ruid2/ | 2016-08-11 19:57 | - | |
| mod_xsendfile/ | 2016-08-11 19:58 | - | |
| modularity-testing-framework/ | 2018-08-28 16:08 | - | |
| module-build-service/ | 2019-02-22 16:36 | - | |
| modulemd/ | 2018-08-28 16:14 | - | |
| moin/ | 2018-08-28 16:17 | - | |
| molequeue/ | 2019-03-21 04:01 | - | |
| mom/ | 2018-08-28 16:22 | - | |
| mongo-c-driver/ | 2017-07-30 17:47 | - | |
| mongo-cxx-driver/ | 2017-08-02 12:49 | - | |
| mongodb/ | 2019-02-22 16:43 | - | |
| monit/ | 2018-08-28 16:27 | - | |
| monitor-edid/ | 2016-08-11 20:01 | - | |
| monitorix/ | 2018-08-28 16:30 | - | |
| monkeysphere/ | 2017-07-30 17:56 | - | |
| mono-addins/ | 2019-03-21 04:06 | - | |
| mono-basic/ | 2019-03-21 04:09 | - | |
| mono-cecil/ | 2019-03-21 04:11 | - | |
| mono-zeroconf/ | 2019-03-21 04:13 | - | |
| mono/ | 2019-03-21 04:04 | - | |
| monotone/ | 2017-07-30 18:06 | - | |
| moodle/ | 2019-02-22 17:22 | - | |
| moon-buggy/ | 2016-08-11 20:07 | - | |
| moos/ | 2018-08-28 16:48 | - | |
| moreutils/ | 2016-08-11 20:08 | - | |
| mosh/ | 2017-07-30 18:18 | - | |
| mosquitto/ | 2019-02-22 17:27 | - | |
| most/ | 2017-07-30 18:23 | - | |
| mote/ | 2018-08-28 16:53 | - | |
| mousepad/ | 2019-03-21 04:15 | - | |
| moyogo-molengo-fonts/ | 2017-08-02 12:49 | - | |
| mozc/ | 2019-03-13 20:14 | - | |
| mozilla-adblockplus/ | 2016-08-11 20:14 | - | |
| mozilla-fira-fonts/ | 2017-07-30 18:29 | - | |
| mozilla-https-everywhere/ | 2019-02-22 17:32 | - | |
| mozilla-noscript/ | 2019-02-22 17:35 | - | |
| mozilla-requestpolicy/ | 2018-08-28 17:04 | - | |
| mozilla-ublock-origin/ | 2018-08-28 17:07 | - | |
| mozjs38/ | 2017-07-30 18:39 | - | |
| mozo/ | 2017-07-30 18:46 | - | |
| mp/ | 2017-07-30 18:50 | - | |
| mpdecimal/ | 2017-07-30 18:58 | - | |
| mpg123/ | 2018-08-28 17:09 | - | |
| mph-2b-damase-fonts/ | 2016-08-11 20:17 | - | |
| mpi4py/ | 2017-07-30 19:05 | - | |
| mpop/ | 2017-07-30 19:10 | - | |
| mpris-scrobbler/ | 2019-03-21 04:17 | - | |
| mpssh/ | 2016-08-11 20:19 | - | |
| mrbs/ | 2018-08-28 17:13 | - | |
| mrrescue/ | 2018-08-28 17:15 | - | |
| msgpack/ | 2017-07-30 19:16 | - | |
| msgpuck/ | 2018-08-28 17:19 | - | |
| msktutil/ | 2019-02-22 17:38 | - | |
| msmtp/ | 2016-08-11 20:21 | - | |
| msr-tools/ | 2016-08-11 20:22 | - | |
| mtpaint/ | 2017-07-30 19:23 | - | |
| muParser/ | 2019-02-22 17:48 | - | |
| muffin/ | 2019-03-21 04:19 | - | |
| multilib-rpm-config/ | 2017-07-30 19:27 | - | |
| multitail/ | 2016-08-11 20:24 | - | |
| munge/ | 2017-07-30 19:52 | - | |
| munin/ | 2019-02-22 17:43 | - | |
| mup/ | 2018-08-28 17:44 | - | |
| mussh/ | 2016-08-11 20:28 | - | |
| mxml/ | 2017-07-30 20:03 | - | |
| mylvmbackup/ | 2017-08-02 12:49 | - | |
| myproxy/ | 2019-03-21 04:21 | - | |
| myrepos/ | 2019-02-22 17:55 | - | |
| mysql++/ | 2016-08-11 20:30 | - | |
| mysql-connector-python/ | 2016-08-11 20:30 | - | |
| mysql-mmm/ | 2018-08-28 17:49 | - | |
| mysql-proxy/ | 2016-08-11 20:32 | - | |
| mysql-utilities/ | 2016-08-11 20:33 | - | |
| mysqlreport/ | 2016-08-11 20:32 | - | |
| mysqltuner/ | 2019-02-22 17:57 | - | |
| mytop/ | 2016-08-11 20:35 | - | |
| nacl/ | 2017-07-30 20:09 | - | |
| nagios-plugins-bonding/ | 2016-08-11 20:36 | - | |
| nagios-plugins-check-updates/ | 2019-02-22 18:09 | - | |
| nagios-plugins-fts/ | 2018-10-10 03:48 | - | |
| nagios-plugins-lcgdm/ | 2017-07-30 20:30 | - | |
| nagios-plugins-openmanage/ | 2016-08-11 20:37 | - | |
| nagios-plugins/ | 2019-02-22 18:04 | - | |
| nagios/ | 2019-02-22 18:00 | - | |
| nant/ | 2019-03-21 04:26 | - | |
| nautilus-image-converter/ | 2017-08-02 12:49 | - | |
| nautilus-python/ | 2019-02-22 18:15 | - | |
| nawk/ | 2016-08-11 20:38 | - | |
| nbd/ | 2017-07-30 20:40 | - | |
| nbdkit/ | 2019-03-21 04:28 | - | |
| ncdu/ | 2019-03-21 04:30 | - | |
| ncftp/ | 2016-08-11 20:40 | - | |
| ncl/ | 2018-08-28 18:16 | - | |
| nco/ | 2019-02-22 18:23 | - | |
| ncrack/ | 2017-07-30 20:50 | - | |
| ncview/ | 2017-08-06 07:16 | - | |
| ndctl/ | 2016-08-11 20:42 | - | |
| ndisc6/ | 2017-07-30 20:55 | - | |
| ndjbdns/ | 2016-08-11 20:42 | - | |
| ndoutils/ | 2017-07-30 20:57 | - | |
| neXtaw/ | 2016-08-11 20:53 | - | |
| nebula/ | 2017-07-30 21:00 | - | |
| nec2c/ | 2018-08-28 18:37 | - | |
| nedit/ | 2017-07-30 21:02 | - | |
| needrestart/ | 2018-08-28 18:40 | - | |
| nekovm/ | 2019-02-28 15:36 | - | |
| nemo-extensions/ | 2019-03-21 04:35 | - | |
| nemo/ | 2019-03-21 04:33 | - | |
| neovim/ | 2019-02-22 18:35 | - | |
| netbsd-iscsi/ | 2016-08-11 20:45 | - | |
| netcdf-cxx/ | 2017-08-06 07:59 | - | |
| netcdf-fortran/ | 2017-08-06 08:15 | - | |
| netcdf/ | 2017-07-30 21:15 | - | |
| netcdf4-python/ | 2019-03-21 04:37 | - | |
| netgen-mesher/ | 2017-08-06 08:35 | - | |
| nethogs/ | 2017-07-30 21:52 | - | |
| netsed/ | 2016-08-11 20:49 | - | |
| nex/ | 2017-07-30 22:11 | - | |
| nextcloud-client/ | 2019-03-21 04:45 | - | |
| nextcloud/ | 2017-08-06 09:04 | - | |
| nfdump/ | 2018-08-28 19:10 | - | |
| nfft/ | 2017-07-30 22:22 | - | |
| nfs-ganesha/ | 2017-07-30 22:25 | - | |
| nftables/ | 2017-07-30 22:29 | - | |
| nghttp2/ | 2018-08-28 19:13 | - | |
| nginx/ | 2018-08-28 19:17 | - | |
| ngircd/ | 2016-08-11 20:58 | - | |
| ngrep/ | 2018-10-10 04:07 | - | |
| nightview/ | 2019-02-22 18:58 | - | |
| nikto/ | 2018-08-28 19:23 | - | |
| ninja-build/ | 2019-02-22 19:05 | - | |
| nitroshare/ | 2017-07-30 22:46 | - | |
| nkf/ | 2016-08-11 21:00 | - | |
| nload/ | 2016-08-11 21:01 | - | |
| nmbscan/ | 2016-08-11 21:02 | - | |
| nmh/ | 2018-08-28 19:27 | - | |
| nmon/ | 2018-08-28 19:31 | - | |
| nnn/ | 2019-02-22 19:09 | - | |
| no-more-secrets/ | 2018-08-28 23:12 | - | |
| node-gyp/ | 2018-09-05 11:29 | - | |
| nodejs-abbrev/ | 2017-08-02 12:49 | - | |
| nodejs-after/ | 2017-08-02 12:49 | - | |
| nodejs-agent-base/ | 2017-08-02 12:49 | - | |
| nodejs-ain2/ | 2017-08-02 12:49 | - | |
| nodejs-alter/ | 2017-08-02 12:49 | - | |
| nodejs-amdefine/ | 2018-09-01 16:56 | - | |
| nodejs-ansi-font/ | 2017-08-02 12:49 | - | |
| nodejs-ansi-regex/ | 2017-08-02 12:49 | - | |
| nodejs-ansi-styles/ | 2017-08-02 12:49 | - | |
| nodejs-ansi/ | 2017-07-30 23:04 | - | |
| nodejs-ansicolors/ | 2018-09-01 16:59 | - | |
| nodejs-ansistyles/ | 2018-09-01 17:02 | - | |
| nodejs-archy/ | 2018-09-01 17:05 | - | |
| nodejs-argparse/ | 2017-08-02 12:49 | - | |
| nodejs-arrify/ | 2017-08-02 12:49 | - | |
| nodejs-as-number/ | 2017-08-02 12:49 | - | |
| nodejs-asap/ | 2017-08-02 12:49 | - | |
| nodejs-ascii-tree/ | 2017-08-02 12:49 | - | |
| nodejs-asn1/ | 2018-09-01 17:07 | - | |
| nodejs-assert-plus/ | 2018-09-01 17:10 | - | |
| nodejs-assertion-error/ | 2017-08-02 12:49 | - | |
| nodejs-ast-traverse/ | 2017-08-02 12:49 | - | |
| nodejs-ast-types/ | 2017-08-02 12:49 | - | |
| nodejs-astral-angular-annotate/ | 2017-08-02 12:49 | - | |
| nodejs-astral-pass/ | 2017-08-02 12:49 | - | |
| nodejs-astral/ | 2017-07-30 23:25 | - | |
| nodejs-async-cache/ | 2017-08-02 12:49 | - | |
| nodejs-async/ | 2018-09-01 17:13 | - | |
| nodejs-aws-sign/ | 2018-09-01 17:16 | - | |
| nodejs-aws-sign2/ | 2017-08-02 12:49 | - | |
| nodejs-backbone/ | 2017-08-02 12:49 | - | |
| nodejs-base64-js/ | 2017-08-02 12:49 | - | |
| nodejs-basic-auth-connect/ | 2017-08-02 12:49 | - | |
| nodejs-basic-auth-parser/ | 2017-08-02 12:49 | - | |
| nodejs-basic-auth/ | 2017-07-30 23:36 | - | |
| nodejs-batch/ | 2017-08-02 12:49 | - | |
| nodejs-better-assert/ | 2018-09-01 17:18 | - | |
| nodejs-bignumber-js/ | 2018-09-01 17:21 | - | |
| nodejs-bindings/ | 2017-08-02 12:49 | - | |
| nodejs-bl/ | 2017-07-30 23:47 | - | |
| nodejs-block-stream/ | 2018-09-01 17:24 | - | |
| nodejs-bluebird/ | 2017-08-02 12:49 | - | |
| nodejs-boolbase/ | 2017-08-02 12:49 | - | |
| nodejs-boom/ | 2018-09-01 17:27 | - | |
| nodejs-breakable/ | 2017-08-02 12:49 | - | |
| nodejs-browser-request/ | 2017-08-02 12:49 | - | |
| nodejs-bson/ | 2019-02-22 19:37 | - | |
| nodejs-buffer-crc32/ | 2017-08-02 12:49 | - | |
| nodejs-buffer-equal/ | 2017-08-02 12:49 | - | |
| nodejs-builtin-modules/ | 2019-02-22 19:40 | - | |
| nodejs-builtins/ | 2018-09-01 17:32 | - | |
| nodejs-bunker/ | 2017-08-02 12:49 | - | |
| nodejs-burrito/ | 2017-08-02 12:49 | - | |
| nodejs-bytes/ | 2017-08-02 12:49 | - | |
| nodejs-caller-callsite/ | 2017-08-02 12:49 | - | |
| nodejs-caller-path/ | 2017-08-02 12:49 | - | |
| nodejs-callsite/ | 2018-09-01 17:34 | - | |
| nodejs-callsites/ | 2017-08-02 12:49 | - | |
| nodejs-camel-case/ | 2017-08-02 12:49 | - | |
| nodejs-caniuse-db/ | 2017-08-02 12:49 | - | |
| nodejs-chai/ | 2017-07-31 00:10 | - | |
| nodejs-chainsaw/ | 2017-08-02 12:49 | - | |
| nodejs-chalk/ | 2017-08-02 12:49 | - | |
| nodejs-change-case/ | 2017-08-02 12:49 | - | |
| nodejs-char-spinner/ | 2017-08-02 12:49 | - | |
| nodejs-character-parser/ | 2017-08-02 12:49 | - | |
| nodejs-charm/ | 2017-08-02 12:49 | - | |
| nodejs-child-process-close/ | 2018-09-01 17:38 | - | |
| nodejs-chmodr/ | 2018-09-01 17:40 | - | |
| nodejs-chownr/ | 2018-09-01 17:43 | - | |
| nodejs-clean-css/ | 2017-08-02 12:49 | - | |
| nodejs-cli/ | 2017-08-02 12:49 | - | |
| nodejs-clone/ | 2017-08-02 12:49 | - | |
| nodejs-cls/ | 2017-08-02 12:49 | - | |
| nodejs-cmd-shim/ | 2018-09-01 17:46 | - | |
| nodejs-co/ | 2017-07-31 00:28 | - | |
| nodejs-codemirror/ | 2017-08-02 12:49 | - | |
| nodejs-collections/ | 2017-08-02 12:49 | - | |
| nodejs-colors/ | 2017-08-02 12:49 | - | |
| nodejs-combined-stream/ | 2018-09-01 17:49 | - | |
| nodejs-commander/ | 2017-08-02 12:49 | - | |
| nodejs-component-emitter/ | 2017-08-02 12:49 | - | |
| nodejs-compress-commons/ | 2017-08-02 12:49 | - | |
| nodejs-compressible/ | 2017-08-02 12:49 | - | |
| nodejs-compression/ | 2017-08-02 12:49 | - | |
| nodejs-concat-stream/ | 2017-08-02 12:49 | - | |
| nodejs-config-chain/ | 2018-09-01 17:52 | - | |
| nodejs-connect-livereload/ | 2017-08-02 12:49 | - | |
| nodejs-connect-timeout/ | 2017-08-02 12:49 | - | |
| nodejs-console-browserify/ | 2017-08-02 12:49 | - | |
| nodejs-console-dot-log/ | 2017-08-02 12:49 | - | |
| nodejs-constant-case/ | 2017-08-02 12:49 | - | |
| nodejs-constantinople/ | 2017-08-02 12:49 | - | |
| nodejs-content-type/ | 2017-08-02 12:49 | - | |
| nodejs-cookie-jar/ | 2018-09-01 17:54 | - | |
| nodejs-cookie-parser/ | 2017-08-02 12:49 | - | |
| nodejs-cookie-signature/ | 2017-08-02 12:49 | - | |
| nodejs-cookie/ | 2017-07-31 00:50 | - | |
| nodejs-cookiejar/ | 2017-08-02 12:49 | - | |
| nodejs-core-util-is/ | 2017-08-02 12:49 | - | |
| nodejs-couch-login/ | 2017-08-02 12:49 | - | |
| nodejs-crc32-stream/ | 2017-08-02 12:49 | - | |
| nodejs-cryptiles/ | 2018-09-01 17:57 | - | |
| nodejs-css-parse/ | 2017-08-02 12:49 | - | |
| nodejs-css-stringify/ | 2017-08-02 12:49 | - | |
| nodejs-css/ | 2017-07-31 01:02 | - | |
| nodejs-csslint/ | 2017-08-02 12:49 | - | |
| nodejs-cssom/ | 2017-08-02 12:49 | - | |
| nodejs-ctype/ | 2018-09-01 18:00 | - | |
| nodejs-cycle/ | 2017-08-02 12:49 | - | |
| nodejs-d/ | 2017-07-31 01:06 | - | |
| nodejs-dashdash/ | 2017-08-02 12:49 | - | |
| nodejs-data-uri-to-buffer/ | 2017-08-02 12:49 | - | |
| nodejs-date-now/ | 2017-08-02 12:49 | - | |
| nodejs-dateformat/ | 2017-08-02 12:49 | - | |
| nodejs-debug/ | 2017-07-31 01:13 | - | |
| nodejs-debuglog/ | 2017-08-02 12:49 | - | |
| nodejs-deep-eql/ | 2017-08-02 12:49 | - | |
| nodejs-deep-equal/ | 2018-09-01 18:03 | - | |
| nodejs-deep-extend/ | 2018-08-28 20:30 | - | |
| nodejs-defined/ | 2018-09-01 18:06 | - | |
| nodejs-delayed-stream/ | 2018-09-01 18:08 | - | |
| nodejs-delegates/ | 2017-08-02 12:49 | - | |
| nodejs-dep-graph/ | 2017-08-02 12:49 | - | |
| nodejs-depd/ | 2017-08-02 12:49 | - | |
| nodejs-destroy/ | 2017-08-02 12:49 | - | |
| nodejs-diff/ | 2017-07-31 01:35 | - | |
| nodejs-difflet/ | 2017-08-02 12:49 | - | |
| nodejs-domelementtype/ | 2017-08-02 12:49 | - | |
| nodejs-domhandler/ | 2017-08-02 12:49 | - | |
| nodejs-domutils/ | 2017-08-02 12:49 | - | |
| nodejs-dot-case/ | 2017-08-02 12:49 | - | |
| nodejs-dryice/ | 2017-08-02 12:49 | - | |
| nodejs-dtree/ | 2017-08-02 12:49 | - | |
| nodejs-duplex/ | 2017-07-31 01:42 | - | |
| nodejs-duplexer/ | 2017-08-02 12:49 | - | |
| nodejs-duplexify/ | 2017-08-02 12:49 | - | |
| nodejs-editor/ | 2018-09-01 18:11 | - | |
| nodejs-ee-first/ | 2017-08-02 12:49 | - | |
| nodejs-ejs/ | 2017-08-02 12:49 | - | |
| nodejs-end-of-stream/ | 2017-08-02 12:49 | - | |
| nodejs-entities/ | 2017-08-02 12:49 | - | |
| nodejs-error-ex/ | 2017-08-02 12:49 | - | |
| nodejs-errorhandler/ | 2017-08-02 12:49 | - | |
| nodejs-errs/ | 2017-08-02 12:49 | - | |
| nodejs-es5-ext/ | 2017-08-02 12:49 | - | |
| nodejs-es6-iterator/ | 2017-08-02 12:49 | - | |
| nodejs-es6-promise/ | 2017-08-02 12:49 | - | |
| nodejs-es6-symbol/ | 2017-08-02 12:49 | - | |
| nodejs-escape-html/ | 2017-08-02 12:49 | - | |
| nodejs-escape-string-regexp/ | 2017-07-31 02:02 | - | |
| nodejs-escodegen/ | 2017-08-02 12:49 | - | |
| nodejs-esprima-harmony-jscs/ | 2017-08-02 12:49 | - | |
| nodejs-esprima/ | 2017-07-31 02:05 | - | |
| nodejs-estraverse/ | 2017-08-02 12:49 | - | |
| nodejs-esutils/ | 2017-08-02 12:49 | - | |
| nodejs-etag/ | 2017-08-02 12:49 | - | |
| nodejs-event-stream/ | 2017-08-02 12:49 | - | |
| nodejs-eventemitter2/ | 2017-08-02 12:49 | - | |
| nodejs-exit/ | 2017-08-02 12:49 | - | |
| nodejs-expect-dot-js/ | 2017-08-02 12:49 | - | |
| nodejs-express-session/ | 2017-08-02 12:49 | - | |
| nodejs-extend/ | 2017-08-02 12:49 | - | |
| nodejs-extsprintf/ | 2017-08-02 12:49 | - | |
| nodejs-eyes/ | 2017-08-02 12:49 | - | |
| nodejs-faye-websocket/ | 2017-08-02 12:49 | - | |
| nodejs-fg-lodash/ | 2017-08-02 12:49 | - | |
| nodejs-file-uri-to-path/ | 2017-08-02 12:49 | - | |
| nodejs-filed/ | 2017-08-02 12:49 | - | |
| nodejs-fileset/ | 2017-08-02 12:49 | - | |
| nodejs-findup-sync/ | 2017-08-02 12:49 | - | |
| nodejs-follow/ | 2017-08-02 12:49 | - | |
| nodejs-forever-agent/ | 2018-09-01 18:14 | - | |
| nodejs-form-data/ | 2017-08-02 12:49 | - | |
| nodejs-formatio/ | 2017-08-02 12:49 | - | |
| nodejs-formidable/ | 2017-08-02 12:49 | - | |
| nodejs-freetree/ | 2017-08-02 12:49 | - | |
| nodejs-fresh/ | 2017-08-02 12:49 | - | |
| nodejs-from/ | 2017-08-02 12:49 | - | |
| nodejs-fs-ext/ | 2018-10-10 04:16 | - | |
| nodejs-fs-extra/ | 2017-08-02 12:49 | - | |
| nodejs-fs-vacuum/ | 2018-09-01 18:27 | - | |
| nodejs-fs-write-stream-atomic/ | 2018-09-01 18:30 | - | |
| nodejs-fstream-ignore/ | 2018-09-01 18:21 | - | |
| nodejs-fstream-npm/ | 2018-09-01 18:24 | - | |
| nodejs-fstream/ | 2018-09-01 18:19 | - | |
| nodejs-ftp/ | 2017-08-02 12:49 | - | |
| nodejs-gaze/ | 2017-08-02 12:49 | - | |
| nodejs-generate-object-property/ | 2017-08-02 12:49 | - | |
| nodejs-generic-pool/ | 2017-08-02 12:49 | - | |
| nodejs-get-stdin/ | 2017-08-02 12:49 | - | |
| nodejs-get-uri/ | 2017-08-02 12:49 | - | |
| nodejs-getobject/ | 2017-08-02 12:49 | - | |
| nodejs-github-url-from-git/ | 2018-09-01 18:33 | - | |
| nodejs-github-url-from-username-repo/ | 2017-08-02 12:49 | - | |
| nodejs-glob/ | 2018-09-01 18:36 | - | |
| nodejs-globule/ | 2017-08-02 12:49 | - | |
| nodejs-gonzales-pe/ | 2017-08-02 12:49 | - | |
| nodejs-got/ | 2017-08-02 12:49 | - | |
| nodejs-graceful-fs/ | 2018-09-01 18:38 | - | |
| nodejs-graceful-readlink/ | 2017-07-31 02:49 | - | |
| nodejs-grip/ | 2017-08-02 12:49 | - | |
| nodejs-growl/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-angular-templates/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-cli/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-compare-size/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-clean/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-concat/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-cssmin/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-internal/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-nodeunit/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-requirejs/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-uglify/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-contrib-watch/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-git-authors/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-init/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-legacy-util/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-saucelabs/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-sed/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-util-args/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-util-options/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-util-process/ | 2017-08-02 12:49 | - | |
| nodejs-grunt-util-property/ | 2017-08-02 12:49 | - | |
| nodejs-grunt/ | 2017-07-31 02:51 | - | |
| nodejs-handlebars/ | 2018-09-01 18:41 | - | |
| nodejs-has-ansi/ | 2017-07-31 03:03 | - | |
| nodejs-has-color/ | 2017-08-02 12:49 | - | |
| nodejs-has-unicode/ | 2017-08-02 12:49 | - | |
| nodejs-hash_file/ | 2017-08-02 12:49 | - | |
| nodejs-hashish/ | 2018-09-01 18:44 | - | |
| nodejs-hawk/ | 2018-09-01 18:47 | - | |
| nodejs-heap/ | 2017-07-31 03:17 | - | |
| nodejs-highlight-js/ | 2017-08-02 12:49 | - | |
| nodejs-hock/ | 2017-08-02 12:49 | - | |
| nodejs-hoek/ | 2018-09-01 18:49 | - | |
| nodejs-hooker/ | 2017-08-02 12:49 | - | |
| nodejs-hosted-git-info/ | 2018-09-01 18:52 | - | |
| nodejs-html-minifier/ | 2017-08-02 12:49 | - | |
| nodejs-htmlparser2/ | 2017-08-02 12:49 | - | |
| nodejs-http-proxy-agent/ | 2017-08-02 12:49 | - | |
| nodejs-http-signature/ | 2018-09-01 18:55 | - | |
| nodejs-https-proxy-agent/ | 2017-08-02 12:49 | - | |
| nodejs-i/ | 2017-07-31 03:36 | - | |
| nodejs-i2c/ | 2018-10-10 04:18 | - | |
| nodejs-i18n-transform/ | 2017-08-02 12:49 | - | |
| nodejs-iconv-lite/ | 2017-08-02 12:49 | - | |
| nodejs-imurmurhash/ | 2017-08-02 12:49 | - | |
| nodejs-infinity-agent/ | 2017-08-02 12:49 | - | |
| nodejs-inherits/ | 2018-09-01 19:03 | - | |
| nodejs-inherits1/ | 2018-09-01 19:00 | - | |
| nodejs-ini/ | 2018-09-01 19:06 | - | |
| nodejs-init-package-json/ | 2018-09-01 19:08 | - | |
| nodejs-install/ | 2017-08-02 12:49 | - | |
| nodejs-int64-buffer/ | 2017-07-31 03:55 | - | |
| nodejs-ip/ | 2017-08-02 12:49 | - | |
| nodejs-is-arrayish/ | 2017-08-02 12:49 | - | |
| nodejs-is-builtin-module/ | 2017-07-31 04:00 | - | |
| nodejs-is-lower-case/ | 2017-08-02 12:49 | - | |
| nodejs-is-property/ | 2017-08-02 12:49 | - | |
| nodejs-is-stream/ | 2017-08-02 12:49 | - | |
| nodejs-is-typedarray/ | 2017-08-02 12:49 | - | |
| nodejs-is-upper-case/ | 2017-08-02 12:49 | - | |
| nodejs-is-windows/ | 2017-08-02 12:49 | - | |
| nodejs-iso8601/ | 2017-08-02 12:49 | - | |
| nodejs-isodate/ | 2017-08-02 12:49 | - | |
| nodejs-istanbul/ | 2017-08-02 12:49 | - | |
| nodejs-jade/ | 2017-08-02 12:49 | - | |
| nodejs-jasmine-growl-reporter/ | 2017-08-02 12:49 | - | |
| nodejs-jasmine-reporters/ | 2017-08-02 12:49 | - | |
| nodejs-js-yaml/ | 2017-08-02 12:49 | - | |
| nodejs-jscoverage/ | 2017-08-02 12:49 | - | |
| nodejs-json-stringify-safe/ | 2018-09-01 19:11 | - | |
| nodejs-jsonfile/ | 2017-08-02 12:49 | - | |
| nodejs-jsonify/ | 2017-08-02 12:49 | - | |
| nodejs-jsonparse/ | 2017-08-02 12:49 | - | |
| nodejs-jsonpointer/ | 2017-08-02 12:49 | - | |
| nodejs-jsonstream/ | 2017-08-02 12:49 | - | |
| nodejs-jwt-simple/ | 2017-08-02 12:49 | - | |
| nodejs-keypress/ | 2017-08-02 12:49 | - | |
| nodejs-langdetect/ | 2017-08-02 12:49 | - | |
| nodejs-lazystream/ | 2017-08-02 12:49 | - | |
| nodejs-lcov-parse/ | 2017-07-31 04:25 | - | |
| nodejs-less/ | 2018-09-01 19:14 | - | |
| nodejs-lex-parser/ | 2017-08-02 12:49 | - | |
| nodejs-libxmljs/ | 2019-02-22 19:43 | - | |
| nodejs-line-reader/ | 2017-08-02 12:49 | - | |
| nodejs-load-grunt-tasks/ | 2017-08-02 12:49 | - | |
| nodejs-lockfile/ | 2017-08-02 12:49 | - | |
| nodejs-lodash/ | 2017-08-02 12:49 | - | |
| nodejs-log-symbols/ | 2017-08-02 12:49 | - | |
| nodejs-lolex/ | 2017-08-02 12:49 | - | |
| nodejs-lower-case-first/ | 2017-08-02 12:49 | - | |
| nodejs-lower-case/ | 2017-07-31 04:36 | - | |
| nodejs-lowercase-keys/ | 2017-08-02 12:49 | - | |
| nodejs-lru-cache/ | 2018-09-01 19:19 | - | |
| nodejs-ltx/ | 2017-08-02 12:49 | - | |
| nodejs-map-stream/ | 2017-08-02 12:49 | - | |
| nodejs-markdown/ | 2017-08-02 12:49 | - | |
| nodejs-maxmin/ | 2017-08-02 12:49 | - | |
| nodejs-media-typer/ | 2017-08-02 12:49 | - | |
| nodejs-merge-descriptors/ | 2017-08-02 12:49 | - | |
| nodejs-method-override/ | 2017-08-02 12:49 | - | |
| nodejs-methods/ | 2017-08-02 12:49 | - | |
| nodejs-mime-db/ | 2017-08-02 12:49 | - | |
| nodejs-mime/ | 2017-07-31 04:48 | - | |
| nodejs-mimeparse/ | 2017-08-02 12:49 | - | |
| nodejs-minimatch/ | 2018-09-01 19:22 | - | |
| nodejs-minimist/ | 2017-08-02 12:49 | - | |
| nodejs-minstache/ | 2017-08-02 12:49 | - | |
| nodejs-mkdirp/ | 2018-09-01 19:24 | - | |
| nodejs-mkfiletree/ | 2017-08-02 12:49 | - | |
| nodejs-mongodb/ | 2018-09-01 19:27 | - | |
| nodejs-monocle/ | 2017-08-02 12:49 | - | |
| nodejs-morgan/ | 2017-08-02 12:49 | - | |
| nodejs-ms/ | 2017-08-02 12:49 | - | |
| nodejs-multimatch/ | 2017-08-02 12:49 | - | |
| nodejs-multiparty/ | 2017-08-02 12:49 | - | |
| nodejs-mute-stream/ | 2018-09-01 19:30 | - | |
| nodejs-mysql/ | 2018-09-01 19:33 | - | |
| nodejs-nan/ | 2017-07-31 05:16 | - | |
| nodejs-nan0/ | 2017-08-02 12:49 | - | |
| nodejs-nan1/ | 2017-07-31 05:14 | - | |
| nodejs-nano/ | 2017-08-02 12:49 | - | |
| nodejs-ncp/ | 2017-08-02 12:49 | - | |
| nodejs-negotiator/ | 2017-08-02 12:49 | - | |
| nodejs-netmask/ | 2017-08-02 12:49 | - | |
| nodejs-next-tick/ | 2017-08-02 12:49 | - | |
| nodejs-node-expat/ | 2018-10-10 04:22 | - | |
| nodejs-node-int64/ | 2017-08-02 12:49 | - | |
| nodejs-node-print/ | 2017-08-02 12:49 | - | |
| nodejs-node-static/ | 2018-09-01 19:37 | - | |
| nodejs-node-stringprep/ | 2018-10-10 04:24 | - | |
| nodejs-node-uuid/ | 2017-08-02 12:49 | - | |
| nodejs-nomnom/ | 2017-08-02 12:49 | - | |
| nodejs-nopt/ | 2018-09-01 19:42 | - | |
| nodejs-noptify/ | 2017-08-02 12:49 | - | |
| nodejs-normalize-git-url/ | 2018-09-01 19:45 | - | |
| nodejs-normalize-package-data/ | 2018-09-01 19:48 | - | |
| nodejs-normalize-path/ | 2017-08-02 12:49 | - | |
| nodejs-npm-registry-client/ | 2017-08-02 12:49 | - | |
| nodejs-npm-user-validate/ | 2018-09-01 19:54 | - | |
| nodejs-npmconf/ | 2017-08-02 12:49 | - | |
| nodejs-npmlog/ | 2018-09-01 19:51 | - | |
| nodejs-nsp-api/ | 2017-08-02 12:49 | - | |
| nodejs-nsp-audit-shrinkwrap/ | 2017-08-02 12:49 | - | |
| nodejs-nth-check/ | 2017-07-31 05:46 | - | |
| nodejs-oauth-sign/ | 2018-09-01 19:56 | - | |
| nodejs-object-assign/ | 2017-08-02 12:49 | - | |
| nodejs-on-headers/ | 2017-08-02 12:49 | - | |
| nodejs-once/ | 2018-09-01 19:59 | - | |
| nodejs-open/ | 2017-07-31 05:57 | - | |
| nodejs-opener/ | 2018-09-01 20:02 | - | |
| nodejs-optimist/ | 2018-09-01 20:05 | - | |
| nodejs-options/ | 2018-09-01 20:08 | - | |
| nodejs-opts/ | 2018-09-01 20:10 | - | |
| nodejs-osenv/ | 2018-09-01 20:13 | - | |
| nodejs-package-info/ | 2017-08-02 12:49 | - | |
| nodejs-package/ | 2017-07-31 06:09 | - | |
| nodejs-packaging/ | 2016-08-12 01:38 | - | |
| nodejs-paperboy/ | 2017-08-02 12:49 | - | |
| nodejs-param-case/ | 2017-08-02 12:49 | - | |
| nodejs-parse-json/ | 2017-08-02 12:49 | - | |
| nodejs-parserlib/ | 2017-08-02 12:49 | - | |
| nodejs-pascal-case/ | 2017-08-02 12:49 | - | |
| nodejs-path-case/ | 2017-08-02 12:49 | - | |
| nodejs-path-exists/ | 2017-08-02 12:49 | - | |
| nodejs-path-is-inside/ | 2018-09-01 20:16 | - | |
| nodejs-pause-stream/ | 2017-08-02 12:49 | - | |
| nodejs-pause/ | 2017-07-31 06:22 | - | |
| nodejs-pend/ | 2017-08-02 12:49 | - | |
| nodejs-pg/ | 2018-10-10 04:26 | - | |
| nodejs-pinkie-promise/ | 2017-08-02 12:49 | - | |
| nodejs-pinkie/ | 2017-07-31 06:26 | - | |
| nodejs-pkginfo/ | 2017-08-02 12:49 | - | |
| nodejs-posix-getopt/ | 2017-08-02 12:49 | - | |
| nodejs-prepend-http/ | 2017-08-02 12:49 | - | |
| nodejs-pretty-bytes/ | 2017-08-02 12:49 | - | |
| nodejs-private/ | 2017-08-02 12:49 | - | |
| nodejs-promise/ | 2017-08-02 12:49 | - | |
| nodejs-prompt/ | 2017-08-02 12:49 | - | |
| nodejs-promzard/ | 2018-09-01 20:21 | - | |
| nodejs-propagate/ | 2017-08-02 12:49 | - | |
| nodejs-proto-list/ | 2018-09-01 20:24 | - | |
| nodejs-proxy/ | 2017-08-02 12:49 | - | |
| nodejs-pubcontrol/ | 2017-08-02 12:49 | - | |
| nodejs-q-io/ | 2017-08-02 12:49 | - | |
| nodejs-q/ | 2017-07-31 06:42 | - | |
| nodejs-qs/ | 2017-08-02 12:49 | - | |
| nodejs-range-parser/ | 2017-08-02 12:49 | - | |
| nodejs-raw-body/ | 2017-08-02 12:49 | - | |
| nodejs-rc/ | 2017-08-02 12:49 | - | |
| nodejs-read-all-stream/ | 2017-08-02 12:49 | - | |
| nodejs-read-installed/ | 2017-08-02 12:49 | - | |
| nodejs-read-package-json/ | 2017-08-02 12:49 | - | |
| nodejs-read/ | 2018-09-01 20:27 | - | |
| nodejs-readable-stream/ | 2017-08-02 12:49 | - | |
| nodejs-readdirp/ | 2017-08-02 12:49 | - | |
| nodejs-reduce-component/ | 2017-08-02 12:49 | - | |
| nodejs-registry-url/ | 2017-08-02 12:49 | - | |
| nodejs-relateurl/ | 2017-08-02 12:49 | - | |
| nodejs-repl/ | 2018-09-01 20:30 | - | |
| nodejs-replace/ | 2017-08-02 12:49 | - | |
| nodejs-request/ | 2018-09-01 20:32 | - | |
| nodejs-requestretry/ | 2017-08-02 12:49 | - | |
| nodejs-require-all/ | 2018-09-01 20:35 | - | |
| nodejs-require-cs/ | 2017-08-02 12:49 | - | |
| nodejs-require-directory/ | 2017-08-02 12:49 | - | |
| nodejs-require-inject/ | 2018-09-01 20:38 | - | |
| nodejs-require-uncached/ | 2017-08-02 12:49 | - | |
| nodejs-requirejs/ | 2017-08-02 12:49 | - | |
| nodejs-resolve-from/ | 2017-08-02 12:49 | - | |
| nodejs-resolve/ | 2017-07-31 07:21 | - | |
| nodejs-response-time/ | 2017-08-02 12:49 | - | |
| nodejs-retry/ | 2018-09-01 20:41 | - | |
| nodejs-revalidator/ | 2017-08-02 12:49 | - | |
| nodejs-rhea/ | 2018-08-28 22:34 | - | |
| nodejs-rimraf/ | 2018-09-01 20:44 | - | |
| nodejs-ronn/ | 2017-08-02 12:49 | - | |
| nodejs-runforcover/ | 2017-08-02 12:49 | - | |
| nodejs-samsam/ | 2017-08-02 12:49 | - | |
| nodejs-sauce-tunnel/ | 2017-08-02 12:49 | - | |
| nodejs-saucelabs/ | 2017-08-02 12:49 | - | |
| nodejs-sax/ | 2017-08-02 12:49 | - | |
| nodejs-semver/ | 2018-09-01 20:47 | - | |
| nodejs-send/ | 2017-08-02 12:49 | - | |
| nodejs-sentence-case/ | 2017-08-02 12:49 | - | |
| nodejs-seq/ | 2017-08-02 12:49 | - | |
| nodejs-serve-index/ | 2017-08-02 12:49 | - | |
| nodejs-sha/ | 2018-09-01 20:49 | - | |
| nodejs-shelljs/ | 2017-08-02 12:49 | - | |
| nodejs-should/ | 2017-08-02 12:49 | - | |
| nodejs-showdown/ | 2017-08-02 12:49 | - | |
| nodejs-sigmund/ | 2018-09-01 20:53 | - | |
| nodejs-silent-npm-registry-client/ | 2017-08-02 12:49 | - | |
| nodejs-simple-assert/ | 2017-08-02 12:49 | - | |
| nodejs-simple-fmt/ | 2017-08-02 12:49 | - | |
| nodejs-simple-is/ | 2017-08-02 12:49 | - | |
| nodejs-slide/ | 2017-08-02 12:49 | - | |
| nodejs-smart-buffer/ | 2017-08-02 12:49 | - | |
| nodejs-snake-case/ | 2017-08-02 12:49 | - | |
| nodejs-snockets/ | 2017-08-02 12:49 | - | |
| nodejs-sntp/ | 2018-09-01 20:55 | - | |
| nodejs-socks-client/ | 2017-08-02 12:49 | - | |
| nodejs-source-map/ | 2017-08-02 12:49 | - | |
| nodejs-spdx-license-ids/ | 2018-09-01 20:58 | - | |
| nodejs-split/ | 2017-08-02 12:49 | - | |
| nodejs-sprintf/ | 2017-08-02 12:49 | - | |
| nodejs-stable/ | 2017-08-02 12:49 | - | |
| nodejs-stack-trace/ | 2017-08-02 12:49 | - | |
| nodejs-static-favicon/ | 2017-08-02 12:49 | - | |
| nodejs-statuses/ | 2017-08-02 12:49 | - | |
| nodejs-std-mocks/ | 2017-08-02 12:49 | - | |
| nodejs-stream-combiner/ | 2017-08-02 12:49 | - | |
| nodejs-stream-counter/ | 2017-08-02 12:49 | - | |
| nodejs-stream-equal/ | 2017-08-02 12:49 | - | |
| nodejs-stream-reduce/ | 2017-08-02 12:49 | - | |
| nodejs-stream-spigot/ | 2017-08-02 12:49 | - | |
| nodejs-stream-to-array/ | 2017-08-02 12:49 | - | |
| nodejs-streamsink/ | 2017-08-02 12:49 | - | |
| nodejs-stringset/ | 2017-08-02 12:49 | - | |
| nodejs-strip-ansi/ | 2017-08-02 12:49 | - | |
| nodejs-strip-indent/ | 2017-08-02 12:49 | - | |
| nodejs-strip-json-comments/ | 2017-08-02 12:49 | - | |
| nodejs-strip-path/ | 2017-08-02 12:49 | - | |
| nodejs-strscanner/ | 2017-08-02 12:49 | - | |
| nodejs-stylus/ | 2017-08-02 12:49 | - | |
| nodejs-superagent/ | 2017-08-02 12:49 | - | |
| nodejs-supertest/ | 2017-08-02 12:49 | - | |
| nodejs-supervisor/ | 2018-09-01 21:01 | - | |
| nodejs-supports-color/ | 2017-08-02 12:49 | - | |
| nodejs-swap-case/ | 2017-08-02 12:49 | - | |
| nodejs-tap/ | 2017-07-31 08:25 | - | |
| nodejs-tape/ | 2017-08-02 12:49 | - | |
| nodejs-tar/ | 2018-09-01 21:04 | - | |
| nodejs-temp/ | 2017-08-02 12:49 | - | |
| nodejs-test/ | 2017-07-31 08:32 | - | |
| nodejs-testswarm/ | 2017-08-02 12:49 | - | |
| nodejs-through/ | 2017-07-31 08:36 | - | |
| nodejs-through2/ | 2017-08-02 12:49 | - | |
| nodejs-thunkify/ | 2017-08-02 12:49 | - | |
| nodejs-timed-out/ | 2017-08-02 12:49 | - | |
| nodejs-tiny-lr-fork/ | 2017-08-02 12:49 | - | |
| nodejs-tinycolor/ | 2018-09-01 21:06 | - | |
| nodejs-title-case/ | 2017-08-02 12:49 | - | |
| nodejs-transformers/ | 2017-08-02 12:49 | - | |
| nodejs-traverse/ | 2017-08-02 12:49 | - | |
| nodejs-tryor/ | 2017-08-02 12:49 | - | |
| nodejs-tunnel-agent/ | 2018-09-01 21:09 | - | |
| nodejs-type-detect/ | 2017-08-02 12:49 | - | |
| nodejs-typeahead.js/ | 2017-07-31 08:45 | - | |
| nodejs-typedarray/ | 2017-08-02 12:49 | - | |
| nodejs-uglify-to-browserify/ | 2017-08-02 12:49 | - | |
| nodejs-uid-number/ | 2018-09-01 21:12 | - | |
| nodejs-uid2/ | 2017-08-02 12:49 | - | |
| nodejs-ultron/ | 2018-09-01 21:15 | - | |
| nodejs-unc-path-regex/ | 2017-08-02 12:49 | - | |
| nodejs-underscore-dot-logger/ | 2017-08-02 12:49 | - | |
| nodejs-underscore-dot-string/ | 2018-09-01 21:18 | - | |
| nodejs-underscore/ | 2017-07-31 08:59 | - | |
| nodejs-unicode-7.0.0/ | 2017-08-02 12:49 | - | |
| nodejs-unpipe/ | 2017-08-02 12:49 | - | |
| nodejs-upper-case-first/ | 2017-08-02 12:49 | - | |
| nodejs-upper-case/ | 2017-07-31 09:08 | - | |
| nodejs-url-parse-lax/ | 2017-08-02 12:49 | - | |
| nodejs-url2/ | 2017-08-02 12:49 | - | |
| nodejs-util-extend/ | 2017-08-02 12:49 | - | |
| nodejs-util/ | 2017-07-31 09:16 | - | |
| nodejs-utile/ | 2017-08-02 12:49 | - | |
| nodejs-utils-merge/ | 2017-08-02 12:49 | - | |
| nodejs-verror/ | 2017-08-02 12:49 | - | |
| nodejs-vhost/ | 2017-08-02 12:49 | - | |
| nodejs-vow-queue/ | 2017-08-02 12:49 | - | |
| nodejs-vow/ | 2017-07-31 09:20 | - | |
| nodejs-vows/ | 2017-08-02 12:49 | - | |
| nodejs-walkdir/ | 2017-08-02 12:49 | - | |
| nodejs-watchit/ | 2017-08-02 12:49 | - | |
| nodejs-weak-map/ | 2017-08-02 12:49 | - | |
| nodejs-websocket-driver/ | 2017-08-02 12:49 | - | |
| nodejs-when/ | 2017-08-02 12:49 | - | |
| nodejs-which/ | 2018-09-01 21:20 | - | |
| nodejs-winston/ | 2017-08-02 12:49 | - | |
| nodejs-with/ | 2017-08-02 12:49 | - | |
| nodejs-wordwrap/ | 2017-08-02 12:49 | - | |
| nodejs-write-file-atomic/ | 2018-09-01 21:23 | - | |
| nodejs-ws/ | 2018-09-01 21:26 | - | |
| nodejs-xmldom/ | 2017-08-02 12:49 | - | |
| nodejs-xregexp/ | 2017-08-02 12:49 | - | |
| nodejs-xtend/ | 2017-08-02 12:49 | - | |
| nodejs-yamlish/ | 2018-09-01 21:29 | - | |
| nodejs-yargs/ | 2017-08-02 12:49 | - | |
| nodejs-zip-stream/ | 2017-08-02 12:49 | - | |
| nodejs/ | 2019-02-22 19:12 | - | |
| nodeunit/ | 2017-07-31 09:47 | - | |
| nodm/ | 2017-07-31 09:49 | - | |
| noggit/ | 2017-07-31 09:52 | - | |
| noip/ | 2017-07-31 09:57 | - | |
| nomarch/ | 2016-08-12 03:00 | - | |
| nordugrid-arc-doc/ | 2019-02-22 19:48 | - | |
| nordugrid-arc-gangliarc/ | 2017-07-31 10:07 | - | |
| nordugrid-arc-nagios-plugins/ | 2018-08-28 23:22 | - | |
| nordugrid-arc/ | 2019-03-21 04:47 | - | |
| nosync/ | 2017-07-31 10:12 | - | |
| notification-daemon/ | 2018-08-28 23:24 | - | |
| notify-python/ | 2016-08-12 03:04 | - | |
| notify-sharp/ | 2019-03-21 04:49 | - | |
| notify-sharp3/ | 2019-03-21 04:51 | - | |
| nova-agent/ | 2019-02-22 19:58 | - | |
| novnc/ | 2016-08-12 03:05 | - | |
| nqp/ | 2019-02-22 20:01 | - | |
| nrpe/ | 2019-02-22 20:06 | - | |
| nsca/ | 2017-07-31 10:33 | - | |
| nsd/ | 2019-02-22 20:09 | - | |
| nss-mdns/ | 2018-08-28 23:50 | - | |
| nss_wrapper/ | 2019-02-22 20:13 | - | |
| ntfs-3g/ | 2018-08-28 23:53 | - | |
| nudoku/ | 2017-07-31 10:41 | - | |
| nuget/ | 2019-03-21 04:53 | - | |
| nulib2/ | 2018-08-28 23:58 | - | |
| numix-gtk-theme/ | 2019-02-22 20:18 | - | |
| numix-icon-theme-circle/ | 2019-02-22 20:25 | - | |
| numix-icon-theme-square/ | 2019-02-22 20:28 | - | |
| numix-icon-theme/ | 2019-02-22 20:21 | - | |
| nunit/ | 2019-03-21 04:57 | - | |
| nunit2/ | 2019-03-21 04:55 | - | |
| nut/ | 2018-08-29 00:05 | - | |
| nuttcp/ | 2017-07-31 11:03 | - | |
| nv-codec-headers/ | 2018-08-29 00:10 | - | |
| nvidia-query-resource-opengl/ | 2018-08-29 00:12 | - | |
| nvidia-texture-tools/ | 2017-07-31 11:06 | - | |
| nvml/ | 2019-03-21 05:00 | - | |
| nwchem/ | 2019-03-21 05:02 | - | |
| nwipe/ | 2018-08-29 00:19 | - | |
| nx-libs/ | 2019-02-22 20:39 | - | |
| oath-toolkit/ | 2017-07-31 13:18 | - | |
| obconf-qt/ | 2017-08-06 13:26 | - | |
| objenesis/ | 2016-08-12 03:12 | - | |
| ocaml-biniou/ | 2018-09-01 21:52 | - | |
| ocaml-camlidl/ | 2018-08-29 00:33 | - | |
| ocaml-config-file/ | 2016-08-12 03:14 | - | |
| ocaml-cppo/ | 2016-08-12 03:15 | - | |
| ocaml-curl/ | 2018-09-05 12:04 | - | |
| ocaml-easy-format/ | 2018-08-29 00:37 | - | |
| ocaml-lablgl/ | 2018-09-01 21:57 | - | |
| ocaml-lablgtk/ | 2018-09-01 22:00 | - | |
| ocaml-labltk/ | 2018-08-29 00:44 | - | |
| ocaml-lwt/ | 2018-09-01 22:08 | - | |
| ocaml-menhir/ | 2019-02-22 20:52 | - | |
| ocaml-opam-file-format/ | 2018-08-29 00:50 | - | |
| ocaml-ounit/ | 2018-08-29 00:52 | - | |
| ocaml-pcre/ | 2019-02-22 20:58 | - | |
| ocaml-react/ | 2018-08-29 00:55 | - | |
| ocaml-sexplib/ | 2019-02-28 16:12 | - | |
| ocaml-ssl/ | 2018-08-29 00:58 | - | |
| ocaml-type-conv/ | 2019-02-22 21:03 | - | |
| ocaml-xmlm/ | 2018-08-29 01:01 | - | |
| ocaml-yojson/ | 2018-09-01 22:12 | - | |
| oci-kvm-hook/ | 2019-03-21 05:04 | - | |
| ocl-icd/ | 2018-08-29 01:08 | - | |
| ocserv/ | 2019-02-22 21:08 | - | |
| ocsinventory-ipdiscover/ | 2016-08-12 03:25 | - | |
| octave-control/ | 2018-08-29 01:48 | - | |
| octave-general/ | 2018-08-29 01:56 | - | |
| octave-image/ | 2018-09-01 22:17 | - | |
| octave-io/ | 2018-08-29 02:02 | - | |
| octave-netcdf/ | 2018-08-29 02:06 | - | |
| octave-signal/ | 2018-08-29 02:10 | - | |
| octave-statistics/ | 2018-08-29 02:17 | - | |
| octave/ | 2018-08-29 01:16 | - | |
| odb/ | 2017-07-31 14:51 | - | |
| odcs/ | 2019-02-22 21:13 | - | |
| odt2txt/ | 2018-10-10 04:55 | - | |
| offlineimap/ | 2016-08-12 03:33 | - | |
| oflb-asana-math-fonts/ | 2016-08-12 03:33 | - | |
| ogdi/ | 2017-08-06 14:40 | - | |
| oidentd/ | 2017-07-31 14:57 | - | |
| omniORB/ | 2016-08-12 03:34 | - | |
| oneko/ | 2017-07-31 15:00 | - | |
| onesixtyone/ | 2016-08-12 03:35 | - | |
| oniguruma/ | 2016-08-12 03:36 | - | |
| onionshare/ | 2016-08-12 03:37 | - | |
| opari2/ | 2016-08-12 03:38 | - | |
| open-eid/ | 2018-08-29 02:48 | - | |
| open-sendmail/ | 2016-08-12 04:00 | - | |
| open62541/ | 2018-08-29 02:25 | - | |
| openal-soft/ | 2017-08-02 12:49 | - | |
| openarc/ | 2018-10-10 04:58 | - | |
| openarena/ | 2017-07-31 15:02 | - | |
| openbabel/ | 2019-02-22 21:16 | - | |
| openblas-srpm-macros/ | 2017-07-31 15:45 | - | |
| openblas/ | 2019-03-21 05:06 | - | |
| openboardview/ | 2019-02-22 22:12 | - | |
| openbox/ | 2016-08-12 03:42 | - | |
| opencl-filesystem/ | 2017-07-31 15:47 | - | |
| opencl-headers/ | 2018-08-29 02:40 | - | |
| openconnect/ | 2018-08-29 02:45 | - | |
| opencsg/ | 2016-08-12 03:47 | - | |
| opencsv/ | 2016-08-12 03:50 | - | |
| opendbx/ | 2016-08-14 06:55 | - | |
| opendkim/ | 2017-08-02 12:49 | - | |
| opendmarc/ | 2017-07-31 15:58 | - | |
| openfortivpn/ | 2019-02-22 22:19 | - | |
| opengl-games-utils/ | 2017-07-31 16:01 | - | |
| openjpeg2/ | 2018-09-01 22:43 | - | |
| openlibm/ | 2017-07-31 16:06 | - | |
| openlmi-scripts/ | 2016-08-14 06:58 | - | |
| openmeeg/ | 2019-03-21 05:51 | - | |
| openmx/ | 2017-08-02 12:49 | - | |
| openni/ | 2019-02-22 22:35 | - | |
| openocd/ | 2016-08-12 03:56 | - | |
| openpgm/ | 2016-08-12 03:57 | - | |
| openpgpkey-milter/ | 2016-08-12 03:58 | - | |
| openprops/ | 2016-08-12 03:58 | - | |
| openscap-daemon/ | 2018-08-29 02:58 | - | |
| opensips/ | 2019-02-22 22:40 | - | |
| openslide-python/ | 2016-08-12 04:01 | - | |
| openslide/ | 2017-07-31 16:26 | - | |
| opensmtpd/ | 2018-09-05 12:32 | - | |
| openspecfun/ | 2017-07-31 16:33 | - | |
| openssl-pkcs11/ | 2018-08-29 03:04 | - | |
| openstv/ | 2016-08-12 04:03 | - | |
| opentracker/ | 2017-07-31 16:35 | - | |
| opentrep/ | 2019-03-21 06:00 | - | |
| openvas-cli/ | 2018-09-01 22:50 | - | |
| openvas-gsa/ | 2017-08-06 15:25 | - | |
| openvas-libraries/ | 2018-08-29 03:13 | - | |
| openvas-manager/ | 2018-08-29 03:16 | - | |
| openvas-scanner/ | 2017-08-06 15:49 | - | |
| openvpn-auth-ldap/ | 2019-02-22 22:46 | - | |
| openvpn/ | 2019-03-21 06:02 | - | |
| opus-tools/ | 2016-08-12 04:07 | - | |
| opusfile/ | 2016-08-12 04:06 | - | |
| orage/ | 2019-03-21 06:08 | - | |
| orangefs/ | 2018-08-29 03:29 | - | |
| orocos-bfl/ | 2017-07-31 16:55 | - | |
| orthorobot/ | 2018-08-29 03:37 | - | |
| os-maven-plugin/ | 2017-07-31 17:10 | - | |
| osbs-client/ | 2017-07-31 17:05 | - | |
| osbs/ | 2017-07-31 17:03 | - | |
| osm-gps-map/ | 2018-08-29 03:40 | - | |
| osm2pgsql/ | 2017-08-06 16:09 | - | |
| otf2/ | 2016-08-12 04:08 | - | |
| ovirt-engine-cli/ | 2017-07-31 17:20 | - | |
| ovirt-engine-sdk-java/ | 2017-07-31 17:22 | - | |
| ovirt-engine-sdk-python/ | 2018-08-29 03:44 | - | |
| ovirt-guest-agent/ | 2018-08-29 03:47 | - | |
| owncloud-client/ | 2019-03-21 06:10 | - | |
| owncloud/ | 2017-08-06 16:27 | - | |
| oxygen-fonts/ | 2017-08-02 12:49 | - | |
| oz/ | 2017-07-31 17:41 | - | |
| p0f/ | 2017-07-31 17:43 | - | |
| p7zip/ | 2019-02-22 22:54 | - | |
| packETH/ | 2016-08-12 04:15 | - | |
| packagedb-cli/ | 2018-08-29 03:55 | - | |
| packmol/ | 2018-08-29 03:57 | - | |
| pagekite/ | 2018-08-29 04:00 | - | |
| pagila/ | 2017-07-31 17:50 | - | |
| pagul-fonts/ | 2016-08-12 04:16 | - | |
| pagure/ | 2019-02-22 22:59 | - | |
| paho-c/ | 2019-02-22 23:03 | - | |
| pakiti/ | 2016-08-12 04:18 | - | |
| pam-kwallet/ | 2016-08-12 04:19 | - | |
| pam_2fa/ | 2019-02-22 23:07 | - | |
| pam_afs_session/ | 2018-08-29 04:10 | - | |
| pam_mapi/ | 2019-02-22 23:10 | - | |
| pam_mount/ | 2018-08-29 04:14 | - | |
| pam_radius/ | 2016-08-12 04:20 | - | |
| pam_script/ | 2017-07-31 17:56 | - | |
| pam_ssh/ | 2016-08-12 04:21 | - | |
| pam_url/ | 2017-07-31 17:58 | - | |
| pam_wrapper/ | 2019-02-22 23:13 | - | |
| pam_yubico/ | 2019-02-22 23:16 | - | |
| pamtester/ | 2016-08-12 04:22 | - | |
| pan/ | 2018-08-29 04:19 | - | |
| pandoc-citeproc/ | 2019-03-21 06:14 | - | |
| pandoc/ | 2019-03-21 06:12 | - | |
| pangox-compat/ | 2016-08-12 04:24 | - | |
| paper-icon-theme/ | 2018-08-29 04:28 | - | |
| paperkey/ | 2017-07-31 18:08 | - | |
| par2cmdline/ | 2018-08-29 04:33 | - | |
| parallel/ | 2017-07-31 18:13 | - | |
| paraview/ | 2019-02-22 23:22 | - | |
![[DIR]](/icons/script.gif){kind=icon} | parcimonie.sh/ | 2017-07-31 18:17 | - | |
| paris-traceroute/ | 2016-08-12 04:27 | - | |
| parole/ | 2019-03-21 06:16 | - | |
| partclone/ | 2018-08-29 04:39 | - | |
| pass/ | 2018-10-10 05:43 | - | |
| passenger/ | 2017-08-02 12:49 | - | |
| patchelf/ | 2019-02-23 01:57 | - | |
| pavucontrol-qt/ | 2017-08-06 17:03 | - | |
| pax-utils/ | 2018-08-29 04:47 | - | |
| pbuilder/ | 2017-07-31 18:36 | - | |
| pbzip2/ | 2016-08-12 04:28 | - | |
| pcapy/ | 2016-08-12 04:28 | - | |
| pcc/ | 2018-08-29 04:50 | - | |
| pcl/ | 2019-02-28 17:21 | - | |
| pcllib/ | 2016-08-12 04:29 | - | |
| pcmanfm-qt/ | 2019-03-21 06:18 | - | |
| pcre2/ | 2017-07-31 18:48 | - | |
| pcsc-cyberjack/ | 2018-08-29 04:57 | - | |
| pcsc-perl/ | 2017-07-31 18:53 | - | |
| pcsc-tools/ | 2017-07-31 18:56 | - | |
| pdc-client/ | 2018-08-29 05:00 | - | |
| pdc-updater/ | 2019-02-23 02:04 | - | |
| pdf2djvu/ | 2017-08-02 12:49 | - | |
| pdfcrack/ | 2016-08-12 04:32 | - | |
| pdfedit/ | 2016-08-12 04:32 | - | |
| pdfgrep/ | 2019-02-23 02:09 | - | |
| pdns-recursor/ | 2019-03-05 03:12 | - | |
| pdns/ | 2019-02-28 18:46 | - | |
| pdsh/ | 2019-02-23 02:20 | - | |
| pekwm/ | 2017-07-31 19:20 | - | |
| pem/ | 2016-08-12 04:36 | - | |
| pencil/ | 2017-07-31 19:23 | - | |
| percolator/ | 2019-02-23 02:24 | - | |
| percona-xtrabackup/ | 2017-07-31 19:31 | - | |
| perdition/ | 2019-02-23 02:30 | - | |
| perl-Algorithm-C3/ | 2016-08-12 04:39 | - | |
| perl-Algorithm-CheckDigits/ | 2017-07-31 19:46 | - | |
| perl-Algorithm-Dependency/ | 2016-08-12 04:42 | - | |
| perl-Algorithm-LUHN/ | 2016-08-12 04:43 | - | |
| perl-Algorithm-Loops/ | 2018-08-29 05:21 | - | |
| perl-Alien-Packages/ | 2016-08-12 04:44 | - | |
| perl-Any-Moose/ | 2019-02-23 02:35 | - | |
| perl-AnyEvent-AIO/ | 2017-08-06 17:45 | - | |
| perl-AnyEvent-BDB/ | 2017-08-06 17:59 | - | |
| perl-AnyEvent-HTTP/ | 2017-08-06 18:13 | - | |
| perl-AnyEvent-I3/ | 2016-08-12 04:46 | - | |
| perl-AnyEvent/ | 2017-08-06 17:28 | - | |
| perl-Apache-DBI/ | 2016-08-12 04:47 | - | |
| perl-Apache-Htpasswd/ | 2016-08-12 04:48 | - | |
| perl-Apache-LogFormat-Compiler/ | 2017-08-02 12:49 | - | |
| perl-Apache-Session-Browseable/ | 2017-08-02 12:49 | - | |
| perl-Apache-Session-LDAP/ | 2017-08-02 12:49 | - | |
| perl-Apache-Session-NoSQL/ | 2017-08-02 12:49 | - | |
| perl-Apache-Session/ | 2017-07-31 19:59 | - | |
| perl-Apache2-SOAP/ | 2017-08-02 12:49 | - | |
| perl-App-CSV/ | 2019-02-23 02:37 | - | |
| perl-App-Daemon/ | 2019-02-23 02:39 | - | |
| perl-App-FatPacker/ | 2017-07-31 20:15 | - | |
| perl-App-Nopaste/ | 2019-02-23 02:42 | - | |
| perl-App-SVN-Bisect/ | 2017-08-02 12:49 | - | |
| perl-Archive-Any-Lite/ | 2017-08-02 12:49 | - | |
| perl-Archive-Any/ | 2017-07-31 20:20 | - | |
| perl-Archive-Peek/ | 2019-02-23 02:44 | - | |
| perl-Array-Diff/ | 2017-08-02 12:49 | - | |
| perl-Array-Unique/ | 2016-08-12 04:54 | - | |
| perl-Astro-FITS-CFITSIO/ | 2016-08-12 04:55 | - | |
| perl-Astro-SunTime/ | 2017-07-31 20:26 | - | |
| perl-AuthCAS/ | 2016-08-12 04:55 | - | |
| perl-Authen-Captcha/ | 2017-08-02 12:49 | - | |
| perl-Authen-Credential/ | 2016-08-14 07:27 | - | |
| perl-Authen-DecHpwd/ | 2018-09-01 23:36 | - | |
| perl-Authen-DigestMD5/ | 2016-08-12 04:57 | - | |
| perl-Authen-PAM/ | 2016-08-12 04:58 | - | |
| perl-Authen-Passphrase/ | 2018-09-01 23:40 | - | |
| perl-Authen-Radius/ | 2018-08-29 05:39 | - | |
| perl-Authen-Simple-Passwd/ | 2017-08-02 12:49 | - | |
| perl-Authen-Simple/ | 2017-07-31 20:28 | - | |
| perl-B-Compiling/ | 2016-08-12 05:01 | - | |
| perl-B-Hooks-EndOfScope/ | 2016-08-14 07:30 | - | |
| perl-B-Hooks-OP-Annotation/ | 2017-08-02 12:49 | - | |
| perl-B-Hooks-OP-Check/ | 2016-08-14 07:32 | - | |
| perl-B-Hooks-Parser/ | 2017-08-02 12:49 | - | |
| perl-B-Utils/ | 2017-08-02 12:49 | - | |
| perl-BDB/ | 2017-07-31 20:45 | - | |
| perl-BSD-Resource/ | 2016-08-12 05:05 | - | |
| perl-BZ-Client/ | 2017-08-02 12:49 | - | |
| perl-BerkeleyDB/ | 2017-08-02 12:49 | - | |
| perl-Boulder/ | 2017-07-31 20:47 | - | |
| perl-Business-PayPal-API/ | 2017-08-02 12:49 | - | |
| perl-Business-Stripe/ | 2016-08-12 05:06 | - | |
| perl-Bytes-Random-Secure/ | 2017-08-02 12:49 | - | |
| perl-CBOR-XS/ | 2017-08-02 12:49 | - | |
| perl-CDB_File/ | 2016-08-12 05:14 | - | |
| perl-CGI-Application/ | 2017-08-02 12:49 | - | |
| perl-CGI-Compile/ | 2017-08-02 12:49 | - | |
| perl-CGI-Deurl-XS/ | 2016-08-12 05:15 | - | |
| perl-CGI-Emulate-PSGI/ | 2017-08-02 12:49 | - | |
| perl-CGI-FastTemplate/ | 2016-08-12 05:16 | - | |
| perl-CGI-FormBuilder/ | 2017-08-02 12:49 | - | |
| perl-CGI-SpeedyCGI/ | 2016-08-12 05:17 | - | |
| perl-CHI/ | 2019-02-23 02:48 | - | |
| perl-CLASS/ | 2016-08-12 05:19 | - | |
| perl-CPAN-DistnameInfo/ | 2016-08-12 05:38 | - | |
| perl-CPAN-Meta-Check/ | 2016-08-12 05:39 | - | |
| perl-CPAN-Reporter/ | 2016-08-14 07:49 | - | |
| perl-CSS-Minifier/ | 2016-08-12 05:53 | - | |
| perl-CSS-Squish/ | 2016-08-14 08:21 | - | |
| perl-Cache-Cache/ | 2017-08-02 12:49 | - | |
| perl-Cache-FastMmap/ | 2016-08-14 07:35 | - | |
| perl-Cache-Memcached/ | 2016-08-12 05:09 | - | |
| perl-Cairo-GObject/ | 2017-08-06 19:26 | - | |
| perl-Cairo/ | 2017-07-31 20:52 | - | |
| perl-Canary-Stability/ | 2017-07-31 20:57 | - | |
| perl-Carp-Always/ | 2017-08-02 12:49 | - | |
| perl-Carp-Assert/ | 2017-08-02 12:49 | - | |
| perl-Carp-Fix-1_25/ | 2016-08-12 05:12 | - | |
| perl-Cflow/ | 2018-10-10 06:08 | - | |
| perl-Check-ISA/ | 2019-02-23 02:46 | - | |
| perl-Child/ | 2016-08-12 05:18 | - | |
| perl-Class-Accessor-Chained/ | 2017-07-31 21:16 | - | |
| perl-Class-Accessor-Lite/ | 2016-08-12 05:19 | - | |
| perl-Class-Accessor/ | 2017-07-31 21:14 | - | |
| perl-Class-Autouse/ | 2016-08-12 05:20 | - | |
| perl-Class-ErrorHandler/ | 2016-08-12 05:20 | - | |
| perl-Class-Factory-Util/ | 2016-08-12 05:21 | - | |
| perl-Class-Inner/ | 2016-08-12 05:22 | - | |
| perl-Class-Method-Modifiers/ | 2019-02-23 02:50 | - | |
| perl-Class-MethodMaker/ | 2016-08-12 05:22 | - | |
| perl-Class-Mix/ | 2016-08-14 07:39 | - | |
| perl-Class-ReturnValue/ | 2017-07-31 21:20 | - | |
| perl-Class-Std-Fast/ | 2017-07-31 21:26 | - | |
| perl-Class-Std/ | 2017-07-31 21:23 | - | |
| perl-Class-Tiny/ | 2017-07-31 21:29 | - | |
| perl-Class-Virtual/ | 2017-08-02 12:49 | - | |
| perl-Class-XSAccessor/ | 2016-08-12 05:25 | - | |
| perl-Clipboard/ | 2016-08-14 07:40 | - | |
| perl-Clone-PP/ | 2016-08-12 05:26 | - | |
| perl-Compress-LZ4/ | 2017-08-06 19:46 | - | |
| perl-Compress-LZF/ | 2016-08-12 05:27 | - | |
| perl-Compress-Raw-Lzma/ | 2017-07-31 21:36 | - | |
| perl-Config-Any/ | 2017-08-02 12:49 | - | |
| perl-Config-Auto/ | 2016-08-14 07:42 | - | |
| perl-Config-General/ | 2017-07-31 21:38 | - | |
| perl-Config-Generator/ | 2017-08-02 12:49 | - | |
| perl-Config-GitLike/ | 2019-02-23 02:52 | - | |
| perl-Config-Grammar/ | 2017-07-31 21:44 | - | |
| perl-Config-IniFiles/ | 2016-08-12 05:31 | - | |
| perl-Config-Properties/ | 2016-08-12 05:31 | - | |
| perl-Config-Validator/ | 2016-08-14 07:44 | - | |
| perl-ConfigReader/ | 2017-07-31 21:46 | - | |
| perl-Context-Preserve/ | 2016-08-14 07:45 | - | |
| perl-Contextual-Return/ | 2017-08-02 12:49 | - | |
| perl-Convert-ASCII-Armour/ | 2018-08-29 05:47 | - | |
| perl-Convert-BER/ | 2016-08-12 05:35 | - | |
| perl-Convert-Base32/ | 2019-02-23 02:54 | - | |
| perl-Convert-Bencode/ | 2016-08-12 05:35 | - | |
| perl-Convert-BinHex/ | 2016-08-12 05:36 | - | |
| perl-Convert-NLS_DATE_FORMAT/ | 2016-08-12 05:36 | - | |
| perl-Convert-PEM/ | 2016-08-14 07:47 | - | |
| perl-Convert-TNEF/ | 2017-08-02 12:49 | - | |
| perl-Convert-UU/ | 2017-07-31 21:49 | - | |
| perl-Convert-UUlib/ | 2016-08-12 05:38 | - | |
| perl-Coro/ | 2018-09-01 23:49 | - | |
| perl-Cpanel-JSON-XS/ | 2017-08-02 12:49 | - | |
| perl-Crypt-CipherSaber/ | 2016-08-12 05:40 | - | |
| perl-Crypt-Cracklib/ | 2017-07-31 21:55 | - | |
| perl-Crypt-DES_EDE3/ | 2016-08-12 05:41 | - | |
| perl-Crypt-DH-GMP/ | 2019-02-23 02:57 | - | |
| perl-Crypt-DH/ | 2017-08-02 12:49 | - | |
| perl-Crypt-DSA/ | 2016-08-14 07:53 | - | |
| perl-Crypt-ECB/ | 2016-08-12 05:43 | - | |
| perl-Crypt-Eksblowfish/ | 2016-08-14 08:16 | - | |
| perl-Crypt-GeneratePassword/ | 2016-08-12 05:44 | - | |
| perl-Crypt-IDEA/ | 2017-07-31 21:58 | - | |
| perl-Crypt-MySQL/ | 2018-08-29 05:52 | - | |
| perl-Crypt-OpenSSL-X509/ | 2016-08-12 05:44 | - | |
| perl-Crypt-PBKDF2/ | 2019-02-23 03:00 | - | |
| perl-Crypt-PasswdMD5/ | 2018-10-10 06:17 | - | |
| perl-Crypt-RC4/ | 2016-08-12 05:47 | - | |
| perl-Crypt-Random-Seed/ | 2017-08-02 12:49 | - | |
| perl-Crypt-Random-TESHA2/ | 2016-08-14 08:19 | - | |
| perl-Crypt-Rijndael/ | 2016-08-12 05:48 | - | |
| perl-Crypt-SMIME/ | 2017-08-06 20:04 | - | |
| perl-Crypt-Salsa20/ | 2016-08-12 05:49 | - | |
| perl-Crypt-SaltedHash/ | 2016-08-12 05:49 | - | |
| perl-Crypt-ScryptKDF/ | 2016-08-12 05:50 | - | |
| perl-Crypt-SmbHash/ | 2016-08-14 08:20 | - | |
| perl-Crypt-URandom/ | 2016-08-12 05:52 | - | |
| perl-Crypt-UnixCrypt_XS/ | 2018-08-29 05:57 | - | |
| perl-Curses-UI/ | 2017-08-06 20:18 | - | |
| perl-Curses/ | 2017-07-31 22:04 | - | |
| perl-Cwd-Guard/ | 2016-08-12 05:56 | - | |
| perl-DBD-CSV/ | 2017-08-02 12:49 | - | |
| perl-DBD-Firebird/ | 2018-08-29 06:18 | - | |
| perl-DBD-Mock/ | 2016-08-12 06:24 | - | |
| perl-DBD-ODBC/ | 2016-08-12 06:24 | - | |
| perl-DBD-XBase/ | 2016-08-12 06:25 | - | |
| perl-DBIx-Connector/ | 2016-08-14 08:34 | - | |
| perl-DBIx-QueryLog/ | 2019-02-23 03:09 | - | |
| perl-DBIx-RunSQL/ | 2017-08-02 12:49 | - | |
| perl-DBIx-Safe/ | 2016-08-12 06:28 | - | |
| perl-DBM-Deep/ | 2016-08-12 06:28 | - | |
| perl-DB_File-Lock/ | 2016-08-12 06:25 | - | |
| perl-Data-Alias/ | 2016-08-12 05:56 | - | |
| perl-Data-Binary/ | 2019-02-23 03:02 | - | |
| perl-Data-Buffer/ | 2016-08-12 05:58 | - | |
| perl-Data-Compare/ | 2017-08-02 12:49 | - | |
| perl-Data-Dump-Streamer/ | 2017-08-02 12:49 | - | |
| perl-Data-Dump/ | 2017-07-31 22:11 | - | |
| perl-Data-Dumper-Concise/ | 2016-08-12 05:59 | - | |
| perl-Data-Dumper-Names/ | 2016-08-12 05:59 | - | |
| perl-Data-Entropy/ | 2018-08-29 05:59 | - | |
| perl-Data-Faker/ | 2016-08-12 06:00 | - | |
| perl-Data-Float/ | 2018-08-29 06:02 | - | |
| perl-Data-HexDump-XXD/ | 2016-08-12 06:01 | - | |
| perl-Data-HexDump/ | 2018-08-29 06:05 | - | |
| perl-Data-ICal/ | 2017-07-31 22:13 | - | |
| perl-Data-Integer/ | 2018-08-29 06:07 | - | |
| perl-Data-MessagePack/ | 2017-08-02 12:49 | - | |
| perl-Data-Munge/ | 2017-08-02 12:49 | - | |
| perl-Data-Password/ | 2017-07-31 22:15 | - | |
| perl-Data-Record/ | 2016-08-12 06:02 | - | |
| perl-Data-Report/ | 2017-08-02 12:49 | - | |
| perl-Data-Section-Simple/ | 2016-08-12 06:04 | - | |
| perl-Data-Section/ | 2017-07-31 22:20 | - | |
| perl-Data-TreeDumper/ | 2019-02-23 03:05 | - | |
| perl-Data-Tumbler/ | 2016-08-14 08:26 | - | |
| perl-Data-UUID/ | 2016-08-12 06:05 | - | |
| perl-Data-Uniqid/ | 2016-08-12 06:05 | - | |
| perl-Data-Visitor/ | 2019-02-23 03:07 | - | |
| perl-Database-DumpTruck/ | 2016-08-12 05:57 | - | |
| perl-Date-Easter/ | 2016-08-12 06:07 | - | |
| perl-Date-Handler/ | 2016-08-12 06:07 | - | |
| perl-Date-Holidays-DE/ | 2018-08-29 06:12 | - | |
| perl-Date-ICal/ | 2017-08-02 12:49 | - | |
| perl-Date-ISO8601/ | 2016-08-12 06:09 | - | |
| perl-Date-Leapyear/ | 2016-08-12 06:09 | - | |
| perl-Date-Simple/ | 2016-08-12 06:10 | - | |
| perl-DateTime-Calendar-Mayan/ | 2016-08-12 06:10 | - | |
| perl-DateTime-Event-ICal/ | 2017-08-02 12:49 | - | |
| perl-DateTime-Event-Recurrence/ | 2017-08-02 12:49 | - | |
| perl-DateTime-Format-Builder/ | 2016-08-14 08:28 | - | |
| perl-DateTime-Format-Epoch/ | 2016-08-12 06:13 | - | |
| perl-DateTime-Format-Excel/ | 2016-08-12 06:13 | - | |
| perl-DateTime-Format-HTTP/ | 2016-08-12 06:14 | - | |
| perl-DateTime-Format-IBeat/ | 2016-08-12 06:15 | - | |
| perl-DateTime-Format-ISO8601/ | 2017-08-02 12:49 | - | |
| perl-DateTime-Format-Mail/ | 2016-08-12 06:16 | - | |
| perl-DateTime-Format-MySQL/ | 2017-08-02 12:49 | - | |
| perl-DateTime-Format-Oracle/ | 2017-08-02 12:49 | - | |
| perl-DateTime-Format-Pg/ | 2017-08-02 12:49 | - | |
| perl-DateTime-Format-RFC3339/ | 2016-08-12 06:18 | - | |
| perl-DateTime-Format-Strptime/ | 2018-08-29 06:15 | - | |
| perl-DateTime-Format-W3CDTF/ | 2016-08-12 06:19 | - | |
| perl-DateTime-Incomplete/ | 2017-08-02 12:49 | - | |
| perl-DateTime-Precise/ | 2016-08-12 06:20 | - | |
| perl-DateTime-Set/ | 2017-08-02 12:49 | - | |
| perl-DateTime-TimeZone-SystemV/ | 2016-08-14 08:32 | - | |
| perl-DateTime-TimeZone-Tzfile/ | 2017-08-02 12:49 | - | |
| perl-Declare-Constraints-Simple/ | 2016-08-12 06:29 | - | |
| perl-Devel-Autoflush/ | 2016-08-12 06:30 | - | |
| perl-Devel-CallChecker/ | 2016-08-14 08:36 | - | |
| perl-Devel-CallParser/ | 2019-03-21 06:20 | - | |
| perl-Devel-Caller/ | 2016-08-12 06:31 | - | |
| perl-Devel-CheckBin/ | 2016-08-12 06:33 | - | |
| perl-Devel-CheckCompiler/ | 2016-08-12 06:33 | - | |
| perl-Devel-Declare/ | 2017-08-02 12:49 | - | |
| perl-Devel-GlobalDestruction-XS/ | 2016-08-12 06:34 | - | |
| perl-Devel-GlobalDestruction/ | 2017-07-31 22:42 | - | |
| perl-Devel-Hexdump/ | 2016-08-12 06:35 | - | |
| perl-Devel-Hide/ | 2016-08-12 06:36 | - | |
| perl-Devel-LexAlias/ | 2016-08-12 06:36 | - | |
| perl-Devel-NYTProf/ | 2016-08-12 06:37 | - | |
| perl-Devel-OverloadInfo/ | 2017-08-02 12:49 | - | |
| perl-Devel-PartialDump/ | 2019-02-23 03:17 | - | |
| perl-Devel-REPL/ | 2019-02-23 03:19 | - | |
| perl-Devel-Size/ | 2019-02-23 03:21 | - | |
| perl-Devel-StackTrace-AsHTML/ | 2016-08-12 06:40 | - | |
| perl-Devel-StackTrace-WithLexicals/ | 2016-08-12 06:40 | - | |
| perl-Devel-StringInfo/ | 2019-02-23 03:24 | - | |
| perl-Devel-Timer/ | 2016-08-12 06:41 | - | |
| perl-Device-SerialPort/ | 2017-07-31 22:50 | - | |
| perl-Digest-BubbleBabble/ | 2016-08-12 06:42 | - | |
| perl-Digest-CRC/ | 2016-08-12 06:43 | - | |
| perl-Digest-JHash/ | 2017-07-31 22:52 | - | |
| perl-Digest-MD2/ | 2016-08-12 06:43 | - | |
| perl-Digest-MD4/ | 2016-08-12 06:44 | - | |
| perl-Digest-MD5-File/ | 2016-08-12 06:44 | - | |
| perl-Digest-PBKDF2/ | 2019-02-23 03:26 | - | |
| perl-Digest-Perl-MD5/ | 2016-08-12 06:45 | - | |
| perl-Digest-SHA3/ | 2016-08-12 06:46 | - | |
| perl-Directory-Queue/ | 2016-08-14 08:40 | - | |
| perl-Directory-Scratch/ | 2017-08-02 12:49 | - | |
| perl-DynaLoader-Functions/ | 2016-08-12 06:47 | - | |
| perl-EV/ | 2018-08-29 06:36 | - | |
| perl-Email-Abstract/ | 2017-08-02 12:49 | - | |
| perl-Email-Date-Format/ | 2016-08-12 06:49 | - | |
| perl-Email-Find/ | 2017-07-31 22:56 | - | |
| perl-Email-MIME-ContentType/ | 2016-08-12 06:50 | - | |
| perl-Email-MIME-Encodings/ | 2016-08-12 06:50 | - | |
| perl-Email-MIME/ | 2017-07-31 22:59 | - | |
| perl-Email-MessageID/ | 2016-08-12 06:49 | - | |
| perl-Email-Reply/ | 2017-08-02 12:49 | - | |
| perl-Email-Send/ | 2017-08-02 12:49 | - | |
| perl-Email-Sender/ | 2019-02-23 03:28 | - | |
| perl-Email-Simple/ | 2018-08-29 06:33 | - | |
| perl-Email-Valid/ | 2017-08-02 12:49 | - | |
| perl-Encode-DoubleEncodedUTF8/ | 2016-08-12 06:53 | - | |
| perl-Encode-EUCJPASCII/ | 2016-08-12 06:53 | - | |
| perl-Encode-HanExtra/ | 2016-08-12 06:54 | - | |
| perl-Encode-JIS2K/ | 2016-08-12 06:55 | - | |
| perl-Env-Sanctify/ | 2016-08-12 06:56 | - | |
| perl-Eval-Closure/ | 2016-08-12 06:57 | - | |
| perl-Event/ | 2016-08-12 06:57 | - | |
| perl-Excel-Writer-XLSX/ | 2016-08-12 06:58 | - | |
| perl-Exception-Base/ | 2017-08-02 12:49 | - | |
| perl-Exception-Class-TryCatch/ | 2016-08-12 06:59 | - | |
| perl-Expect/ | 2016-08-12 07:01 | - | |
| perl-Exporter-Declare/ | 2016-08-14 08:42 | - | |
| perl-Exporter-Lite/ | 2016-08-12 07:02 | - | |
| perl-Exporter-Tiny/ | 2016-08-12 07:03 | - | |
| perl-ExtUtils-AutoInstall/ | 2016-08-12 07:04 | - | |
| perl-ExtUtils-CChecker/ | 2016-08-12 07:05 | - | |
| perl-ExtUtils-Config/ | 2016-08-12 07:05 | - | |
| perl-ExtUtils-Depends/ | 2016-08-12 07:06 | - | |
| perl-ExtUtils-F77/ | 2016-08-12 07:06 | - | |
| perl-ExtUtils-Helpers/ | 2016-08-12 07:07 | - | |
| perl-ExtUtils-InstallPaths/ | 2017-08-02 12:49 | - | |
| perl-ExtUtils-PkgConfig/ | 2016-08-12 07:08 | - | |
| perl-ExtUtils-XSBuilder/ | 2016-08-12 07:08 | - | |
| perl-ExtUtils-XSpp/ | 2017-07-31 23:06 | - | |
| perl-FCGI-Client/ | 2019-02-23 03:30 | - | |
| perl-FCGI-ProcManager/ | 2016-08-12 07:09 | - | |
| perl-Fennec-Lite/ | 2016-08-12 07:10 | - | |
| perl-Fennec/ | 2017-07-31 23:11 | - | |
| perl-File-BaseDir/ | 2016-08-12 07:11 | - | |
| perl-File-Comments/ | 2017-08-02 12:49 | - | |
| perl-File-ConfigDir/ | 2016-08-12 07:13 | - | |
| perl-File-Copy-Recursive-Reduced/ | 2018-08-29 06:43 | - | |
| perl-File-DesktopEntry/ | 2016-08-12 07:14 | - | |
| perl-File-Edit-Portable/ | 2017-08-02 12:49 | - | |
| perl-File-FcntlLock/ | 2017-07-31 23:17 | - | |
| perl-File-Find-Object-Rule/ | 2017-08-02 12:49 | - | |
| perl-File-Find-Object/ | 2017-07-31 23:19 | - | |
| perl-File-Find-Rule-Age/ | 2016-08-14 08:45 | - | |
| perl-File-Find-Rule-VCS/ | 2016-08-12 07:16 | - | |
| perl-File-FindLib/ | 2016-08-12 07:15 | - | |
| perl-File-Flat/ | 2016-08-12 07:17 | - | |
| perl-File-KeePass/ | 2017-07-31 23:24 | - | |
| perl-File-LibMagic/ | 2016-08-12 07:18 | - | |
| perl-File-MMagic/ | 2016-08-12 07:20 | - | |
| perl-File-Map/ | 2017-08-02 12:49 | - | |
| perl-File-MimeInfo/ | 2016-08-12 07:20 | - | |
| perl-File-NFSLock/ | 2016-08-12 07:22 | - | |
| perl-File-Next/ | 2017-07-31 23:27 | - | |
| perl-File-Pid/ | 2017-07-31 23:29 | - | |
| perl-File-ReadBackwards/ | 2016-08-12 07:22 | - | |
| perl-File-RsyncP/ | 2016-08-12 07:23 | - | |
| perl-File-ShareDir-Install/ | 2016-08-12 07:24 | - | |
| perl-File-Slurp-Tiny/ | 2016-08-12 07:25 | - | |
| perl-File-Spec-Native/ | 2017-08-02 12:49 | - | |
| perl-File-Sync/ | 2016-08-12 07:26 | - | |
| perl-File-Tail/ | 2016-08-12 07:27 | - | |
| perl-File-Tempdir/ | 2016-08-12 07:28 | - | |
| perl-File-Touch/ | 2017-07-31 23:31 | - | |
| perl-File-Type/ | 2016-08-12 07:29 | - | |
| perl-File-chdir/ | 2016-08-12 07:11 | - | |
| perl-File-chmod/ | 2016-08-12 07:12 | - | |
| perl-FileHandle-Unget/ | 2016-08-12 07:17 | - | |
| perl-Filesys-Df/ | 2016-08-12 07:26 | - | |
| perl-Filesys-Notify-Simple/ | 2017-08-02 12:49 | - | |
| perl-Finance-Quote/ | 2018-08-29 06:46 | - | |
| perl-Font-TTFMetrics/ | 2016-08-12 07:31 | - | |
| perl-Frontier-RPC/ | 2016-08-12 07:32 | - | |
| perl-Fsdb/ | 2019-02-23 03:32 | - | |
| perl-Fuse/ | 2019-02-23 03:38 | - | |
| perl-GD-SecurityImage/ | 2017-07-31 23:40 | - | |
| perl-GDGraph/ | 2017-07-31 23:35 | - | |
| perl-GDGraph3d/ | 2017-08-02 12:49 | - | |
| perl-GDTextUtil/ | 2016-08-12 07:33 | - | |
| perl-GTop/ | 2019-02-23 03:47 | - | |
| perl-Geo-IP/ | 2016-08-12 07:34 | - | |
| perl-Geography-Countries/ | 2017-07-31 23:46 | - | |
| perl-Getopt-ArgvFile/ | 2018-08-29 06:57 | - | |
| perl-Getopt-Long-Descriptive/ | 2016-08-12 07:34 | - | |
| perl-Getopt-Simple/ | 2016-08-12 07:35 | - | |
| perl-Git-Wrapper/ | 2017-07-31 23:48 | - | |
| perl-Glib-Object-Introspection/ | 2017-08-06 21:06 | - | |
| perl-Glib/ | 2017-07-31 23:51 | - | |
| perl-GraphViz/ | 2016-08-12 07:36 | - | |
| perl-Gtk2/ | 2018-08-29 06:59 | - | |
| perl-Gtk3-WebKit/ | 2017-08-06 21:29 | - | |
| perl-Gtk3/ | 2019-02-23 03:43 | - | |
| perl-Guard/ | 2016-08-12 07:38 | - | |
| perl-HTML-Element-Extended/ | 2016-08-12 07:42 | - | |
| perl-HTML-Encoding/ | 2016-08-12 07:43 | - | |
| perl-HTML-Entities-Numbered/ | 2016-08-12 07:44 | - | |
| perl-HTML-Form/ | 2016-08-12 07:44 | - | |
| perl-HTML-FromText/ | 2017-08-01 00:06 | - | |
| perl-HTML-PrettyPrinter/ | 2016-08-12 07:45 | - | |
| perl-HTML-Scrubber/ | 2016-08-12 07:45 | - | |
| perl-HTML-Strip/ | 2017-08-01 00:09 | - | |
| perl-HTML-StripScripts-Parser/ | 2017-08-02 12:49 | - | |
| perl-HTML-StripScripts/ | 2017-08-01 00:11 | - | |
| perl-HTML-Table/ | 2017-08-01 00:16 | - | |
| perl-HTML-TableExtract/ | 2016-08-12 07:47 | - | |
| perl-HTML-Template-Pro/ | 2016-08-12 07:47 | - | |
| perl-HTML-Template/ | 2017-08-01 00:18 | - | |
| perl-HTML-Tidy/ | 2017-08-02 12:49 | - | |
| perl-HTTP-Body/ | 2016-08-12 07:49 | - | |
| perl-HTTP-BrowserDetect/ | 2017-08-02 12:49 | - | |
| perl-HTTP-Cache-Transparent/ | 2017-08-01 00:23 | - | |
| perl-HTTP-DAV/ | 2016-08-12 07:50 | - | |
| perl-HTTP-Daemon-SSL/ | 2016-08-12 07:50 | - | |
| perl-HTTP-Exception/ | 2017-08-02 12:49 | - | |
| perl-HTTP-Headers-Fast/ | 2017-08-01 00:29 | - | |
| perl-HTTP-Lite/ | 2018-08-29 07:07 | - | |
| perl-HTTP-Parser/ | 2016-08-12 07:52 | - | |
| perl-HTTP-ProxyAutoConfig/ | 2016-08-12 07:52 | - | |
| perl-HTTP-Request-AsCGI/ | 2017-08-02 12:49 | - | |
| perl-HTTP-Response-Encoding/ | 2016-08-12 07:53 | - | |
| perl-HTTP-Server-Simple-PSGI/ | 2017-08-02 12:49 | - | |
| perl-HTTP-Server-Simple/ | 2017-08-01 00:34 | - | |
| perl-HTTP-Soup/ | 2017-08-06 21:46 | - | |
| perl-Hash-FieldHash/ | 2017-08-02 12:49 | - | |
| perl-Hash-Merge-Simple/ | 2016-08-12 07:39 | - | |
| perl-Hash-MoreUtils/ | 2017-08-01 00:01 | - | |
| perl-Hash-MultiValue/ | 2017-08-02 12:49 | - | |
| perl-Hash-StoredIterator/ | 2017-08-02 12:49 | - | |
| perl-Hash-Util-FieldHash-Compat/ | 2017-08-02 12:49 | - | |
| perl-Heap/ | 2016-08-12 07:42 | - | |
| perl-IO-AIO/ | 2016-08-12 07:58 | - | |
| perl-IO-All/ | 2016-08-14 08:58 | - | |
| perl-IO-Capture/ | 2016-08-12 08:00 | - | |
| perl-IO-Compress-Lzma/ | 2016-08-12 08:01 | - | |
| perl-IO-FDPass/ | 2018-08-29 07:16 | - | |
| perl-IO-Handle-Util/ | 2017-08-02 12:49 | - | |
| perl-IO-Interface/ | 2017-08-01 00:51 | - | |
| perl-IO-LockedFile/ | 2017-08-01 00:53 | - | |
| perl-IO-Multiplex/ | 2016-08-12 08:02 | - | |
| perl-IO-Pipely/ | 2016-08-12 08:02 | - | |
| perl-IO-Pty-Easy/ | 2016-08-12 08:03 | - | |
| perl-IO-SessionData/ | 2016-08-12 08:03 | - | |
| perl-IO-Socket-Multicast/ | 2017-08-06 22:00 | - | |
| perl-IO-Socket-Socks/ | 2018-08-29 07:18 | - | |
| perl-IO-Socket-Timeout/ | 2017-08-02 12:49 | - | |
| perl-IO-Tee/ | 2016-08-12 08:04 | - | |
| perl-IO-TieCombine/ | 2017-08-01 00:57 | - | |
| perl-IPC-ShareLite/ | 2016-08-12 08:07 | - | |
| perl-IPC-Shareable/ | 2016-08-12 08:06 | - | |
| perl-IPC-SharedCache/ | 2017-08-02 12:49 | - | |
| perl-IPC-Signal/ | 2016-08-12 08:07 | - | |
| perl-IPC-System-Simple/ | 2016-08-12 08:08 | - | |
| perl-IPTables-ChainMgr/ | 2018-08-29 07:21 | - | |
| perl-IPTables-Parse/ | 2017-08-01 00:59 | - | |
| perl-IRC-Utils/ | 2016-08-12 08:08 | - | |
| perl-Image-Dot/ | 2016-08-12 07:55 | - | |
| perl-Image-ExifTool/ | 2018-08-29 07:10 | - | |
| perl-Image-Size/ | 2017-08-01 00:43 | - | |
| perl-Image-SubImageFind/ | 2016-08-12 07:56 | - | |
| perl-Import-Into/ | 2016-08-12 07:57 | - | |
| perl-Inline-Python/ | 2016-08-12 07:58 | - | |
| perl-JSON-Any/ | 2019-02-23 03:52 | - | |
| perl-JSON-MaybeXS/ | 2017-08-06 22:15 | - | |
| perl-JSON-RPC/ | 2017-08-02 12:49 | - | |
| perl-JSON-WebToken/ | 2017-08-01 01:08 | - | |
| perl-JSON-XS/ | 2017-08-02 12:49 | - | |
| perl-JavaScript-Minifier/ | 2016-08-12 08:09 | - | |
| perl-Jcode/ | 2016-08-12 08:09 | - | |
| perl-Judy/ | 2017-08-06 22:29 | - | |
| perl-LWP-Authen-Negotiate/ | 2016-08-12 08:23 | - | |
| perl-LWP-Protocol-PSGI/ | 2017-08-02 12:49 | - | |
| perl-LWP-Protocol-http10/ | 2016-08-12 08:24 | - | |
| perl-LWP-Protocol-https/ | 2016-08-12 08:24 | - | |
| perl-LWP-UserAgent-DNS-Hosts/ | 2017-08-01 01:58 | - | |
| perl-LWP-UserAgent-Determined/ | 2017-08-01 01:55 | - | |
| perl-Lexical-Persistence/ | 2016-08-12 08:12 | - | |
| perl-Lexical-SealRequireHints/ | 2016-08-12 08:13 | - | |
| perl-Lexical-Var/ | 2017-08-02 12:49 | - | |
| perl-Lingua-EN-Numbers-Ordinate/ | 2017-08-01 01:15 | - | |
| perl-Lingua-EN-Sentence/ | 2016-08-12 08:15 | - | |
| perl-Lingua-Preferred/ | 2017-08-01 01:18 | - | |
| perl-Lingua-Stem-Snowball/ | 2016-08-12 08:16 | - | |
| perl-Lingua-StopWords/ | 2016-08-12 08:16 | - | |
| perl-Lingua-Translit/ | 2018-08-29 07:26 | - | |
| perl-Linux-Inotify2/ | 2016-08-12 08:17 | - | |
| perl-Linux-Pid/ | 2016-08-12 08:18 | - | |
| perl-List-Compare/ | 2016-08-12 08:18 | - | |
| perl-Locale-Maketext-Lexicon/ | 2018-08-29 07:28 | - | |
| perl-Locale-SubCountry/ | 2017-08-01 01:22 | - | |
| perl-Locale-US/ | 2016-08-12 08:19 | - | |
| perl-LockFile-Simple/ | 2016-08-12 08:19 | - | |
| perl-Log-Any-Adapter-Dispatch/ | 2017-08-02 12:49 | - | |
| perl-Log-Any-Adapter/ | 2017-08-01 01:27 | - | |
| perl-Log-Any/ | 2017-08-01 01:24 | - | |
| perl-Log-Dispatch-Array/ | 2017-08-02 12:49 | - | |
| perl-Log-Dispatch-FileRotate/ | 2017-08-02 12:49 | - | |
| perl-Log-Dispatch/ | 2017-08-01 01:32 | - | |
| perl-Log-Log4perl-Appender-Socket-UNIX/ | 2017-08-02 12:49 | - | |
| perl-Log-Log4perl/ | 2017-08-01 01:39 | - | |
| perl-Log-LogLite/ | 2017-08-01 01:47 | - | |
| perl-Log-TraceMessages/ | 2017-08-01 01:49 | - | |
| perl-Lucy/ | 2017-08-02 12:49 | - | |
| perl-MCE-Shared/ | 2019-02-23 03:58 | - | |
| perl-MCE/ | 2019-02-23 03:56 | - | |
| perl-MIME-Base32/ | 2016-08-12 08:35 | - | |
| perl-MIME-Charset/ | 2016-08-12 08:35 | - | |
| perl-MIME-EncWords/ | 2017-08-02 12:49 | - | |
| perl-MIME-Lite-HTML/ | 2017-08-02 12:49 | - | |
| perl-MIME-Lite/ | 2017-08-01 02:20 | - | |
| perl-MIME-Types/ | 2016-08-12 08:38 | - | |
| perl-MIME-tools/ | 2016-08-12 08:38 | - | |
| perl-MLDBM/ | 2016-08-12 08:39 | - | |
| perl-MRO-Compat/ | 2016-08-12 09:05 | - | |
| perl-Mail-Box/ | 2017-08-06 22:44 | - | |
| perl-Mail-IMAPClient/ | 2016-08-12 08:25 | - | |
| perl-Mail-Mbox-MessageParser/ | 2016-08-12 08:26 | - | |
| perl-Mail-MboxParser/ | 2017-08-02 12:49 | - | |
| perl-Mail-POP3Client/ | 2017-08-01 02:03 | - | |
| perl-Mail-Sender/ | 2017-08-01 02:05 | - | |
| perl-Mail-Sendmail/ | 2016-08-12 08:27 | - | |
| perl-Mail-Transport-Dbx/ | 2017-08-01 02:07 | - | |
| perl-Math-BaseCnv/ | 2016-08-12 08:28 | - | |
| perl-Math-BigInt-GMP/ | 2016-08-12 08:29 | - | |
| perl-Math-Calc-Units/ | 2016-08-12 08:29 | - | |
| perl-Math-GMP/ | 2016-08-12 08:30 | - | |
| perl-Math-Int64/ | 2016-08-12 08:31 | - | |
| perl-Math-Random-ISAAC/ | 2017-08-02 12:49 | - | |
| perl-Math-Random-MT-Auto/ | 2019-03-21 06:24 | - | |
| perl-Math-Round/ | 2016-08-12 08:32 | - | |
| perl-Messaging-Message/ | 2017-08-02 12:49 | - | |
| perl-Meta-Builder/ | 2016-08-12 08:34 | - | |
| perl-MetaCPAN-API-Tiny/ | 2017-08-01 02:18 | - | |
| perl-Mo/ | 2019-02-23 04:00 | - | |
| perl-Mock-Quick/ | 2016-08-14 09:11 | - | |
| perl-Mock-Sub/ | 2018-08-29 07:40 | - | |
| perl-Modern-Perl/ | 2016-08-12 08:41 | - | |
| perl-Module-Build-Tiny/ | 2017-08-02 12:49 | - | |
| perl-Module-Build-XSUtil/ | 2016-08-12 08:42 | - | |
| perl-Module-CPANTS-Analyse/ | 2017-08-02 12:49 | - | |
| perl-Module-CPANfile/ | 2017-08-01 02:29 | - | |
| perl-Module-Extract-Namespaces/ | 2016-08-12 08:43 | - | |
| perl-Module-Extract-Use/ | 2017-08-01 02:35 | - | |
| perl-Module-Extract-VERSION/ | 2016-08-14 09:12 | - | |
| perl-Module-ExtractUse/ | 2017-08-02 12:49 | - | |
| perl-Module-Find/ | 2016-08-12 08:44 | - | |
| perl-Module-Info/ | 2016-08-12 08:45 | - | |
| perl-Module-Install-AuthorTests/ | 2016-08-12 08:45 | - | |
| perl-Module-Install-AutoLicense/ | 2017-08-02 12:49 | - | |
| perl-Module-Install-GithubMeta/ | 2016-08-12 08:47 | - | |
| perl-Module-Install-ReadmeFromPod/ | 2017-08-02 12:49 | - | |
| perl-Module-Install-ReadmeMarkdownFromPod/ | 2016-08-12 08:48 | - | |
| perl-Module-Install-Repository/ | 2016-08-14 09:16 | - | |
| perl-Module-Reader/ | 2017-08-01 02:44 | - | |
| perl-Module-Refresh/ | 2017-08-02 12:49 | - | |
| perl-Module-Versions-Report/ | 2016-08-12 08:50 | - | |
| perl-Mojolicious-Plugin-I18N/ | 2018-08-29 07:46 | - | |
| perl-Mojolicious-Plugin-RenderFile/ | 2018-08-29 07:49 | - | |
| perl-Mojolicious/ | 2019-02-23 04:02 | - | |
| perl-Mon/ | 2017-08-01 02:46 | - | |
| perl-Monitoring-Plugin/ | 2017-08-02 12:49 | - | |
| perl-Monkey-Patch/ | 2018-08-29 07:51 | - | |
| perl-Moose/ | 2019-03-21 06:26 | - | |
| perl-MooseX-Aliases/ | 2019-02-23 04:08 | - | |
| perl-MooseX-AttributeHelpers/ | 2019-02-23 04:10 | - | |
| perl-MooseX-ConfigFromFile/ | 2019-02-23 04:12 | - | |
| perl-MooseX-Daemonize/ | 2019-02-23 04:14 | - | |
| perl-MooseX-Declare/ | 2019-02-23 04:16 | - | |
| perl-MooseX-Getopt/ | 2019-02-23 04:18 | - | |
| perl-MooseX-GlobRef/ | 2019-02-23 04:20 | - | |
| perl-MooseX-InsideOut/ | 2019-02-23 04:22 | - | |
| perl-MooseX-LazyRequire/ | 2019-02-23 04:24 | - | |
| perl-MooseX-Meta-TypeConstraint-ForceCoercion/ | 2019-02-23 04:26 | - | |
| perl-MooseX-Method-Signatures/ | 2019-02-23 04:28 | - | |
| perl-MooseX-NonMoose/ | 2019-02-23 04:30 | - | |
| perl-MooseX-Object-Pluggable/ | 2019-02-23 04:32 | - | |
| perl-MooseX-POE/ | 2019-02-23 04:34 | - | |
| perl-MooseX-Role-Parameterized/ | 2019-02-23 04:36 | - | |
| perl-MooseX-Role-WithOverloading/ | 2019-03-21 06:29 | - | |
| perl-MooseX-SimpleConfig/ | 2019-02-23 04:40 | - | |
| perl-MooseX-Traits/ | 2019-02-23 04:42 | - | |
| perl-MooseX-Types-DateTime/ | 2019-02-23 04:46 | - | |
| perl-MooseX-Types-NetAddr-IP/ | 2019-02-23 04:48 | - | |
| perl-MooseX-Types-Path-Class/ | 2019-02-23 04:50 | - | |
| perl-MooseX-Types-Path-Tiny/ | 2019-02-23 04:52 | - | |
| perl-MooseX-Types-Stringlike/ | 2019-02-23 04:54 | - | |
| perl-MooseX-Types-Structured/ | 2019-02-23 04:56 | - | |
| perl-MooseX-Types/ | 2019-02-23 04:44 | - | |
| perl-Mouse/ | 2019-03-21 06:31 | - | |
| perl-MouseX-ConfigFromFile/ | 2019-02-23 05:01 | - | |
| perl-MouseX-Getopt/ | 2019-02-23 05:02 | - | |
| perl-MouseX-SimpleConfig/ | 2019-02-23 05:05 | - | |
| perl-MouseX-Types-Path-Class/ | 2019-02-23 05:09 | - | |
| perl-MouseX-Types/ | 2019-02-23 05:07 | - | |
| perl-Mozilla-CA/ | 2016-08-12 09:05 | - | |
| perl-NTLM/ | 2016-08-12 09:28 | - | |
| perl-Nagios-Plugin-WWW-Mechanize/ | 2017-08-02 12:49 | - | |
| perl-Nagios-Plugin/ | 2017-08-01 03:51 | - | |
| perl-Net-ARP/ | 2016-08-12 09:08 | - | |
| perl-Net-Amazon-EC2-Metadata/ | 2016-08-12 09:07 | - | |
| perl-Net-CIDR-Lite/ | 2016-08-12 09:08 | - | |
| perl-Net-CIDR/ | 2017-08-01 03:58 | - | |
| perl-Net-CUPS/ | 2016-08-12 09:09 | - | |
| perl-Net-Domain-TLD/ | 2018-08-29 09:01 | - | |
| perl-Net-FTP-AutoReconnect/ | 2016-08-12 09:10 | - | |
| perl-Net-FTP-RetrHandle/ | 2016-08-12 09:11 | - | |
| perl-Net-FTPServer/ | 2016-08-12 09:11 | - | |
| perl-Net-GitHub/ | 2019-02-23 05:13 | - | |
| perl-Net-HL7/ | 2017-08-02 12:49 | - | |
| perl-Net-IDN-Encode/ | 2016-08-12 09:13 | - | |
| perl-Net-INET6Glue/ | 2016-08-12 09:14 | - | |
| perl-Net-IP-CMatch/ | 2016-08-12 09:14 | - | |
| perl-Net-IP-Match-Regexp/ | 2016-08-12 09:15 | - | |
| perl-Net-IP-Minimal/ | 2016-08-12 09:15 | - | |
| perl-Net-IP/ | 2017-08-01 04:02 | - | |
| perl-Net-IPv4Addr/ | 2016-08-12 09:16 | - | |
| perl-Net-Jabber/ | 2017-08-02 12:49 | - | |
| perl-Net-MQTT-Simple/ | 2018-08-29 09:06 | - | |
| perl-Net-NBName/ | 2016-08-12 09:17 | - | |
| perl-Net-Netmask/ | 2016-08-12 09:18 | - | |
| perl-Net-OAuth/ | 2017-08-02 12:49 | - | |
| perl-Net-OpenID-Common/ | 2019-02-23 05:15 | - | |
| perl-Net-OpenID-Consumer/ | 2019-02-23 05:18 | - | |
| perl-Net-OpenID-Server/ | 2019-02-23 05:21 | - | |
| perl-Net-OpenSSH/ | 2016-08-12 09:19 | - | |
| perl-Net-POP3S/ | 2016-08-12 09:21 | - | |
| perl-Net-Patricia/ | 2016-08-12 09:20 | - | |
| perl-Net-Pcap-Easy/ | 2017-08-07 00:11 | - | |
| perl-Net-Pcap/ | 2017-08-01 04:07 | - | |
| perl-Net-SFTP-Foreign/ | 2017-08-01 04:11 | - | |
| perl-Net-SMTPS/ | 2016-08-12 09:22 | - | |
| perl-Net-SNMP/ | 2016-08-12 09:23 | - | |
| perl-Net-SSH/ | 2018-08-29 09:09 | - | |
| perl-Net-SSLGlue/ | 2017-08-01 04:14 | - | |
| perl-Net-STOMP-Client/ | 2017-08-02 12:49 | - | |
| perl-Net-Server/ | 2016-08-12 09:22 | - | |
| perl-Net-Statsd/ | 2016-08-12 09:24 | - | |
| perl-Net-Twitter-Lite/ | 2017-08-02 12:49 | - | |
| perl-Net-UPnP/ | 2017-08-01 04:22 | - | |
| perl-Net-Whois-IP/ | 2017-08-01 04:24 | - | |
| perl-Net-Whois-Raw/ | 2016-08-14 09:38 | - | |
| perl-Net-XMPP/ | 2017-08-02 12:49 | - | |
| perl-NetPacket/ | 2016-08-12 09:20 | - | |
| perl-Nmap-Parser/ | 2018-08-29 09:11 | - | |
| perl-No-Worries/ | 2018-08-29 09:14 | - | |
| perl-Number-Bytes-Human/ | 2017-08-01 04:29 | - | |
| perl-Number-Format/ | 2016-08-12 09:29 | - | |
| perl-OLE-Storage_Lite/ | 2016-08-12 09:32 | - | |
| perl-Object-ID/ | 2017-08-02 12:49 | - | |
| perl-Object-InsideOut/ | 2019-02-23 05:24 | - | |
| perl-Object-MultiType/ | 2016-08-12 09:31 | - | |
| perl-Object-Pluggable/ | 2016-08-12 09:31 | - | |
| perl-Object-Realize-Later/ | 2017-08-01 04:35 | - | |
| perl-OpenGL/ | 2016-08-12 09:32 | - | |
| perl-PAR-Packer/ | 2018-08-29 09:21 | - | |
| perl-PAR/ | 2018-08-29 09:19 | - | |
| perl-PDF-API2/ | 2016-08-12 09:42 | - | |
| perl-PDL/ | 2019-03-21 06:33 | - | |
| perl-PHP-Serialization/ | 2017-08-01 05:03 | - | |
| perl-POE-Component-Client-DNS/ | 2017-08-07 01:38 | - | |
| perl-POE-Component-Client-HTTP/ | 2017-08-07 01:52 | - | |
| perl-POE-Component-Client-Keepalive/ | 2017-08-07 02:07 | - | |
| perl-POE-Component-Client-Ping/ | 2017-08-07 02:22 | - | |
| perl-POE-Component-IRC/ | 2017-08-07 02:36 | - | |
| perl-POE-Component-Resolver/ | 2017-08-07 02:51 | - | |
| perl-POE-Component-SSLify/ | 2017-08-07 03:10 | - | |
| perl-POE-Component-Server-SOAP/ | 2019-02-23 05:38 | - | |
| perl-POE-Component-Server-SimpleHTTP/ | 2019-02-23 05:36 | - | |
| perl-POE-Component-Syndicator/ | 2017-08-07 03:26 | - | |
| perl-POE-Filter-HTTP-Parser/ | 2017-08-07 03:40 | - | |
| perl-POE-Filter-IRCD/ | 2017-08-07 03:56 | - | |
| perl-POE-Filter-Zlib/ | 2017-08-07 04:11 | - | |
| perl-POE-Loop-Event/ | 2017-08-07 04:26 | - | |
| perl-POE-Test-Loops/ | 2017-08-07 04:41 | - | |
| perl-POE/ | 2017-08-07 01:22 | - | |
| perl-POSIX-strptime/ | 2016-08-12 10:00 | - | |
| perl-PSGI/ | 2016-08-12 10:04 | - | |
| perl-Package-Anon/ | 2016-08-12 09:33 | - | |
| perl-Pango/ | 2017-08-07 00:27 | - | |
| perl-Parallel-ForkManager/ | 2017-08-02 12:49 | - | |
| perl-Parallel-Runner/ | 2016-08-12 09:35 | - | |
| perl-Params-Classify/ | 2016-08-12 09:36 | - | |
| perl-Params-Coerce/ | 2016-08-12 09:37 | - | |
| perl-Parse-CPAN-Packages-Fast/ | 2016-08-12 09:38 | - | |
| perl-Parse-CPAN-Packages/ | 2019-02-23 05:26 | - | |
| perl-Parse-DMIDecode/ | 2017-08-01 04:47 | - | |
| perl-Parse-DebControl/ | 2017-08-01 04:45 | - | |
| perl-Parse-Debian-Packages/ | 2016-08-12 09:38 | - | |
| perl-Parse-EDID/ | 2018-09-02 01:39 | - | |
| perl-Parse-Gitignore/ | 2017-08-07 00:45 | - | |
| perl-Parse-Method-Signatures/ | 2019-02-23 05:28 | - | |
| perl-Path-Class/ | 2016-08-12 09:41 | - | |
| perl-Path-Tiny/ | 2017-08-07 01:02 | - | |
| perl-Perl-Destruct-Level/ | 2016-08-12 09:44 | - | |
| perl-Perl6-Caller/ | 2016-08-12 09:43 | - | |
| perl-PerlIO-Layers/ | 2016-08-12 09:46 | - | |
| perl-PerlIO-buffersize/ | 2016-08-12 09:45 | - | |
| perl-PerlIO-gzip/ | 2016-08-12 09:46 | - | |
| perl-PerlIO-via-Timeout/ | 2017-08-02 12:49 | - | |
| perl-Plack-Middleware-FixMissingBodyInRedirect/ | 2017-08-02 12:49 | - | |
| perl-Plack-Middleware-RemoveRedundantBody/ | 2017-08-02 12:49 | - | |
| perl-Plack/ | 2019-02-23 05:34 | - | |
| perl-Pod-Markdown/ | 2016-08-12 09:49 | - | |
| perl-Pod-Readme/ | 2016-08-14 09:43 | - | |
| perl-Pod-Snippets/ | 2016-08-12 09:50 | - | |
| perl-Pod-Strip/ | 2016-08-12 09:50 | - | |
| perl-Pod-Tests/ | 2016-08-12 09:51 | - | |
| perl-Prima/ | 2016-08-12 10:00 | - | |
| perl-Proc-Daemon/ | 2017-08-02 12:49 | - | |
| perl-Proc-PID-File/ | 2016-08-12 10:02 | - | |
| perl-Proc-ProcessTable/ | 2016-08-12 10:02 | - | |
| perl-Proc-Queue/ | 2018-08-29 09:43 | - | |
| perl-Proc-WaitStat/ | 2016-08-12 10:03 | - | |
| perl-Protocol-WebSocket/ | 2016-08-12 10:03 | - | |
| perl-Qt/ | 2019-02-23 05:40 | - | |
| perl-REST-Client/ | 2017-08-02 12:49 | - | |
| perl-RPC-XML/ | 2017-08-02 12:49 | - | |
| perl-RPM2/ | 2018-08-29 09:52 | - | |
| perl-Razor-Agent/ | 2016-08-12 10:04 | - | |
| perl-Redis/ | 2019-02-23 05:46 | - | |
| perl-Ref-Util-XS/ | 2017-08-01 05:51 | - | |
| perl-Ref-Util/ | 2017-08-07 04:59 | - | |
| perl-Regexp-Assemble/ | 2016-08-14 09:53 | - | |
| perl-Regexp-Common/ | 2016-08-12 10:06 | - | |
| perl-Regexp-Grammars/ | 2019-02-23 05:50 | - | |
| perl-Regexp-IPv6/ | 2016-08-12 10:08 | - | |
| perl-Return-MultiLevel/ | 2017-08-02 12:49 | - | |
| perl-Return-Value/ | 2016-08-12 10:09 | - | |
| perl-Role-Tiny/ | 2017-08-02 12:49 | - | |
| perl-Rose-DB-Object/ | 2017-08-02 12:49 | - | |
| perl-Rose-DB/ | 2017-08-01 06:01 | - | |
| perl-Rose-DateTime/ | 2017-08-02 12:49 | - | |
| perl-Rose-Object/ | 2016-08-12 10:11 | - | |
| perl-Router-Simple/ | 2016-08-12 10:12 | - | |
| perl-SGML-Parser-OpenSP/ | 2017-08-02 12:49 | - | |
| perl-SNMP-Info/ | 2016-08-12 10:19 | - | |
| perl-SNMP-Simple/ | 2016-08-12 10:20 | - | |
| perl-SOAP-Lite/ | 2016-08-12 10:20 | - | |
| perl-SOAP-WSDL/ | 2017-08-01 06:21 | - | |
| perl-SOCKS/ | 2016-08-12 10:22 | - | |
| perl-SQL-ReservedWords/ | 2016-08-12 10:27 | - | |
| perl-SQL-Statement/ | 2017-08-02 12:49 | - | |
| perl-SUPER/ | 2017-08-02 12:49 | - | |
| perl-Safe-Isa/ | 2016-08-12 10:13 | - | |
| perl-Scalar-Properties/ | 2017-08-02 12:49 | - | |
| perl-Scalar-String/ | 2018-08-29 09:55 | - | |
| perl-Schedule-Cron-Events/ | 2016-08-14 09:58 | - | |
| perl-Schedule-Cron/ | 2019-02-23 05:53 | - | |
| perl-Schedule-RateLimiter/ | 2016-08-12 10:14 | - | |
| perl-Scope-Guard/ | 2016-08-12 10:15 | - | |
| perl-Sereal-Decoder/ | 2019-03-21 06:37 | - | |
| perl-Sereal-Encoder/ | 2019-03-21 06:39 | - | |
| perl-Sereal/ | 2019-02-23 05:56 | - | |
| perl-Set-Crontab/ | 2016-08-12 10:17 | - | |
| perl-Set-Infinite/ | 2016-08-12 10:17 | - | |
| perl-Set-Scalar/ | 2016-08-12 10:18 | - | |
| perl-Socket-GetAddrInfo/ | 2016-08-12 10:21 | - | |
| perl-Software-License-CCpack/ | 2017-08-02 12:49 | - | |
| perl-Software-License/ | 2017-08-01 06:25 | - | |
| perl-Sort-Key/ | 2017-08-01 06:30 | - | |
| perl-Sort-Maker/ | 2016-08-12 10:23 | - | |
| perl-Sort-MergeSort/ | 2016-08-12 10:23 | - | |
| perl-Sort-Naturally/ | 2016-08-12 10:24 | - | |
| perl-Spiffy/ | 2016-08-12 10:24 | - | |
| perl-Spreadsheet-ParseExcel/ | 2017-08-02 12:49 | - | |
| perl-Spreadsheet-WriteExcel/ | 2016-08-12 10:26 | - | |
| perl-Spreadsheet-XLSX/ | 2017-08-02 12:49 | - | |
| perl-Statistics-Basic/ | 2016-08-12 10:28 | - | |
| perl-Statistics-Descriptive/ | 2018-08-29 10:04 | - | |
| perl-Stream-Buffered/ | 2016-08-12 10:29 | - | |
| perl-String-Escape/ | 2016-08-12 10:30 | - | |
| perl-String-Random/ | 2016-08-12 10:30 | - | |
| perl-String-RewritePrefix/ | 2017-08-01 06:36 | - | |
| perl-Sub-Delete/ | 2018-08-29 10:07 | - | |
| perl-Sub-Exporter-Progressive/ | 2016-08-12 10:31 | - | |
| perl-Sub-Identify/ | 2016-08-12 10:31 | - | |
| perl-Sub-Name/ | 2016-08-12 10:32 | - | |
| perl-Sub-Override/ | 2018-08-29 10:09 | - | |
| perl-Symbol-Util/ | 2016-08-12 10:33 | - | |
| perl-Sys-Detect-Virtualization/ | 2016-08-12 10:34 | - | |
| perl-Sys-Hostname-Long/ | 2016-08-12 10:34 | - | |
| perl-Sys-Mmap/ | 2017-08-01 06:41 | - | |
| perl-Sys-SigAction/ | 2016-08-12 10:35 | - | |
| perl-Sys-Statistics-Linux/ | 2019-02-23 06:02 | - | |
| perl-Sys-Syscall/ | 2016-08-12 10:36 | - | |
| perl-Sysadm-Install/ | 2017-08-02 12:49 | - | |
| perl-TAP-Harness-Env/ | 2016-08-12 10:38 | - | |
| perl-TAP-Harness-JUnit/ | 2016-08-12 10:38 | - | |
| perl-Taint-Util/ | 2016-08-12 10:37 | - | |
| perl-Tangerine/ | 2017-08-01 06:44 | - | |
| perl-TeX-Hyphen/ | 2016-08-12 11:15 | - | |
| perl-Template-GD/ | 2017-08-02 12:49 | - | |
| perl-Term-Encoding/ | 2016-08-12 10:39 | - | |
| perl-Term-ProgressBar/ | 2017-08-01 06:49 | - | |
| perl-Term-ReadLine-Gnu/ | 2016-08-12 10:40 | - | |
| perl-Term-ReadPassword/ | 2018-08-29 10:14 | - | |
| perl-Term-ShellUI/ | 2016-08-12 10:41 | - | |
| perl-Term-Size/ | 2016-08-12 10:42 | - | |
| perl-Test-API/ | 2016-08-12 10:42 | - | |
| perl-Test-Assert/ | 2017-08-02 12:49 | - | |
| perl-Test-Base/ | 2016-08-12 10:43 | - | |
| perl-Test-CPAN-Meta-JSON/ | 2016-08-12 10:49 | - | |
| perl-Test-CPAN-Meta-YAML/ | 2017-08-02 12:49 | - | |
| perl-Test-Carp/ | 2016-08-12 10:44 | - | |
| perl-Test-CheckChanges/ | 2016-08-12 10:44 | - | |
| perl-Test-CheckDeps/ | 2016-08-12 10:45 | - | |
| perl-Test-CheckManifest/ | 2016-08-12 10:46 | - | |
| perl-Test-Class/ | 2017-08-02 12:49 | - | |
| perl-Test-CleanNamespaces/ | 2019-02-23 06:04 | - | |
| perl-Test-Command/ | 2016-08-12 10:47 | - | |
| perl-Test-Compile/ | 2017-08-02 12:49 | - | |
| perl-Test-ConsistentVersion/ | 2017-08-02 12:49 | - | |
| perl-Test-Dependencies/ | 2017-08-07 05:23 | - | |
| perl-Test-Distribution/ | 2016-08-12 10:50 | - | |
| perl-Test-Email/ | 2017-08-01 07:04 | - | |
| perl-Test-FailWarnings/ | 2016-08-12 10:50 | - | |
| perl-Test-Fake-HTTPD/ | 2017-08-02 12:49 | - | |
| perl-Test-File-Contents/ | 2016-08-12 10:52 | - | |
| perl-Test-File/ | 2017-08-01 07:10 | - | |
| perl-Test-Inline/ | 2016-08-12 10:52 | - | |
| perl-Test-Kwalitee-Extra/ | 2017-08-02 12:49 | - | |
| perl-Test-Kwalitee/ | 2017-08-01 07:12 | - | |
| perl-Test-LeakTrace/ | 2017-08-02 12:49 | - | |
| perl-Test-LoadAllModules/ | 2016-08-12 10:54 | - | |
| perl-Test-Log-Dispatch/ | 2017-08-01 07:18 | - | |
| perl-Test-LongString/ | 2016-08-12 10:54 | - | |
| perl-Test-Mock-Guard/ | 2017-08-01 07:20 | - | |
| perl-Test-Mock-LWP/ | 2016-08-12 10:55 | - | |
| perl-Test-MockModule/ | 2016-08-12 10:56 | - | |
| perl-Test-MockTime/ | 2016-08-12 10:56 | - | |
| perl-Test-Mojibake/ | 2017-08-02 12:49 | - | |
| perl-Test-Most/ | 2016-08-12 10:58 | - | |
| perl-Test-NeedsDisplay/ | 2016-08-12 10:59 | - | |
| perl-Test-Number-Delta/ | 2016-08-12 10:59 | - | |
| perl-Test-POE-Client-TCP/ | 2017-08-07 05:39 | - | |
| perl-Test-POE-Server-TCP/ | 2017-08-07 05:54 | - | |
| perl-Test-Pod-Content/ | 2017-08-02 12:49 | - | |
| perl-Test-PostgreSQL/ | 2017-08-02 12:49 | - | |
| perl-Test-Prereq/ | 2016-08-12 11:02 | - | |
| perl-Test-Regexp/ | 2016-08-12 11:02 | - | |
| perl-Test-Reporter/ | 2016-08-12 11:04 | - | |
| perl-Test-RequiresInternet/ | 2016-08-12 11:05 | - | |
| perl-Test-SQL-Data/ | 2018-08-29 10:19 | - | |
| perl-Test-SharedFork/ | 2016-08-12 11:05 | - | |
| perl-Test-Signature/ | 2016-08-12 11:06 | - | |
| perl-Test-TCP/ | 2017-08-02 12:49 | - | |
| perl-Test-TinyMocker/ | 2016-08-12 11:07 | - | |
| perl-Test-TrailingSpace/ | 2017-08-02 12:49 | - | |
| perl-Test-Trap/ | 2017-08-02 12:49 | - | |
| perl-Test-Unit-Lite/ | 2016-08-12 11:09 | - | |
| perl-Test-Unit-Runner-Xml/ | 2017-08-02 12:49 | - | |
| perl-Test-Unit/ | 2017-08-01 07:41 | - | |
| perl-Test-UseAllModules/ | 2016-08-12 11:10 | - | |
| perl-Test-Valgrind/ | 2016-08-12 11:11 | - | |
| perl-Test-Version/ | 2016-08-12 11:12 | - | |
| perl-Test-WWW-Selenium/ | 2016-08-12 11:13 | - | |
| perl-Test-Warnings/ | 2017-08-02 12:49 | - | |
| perl-Test-XML/ | 2016-08-14 10:14 | - | |
| perl-Test-YAML-Valid/ | 2017-08-02 12:49 | - | |
| perl-Test-mysqld/ | 2017-08-02 12:49 | - | |
| perl-Test-use-ok/ | 2016-08-12 11:11 | - | |
| perl-Text-ASCIITable/ | 2016-08-12 11:16 | - | |
| perl-Text-Aligner/ | 2016-08-12 11:16 | - | |
| perl-Text-Autoformat/ | 2017-08-02 12:49 | - | |
| perl-Text-CSV-Separator/ | 2016-08-12 11:17 | - | |
| perl-Text-CSV/ | 2017-08-01 07:46 | - | |
| perl-Text-Format/ | 2017-08-02 12:49 | - | |
| perl-Text-Fuzzy/ | 2017-08-01 07:51 | - | |
| perl-Text-Haml/ | 2018-08-29 10:22 | - | |
| perl-Text-Levenshtein-Damerau-XS/ | 2016-08-12 11:19 | - | |
| perl-Text-Markdown/ | 2017-08-02 12:49 | - | |
| perl-Text-Patch/ | 2016-08-12 11:20 | - | |
| perl-Text-Reform/ | 2016-08-12 11:20 | - | |
| perl-Text-Table-Tiny/ | 2016-08-12 11:21 | - | |
| perl-Text-Template/ | 2016-08-12 11:22 | - | |
| perl-Text-Xslate/ | 2019-03-21 06:41 | - | |
| perl-Text-vFile-asData/ | 2017-08-01 07:53 | - | |
| perl-Throwable/ | 2019-02-23 06:08 | - | |
| perl-Tie-Cache/ | 2016-08-12 11:23 | - | |
| perl-Tie-Hash-Method/ | 2016-08-12 11:23 | - | |
| perl-Tie-RefHash-Weak/ | 2016-08-14 10:18 | - | |
| perl-Tie-ToObject/ | 2016-08-12 11:24 | - | |
| perl-Time-Clock/ | 2016-08-12 11:25 | - | |
| perl-Time-Duration-Parse/ | 2017-08-02 12:49 | - | |
| perl-Time-Duration/ | 2017-08-01 07:57 | - | |
| perl-Time-Mock/ | 2016-08-12 11:26 | - | |
| perl-Time-Moment/ | 2019-03-21 06:43 | - | |
| perl-Time-Out/ | 2016-08-12 11:27 | - | |
| perl-Time-ParseDate/ | 2016-08-12 11:28 | - | |
| perl-Time-Period/ | 2016-08-12 11:29 | - | |
| perl-Time-TAI64/ | 2016-08-12 11:29 | - | |
| perl-Time-timegm/ | 2016-08-12 11:30 | - | |
| perl-Time-y2038/ | 2016-08-12 11:30 | - | |
| perl-Tk-Canvas-GradientColor/ | 2018-08-29 10:31 | - | |
| perl-Tk-ColoredButton/ | 2018-08-29 10:34 | - | |
| perl-Tk-EntryCheck/ | 2018-08-29 10:37 | - | |
| perl-Tk-Getopt/ | 2018-08-29 10:40 | - | |
| perl-Tk-Pod/ | 2018-08-29 10:42 | - | |
| perl-Tk-TableMatrix/ | 2017-08-01 08:03 | - | |
| perl-Tk-Text-SuperText/ | 2016-08-12 11:31 | - | |
| perl-Tree-R/ | 2016-08-12 11:31 | - | |
| perl-Types-Serialiser/ | 2016-08-12 11:33 | - | |
| perl-UNIVERSAL-ref/ | 2017-08-02 12:49 | - | |
| perl-UNIVERSAL-require/ | 2016-08-12 11:36 | - | |
| perl-URI-Encode/ | 2016-08-12 11:37 | - | |
| perl-URI-Find/ | 2016-08-12 11:38 | - | |
| perl-URL-Encode-XS/ | 2016-08-12 11:38 | - | |
| perl-Unicode-CheckUTF8/ | 2016-08-12 11:34 | - | |
| perl-Unicode-LineBreak/ | 2019-02-23 06:13 | - | |
| perl-Unicode-Map/ | 2016-08-12 11:35 | - | |
| perl-Unicode-MapUTF8/ | 2017-08-01 08:08 | - | |
| perl-Unicode-UTF8/ | 2017-08-02 12:49 | - | |
| perl-Unix-Syslog/ | 2016-08-12 11:37 | - | |
| perl-User-Identity/ | 2017-08-01 08:14 | - | |
| perl-User/ | 2016-08-12 11:39 | - | |
| perl-Variable-Magic/ | 2016-08-12 11:40 | - | |
| perl-WWW-GoodData/ | 2016-08-12 11:42 | - | |
| perl-WWW-Mechanize-GZip/ | 2017-08-02 12:49 | - | |
| perl-WWW-Mechanize/ | 2017-08-01 08:16 | - | |
| perl-WWW-Pastebin-PastebinCom-Create/ | 2017-08-02 12:49 | - | |
| perl-WWW-Shorten/ | 2016-08-14 10:24 | - | |
| perl-WWW-Splunk/ | 2017-08-02 12:49 | - | |
| perl-WWW-Twilio-API/ | 2016-08-12 11:45 | - | |
| perl-WWW-Twilio-TwiML/ | 2016-08-12 11:45 | - | |
| perl-Want/ | 2016-08-12 11:41 | - | |
| perl-WebService-Linode/ | 2017-08-02 12:49 | - | |
| perl-X10/ | 2017-08-01 08:27 | - | |
| perl-X11-GUITest/ | 2016-08-12 11:46 | - | |
| perl-X11-Protocol/ | 2016-08-12 11:46 | - | |
| perl-XML-Entities/ | 2016-08-12 11:47 | - | |
| perl-XML-Generator-DBI/ | 2016-08-12 11:47 | - | |
| perl-XML-Generator/ | 2017-08-01 08:30 | - | |
| perl-XML-Hash-LX/ | 2017-08-01 08:32 | - | |
| perl-XML-Merge/ | 2016-08-14 10:26 | - | |
| perl-XML-RSS/ | 2016-08-12 11:50 | - | |
| perl-XML-SemanticDiff/ | 2018-08-29 10:48 | - | |
| perl-XML-Simple-DTDReader/ | 2016-08-12 11:51 | - | |
| perl-XML-Smart/ | 2016-08-12 11:51 | - | |
| perl-XML-Stream/ | 2016-08-12 11:52 | - | |
| perl-XML-Tidy/ | 2016-08-12 11:52 | - | |
| perl-XML-TreePP/ | 2016-08-12 11:53 | - | |
| perl-XMLRPC-Lite/ | 2017-08-02 12:49 | - | |
| perl-YAML-LibYAML/ | 2016-08-12 11:53 | - | |
| perl-ZMQ-Constants/ | 2016-08-12 11:54 | - | |
| perl-ZMQ-LibZMQ3/ | 2017-08-07 06:15 | - | |
| perl-aliased/ | 2016-08-12 04:44 | - | |
| perl-asa/ | 2016-08-12 04:54 | - | |
| perl-autobox-Core/ | 2017-08-06 18:41 | - | |
| perl-autobox-List-Util/ | 2017-08-06 19:12 | - | |
| perl-autobox-dump/ | 2017-08-06 18:57 | - | |
| perl-autobox/ | 2017-07-31 20:33 | - | |
| perl-autovivification/ | 2017-08-02 12:49 | - | |
| perl-boolean/ | 2016-08-12 05:04 | - | |
| perl-ccom/ | 2016-08-12 05:13 | - | |
| perl-common-sense/ | 2016-08-12 05:26 | - | |
| perl-constant-boolean/ | 2017-08-02 12:49 | - | |
| perl-enum/ | 2016-08-12 06:56 | - | |
| perl-experimental/ | 2018-08-29 06:38 | - | |
| perl-generators/ | 2019-02-23 03:41 | - | |
| perl-indirect/ | 2019-03-21 06:22 | - | |
| perl-lib-abs/ | 2017-08-01 01:12 | - | |
| perl-libwhisker2/ | 2016-08-12 08:14 | - | |
| perl-mime-construct/ | 2016-08-14 09:09 | - | |
| perl-namespace-autoclean/ | 2019-02-23 05:11 | - | |
| perl-namespace-clean/ | 2017-08-02 12:49 | - | |
| perl-perl5i/ | 2019-03-21 06:35 | - | |
| perl-perlindex/ | 2018-08-29 09:35 | - | |
| perl-pmtools/ | 2016-08-12 09:48 | - | |
| perl-rpm-build-perl/ | 2017-08-01 06:07 | - | |
| perl-true/ | 2017-08-02 12:49 | - | |
| perl-utf8-all/ | 2016-08-12 11:39 | - | |
| petsc/ | 2019-03-21 06:45 | - | |
| petsc4py/ | 2019-03-21 06:47 | - | |
| pg-semver/ | 2016-08-12 11:56 | - | |
| pg_top/ | 2016-08-12 11:57 | - | |
| pg_view/ | 2018-08-29 10:59 | - | |
| pgadmin3/ | 2019-02-23 06:20 | - | |
| pgcenter/ | 2017-08-01 08:57 | - | |
| pgpdump/ | 2018-08-29 10:57 | - | |
| pgtune/ | 2016-08-12 11:57 | - | |
| phd2/ | 2019-02-23 06:29 | - | |
| phetsarath-fonts/ | 2016-08-12 11:58 | - | |
| phonon-qt5-backend-gstreamer/ | 2019-03-21 06:53 | - | |
| phonon-qt5/ | 2019-03-21 06:50 | - | |
| phoronix-test-suite/ | 2019-02-23 06:42 | - | |
| phototonic/ | 2018-10-10 08:56 | - | |
| php-Assetic/ | 2019-02-23 06:44 | - | |
| php-EasyRdf/ | 2017-08-07 15:47 | - | |
| php-Faker/ | 2017-08-07 17:16 | - | |
| php-IDNA_Convert/ | 2016-08-12 13:41 | - | |
| php-JMSParser/ | 2017-08-08 17:18 | - | |
| php-JsonSchema/ | 2017-08-08 17:50 | - | |
| php-Metadata/ | 2017-08-08 20:57 | - | |
| php-Monolog/ | 2017-08-08 21:44 | - | |
| php-PHP-CSS-Parser/ | 2017-08-09 07:51 | - | |
| php-PHPMailer/ | 2019-02-23 08:03 | - | |
| php-PHPParser/ | 2017-08-09 10:26 | - | |
| php-PhpCollection/ | 2017-08-09 07:36 | - | |
| php-PhpOption/ | 2017-08-09 10:11 | - | |
| php-Pimple/ | 2017-08-09 15:14 | - | |
| php-PsrLog/ | 2019-02-23 08:12 | - | |
| php-Raven/ | 2017-08-09 16:01 | - | |
| php-Smarty/ | 2016-08-12 16:15 | - | |
| php-SymfonyCmfRouting/ | 2018-08-29 16:34 | - | |
| php-ZendFramework/ | 2017-08-01 23:39 | - | |
| php-ZendFramework2/ | 2019-02-23 08:26 | - | |
| php-adodb/ | 2017-08-01 09:11 | - | |
| php-akamai-open-edgegrid-auth/ | 2018-08-29 11:08 | - | |
| php-amqplib/ | 2018-08-29 11:11 | - | |
| php-andrewsville-php-token-reflection/ | 2017-08-07 07:07 | - | |
| php-apigen-theme-bootstrap/ | 2016-08-12 12:01 | - | |
| php-apigen-theme-default/ | 2016-08-12 12:02 | - | |
| php-asm89-stack-cors/ | 2017-08-07 07:21 | - | |
| php-aws-php-sns-message-validator/ | 2018-08-29 11:17 | - | |
| php-aws-sdk/ | 2017-08-02 12:49 | - | |
| php-bacon-qr-code/ | 2018-08-29 11:20 | - | |
| php-bantu-ini-get-wrapper/ | 2017-08-07 07:54 | - | |
| php-bartlett-PHP-CompatInfo/ | 2018-08-29 11:23 | - | |
| php-bartlett-PHP-Reflect/ | 2017-08-07 08:39 | - | |
| php-bartlett-php-compatinfo-db/ | 2018-10-10 09:03 | - | |
| php-bartlett-umlwriter/ | 2017-08-07 08:55 | - | |
| php-behat-gherkin/ | 2018-08-29 11:29 | - | |
| php-behat-mink-browserkit-driver/ | 2017-08-07 09:26 | - | |
| php-behat-mink/ | 2017-08-07 09:12 | - | |
| php-channel-bartlett/ | 2016-08-12 12:06 | - | |
| php-channel-dropbox-php/ | 2016-08-12 12:06 | - | |
| php-channel-drush/ | 2016-08-12 12:07 | - | |
| php-channel-ezc/ | 2016-08-12 12:08 | - | |
| php-channel-horde/ | 2016-08-12 12:08 | - | |
| php-channel-nrk/ | 2016-08-12 12:09 | - | |
| php-channel-pdepend/ | 2016-08-12 12:09 | - | |
| php-channel-pearplex/ | 2016-08-12 12:10 | - | |
| php-channel-phing/ | 2016-08-12 12:10 | - | |
| php-channel-phpmd/ | 2016-08-12 12:11 | - | |
| php-channel-phpseclib/ | 2016-08-12 12:12 | - | |
| php-channel-pirum/ | 2016-08-12 12:12 | - | |
| php-channel-sabredav/ | 2016-08-12 12:13 | - | |
| php-channel-swift/ | 2016-08-12 12:13 | - | |
| php-channel-theseer/ | 2016-08-12 12:14 | - | |
| php-clue-block-react/ | 2017-08-07 09:41 | - | |
| php-clue-stream-filter/ | 2018-08-29 11:32 | - | |
| php-codeception-specify/ | 2018-08-29 11:35 | - | |
| php-codeception-verify/ | 2018-08-29 11:38 | - | |
| php-composer-ca-bundle/ | 2017-08-01 09:46 | - | |
| php-composer-installers/ | 2018-08-29 11:41 | - | |
| php-composer-semver/ | 2017-08-07 10:25 | - | |
| php-composer-spdx-licenses/ | 2019-02-23 06:47 | - | |
| php-composer-xdebug-handler/ | 2019-02-23 06:50 | - | |
| php-consolidation-annotated-command/ | 2017-08-07 10:55 | - | |
| php-consolidation-config/ | 2018-08-29 11:50 | - | |
| php-consolidation-output-formatters/ | 2017-08-07 11:07 | - | |
| php-container-interop/ | 2017-08-01 09:59 | - | |
| php-cs-fixer/ | 2018-08-29 11:53 | - | |
| php-d11wtq-boris/ | 2017-08-02 12:49 | - | |
| php-deepend-Mockery/ | 2017-08-07 11:38 | - | |
| php-dflydev-dot-access-data/ | 2018-08-29 11:57 | - | |
| php-di-invoker/ | 2017-08-07 12:08 | - | |
| php-di-phpdoc-reader/ | 2017-08-07 12:23 | - | |
| php-di-symfony2-bridge/ | 2017-08-07 12:37 | - | |
| php-di/ | 2017-08-07 11:53 | - | |
| php-dnoegel-php-xdg-base-dir/ | 2017-08-07 12:53 | - | |
| php-doctrine-annotations/ | 2017-08-07 13:08 | - | |
| php-doctrine-cache/ | 2017-08-07 13:23 | - | |
| php-doctrine-collections/ | 2017-08-07 13:39 | - | |
| php-doctrine-common/ | 2017-08-07 13:54 | - | |
| php-doctrine-datafixtures/ | 2017-08-07 14:09 | - | |
| php-doctrine-dbal/ | 2017-08-07 14:25 | - | |
| php-doctrine-doctrine-bundle/ | 2018-08-29 12:00 | - | |
| php-doctrine-doctrine-cache-bundle/ | 2017-08-07 14:42 | - | |
| php-doctrine-inflector/ | 2017-08-07 14:59 | - | |
| php-doctrine-instantiator/ | 2017-08-07 15:14 | - | |
| php-doctrine-lexer/ | 2017-08-01 10:38 | - | |
| php-doctrine-orm/ | 2017-08-07 15:25 | - | |
| php-dropbox-php-Dropbox/ | 2016-08-12 12:25 | - | |
| php-drush-drush/ | 2019-02-23 06:53 | - | |
| php-egulias-email-validator/ | 2017-08-07 16:04 | - | |
| php-email-address-validation/ | 2017-08-01 10:48 | - | |
| php-endroid-qrcode/ | 2018-08-29 12:06 | - | |
| php-erusev-parsedown/ | 2018-08-29 12:09 | - | |
| php-evenement/ | 2018-08-29 12:12 | - | |
| php-extras/ | 2017-08-02 12:49 | - | |
| php-ezc-Archive/ | 2016-08-12 12:28 | - | |
| php-ezc-Authentication/ | 2017-08-01 11:02 | - | |
| php-ezc-AuthenticationDatabaseTiein/ | 2016-08-12 12:28 | - | |
| php-ezc-Base/ | 2016-08-12 12:29 | - | |
| php-ezc-Cache/ | 2016-08-12 12:30 | - | |
| php-ezc-Configuration/ | 2016-08-12 12:30 | - | |
| php-ezc-ConsoleTools/ | 2016-08-12 12:31 | - | |
| php-ezc-Database/ | 2017-08-01 11:05 | - | |
| php-ezc-DatabaseSchema/ | 2016-08-12 12:31 | - | |
| php-ezc-EventLog/ | 2017-08-01 11:07 | - | |
| php-ezc-EventLogDatabaseTiein/ | 2016-08-12 12:32 | - | |
| php-ezc-Feed/ | 2016-08-12 12:32 | - | |
| php-ezc-File/ | 2016-08-12 12:33 | - | |
| php-ezc-Graph/ | 2016-08-12 12:34 | - | |
| php-ezc-Mail/ | 2016-08-12 12:34 | - | |
| php-ezc-PersistentObject/ | 2017-08-01 11:09 | - | |
| php-ezc-PersistentObjectDatabaseSchemaTiein/ | 2016-08-12 12:35 | - | |
| php-ezc-SystemInformation/ | 2016-08-12 12:35 | - | |
| php-ezc-Template/ | 2016-08-12 12:36 | - | |
| php-ezc-Webdav/ | 2016-08-12 12:36 | - | |
| php-fedora-autoloader/ | 2017-08-07 17:31 | - | |
| php-fig-http-message-util/ | 2019-02-23 06:56 | - | |
| php-firephp-firephp-core/ | 2017-08-07 17:46 | - | |
| php-flow-jsonpath/ | 2018-08-29 12:15 | - | |
| php-gecko-packages-gecko-php-unit/ | 2018-08-29 12:18 | - | |
| php-geshi/ | 2016-08-12 12:38 | - | |
| php-getid3/ | 2019-02-23 06:59 | - | |
| php-gitter/ | 2017-08-07 18:16 | - | |
| php-gliph/ | 2017-08-07 18:31 | - | |
| php-google-apiclient/ | 2017-08-07 18:47 | - | |
| php-goutte/ | 2017-08-07 19:02 | - | |
| php-grasmash-expander/ | 2018-08-29 12:23 | - | |
| php-grasmash-yaml-expander/ | 2018-08-29 12:26 | - | |
| php-guzzle-Guzzle/ | 2017-08-07 19:17 | - | |
| php-guzzlehttp-guzzle/ | 2018-08-29 12:29 | - | |
| php-guzzlehttp-psr7/ | 2017-08-07 19:47 | - | |
| php-guzzlehttp-ringphp/ | 2017-08-07 20:02 | - | |
| php-guzzlehttp-streams/ | 2017-08-07 20:17 | - | |
| php-hamcrest/ | 2017-08-07 20:32 | - | |
| php-henrikbjorn-lurker/ | 2018-08-29 12:32 | - | |
| php-horde-Horde-Alarm/ | 2018-08-29 12:38 | - | |
| php-horde-Horde-Argv/ | 2017-08-07 21:04 | - | |
| php-horde-Horde-Auth/ | 2018-08-29 12:42 | - | |
| php-horde-Horde-Autoloader/ | 2017-08-07 21:21 | - | |
| php-horde-Horde-Browser/ | 2019-02-23 07:04 | - | |
| php-horde-Horde-Cache/ | 2017-08-07 21:37 | - | |
| php-horde-Horde-Cli/ | 2018-08-29 12:48 | - | |
| php-horde-Horde-Compress-Fast/ | 2017-08-07 22:07 | - | |
| php-horde-Horde-Compress/ | 2018-08-29 12:50 | - | |
| php-horde-Horde-Constraint/ | 2016-08-12 12:49 | - | |
| php-horde-Horde-Controller/ | 2018-08-29 12:54 | - | |
| php-horde-Horde-Core/ | 2019-02-23 07:07 | - | |
| php-horde-Horde-Crypt-Blowfish/ | 2017-08-07 22:55 | - | |
| php-horde-Horde-Crypt/ | 2018-08-29 13:00 | - | |
| php-horde-Horde-Css-Parser/ | 2017-08-07 23:10 | - | |
| php-horde-Horde-CssMinify/ | 2017-08-01 12:15 | - | |
| php-horde-Horde-Data/ | 2017-08-07 23:26 | - | |
| php-horde-Horde-Date-Parser/ | 2017-08-07 23:56 | - | |
| php-horde-Horde-Date/ | 2018-08-29 13:04 | - | |
| php-horde-Horde-Dav/ | 2017-08-01 12:26 | - | |
| php-horde-Horde-Db/ | 2018-08-29 13:07 | - | |
| php-horde-Horde-Editor/ | 2018-08-29 13:10 | - | |
| php-horde-Horde-ElasticSearch/ | 2016-08-12 12:55 | - | |
| php-horde-Horde-Exception/ | 2017-08-08 00:13 | - | |
| php-horde-Horde-Feed/ | 2017-08-08 00:28 | - | |
| php-horde-Horde-Form/ | 2019-02-23 07:11 | - | |
| php-horde-Horde-Group/ | 2018-08-29 13:15 | - | |
| php-horde-Horde-HashTable/ | 2017-08-08 00:46 | - | |
| php-horde-Horde-History/ | 2018-08-29 13:19 | - | |
| php-horde-Horde-Http/ | 2017-08-08 01:02 | - | |
| php-horde-Horde-Icalendar/ | 2018-08-29 13:22 | - | |
| php-horde-Horde-Idna/ | 2017-08-08 01:32 | - | |
| php-horde-Horde-Image/ | 2019-02-23 07:14 | - | |
| php-horde-Horde-Imap-Client/ | 2018-08-29 13:28 | - | |
| php-horde-Horde-Imsp/ | 2016-08-12 13:01 | - | |
| php-horde-Horde-Injector/ | 2017-08-08 02:05 | - | |
| php-horde-Horde-Itip/ | 2017-08-08 02:19 | - | |
| php-horde-Horde-JavascriptMinify/ | 2017-08-08 02:35 | - | |
| php-horde-Horde-Kolab-Format/ | 2017-08-08 02:51 | - | |
| php-horde-Horde-Kolab-Server/ | 2017-08-08 03:07 | - | |
| php-horde-Horde-Kolab-Session/ | 2018-08-29 13:32 | - | |
| php-horde-Horde-Kolab-Storage/ | 2018-08-29 13:35 | - | |
| php-horde-Horde-Ldap/ | 2018-08-29 13:39 | - | |
| php-horde-Horde-ListHeaders/ | 2017-08-08 03:43 | - | |
| php-horde-Horde-Lock/ | 2017-08-01 13:11 | - | |
| php-horde-Horde-Log/ | 2017-08-08 03:59 | - | |
| php-horde-Horde-LoginTasks/ | 2017-08-08 04:13 | - | |
| php-horde-Horde-Mail-Autoconfig/ | 2017-08-08 04:45 | - | |
| php-horde-Horde-Mail/ | 2017-08-01 13:20 | - | |
| php-horde-Horde-Mapi/ | 2017-08-08 04:59 | - | |
| php-horde-Horde-Memcache/ | 2017-08-01 13:26 | - | |
| php-horde-Horde-Mime-Viewer/ | 2018-08-29 13:45 | - | |
| php-horde-Horde-Mime/ | 2018-08-29 13:42 | - | |
| php-horde-Horde-Mongo/ | 2016-08-12 13:11 | - | |
| php-horde-Horde-Nls/ | 2017-08-01 13:32 | - | |
| php-horde-Horde-Notification/ | 2017-08-08 05:29 | - | |
| php-horde-Horde-Oauth/ | 2016-08-12 13:12 | - | |
| php-horde-Horde-OpenXchange/ | 2016-08-12 13:13 | - | |
| php-horde-Horde-Pack/ | 2017-08-08 05:45 | - | |
| php-horde-Horde-Pdf/ | 2017-08-08 05:59 | - | |
| php-horde-Horde-Perms/ | 2017-08-08 06:14 | - | |
| php-horde-Horde-Prefs/ | 2018-08-29 13:48 | - | |
| php-horde-Horde-Queue/ | 2017-08-01 13:44 | - | |
| php-horde-Horde-Rdo/ | 2017-08-08 06:45 | - | |
| php-horde-Horde-Role/ | 2016-08-12 13:16 | - | |
| php-horde-Horde-Routes/ | 2017-08-08 07:00 | - | |
| php-horde-Horde-Rpc/ | 2018-08-29 13:51 | - | |
| php-horde-Horde-Scribe/ | 2016-08-12 13:18 | - | |
| php-horde-Horde-Secret/ | 2017-08-08 07:15 | - | |
| php-horde-Horde-Serialize/ | 2017-08-08 07:32 | - | |
| php-horde-Horde-Service-Gravatar/ | 2017-08-08 07:47 | - | |
| php-horde-Horde-Service-Weather/ | 2017-08-08 08:01 | - | |
| php-horde-Horde-SessionHandler/ | 2017-08-08 08:17 | - | |
| php-horde-Horde-Share/ | 2018-08-29 13:54 | - | |
| php-horde-Horde-Smtp/ | 2017-08-08 08:48 | - | |
| php-horde-Horde-Socket-Client/ | 2018-08-29 13:57 | - | |
| php-horde-Horde-SpellChecker/ | 2017-08-08 09:03 | - | |
| php-horde-Horde-Stream-Filter/ | 2017-08-08 09:33 | - | |
| php-horde-Horde-Stream-Wrapper/ | 2017-08-08 09:48 | - | |
| php-horde-Horde-Stream/ | 2017-08-08 09:19 | - | |
| php-horde-Horde-Stringprep/ | 2017-08-01 14:13 | - | |
| php-horde-Horde-Support/ | 2017-08-08 10:04 | - | |
| php-horde-Horde-SyncMl/ | 2016-08-12 13:26 | - | |
| php-horde-Horde-Template/ | 2017-08-08 10:19 | - | |
| php-horde-Horde-Test/ | 2017-08-01 14:19 | - | |
| php-horde-Horde-Text-Diff/ | 2017-08-08 10:36 | - | |
| php-horde-Horde-Text-Filter-Csstidy/ | 2017-08-08 11:03 | - | |
| php-horde-Horde-Text-Filter/ | 2017-08-08 10:51 | - | |
| php-horde-Horde-Text-Flowed/ | 2017-08-08 11:19 | - | |
| php-horde-Horde-Thrift/ | 2016-08-12 13:29 | - | |
| php-horde-Horde-Timezone/ | 2017-08-08 11:34 | - | |
| php-horde-Horde-Token/ | 2017-08-08 11:50 | - | |
| php-horde-Horde-Translation/ | 2017-08-08 12:05 | - | |
| php-horde-Horde-Tree/ | 2016-08-12 13:31 | - | |
| php-horde-Horde-Url/ | 2018-08-29 14:00 | - | |
| php-horde-Horde-Util/ | 2017-08-08 12:21 | - | |
| php-horde-Horde-Vfs/ | 2017-08-08 12:36 | - | |
| php-horde-Horde-View/ | 2017-08-08 12:52 | - | |
| php-horde-Horde-Xml-Element/ | 2017-08-08 13:09 | - | |
| php-horde-Horde-Xml-Wbxml/ | 2017-08-08 13:24 | - | |
| php-horde-content/ | 2017-08-07 20:47 | - | |
| php-horde-horde-lz4/ | 2017-08-08 04:29 | - | |
| php-horde-horde/ | 2019-02-23 07:01 | - | |
| php-horde-imp/ | 2019-02-23 07:17 | - | |
| php-horde-ingo/ | 2017-08-08 13:58 | - | |
| php-horde-kronolith/ | 2019-02-23 07:22 | - | |
| php-horde-mnemo/ | 2018-08-29 14:14 | - | |
| php-horde-nag/ | 2019-02-23 07:27 | - | |
| php-horde-passwd/ | 2018-08-29 14:21 | - | |
| php-horde-turba/ | 2018-10-10 09:15 | - | |
| php-horde-wicked/ | 2018-08-29 14:31 | - | |
| php-htmLawed/ | 2016-08-12 13:39 | - | |
| php-http-interop-http-middleware/ | 2017-08-01 15:03 | - | |
| php-iamcal-lib-autolink/ | 2017-08-01 15:05 | - | |
| php-icewind-smb/ | 2017-08-01 15:07 | - | |
| php-icewind-streams/ | 2017-08-08 15:11 | - | |
| php-idn/ | 2016-08-12 13:41 | - | |
| php-interfasys-lognormalizer/ | 2017-08-08 15:26 | - | |
| php-ircmaxell-random-lib/ | 2017-08-08 15:42 | - | |
| php-ircmaxell-security-lib/ | 2017-08-08 15:57 | - | |
| php-jakub-onderka-php-console-color/ | 2017-08-08 16:12 | - | |
| php-jakub-onderka-php-console-highlighter/ | 2017-08-08 16:27 | - | |
| php-jakubledl-dissect/ | 2018-08-29 14:37 | - | |
| php-jdorn-sql-formatter/ | 2017-08-08 16:43 | - | |
| php-jeremeamia-superclosure/ | 2019-02-23 07:32 | - | |
| php-jsonlint/ | 2017-08-08 17:33 | - | |
| php-justinrainbow-json-schema/ | 2017-08-08 18:05 | - | |
| php-justinrainbow-json-schema4/ | 2017-08-08 18:21 | - | |
| php-justinrainbow-json-schema5/ | 2019-02-23 07:35 | - | |
| php-kdyby-events/ | 2017-08-02 12:49 | - | |
| php-kolab-net-ldap3/ | 2018-10-10 09:23 | - | |
| php-kukulich-fshl/ | 2017-08-08 18:53 | - | |
| php-latte/ | 2017-08-02 12:49 | - | |
| php-league-climate/ | 2018-08-29 14:48 | - | |
| php-league-container/ | 2018-08-29 14:51 | - | |
| php-league-flysystem/ | 2017-08-08 19:25 | - | |
| php-league-plates/ | 2017-08-08 19:40 | - | |
| php-lessphp/ | 2017-08-08 19:54 | - | |
| php-libvirt/ | 2018-08-29 14:54 | - | |
| php-lukasreschke-id3parser/ | 2017-08-01 15:59 | - | |
| php-magickwand/ | 2016-08-12 13:51 | - | |
| php-markdown/ | 2018-08-29 14:58 | - | |
| php-masterminds-html5/ | 2018-08-29 15:00 | - | |
| php-maxminddb/ | 2019-02-23 07:38 | - | |
| php-mcnetic-zipstreamer/ | 2017-08-08 20:24 | - | |
| php-mikey179-vfsstream/ | 2018-08-29 15:03 | - | |
| php-mnapoli-phpunit-easymock/ | 2017-08-08 21:29 | - | |
| php-mongodb/ | 2017-08-01 16:15 | - | |
| php-mtdowling-jmespath-php/ | 2017-08-08 22:01 | - | |
| php-myclabs-deep-copy/ | 2017-08-08 22:16 | - | |
| php-myclabs-php-enum/ | 2017-08-08 22:30 | - | |
| php-natxet-cssmin/ | 2017-08-01 16:28 | - | |
| php-nette-application/ | 2017-08-02 12:49 | - | |
| php-nette-bootstrap/ | 2017-08-02 12:49 | - | |
| php-nette-caching/ | 2017-08-02 12:49 | - | |
| php-nette-component-model/ | 2017-08-02 12:49 | - | |
| php-nette-database/ | 2017-08-02 12:49 | - | |
| php-nette-deprecated/ | 2017-08-02 12:49 | - | |
| php-nette-di/ | 2017-08-02 12:49 | - | |
| php-nette-finder/ | 2017-08-02 12:49 | - | |
| php-nette-forms/ | 2017-08-02 12:49 | - | |
| php-nette-http/ | 2017-08-02 12:49 | - | |
| php-nette-mail/ | 2017-08-02 12:49 | - | |
| php-nette-neon/ | 2017-08-02 12:49 | - | |
| php-nette-php-generator/ | 2017-08-02 12:49 | - | |
| php-nette-reflection/ | 2017-08-02 12:49 | - | |
| php-nette-robot-loader/ | 2017-08-02 12:49 | - | |
| php-nette-safe-stream/ | 2017-08-02 12:49 | - | |
| php-nette-security/ | 2017-08-02 12:49 | - | |
| php-nette-tester/ | 2017-08-02 12:49 | - | |
| php-nette-tokenizer/ | 2017-08-02 12:49 | - | |
| php-nette-utils/ | 2017-08-08 22:45 | - | |
| php-nette/ | 2017-08-01 16:30 | - | |
| php-nikic-fast-route/ | 2017-08-08 23:00 | - | |
| php-nikic-php-parser/ | 2017-08-08 23:15 | - | |
| php-nrk-Predis/ | 2019-02-23 07:42 | - | |
| php-ocramius-code-generator-utils/ | 2017-08-08 23:32 | - | |
| php-ocramius-generated-hydrator/ | 2017-08-08 23:47 | - | |
| php-ocramius-instantiator/ | 2017-08-09 00:05 | - | |
| php-ocramius-lazy-map/ | 2017-08-09 00:20 | - | |
| php-ocramius-proxy-manager/ | 2017-08-09 00:35 | - | |
| php-onelogin-php-saml/ | 2019-02-23 07:44 | - | |
| php-opencloud/ | 2017-08-09 00:56 | - | |
| php-owncloud-tarstreamer/ | 2017-08-09 01:11 | - | |
| php-paragonie-constant-time-encoding/ | 2018-10-10 09:30 | - | |
| php-paragonie-random-compat/ | 2018-08-29 15:13 | - | |
| php-password-compat/ | 2017-08-09 01:57 | - | |
| php-patchwork-jsqueeze/ | 2017-08-09 02:12 | - | |
| php-patchwork-utf8/ | 2017-08-09 02:28 | - | |
| php-pclzip/ | 2016-08-12 14:14 | - | |
| php-pda-pheanstalk/ | 2018-08-29 15:16 | - | |
| php-pdepend-PHP-Depend/ | 2017-08-09 02:43 | - | |
| php-pear-Auth-RADIUS/ | 2016-08-12 14:15 | - | |
| php-pear-Auth-SASL/ | 2016-08-12 14:15 | - | |
| php-pear-Auth/ | 2017-08-01 17:52 | - | |
| php-pear-Benchmark/ | 2016-08-12 14:16 | - | |
| php-pear-CAS/ | 2019-02-23 07:47 | - | |
| php-pear-Cache-Lite/ | 2016-08-12 14:16 | - | |
| php-pear-Cache/ | 2017-08-01 17:54 | - | |
| php-pear-CodeGen-PECL/ | 2017-08-02 12:49 | - | |
| php-pear-CodeGen/ | 2017-08-01 17:58 | - | |
| php-pear-Console-Color/ | 2016-08-12 14:19 | - | |
| php-pear-Console-CommandLine/ | 2016-08-12 14:20 | - | |
| php-pear-Console-Getargs/ | 2017-08-09 03:02 | - | |
| php-pear-Console-ProgressBar/ | 2016-08-12 14:21 | - | |
| php-pear-Console-Table/ | 2017-08-02 12:49 | - | |
| php-pear-Crypt-Blowfish/ | 2016-08-12 14:22 | - | |
| php-pear-Crypt-CHAP/ | 2016-08-12 14:22 | - | |
| php-pear-DB-DataObject-FormBuilder/ | 2016-08-12 14:24 | - | |
| php-pear-DB-DataObject/ | 2017-08-01 18:14 | - | |
| php-pear-DB-QueryTool/ | 2016-08-12 14:24 | - | |
| php-pear-DB/ | 2017-08-01 18:11 | - | |
| php-pear-Date-Holidays-USA/ | 2016-08-12 14:23 | - | |
| php-pear-Date-Holidays/ | 2017-08-01 18:09 | - | |
| php-pear-Date/ | 2017-08-01 18:07 | - | |
| php-pear-Event-Dispatcher/ | 2016-08-12 14:26 | - | |
| php-pear-File-CSV/ | 2016-08-12 14:26 | - | |
| php-pear-File-Find/ | 2016-08-12 14:27 | - | |
| php-pear-File-Fstab/ | 2016-08-12 14:27 | - | |
| php-pear-File-Passwd/ | 2016-08-12 14:28 | - | |
| php-pear-File-SMBPasswd/ | 2016-08-12 14:28 | - | |
| php-pear-File-Util/ | 2016-08-12 14:29 | - | |
| php-pear-File/ | 2017-08-01 18:16 | - | |
| php-pear-HTML-Common/ | 2016-08-12 14:29 | - | |
| php-pear-HTML-QuickForm-ElementGrid/ | 2016-08-12 14:30 | - | |
| php-pear-HTML-QuickForm-advmultiselect/ | 2017-08-09 03:17 | - | |
| php-pear-HTML-QuickForm/ | 2017-08-01 18:18 | - | |
| php-pear-HTML-Table/ | 2017-08-02 12:49 | - | |
| php-pear-HTTP-Client/ | 2016-08-12 14:31 | - | |
| php-pear-HTTP-OAuth/ | 2017-08-09 03:33 | - | |
| php-pear-HTTP-Request/ | 2017-08-01 18:26 | - | |
| php-pear-HTTP-Request2/ | 2016-08-12 14:33 | - | |
| php-pear-HTTP-Upload/ | 2016-08-12 14:33 | - | |
| php-pear-HTTP/ | 2017-08-01 18:22 | - | |
| php-pear-Image-Canvas/ | 2016-08-12 14:34 | - | |
| php-pear-Image-Color/ | 2017-08-09 03:48 | - | |
| php-pear-Image-Graph/ | 2017-08-01 18:31 | - | |
| php-pear-Image-GraphViz/ | 2016-08-12 14:35 | - | |
| php-pear-Image-Text/ | 2016-08-12 14:36 | - | |
| php-pear-Log/ | 2016-08-12 14:36 | - | |
| php-pear-MDB2-Driver-mysql/ | 2017-08-01 18:41 | - | |
| php-pear-MDB2-Driver-mysqli/ | 2016-08-12 14:38 | - | |
| php-pear-MDB2-Driver-pgsql/ | 2016-08-12 14:39 | - | |
| php-pear-MDB2/ | 2017-08-01 18:39 | - | |
| php-pear-Mail-Mime/ | 2018-08-29 15:22 | - | |
| php-pear-Mail-mimeDecode/ | 2016-08-14 12:03 | - | |
| php-pear-Mail/ | 2017-08-01 18:33 | - | |
| php-pear-Math-Stats/ | 2017-08-09 04:02 | - | |
| php-pear-Net-Curl/ | 2016-08-12 14:39 | - | |
| php-pear-Net-DIME/ | 2016-08-12 14:40 | - | |
| php-pear-Net-DNS/ | 2017-08-01 18:43 | - | |
| php-pear-Net-DNS2/ | 2017-08-09 04:17 | - | |
| php-pear-Net-FTP/ | 2016-08-12 14:41 | - | |
| php-pear-Net-IDNA2/ | 2016-08-12 14:42 | - | |
| php-pear-Net-IMAP/ | 2016-08-12 14:42 | - | |
| php-pear-Net-IPv4/ | 2017-08-09 04:33 | - | |
| php-pear-Net-LDAP2/ | 2016-08-12 14:44 | - | |
| php-pear-Net-POP3/ | 2016-08-12 14:45 | - | |
| php-pear-Net-Ping/ | 2016-08-12 14:44 | - | |
| php-pear-Net-SMTP/ | 2017-08-01 18:50 | - | |
| php-pear-Net-Sieve/ | 2016-08-12 14:45 | - | |
| php-pear-Net-Socket/ | 2016-08-12 14:46 | - | |
| php-pear-Net-Traceroute/ | 2016-08-12 14:47 | - | |
| php-pear-Net-URL-Mapper/ | 2017-08-09 04:50 | - | |
| php-pear-Net-URL/ | 2017-08-01 18:52 | - | |
| php-pear-Net-URL2/ | 2017-08-01 18:54 | - | |
| php-pear-Net-UserAgent-Detect/ | 2016-08-12 14:49 | - | |
| php-pear-Numbers-Roman/ | 2017-08-09 05:05 | - | |
| php-pear-Numbers-Words/ | 2017-08-09 05:16 | - | |
| php-pear-OLE/ | 2016-08-12 14:50 | - | |
| php-pear-PEAR-Command-Packaging/ | 2016-08-12 14:52 | - | |
| php-pear-PHP-CodeSniffer/ | 2017-08-09 05:31 | - | |
| php-pear-Pager/ | 2016-08-12 14:51 | - | |
| php-pear-Payment-Process/ | 2016-08-12 14:51 | - | |
| php-pear-PhpDocumentor/ | 2017-08-09 05:47 | - | |
| php-pear-SOAP/ | 2016-08-12 14:55 | - | |
| php-pear-Services-Twitter/ | 2016-08-12 14:54 | - | |
| php-pear-Services-Weather/ | 2016-08-12 14:55 | - | |
| php-pear-Structures-DataGrid-DataSource-Array/ | 2016-08-12 14:56 | - | |
| php-pear-Structures-DataGrid-DataSource-DataObject/ | 2016-08-12 14:56 | - | |
| php-pear-Structures-DataGrid-DataSource-MDB2/ | 2016-08-12 14:57 | - | |
| php-pear-Structures-DataGrid-DataSource-RSS/ | 2016-08-12 14:58 | - | |
| php-pear-Structures-DataGrid-Renderer-Pager/ | 2016-08-12 14:58 | - | |
| php-pear-Structures-DataGrid-Renderer-Smarty/ | 2016-08-12 14:59 | - | |
| php-pear-Structures-DataGrid/ | 2017-08-01 19:08 | - | |
| php-pear-Text-CAPTCHA/ | 2016-08-12 14:59 | - | |
| php-pear-Text-Diff/ | 2017-08-01 19:10 | - | |
| php-pear-Text-Figlet/ | 2016-08-12 15:00 | - | |
| php-pear-Text-Password/ | 2016-08-12 15:01 | - | |
| php-pear-Validate-Finance-CreditCard/ | 2016-08-12 15:02 | - | |
| php-pear-Validate/ | 2017-08-01 19:13 | - | |
| php-pear-Var-Dump/ | 2016-08-12 15:03 | - | |
| php-pear-XML-Beautifier/ | 2016-08-12 15:03 | - | |
| php-pear-XML-Parser/ | 2016-08-12 15:04 | - | |
| php-pear-XML-RPC/ | 2017-08-01 19:15 | - | |
| php-pear-XML-RPC2/ | 2016-08-12 15:04 | - | |
| php-pear-XML-RSS/ | 2016-08-12 15:05 | - | |
| php-pear-XML-SVG/ | 2016-08-12 15:06 | - | |
| php-pear-XML-Serializer/ | 2017-08-09 06:02 | - | |
| php-pear-console-color2/ | 2016-08-12 14:19 | - | |
| php-pear-crypt-gpg/ | 2018-08-29 15:19 | - | |
| php-pear-phing/ | 2017-08-01 19:02 | - | |
| php-pear-text-wiki/ | 2016-08-12 15:02 | - | |
| php-pecl-amqp/ | 2018-08-29 15:24 | - | |
| php-pecl-apcu/ | 2017-08-01 19:19 | - | |
| php-pecl-apfd/ | 2016-08-12 15:08 | - | |
| php-pecl-cairo/ | 2016-08-12 15:09 | - | |
| php-pecl-dio/ | 2017-08-01 19:22 | - | |
| php-pecl-event/ | 2016-08-12 15:09 | - | |
| php-pecl-fann/ | 2017-08-02 12:50 | - | |
| php-pecl-gearman/ | 2016-08-12 15:10 | - | |
| php-pecl-geoip/ | 2016-08-12 15:11 | - | |
| php-pecl-gmagick/ | 2016-08-14 12:10 | - | |
| php-pecl-http/ | 2017-08-01 19:26 | - | |
| php-pecl-http1/ | 2016-08-12 15:13 | - | |
| php-pecl-igbinary/ | 2016-08-12 15:13 | - | |
| php-pecl-imagick/ | 2016-08-12 15:14 | - | |
| php-pecl-json-post/ | 2016-08-12 15:15 | - | |
| php-pecl-judy/ | 2017-08-09 06:17 | - | |
| php-pecl-krb5/ | 2018-08-29 15:27 | - | |
| php-pecl-libsodium/ | 2018-08-29 15:30 | - | |
| php-pecl-lzf/ | 2016-08-12 15:17 | - | |
| php-pecl-mailparse/ | 2016-08-12 15:18 | - | |
| php-pecl-memcached/ | 2019-03-21 06:55 | - | |
| php-pecl-memprof/ | 2017-08-09 06:48 | - | |
| php-pecl-mongo/ | 2017-08-01 19:40 | - | |
| php-pecl-mongodb/ | 2017-08-09 07:02 | - | |
| php-pecl-msgpack/ | 2019-03-21 06:57 | - | |
| php-pecl-ncurses/ | 2016-08-12 15:21 | - | |
| php-pecl-oauth/ | 2016-08-12 15:21 | - | |
| php-pecl-parsekit/ | 2016-08-12 15:22 | - | |
| php-pecl-pq/ | 2017-08-01 19:47 | - | |
| php-pecl-propro/ | 2016-08-12 15:23 | - | |
| php-pecl-psr/ | 2019-02-23 07:54 | - | |
| php-pecl-radius/ | 2016-08-12 15:24 | - | |
| php-pecl-raphf/ | 2016-08-12 15:25 | - | |
| php-pecl-redis/ | 2017-08-01 19:50 | - | |
| php-pecl-rrd/ | 2016-08-12 15:26 | - | |
| php-pecl-runkit/ | 2016-08-12 15:26 | - | |
| php-pecl-solr/ | 2017-08-01 19:53 | - | |
| php-pecl-solr2/ | 2016-08-12 15:28 | - | |
| php-pecl-ssdeep/ | 2019-02-23 07:57 | - | |
| php-pecl-ssh2/ | 2016-08-12 15:29 | - | |
| php-pecl-uuid/ | 2016-08-12 15:30 | - | |
| php-pecl-xattr/ | 2016-08-12 15:31 | - | |
| php-pecl-xdebug/ | 2016-08-12 15:31 | - | |
| php-pecl-xhprof/ | 2016-08-12 15:32 | - | |
| php-pecl-xmldiff/ | 2016-08-12 15:33 | - | |
| php-pecl-yac/ | 2016-08-12 15:33 | - | |
| php-pecl-yaml/ | 2016-08-12 15:34 | - | |
| php-pecl-zendopcache/ | 2017-08-01 19:58 | - | |
| php-php-gettext/ | 2017-08-01 20:10 | - | |
| php-phpass/ | 2016-08-12 15:36 | - | |
| php-phpdocumentor-reflection-docblock/ | 2017-08-09 08:21 | - | |
| php-phpdocumentor-reflection/ | 2017-08-09 08:07 | - | |
| php-phpiredis/ | 2019-02-23 08:00 | - | |
| php-phpmd-PHP-PMD/ | 2017-08-09 08:38 | - | |
| php-phpmyadmin-motranslator/ | 2018-08-29 15:46 | - | |
| php-phpmyadmin-shapefile/ | 2017-08-09 09:09 | - | |
| php-phpmyadmin-sql-parser/ | 2019-02-23 08:06 | - | |
| php-phpoffice-phpexcel/ | 2017-08-09 09:40 | - | |
| php-phpseclib-crypt-aes/ | 2016-08-12 15:41 | - | |
| php-phpseclib-crypt-base/ | 2016-08-12 15:41 | - | |
| php-phpseclib-crypt-blowfish/ | 2016-08-12 15:42 | - | |
| php-phpseclib-crypt-des/ | 2016-08-12 15:42 | - | |
| php-phpseclib-crypt-hash/ | 2016-08-12 15:43 | - | |
| php-phpseclib-crypt-random/ | 2016-08-12 15:44 | - | |
| php-phpseclib-crypt-rc4/ | 2016-08-12 15:45 | - | |
| php-phpseclib-crypt-rijndael/ | 2016-08-12 15:45 | - | |
| php-phpseclib-crypt-rsa/ | 2016-08-12 15:46 | - | |
| php-phpseclib-crypt-tripledes/ | 2016-08-12 15:46 | - | |
| php-phpseclib-crypt-twofish/ | 2016-08-12 15:47 | - | |
| php-phpseclib-file-asn1/ | 2016-08-12 15:47 | - | |
| php-phpseclib-math-biginteger/ | 2016-08-12 15:48 | - | |
| php-phpseclib-net-sftp/ | 2016-08-12 15:48 | - | |
| php-phpseclib-net-ssh2/ | 2016-08-12 15:49 | - | |
| php-phpseclib/ | 2019-02-23 08:09 | - | |
| php-phpspec-php-diff/ | 2017-08-02 12:50 | - | |
| php-phpspec-prophecy/ | 2017-08-02 12:50 | - | |
| php-phpspec/ | 2017-08-09 10:57 | - | |
| php-phpunit-DbUnit/ | 2017-08-09 11:27 | - | |
| php-phpunit-File-Iterator/ | 2017-08-02 12:50 | - | |
| php-phpunit-FinderFacade/ | 2017-08-09 12:28 | - | |
| php-phpunit-PHP-CodeCoverage/ | 2017-08-09 12:44 | - | |
| php-phpunit-PHP-Invoker/ | 2016-08-12 15:58 | - | |
| php-phpunit-PHP-Timer/ | 2017-08-09 13:44 | - | |
| php-phpunit-PHP-TokenStream/ | 2017-08-09 13:59 | - | |
| php-phpunit-PHPUnit-MockObject/ | 2017-08-09 14:13 | - | |
| php-phpunit-PHPUnit-Selenium/ | 2016-08-12 16:00 | - | |
| php-phpunit-PHPUnit-SkeletonGenerator/ | 2017-08-09 14:29 | - | |
| php-phpunit-PHPUnit-Story/ | 2016-08-12 16:01 | - | |
| php-phpunit-PHPUnit/ | 2017-08-01 21:11 | - | |
| php-phpunit-Text-Template/ | 2016-08-12 16:02 | - | |
| php-phpunit-Version/ | 2017-08-09 14:44 | - | |
| php-phpunit-bytekit/ | 2016-08-12 15:51 | - | |
| php-phpunit-comparator/ | 2017-08-09 11:12 | - | |
| php-phpunit-diff/ | 2017-08-09 11:40 | - | |
| php-phpunit-environment/ | 2017-08-09 11:57 | - | |
| php-phpunit-exporter/ | 2017-08-09 12:12 | - | |
| php-phpunit-git/ | 2017-08-02 12:50 | - | |
| php-phpunit-phpcov/ | 2017-08-02 12:50 | - | |
| php-phpunit-phpcpd/ | 2017-08-09 13:00 | - | |
| php-phpunit-phpdcd/ | 2017-08-09 13:14 | - | |
| php-phpunit-phploc/ | 2017-08-09 13:29 | - | |
| php-pimple/ | 2017-08-09 15:30 | - | |
| php-pimple1/ | 2017-08-09 14:58 | - | |
| php-pirum-Pirum/ | 2016-08-12 16:04 | - | |
| php-pluf/ | 2016-08-12 16:04 | - | |
| php-psr-cache/ | 2016-08-12 16:05 | - | |
| php-psr-container/ | 2017-08-01 21:26 | - | |
| php-psr-http-message/ | 2017-08-02 12:50 | - | |
| php-psr-link/ | 2017-08-01 21:30 | - | |
| php-psr-simple-cache/ | 2017-08-01 21:35 | - | |
| php-punic/ | 2017-08-09 15:45 | - | |
| php-react-cache/ | 2017-08-09 16:17 | - | |
| php-react-child-process/ | 2017-08-09 16:32 | - | |
| php-react-dns/ | 2018-08-29 15:55 | - | |
| php-react-event-loop/ | 2017-08-09 16:52 | - | |
| php-react-http-client/ | 2017-08-09 17:25 | - | |
| php-react-http/ | 2017-08-09 17:09 | - | |
| php-react-promise-stream/ | 2018-08-29 15:59 | - | |
| php-react-promise-timer/ | 2017-08-09 17:57 | - | |
| php-react-promise/ | 2017-08-09 17:41 | - | |
| php-react-socket-client/ | 2017-08-09 18:26 | - | |
| php-react-socket/ | 2017-08-09 18:11 | - | |
| php-react-stream/ | 2017-08-09 18:41 | - | |
| php-react/ | 2017-08-01 21:41 | - | |
| php-ringcentral-psr7/ | 2018-08-29 16:01 | - | |
| php-robrichards-xmlseclibs/ | 2017-08-09 19:11 | - | |
| php-robrichards-xmlseclibs1/ | 2017-08-09 18:56 | - | |
| php-robrichards-xmlseclibs3/ | 2018-08-29 16:04 | - | |
| php-sabre-dav/ | 2017-08-09 19:26 | - | |
| php-sabre-event/ | 2017-08-09 19:43 | - | |
| php-sabre-http/ | 2018-08-29 16:07 | - | |
| php-sabre-uri/ | 2017-08-09 20:14 | - | |
| php-sabre-vobject/ | 2017-08-09 20:29 | - | |
| php-sabre-xml/ | 2017-08-09 20:45 | - | |
| php-sabredav-Sabre/ | 2017-08-01 22:12 | - | |
| php-sabredav-Sabre_VObject/ | 2016-08-12 16:08 | - | |
| php-scssphp/ | 2018-08-29 16:10 | - | |
| php-sebastian-global-state/ | 2017-08-09 21:16 | - | |
| php-sebastian-recursion-context/ | 2017-08-09 21:32 | - | |
| php-seld-cli-prompt/ | 2017-08-02 12:50 | - | |
| php-seld-phar-utils/ | 2017-08-02 12:50 | - | |
| php-sentry/ | 2017-08-09 21:47 | - | |
| php-silex/ | 2018-08-29 16:13 | - | |
| php-simplepie/ | 2017-08-09 22:04 | - | |
| php-simplesamlphp-saml2/ | 2018-08-29 16:20 | - | |
| php-simplesamlphp-saml2_1/ | 2018-08-29 16:17 | - | |
| php-smbclient/ | 2017-08-01 22:45 | - | |
| php-solarium/ | 2017-08-09 22:48 | - | |
| php-stack-builder/ | 2018-08-29 16:23 | - | |
| php-stecman-symfony-console-completion/ | 2018-08-29 16:26 | - | |
| php-swift-Swift/ | 2016-08-12 16:18 | - | |
| php-swiftmailer/ | 2018-09-05 16:27 | - | |
| php-symfony-icu/ | 2016-08-12 16:19 | - | |
| php-symfony-polyfill/ | 2018-08-29 16:37 | - | |
| php-symfony-psr-http-message-bridge/ | 2018-08-29 16:40 | - | |
| php-symfony-security-acl/ | 2018-08-29 16:43 | - | |
| php-symfony/ | 2019-02-23 08:15 | - | |
| php-tcpdf/ | 2019-02-23 08:20 | - | |
| php-tecnickcom-tc-lib-barcode/ | 2017-08-10 00:54 | - | |
| php-tecnickcom-tc-lib-color/ | 2017-08-10 01:12 | - | |
| php-theseer-autoload/ | 2018-08-29 16:47 | - | |
| php-theseer-directoryscanner/ | 2017-08-10 01:42 | - | |
| php-theseer-fDOMDocument/ | 2017-08-10 01:59 | - | |
| php-tracy/ | 2017-08-02 12:50 | - | |
| php-true-punycode/ | 2017-08-10 02:15 | - | |
| php-twig-extensions/ | 2019-02-23 08:23 | - | |
| php-twig/ | 2017-08-10 02:30 | - | |
| php-udan11-sql-parser/ | 2017-08-10 02:50 | - | |
| php-vlucas-phpdotenv/ | 2018-08-29 16:52 | - | |
| php-voms-admin/ | 2017-08-01 23:29 | - | |
| php-webmozart-assert/ | 2018-08-29 16:55 | - | |
| php-webmozart-path-util/ | 2017-08-10 03:20 | - | |
| php-whitehat101-apr1-md5/ | 2017-08-10 03:35 | - | |
| php-xcache/ | 2016-08-12 16:27 | - | |
| php-xmlseclibs/ | 2017-08-10 03:50 | - | |
| php-xmpphp/ | 2016-08-12 16:28 | - | |
| php-zendframework-zend-diactoros/ | 2018-09-02 03:04 | - | |
| php-zendframework-zendpdf/ | 2018-09-02 03:07 | - | |
| php-zendframework-zendxml/ | 2018-09-02 03:11 | - | |
| php-zetacomponents-base/ | 2018-09-02 03:14 | - | |
| php-zetacomponents-console-tools/ | 2018-09-02 03:17 | - | |
| php-zetacomponents-document/ | 2018-09-02 03:20 | - | |
| php-zetacomponents-graph/ | 2019-02-25 16:20 | - | |
| php-zetacomponents-unit-test/ | 2017-08-02 12:50 | - | |
| php-zipstream/ | 2016-08-12 16:32 | - | |
| php-znerol-php-stringprep/ | 2018-09-02 03:26 | - | |
| phpMyAdmin/ | 2018-08-29 15:06 | - | |
| phpPgAdmin/ | 2016-08-12 15:35 | - | |
| phpldapadmin/ | 2018-08-29 14:46 | - | |
| phpwapmail/ | 2016-08-12 16:26 | - | |
| phrel/ | 2016-08-12 16:33 | - | |
| physfs/ | 2018-09-02 03:29 | - | |
| picard/ | 2019-02-28 19:38 | - | |
| picketbox-commons/ | 2017-08-02 00:03 | - | |
| picketbox-xacml/ | 2017-08-02 00:09 | - | |
| picocom/ | 2017-08-02 00:14 | - | |
| picosat/ | 2019-02-28 19:42 | - | |
| pidgin-epel/ | 2016-08-12 16:34 | - | |
| pidgin-groupchat-typing-notifications/ | 2019-02-25 16:27 | - | |
| pidgin-otr/ | 2017-08-02 12:50 | - | |
| pidgin-sipe/ | 2016-08-12 16:36 | - | |
| pidgin-toobars/ | 2017-08-02 00:21 | - | |
| pidgin-window-merge/ | 2017-08-02 12:50 | - | |
| piglit/ | 2018-09-02 03:36 | - | |
| pigz/ | 2017-08-02 00:27 | - | |
| pinta/ | 2019-03-21 07:00 | - | |
| pipelight-selinux/ | 2016-08-12 16:40 | - | |
| pisg/ | 2017-08-02 00:32 | - | |
| pix/ | 2018-09-02 04:16 | - | |
| pjproject/ | 2017-08-02 12:50 | - | |
| pkcs11-helper/ | 2016-08-12 16:41 | - | |
| pkgdiff/ | 2016-08-12 16:41 | - | |
| pkgwat/ | 2017-08-02 00:33 | - | |
| pki-usgov-dod-cacerts/ | 2016-08-12 16:42 | - | |
| planet/ | 2017-08-02 00:36 | - | |
| plasma-oxygen/ | 2019-03-21 07:02 | - | |
| platform/ | 2017-08-02 00:40 | - | |
| plib/ | 2017-08-02 00:42 | - | |
| plotnetcfg/ | 2016-08-12 16:44 | - | |
| plotutils/ | 2018-09-02 04:26 | - | |
| plowshare/ | 2016-08-12 16:44 | - | |
| plplot/ | 2019-02-25 16:36 | - | |
| pluma/ | 2017-08-02 12:50 | - | |
| pmix/ | 2016-08-12 16:46 | - | |
| pmount/ | 2016-08-12 16:46 | - | |
| pnglite/ | 2016-08-12 16:47 | - | |
| pngquant/ | 2017-08-02 00:53 | - | |
| pnp4nagios/ | 2016-08-12 16:48 | - | |
| po-debconf/ | 2018-09-02 05:03 | - | |
| po4a/ | 2017-08-02 12:50 | - | |
| poco/ | 2018-09-02 04:32 | - | |
| podofo/ | 2016-08-12 16:50 | - | |
| polkit-gnome/ | 2018-09-02 05:06 | - | |
| polkit-qt5-1/ | 2017-08-02 12:50 | - | |
| poly2tri/ | 2016-08-12 16:57 | - | |
| popub/ | 2019-03-21 07:04 | - | |
| portals-pom/ | 2016-08-12 16:58 | - | |
| portaudio/ | 2017-08-02 12:50 | - | |
| portlet-2.0-api/ | 2017-08-02 01:01 | - | |
| portmidi/ | 2017-08-02 01:06 | - | |
| postbooks/ | 2019-03-05 04:04 | - | |
| postgis/ | 2018-09-02 05:15 | - | |
| postgresql-pgpool-II/ | 2017-08-02 01:17 | - | |
| postgresql-plruby/ | 2016-08-12 17:05 | - | |
| postgrey/ | 2016-08-12 17:07 | - | |
| potrace/ | 2018-09-02 05:21 | - | |
| powerman/ | 2019-02-28 19:57 | - | |
| pptpd/ | 2016-08-12 17:12 | - | |
| preeny/ | 2018-09-02 05:27 | - | |
| prelude-correlator/ | 2019-03-21 07:06 | - | |
| prelude-lml-rules/ | 2018-09-02 05:34 | - | |
| prelude-lml/ | 2019-03-21 07:08 | - | |
| prelude-manager/ | 2019-03-21 07:10 | - | |
| prename/ | 2018-09-02 05:39 | - | |
| preprocess/ | 2017-08-02 12:50 | - | |
| prestopalette/ | 2018-09-02 05:41 | - | |
| prettyping/ | 2018-09-02 05:45 | - | |
| prewikka/ | 2018-09-02 05:48 | - | |
| primer3/ | 2017-08-02 01:33 | - | |
| privoxy/ | 2017-08-02 01:35 | - | |
| procServ/ | 2018-09-02 05:51 | - | |
| procenv/ | 2016-08-12 17:15 | - | |
| procyon/ | 2019-02-25 17:02 | - | |
| proftpd/ | 2018-09-02 05:57 | - | |
| proj/ | 2017-08-02 01:44 | - | |
| prosody/ | 2019-02-25 17:06 | - | |
| protobuf-c/ | 2016-08-12 17:18 | - | |
| protobuf/ | 2017-08-02 01:49 | - | |
| prwd/ | 2016-08-12 17:19 | - | |
| ps2eps/ | 2016-08-12 17:20 | - | |
| psblas3/ | 2019-02-25 17:09 | - | |
| psi-plus/ | 2019-02-25 17:43 | - | |
| pslib/ | 2016-08-12 17:21 | - | |
| pspg/ | 2019-03-06 23:20 | - | |
| pssh/ | 2017-08-02 01:59 | - | |
| pstoedit/ | 2018-10-15 18:44 | - | |
| pstreams-devel/ | 2016-08-12 17:21 | - | |
| psysh/ | 2018-09-02 06:37 | - | |
| ptpd/ | 2017-08-02 02:03 | - | |
| ptpython/ | 2018-09-02 06:41 | - | |
| ptrash/ | 2016-08-12 17:22 | - | |
| pugixml/ | 2017-08-02 02:09 | - | |
| pulledpork/ | 2018-09-02 06:43 | - | |
| pungi/ | 2016-08-12 17:24 | - | |
| puppet-firewalld/ | 2016-08-12 17:24 | - | |
| puppet/ | 2017-08-02 02:13 | - | |
| puppetlabs-stdlib/ | 2018-09-02 06:46 | - | |
| pure-ftpd/ | 2019-03-21 07:12 | - | |
| purple-discord/ | 2019-02-25 17:54 | - | |
| purple-facebook/ | 2019-02-25 17:58 | - | |
| purple-hangouts/ | 2019-02-25 18:01 | - | |
| purple-libsteam/ | 2018-09-02 07:00 | - | |
| purple-matrix/ | 2018-09-02 07:04 | - | |
| purple-mattermost/ | 2018-09-02 07:07 | - | |
| purple-skypeweb/ | 2018-09-02 07:11 | - | |
| putty/ | 2018-09-02 07:14 | - | |
| pv/ | 2017-08-02 02:43 | - | |
| pwauth/ | 2016-08-12 17:25 | - | |
| pwgen/ | 2018-09-02 07:19 | - | |
| pwkickstart/ | 2018-09-02 07:21 | - | |
| pxz/ | 2017-08-02 02:46 | - | |
| py-bcrypt/ | 2016-08-12 17:27 | - | |
| py-radix/ | 2016-08-12 17:41 | - | |
| py4j/ | 2019-02-25 18:05 | - | |
| pyPdf/ | 2018-09-02 07:49 | - | |
| pybugz/ | 2016-08-12 17:28 | - | |
| pycdio/ | 2016-08-12 17:29 | - | |
| pychart/ | 2016-08-12 17:30 | - | |
| pychecker/ | 2016-08-12 17:30 | - | |
| pycmd/ | 2019-02-25 18:07 | - | |
| pycolumnize/ | 2016-08-12 17:33 | - | |
| pycryptopp/ | 2017-08-02 02:50 | - | |
| pydot/ | 2018-09-02 07:34 | - | |
| pyelftools/ | 2016-08-14 13:08 | - | |
| pyephem/ | 2017-08-02 02:55 | - | |
| pyexiv2/ | 2019-02-25 18:10 | - | |
| pyfits/ | 2017-08-02 12:50 | - | |
| pyflakes/ | 2019-02-25 18:13 | - | |
| pygoocanvas/ | 2018-09-02 07:42 | - | |
| pygtksourceview/ | 2016-08-12 17:35 | - | |
| pyhoca-cli/ | 2016-08-12 17:35 | - | |
| pyhoca-gui/ | 2016-08-14 13:10 | - | |
| pyicu/ | 2019-03-21 07:17 | - | |
| pylibacl/ | 2016-08-12 17:37 | - | |
| pylint/ | 2019-02-25 18:17 | - | |
| pynag/ | 2016-08-12 17:37 | - | |
| pyodbc/ | 2016-08-12 17:38 | - | |
| pyotherside/ | 2019-03-21 07:19 | - | |
| pyp2rpm/ | 2016-08-14 13:11 | - | |
| pypolicyd-spf/ | 2018-09-02 07:52 | - | |
| pyproj/ | 2018-09-02 07:54 | - | |
| pypy/ | 2017-08-02 03:09 | - | |
| pyrasite/ | 2016-08-12 17:42 | - | |
| pyrrd/ | 2016-08-12 17:44 | - | |
| pyscard/ | 2016-08-12 17:45 | - | |
| pysendfile/ | 2016-08-12 17:46 | - | |
| pyshp/ | 2016-08-12 17:47 | - | |
| pyside-tools/ | 2019-03-21 07:21 | - | |
| pysnmp/ | 2016-08-12 17:50 | - | |
| pystache/ | 2017-08-02 12:50 | - | |
| pysubnettree/ | 2016-08-12 17:52 | - | |
| pysvn/ | 2017-08-02 12:50 | - | |
| pythia8/ | 2019-03-21 07:23 | - | |
| python-BeautifulSoup/ | 2016-08-12 19:15 | - | |
| python-Bottleneck/ | 2017-08-02 12:50 | - | |
| python-CDDB/ | 2016-08-12 19:46 | - | |
| python-GeoIP/ | 2016-08-12 20:59 | - | |
| python-GnuPGInterface/ | 2016-08-12 21:06 | - | |
| python-GridDataFormats/ | 2016-08-12 21:07 | - | |
| python-Levenshtein/ | 2016-08-12 21:26 | - | |
| python-OWSLib/ | 2016-08-12 22:13 | - | |
| python-PyGithub/ | 2019-02-26 19:33 | - | |
| python-PyMySQL/ | 2019-02-26 19:41 | - | |
| python-SecretStorage/ | 2016-08-12 23:22 | - | |
| python-TurboMail/ | 2016-08-12 23:57 | - | |
| python-XStatic-Angular-Bootstrap/ | 2017-08-02 12:50 | - | |
| python-XStatic-Angular-Cookies/ | 2016-08-14 14:41 | - | |
| python-XStatic-Angular-Mock/ | 2016-08-14 14:42 | - | |
| python-XStatic-Angular-lrdragndrop/ | 2017-08-02 12:50 | - | |
| python-XStatic-Angular/ | 2018-10-17 03:41 | - | |
| python-XStatic-Bootstrap-Datepicker/ | 2017-08-02 12:50 | - | |
| python-XStatic-Bootstrap-SCSS/ | 2016-08-14 14:44 | - | |
| python-XStatic-D3/ | 2017-08-02 12:50 | - | |
| python-XStatic-DataTables/ | 2018-10-17 03:44 | - | |
| python-XStatic-Font-Awesome/ | 2016-08-14 14:45 | - | |
| python-XStatic-Hogan/ | 2017-08-02 12:50 | - | |
| python-XStatic-JQuery-Migrate/ | 2016-08-14 14:47 | - | |
| python-XStatic-JQuery-TableSorter/ | 2016-08-14 14:48 | - | |
| python-XStatic-JQuery-quicksearch/ | 2017-08-02 12:50 | - | |
| python-XStatic-JSEncrypt/ | 2016-08-14 14:49 | - | |
| python-XStatic-Jasmine/ | 2016-08-14 14:46 | - | |
| python-XStatic-Magic-Search/ | 2017-08-02 12:50 | - | |
| python-XStatic-Patternfly/ | 2018-10-17 03:49 | - | |
| python-XStatic-QUnit/ | 2016-08-14 14:51 | - | |
| python-XStatic-Rickshaw/ | 2017-08-02 12:50 | - | |
| python-XStatic-Spin/ | 2016-08-14 14:53 | - | |
| python-XStatic-jQuery/ | 2016-08-13 00:36 | - | |
| python-XStatic-jquery-ui/ | 2018-10-17 03:46 | - | |
| python-XStatic-roboto-fontface/ | 2016-08-14 14:52 | - | |
| python-XStatic-smart-table/ | 2017-08-02 12:50 | - | |
| python-XStatic-termjs/ | 2017-08-02 12:50 | - | |
| python-XStatic/ | 2018-10-17 03:39 | - | |
| python-acme/ | 2019-02-25 22:17 | - | |
| python-adal/ | 2018-09-02 12:24 | - | |
| python-aexpect/ | 2018-09-02 12:26 | - | |
| python-affinity/ | 2018-09-02 12:29 | - | |
| python-aiosmtpd/ | 2019-02-25 22:20 | - | |
| python-alembic/ | 2017-08-02 12:50 | - | |
| python-amqp/ | 2019-02-25 22:22 | - | |
| python-amqplib/ | 2016-08-12 18:48 | - | |
| python-aniso8601/ | 2016-08-12 18:50 | - | |
| python-ansible-runner/ | 2018-09-02 12:36 | - | |
| python-ansible-tower-cli/ | 2018-09-02 12:39 | - | |
| python-anyconfig/ | 2018-09-02 12:42 | - | |
| python-anyjson/ | 2016-08-12 18:51 | - | |
| python-anykeystore/ | 2017-08-02 12:50 | - | |
| python-anymarkup/ | 2017-08-02 12:50 | - | |
| python-apipkg/ | 2016-08-12 18:54 | - | |
| python-appdirs/ | 2017-08-02 07:57 | - | |
| python-application/ | 2016-08-12 18:55 | - | |
| python-apsw/ | 2019-03-21 09:57 | - | |
| python-argcomplete/ | 2017-08-02 08:01 | - | |
| python-argh/ | 2018-09-02 12:47 | - | |
| python-args/ | 2018-09-02 12:49 | - | |
| python-arrow/ | 2019-02-25 22:27 | - | |
| python-asciitree/ | 2018-09-02 12:54 | - | |
| python-ase/ | 2017-08-02 08:11 | - | |
| python-asn1crypto/ | 2019-02-25 22:29 | - | |
| python-assimulo/ | 2018-09-02 12:57 | - | |
| python-astroid/ | 2019-02-25 22:31 | - | |
| python-astropy/ | 2017-08-02 12:50 | - | |
| python-async/ | 2016-08-12 19:06 | - | |
| python-atpublic/ | 2019-03-21 10:00 | - | |
| python-attrs/ | 2019-02-25 22:35 | - | |
| python-auth-credential/ | 2016-08-12 19:07 | - | |
| python-avocado/ | 2019-02-25 22:37 | - | |
| python-azure-sdk/ | 2018-09-02 13:11 | - | |
| python-azure-storage/ | 2018-09-02 13:18 | - | |
| python-backlash/ | 2016-08-12 19:08 | - | |
| python-backports-functools_lru_cache/ | 2018-09-02 13:23 | - | |
| python-backports-shutil_get_terminal_size/ | 2018-09-02 13:25 | - | |
| python-backports_abc/ | 2019-02-25 22:39 | - | |
| python-basemap-data/ | 2017-08-02 08:54 | - | |
| python-basemap/ | 2019-02-25 22:41 | - | |
| python-bcdoc/ | 2016-08-12 19:13 | - | |
| python-bcrypt/ | 2018-09-02 13:30 | - | |
| python-beanbag/ | 2019-02-25 22:44 | - | |
| python-beautifulsoup4/ | 2017-08-02 12:50 | - | |
| python-behave/ | 2018-09-02 13:35 | - | |
| python-betamax/ | 2018-09-02 13:38 | - | |
| python-billiard/ | 2019-02-25 22:46 | - | |
| python-binaryornot/ | 2018-09-02 13:41 | - | |
| python-biopython/ | 2018-09-02 13:44 | - | |
| python-bitarray/ | 2019-03-21 10:01 | - | |
| python-bitlyapi/ | 2016-08-12 19:21 | - | |
| python-bitmath/ | 2018-09-02 13:50 | - | |
| python-bitstring/ | 2018-09-02 13:52 | - | |
| python-bleach/ | 2017-08-02 12:50 | - | |
| python-blessed/ | 2019-02-25 22:51 | - | |
| python-blessings/ | 2016-08-12 19:25 | - | |
| python-blist/ | 2016-08-12 19:26 | - | |
| python-bloom/ | 2017-08-02 12:50 | - | |
| python-blosc/ | 2019-03-21 10:04 | - | |
| python-boto/ | 2017-08-02 09:23 | - | |
| python-boto3/ | 2018-09-02 14:00 | - | |
| python-botocore/ | 2018-09-02 14:03 | - | |
| python-bottle/ | 2019-02-25 22:55 | - | |
| python-breathe/ | 2019-02-25 22:57 | - | |
| python-bsddb3/ | 2019-03-21 10:06 | - | |
| python-bugzilla/ | 2018-09-02 14:10 | - | |
| python-bugzilla2fedmsg/ | 2017-08-02 12:50 | - | |
| python-bunch/ | 2016-08-12 19:35 | - | |
| python-bz2file/ | 2018-09-02 14:13 | - | |
| python-cached_property/ | 2019-02-25 23:01 | - | |
| python-cachetools/ | 2016-08-12 19:38 | - | |
| python-cairocffi/ | 2016-08-12 19:39 | - | |
| python-cairosvg/ | 2016-08-12 19:40 | - | |
| python-caja/ | 2018-09-02 14:17 | - | |
| python-camel/ | 2019-02-25 23:03 | - | |
| python-carbon/ | 2018-09-02 14:25 | - | |
| python-cassandra-driver/ | 2018-09-02 14:28 | - | |
| python-catkin-sphinx/ | 2019-02-25 23:05 | - | |
| python-catkin_pkg/ | 2017-08-02 12:50 | - | |
| python-catkin_tools/ | 2017-08-02 12:50 | - | |
| python-cccolutils/ | 2018-09-02 14:31 | - | |
| python-celery/ | 2019-02-25 23:07 | - | |
| python-certbot-apache/ | 2019-02-25 23:10 | - | |
| python-certbot-dns-cloudflare/ | 2019-02-25 23:15 | - | |
| python-certbot-dns-cloudxns/ | 2019-02-25 23:18 | - | |
| python-certbot-dns-digitalocean/ | 2019-02-25 23:21 | - | |
| python-certbot-dns-dnsimple/ | 2019-02-25 23:24 | - | |
| python-certbot-dns-dnsmadeeasy/ | 2019-02-25 23:27 | - | |
| python-certbot-dns-gehirn/ | 2019-02-25 23:30 | - | |
| python-certbot-dns-google/ | 2019-02-25 23:33 | - | |
| python-certbot-dns-linode/ | 2019-02-25 23:37 | - | |
| python-certbot-dns-luadns/ | 2019-02-25 23:40 | - | |
| python-certbot-dns-nsone/ | 2019-02-25 23:43 | - | |
| python-certbot-dns-ovh/ | 2019-02-25 23:46 | - | |
| python-certbot-dns-rfc2136/ | 2019-02-25 23:49 | - | |
| python-certbot-dns-route53/ | 2019-02-25 23:52 | - | |
| python-certbot-dns-sakuracloud/ | 2019-02-25 23:54 | - | |
| python-certbot-nginx/ | 2019-02-25 23:57 | - | |
| python-certifi/ | 2019-02-26 00:01 | - | |
| python-cffi/ | 2016-08-12 19:46 | - | |
| python-chai/ | 2019-02-26 00:03 | - | |
| python-chameleon/ | 2016-08-12 19:47 | - | |
| python-cheetah/ | 2016-08-12 19:48 | - | |
| python-cherrypy2/ | 2018-09-02 15:24 | - | |
| python-chm/ | 2016-08-12 19:49 | - | |
| python-cjson/ | 2018-09-02 15:27 | - | |
| python-click/ | 2019-02-26 00:05 | - | |
| python-cliff-tablib/ | 2016-08-12 19:51 | - | |
| python-cliff/ | 2017-08-02 10:08 | - | |
| python-clint/ | 2018-09-02 15:32 | - | |
| python-cloudfiles/ | 2018-09-02 15:34 | - | |
| python-cloudflare/ | 2018-09-02 15:37 | - | |
| python-cltk/ | 2016-08-12 19:52 | - | |
| python-clyent/ | 2019-02-26 00:07 | - | |
| python-cmd2/ | 2016-08-12 19:52 | - | |
| python-cmdln/ | 2016-08-12 19:53 | - | |
| python-colander/ | 2016-08-14 13:15 | - | |
| python-collada/ | 2019-02-26 00:09 | - | |
| python-collectd_cvmfs/ | 2019-02-26 00:11 | - | |
| python-collectd_systemd/ | 2019-02-26 00:14 | - | |
| python-colorama/ | 2016-08-12 19:54 | - | |
| python-colorclass/ | 2019-02-26 00:17 | - | |
| python-configargparse/ | 2018-09-02 15:51 | - | |
| python-configparser/ | 2016-08-12 19:55 | - | |
| python-construct/ | 2016-08-12 19:55 | - | |
| python-contextlib2/ | 2019-02-26 00:19 | - | |
| python-cookies/ | 2019-02-26 00:21 | - | |
| python-copr/ | 2018-09-02 15:58 | - | |
| python-cornice/ | 2017-08-02 12:50 | - | |
| python-cov-core/ | 2019-02-26 00:23 | - | |
| python-cpopen/ | 2017-08-02 10:31 | - | |
| python-cpuinfo/ | 2016-08-12 20:00 | - | |
| python-cram/ | 2018-09-02 16:03 | - | |
| python-crank/ | 2016-08-12 20:01 | - | |
| python-croniter/ | 2016-08-12 20:01 | - | |
| python-crypto/ | 2019-03-21 10:08 | - | |
| python-cryptography-vectors/ | 2016-08-12 20:02 | - | |
| python-cssmin/ | 2016-08-12 20:02 | - | |
| python-cssselect/ | 2016-08-12 20:03 | - | |
| python-cvss/ | 2018-09-02 16:07 | - | |
| python-cytoolz/ | 2019-03-21 10:10 | - | |
| python-d2to1/ | 2016-08-12 20:03 | - | |
| python-daemon/ | 2016-08-14 13:17 | - | |
| python-datadog/ | 2019-02-26 00:29 | - | |
| python-datanommer-consumer/ | 2017-08-02 12:50 | - | |
| python-datanommer-models/ | 2018-09-02 16:12 | - | |
| python-dbusmock/ | 2019-02-26 00:31 | - | |
| python-ddt/ | 2019-02-26 15:11 | - | |
| python-debian/ | 2017-08-02 10:48 | - | |
| python-debrepo/ | 2018-10-16 09:30 | - | |
| python-decoratortools/ | 2016-08-12 20:07 | - | |
| python-defusedxml/ | 2019-02-26 15:13 | - | |
| python-demjson/ | 2019-02-26 15:15 | - | |
| python-dialog/ | 2016-08-12 20:09 | - | |
| python-dict-sorted/ | 2018-10-16 09:37 | - | |
| python-dictdiffer/ | 2019-02-26 15:17 | - | |
| python-digitalocean/ | 2019-02-26 15:20 | - | |
| python-dingus/ | 2016-08-12 20:10 | - | |
| python-dirq/ | 2017-08-02 10:57 | - | |
| python-distro/ | 2018-10-16 09:42 | - | |
| python-distroinfo/ | 2019-02-26 15:23 | - | |
| python-distutils-extra/ | 2019-02-26 15:26 | - | |
| python-django-ajax-selects/ | 2019-02-26 15:36 | - | |
| python-django-angular/ | 2016-08-12 20:12 | - | |
| python-django-appconf/ | 2016-08-12 20:12 | - | |
| python-django-babel/ | 2016-08-12 20:13 | - | |
| python-django-compressor/ | 2016-08-12 20:13 | - | |
| python-django-evolution/ | 2017-08-02 12:50 | - | |
| python-django-fas/ | 2016-08-12 20:14 | - | |
| python-django-federated-login/ | 2017-08-02 12:50 | - | |
| python-django-filter/ | 2019-02-26 15:39 | - | |
| python-django-haystack/ | 2018-10-16 09:56 | - | |
| python-django-helpdesk/ | 2018-10-16 10:00 | - | |
| python-django-model-utils/ | 2018-10-16 10:03 | - | |
| python-django-multiselectfield/ | 2018-10-16 10:06 | - | |
| python-django-nose/ | 2016-08-12 20:17 | - | |
| python-django-pipeline/ | 2018-10-16 10:08 | - | |
| python-django-piston/ | 2018-10-16 10:11 | - | |
| python-django-pyscss/ | 2016-08-12 20:19 | - | |
| python-django-redis/ | 2018-10-16 10:14 | - | |
| python-django-south/ | 2018-10-16 10:17 | - | |
| python-django-tagging/ | 2016-08-12 20:20 | - | |
| python-django-tastypie/ | 2018-10-16 10:19 | - | |
| python-django-threadedcomments/ | 2018-10-16 10:22 | - | |
| python-django/ | 2019-02-26 15:28 | - | |
| python-django16/ | 2019-02-26 15:32 | - | |
| python-djblets/ | 2018-10-16 10:25 | - | |
| python-djvulibre/ | 2018-10-16 10:28 | - | |
| python-dns-lexicon/ | 2019-02-26 15:42 | - | |
| python-docker-scripts/ | 2018-10-16 10:36 | - | |
| python-dockerfile-parse/ | 2016-08-12 20:21 | - | |
| python-dockerpty/ | 2019-02-26 15:45 | - | |
| python-docopt/ | 2019-02-26 15:47 | - | |
| python-dogpile-cache/ | 2018-10-16 10:41 | - | |
| python-dogpile-core/ | 2016-08-12 20:24 | - | |
| python-dpath/ | 2018-10-16 10:44 | - | |
| python-drat/ | 2016-08-12 20:25 | - | |
| python-dulwich/ | 2018-10-16 10:46 | - | |
| python-dumptruck/ | 2016-08-12 20:26 | - | |
| python-easyargs/ | 2019-02-26 15:49 | - | |
| python-easygui/ | 2019-02-26 15:51 | - | |
| python-ecdsa/ | 2019-02-26 15:53 | - | |
| python-editor/ | 2016-08-12 20:27 | - | |
| python-elasticsearch/ | 2018-10-16 10:55 | - | |
| python-elfdata/ | 2016-08-12 20:28 | - | |
| python-elixir/ | 2016-08-12 20:28 | - | |
| python-email_reply_parser/ | 2016-08-12 20:29 | - | |
| python-empy/ | 2019-02-26 15:55 | - | |
| python-enchant/ | 2016-08-12 20:30 | - | |
| python-enlighten/ | 2019-02-26 15:57 | - | |
| python-enum/ | 2018-10-16 11:01 | - | |
| python-enum34/ | 2016-08-12 20:31 | - | |
| python-epdb/ | 2016-08-12 20:32 | - | |
| python-epi/ | 2018-10-16 11:04 | - | |
| python-epub/ | 2018-10-16 11:06 | - | |
| python-espeak/ | 2016-08-12 20:33 | - | |
| python-eventlet/ | 2018-10-16 11:09 | - | |
| python-execnet/ | 2019-02-26 15:59 | - | |
| python-extras/ | 2016-08-12 20:34 | - | |
| python-eyed3/ | 2016-08-12 20:35 | - | |
| python-f5-icontrol-rest/ | 2018-10-16 11:14 | - | |
| python-f5-sdk/ | 2018-10-16 11:17 | - | |
| python-fabulous/ | 2016-08-12 20:35 | - | |
| python-fadvise/ | 2018-10-16 11:20 | - | |
| python-falcon/ | 2019-03-21 10:12 | - | |
| python-fastcache/ | 2016-08-12 20:36 | - | |
| python-fasteners/ | 2017-08-02 12:50 | - | |
| python-fauxquests/ | 2018-10-16 11:25 | - | |
| python-fdb/ | 2018-10-16 11:28 | - | |
| python-fedbadges/ | 2018-10-16 11:31 | - | |
| python-fedimg/ | 2018-10-16 11:34 | - | |
| python-fedmsg-atomic-composer/ | 2018-10-16 11:37 | - | |
| python-fedmsg-genacls/ | 2018-10-16 11:40 | - | |
| python-fedmsg-meta-fedora-infrastructure/ | 2019-02-26 16:03 | - | |
| python-fedora/ | 2018-10-16 11:46 | - | |
| python-feedparser/ | 2016-08-12 20:41 | - | |
| python-filelock/ | 2019-02-26 16:07 | - | |
| python-fixtures/ | 2016-08-12 20:41 | - | |
| python-flake8/ | 2017-08-02 12:50 | - | |
| python-flask-admin/ | 2016-08-12 20:43 | - | |
| python-flask-babel/ | 2018-10-16 11:52 | - | |
| python-flask-cache/ | 2016-08-12 20:44 | - | |
| python-flask-login/ | 2018-10-16 11:54 | - | |
| python-flask-mako/ | 2016-08-12 20:45 | - | |
| python-flask-migrate/ | 2018-10-16 11:57 | - | |
| python-flask-multistatic/ | 2018-10-16 12:00 | - | |
| python-flask-oidc/ | 2018-10-16 12:03 | - | |
| python-flask-openid/ | 2018-10-16 12:05 | - | |
| python-flask-restful/ | 2018-10-16 12:08 | - | |
| python-flask-rstpages/ | 2016-08-12 20:47 | - | |
| python-flask-script/ | 2018-10-16 12:11 | - | |
| python-flask-sqlalchemy/ | 2018-10-16 12:14 | - | |
| python-flask-whooshalchemy/ | 2017-08-02 12:50 | - | |
| python-flask-wtf/ | 2016-08-14 13:32 | - | |
| python-flask-xml-rpc/ | 2016-08-12 20:49 | - | |
| python-flexmock/ | 2019-02-26 16:09 | - | |
| python-flock/ | 2018-10-16 12:19 | - | |
| python-flufl-bounce/ | 2019-02-26 16:11 | - | |
| python-flufl-i18n/ | 2019-02-26 16:13 | - | |
| python-flufl-lock/ | 2019-02-26 16:16 | - | |
| python-flufl-testing/ | 2019-02-26 16:17 | - | |
| python-fluidity-sm/ | 2016-08-12 20:50 | - | |
| python-flup/ | 2016-08-12 20:51 | - | |
| python-fmn-consumer/ | 2018-10-16 12:29 | - | |
| python-fmn-lib/ | 2018-10-16 12:33 | - | |
| python-fmn-rules/ | 2018-10-16 12:36 | - | |
| python-fmn-web/ | 2018-10-16 12:39 | - | |
| python-fn/ | 2016-08-12 20:54 | - | |
| python-fontname/ | 2016-08-14 13:36 | - | |
| python-formencode/ | 2017-08-02 12:50 | - | |
| python-freetype/ | 2016-08-12 20:55 | - | |
| python-freezegun/ | 2019-02-26 16:20 | - | |
| python-fudge/ | 2016-08-14 13:37 | - | |
| python-funcparserlib/ | 2018-10-16 12:44 | - | |
| python-funcsigs/ | 2018-10-16 12:47 | - | |
| python-futures/ | 2018-10-16 12:50 | - | |
| python-gammu/ | 2019-03-21 10:14 | - | |
| python-gear/ | 2019-02-26 16:24 | - | |
| python-genshi/ | 2016-08-12 20:58 | - | |
| python-gensim/ | 2016-08-12 20:58 | - | |
| python-geoip-geolite2/ | 2016-08-12 21:00 | - | |
| python-geoip2/ | 2019-02-26 16:27 | - | |
| python-geojson/ | 2017-08-02 12:50 | - | |
| python-gflags/ | 2016-08-12 21:03 | - | |
| python-gfm/ | 2018-10-16 12:58 | - | |
| python-gitdb/ | 2018-10-16 13:01 | - | |
| python-gitlab/ | 2018-10-16 13:04 | - | |
| python-gmpy2/ | 2016-08-12 21:04 | - | |
| python-gnupg/ | 2018-10-16 13:07 | - | |
| python-google-auth/ | 2019-02-26 16:29 | - | |
| python-grapefruit/ | 2016-08-12 21:06 | - | |
| python-graphitesend/ | 2018-10-16 13:09 | - | |
| python-grokmirror/ | 2018-10-16 13:12 | - | |
| python-hexdump/ | 2019-02-26 16:32 | - | |
| python-hgdistver/ | 2016-08-12 21:08 | - | |
| python-html2text/ | 2018-10-16 13:16 | - | |
| python-html5lib/ | 2016-08-12 21:09 | - | |
| python-httmock/ | 2018-10-16 13:19 | - | |
| python-httplib2/ | 2018-10-16 13:22 | - | |
| python-httpretty/ | 2018-10-16 13:25 | - | |
| python-humanize/ | 2018-10-16 13:27 | - | |
| python-hypothesis/ | 2019-02-26 16:33 | - | |
| python-idna/ | 2016-08-12 21:12 | - | |
| python-idstools/ | 2019-02-26 16:36 | - | |
| python-igraph/ | 2018-10-16 13:34 | - | |
| python-impacket/ | 2018-10-16 13:37 | - | |
| python-incremental/ | 2018-10-16 13:40 | - | |
| python-inifile/ | 2018-10-16 13:43 | - | |
| python-inotify_simple/ | 2018-10-16 13:45 | - | |
| python-ipaddress/ | 2016-08-12 21:14 | - | |
| python-ipgetter/ | 2016-08-12 21:14 | - | |
| python-iptools/ | 2016-08-12 21:15 | - | |
| python-ipython_genutils/ | 2019-02-26 16:37 | - | |
| python-iso8601/ | 2019-02-26 16:40 | - | |
| python-isodate/ | 2016-08-12 21:16 | - | |
| python-isort/ | 2019-02-26 16:42 | - | |
| python-ivi/ | 2019-02-26 16:44 | - | |
| python-jaydebeapi/ | 2019-02-26 16:46 | - | |
| python-jcconv/ | 2018-10-16 13:58 | - | |
| python-jedi/ | 2019-02-26 16:48 | - | |
| python-jenkins-job-builder/ | 2019-02-26 16:50 | - | |
| python-jenkins/ | 2018-10-16 14:03 | - | |
| python-jmespath/ | 2016-08-12 21:18 | - | |
| python-josepy/ | 2018-10-16 14:09 | - | |
| python-jsonmodels/ | 2018-10-16 14:11 | - | |
| python-jsonpatch/ | 2016-08-12 21:18 | - | |
| python-jsonpath-rw-ext/ | 2016-08-14 13:39 | - | |
| python-jsonpath-rw/ | 2018-10-16 14:14 | - | |
| python-jsonpickle/ | 2018-10-16 14:17 | - | |
| python-jsonrpclib/ | 2016-08-12 21:19 | - | |
| python-jsonschema/ | 2019-02-26 16:52 | - | |
| python-junit_xml/ | 2018-10-16 14:22 | - | |
| python-junitxml/ | 2016-08-12 21:21 | - | |
| python-jupyter-core/ | 2019-02-26 16:55 | - | |
| python-jwt/ | 2016-08-14 13:42 | - | |
| python-kajiki/ | 2017-08-02 12:50 | - | |
| python-kazoo/ | 2016-08-12 21:23 | - | |
| python-kdcproxy/ | 2016-08-12 21:23 | - | |
| python-keyczar/ | 2016-08-12 21:24 | - | |
| python-keyring/ | 2019-02-26 16:57 | - | |
| python-kid/ | 2016-08-12 21:25 | - | |
| python-kombu/ | 2019-02-26 16:59 | - | |
| python-krbcontext/ | 2018-10-16 14:30 | - | |
| python-kubernetes/ | 2019-02-26 17:02 | - | |
| python-lark-parser/ | 2019-02-26 17:06 | - | |
| python-lazr-config/ | 2019-02-26 17:08 | - | |
| python-lazr-delegates/ | 2019-02-26 17:10 | - | |
| python-lazr-smtptest/ | 2019-02-26 17:12 | - | |
| python-lazy-object-proxy/ | 2019-03-21 10:16 | - | |
| python-ldap3/ | 2019-02-26 17:16 | - | |
| python-lesscpy/ | 2016-08-12 21:26 | - | |
| python-leveldb/ | 2019-03-21 10:18 | - | |
| python-lexicon/ | 2016-08-12 21:27 | - | |
| python-libarchive/ | 2016-08-12 21:27 | - | |
| python-libcloud/ | 2018-10-16 14:44 | - | |
| python-libcnml/ | 2018-10-16 14:47 | - | |
| python-libdiscid/ | 2019-03-21 10:20 | - | |
| python-libpagure/ | 2018-10-16 14:51 | - | |
| python-libqutrub/ | 2016-08-12 21:30 | - | |
| python-lightblue/ | 2018-10-16 14:54 | - | |
| python-line_profiler/ | 2016-08-12 21:31 | - | |
| python-linecache2/ | 2018-10-16 14:57 | - | |
| python-llfuse/ | 2019-03-21 10:22 | - | |
| python-lmdb/ | 2018-10-16 15:02 | - | |
| python-locket/ | 2019-02-26 17:24 | - | |
| python-lockfile/ | 2016-08-12 21:32 | - | |
| python-logbook/ | 2018-10-16 15:06 | - | |
| python-logilab-common/ | 2016-08-12 21:33 | - | |
| python-lz4/ | 2019-03-21 10:24 | - | |
| python-m2ext/ | 2016-08-12 21:33 | - | |
| python-manuel/ | 2016-08-14 13:44 | - | |
| python-marathon/ | 2018-10-16 15:11 | - | |
| python-markdown/ | 2019-02-26 17:28 | - | |
| python-marshmallow/ | 2019-02-26 17:30 | - | |
| python-maxminddb/ | 2019-03-21 10:26 | - | |
| python-mccabe/ | 2019-02-26 17:35 | - | |
| python-meld3/ | 2016-08-12 21:36 | - | |
| python-meliae/ | 2017-08-02 12:50 | - | |
| python-messaging/ | 2016-08-14 13:46 | - | |
| python-migrate/ | 2017-08-02 12:50 | - | |
| python-mimeparse/ | 2019-02-26 17:37 | - | |
| python-mimerender/ | 2018-10-16 15:25 | - | |
| python-minimock/ | 2016-08-12 21:40 | - | |
| python-mistune/ | 2018-10-16 15:28 | - | |
| python-mock/ | 2019-02-26 17:39 | - | |
| python-modestmaps/ | 2019-02-26 17:42 | - | |
| python-moksha-common/ | 2018-10-16 15:35 | - | |
| python-moksha-hub/ | 2019-02-26 17:45 | - | |
| python-moksha-wsgi/ | 2018-10-16 15:41 | - | |
| python-mongoengine/ | 2018-10-16 15:44 | - | |
| python-monotonic/ | 2016-08-12 21:44 | - | |
| python-mox/ | 2016-08-12 21:45 | - | |
| python-mox3/ | 2018-10-16 15:47 | - | |
| python-mpmath/ | 2018-10-16 15:50 | - | |
| python-msgpack/ | 2019-03-21 10:28 | - | |
| python-msrest/ | 2018-10-16 15:59 | - | |
| python-msrestazure/ | 2018-10-16 16:02 | - | |
| python-multi_key_dict/ | 2018-10-16 16:05 | - | |
| python-multilib/ | 2019-02-26 17:50 | - | |
| python-munch/ | 2016-08-12 21:47 | - | |
| python-munkres/ | 2018-10-16 16:09 | - | |
| python-mutagen/ | 2016-08-12 21:49 | - | |
| python-mwclient/ | 2018-10-16 16:12 | - | |
| python-myghty/ | 2016-08-12 21:50 | - | |
| python-naftawayh/ | 2016-08-12 21:51 | - | |
| python-narcissus-app/ | 2018-10-16 16:15 | - | |
| python-narcissus-common/ | 2017-08-02 12:50 | - | |
| python-narcissus-hub/ | 2018-10-16 16:18 | - | |
| python-nbformat/ | 2019-02-26 17:52 | - | |
| python-nbxmpp/ | 2018-10-16 16:23 | - | |
| python-ncclient/ | 2016-08-12 21:54 | - | |
| python-ndg_httpsclient/ | 2016-08-12 21:54 | - | |
| python-neo4j-driver/ | 2019-03-21 10:30 | - | |
| python-neomodel/ | 2019-02-26 17:56 | - | |
| python-neotime/ | 2018-10-16 16:31 | - | |
| python-neovim/ | 2019-02-26 17:59 | - | |
| python-netdiff/ | 2018-10-16 16:35 | - | |
| python-netifaces/ | 2016-08-12 21:55 | - | |
| python-networkmanager/ | 2018-10-16 16:38 | - | |
| python-networkx/ | 2016-08-12 21:55 | - | |
| python-ngram/ | 2018-10-16 16:41 | - | |
| python-nine/ | 2016-08-12 21:57 | - | |
| python-nitrate/ | 2019-02-26 18:01 | - | |
| python-nmrglue/ | 2018-10-16 16:46 | - | |
| python-nose-cover3/ | 2016-08-12 22:00 | - | |
| python-nose-exclude/ | 2016-08-12 22:01 | - | |
| python-nose-parameterized/ | 2016-08-12 22:01 | - | |
| python-nose-progressive/ | 2016-08-12 22:02 | - | |
| python-nose-xcover/ | 2016-08-12 22:02 | - | |
| python-nose2/ | 2019-02-26 18:04 | - | |
| python-nose_fixes/ | 2018-10-16 16:51 | - | |
| python-notario/ | 2018-10-16 16:54 | - | |
| python-ntlm-auth/ | 2018-10-16 17:00 | - | |
| python-ntlm3/ | 2018-10-16 16:57 | - | |
| python-numdisplay/ | 2016-08-12 22:04 | - | |
| python-numexpr/ | 2019-03-21 10:33 | - | |
| python-numpydoc/ | 2016-08-12 22:05 | - | |
| python-oauth/ | 2018-10-16 17:05 | - | |
| python-oauth2/ | 2017-08-02 12:50 | - | |
| python-oauth2client/ | 2018-10-16 17:07 | - | |
| python-oauthlib/ | 2018-10-16 17:10 | - | |
| python-offtrac/ | 2016-08-12 22:07 | - | |
| python-ofxparse/ | 2018-10-16 17:13 | - | |
| python-okaara/ | 2018-10-16 17:16 | - | |
| python-olefile/ | 2019-02-26 18:08 | - | |
| python-oletools/ | 2019-02-26 18:10 | - | |
| python-onionbalance/ | 2018-10-16 17:23 | - | |
| python-openid-cla/ | 2018-10-16 17:30 | - | |
| python-openid-teams/ | 2016-08-12 22:08 | - | |
| python-openid/ | 2018-10-16 17:25 | - | |
| python-openidc-client/ | 2018-10-16 17:28 | - | |
| python-openoffice/ | 2016-08-12 22:09 | - | |
| python-openopt/ | 2016-08-12 22:10 | - | |
| python-openqa_client/ | 2019-02-26 18:12 | - | |
| python-openshift/ | 2019-02-26 18:14 | - | |
| python-optcomplete/ | 2016-08-12 22:10 | - | |
| python-ordered-set/ | 2016-08-12 22:12 | - | |
| python-ordereddict/ | 2016-08-12 22:11 | - | |
| python-oslo-rootwrap/ | 2019-02-26 18:17 | - | |
| python-oslo-sphinx/ | 2019-02-26 18:20 | - | |
| python-osrf-pycommon/ | 2018-10-16 17:37 | - | |
| python-packaging/ | 2018-10-16 17:40 | - | |
| python-paho-mqtt/ | 2016-08-12 22:14 | - | |
| python-pam/ | 2016-08-12 22:14 | - | |
| python-pamela/ | 2019-02-26 18:23 | - | |
| python-pandas/ | 2018-10-16 17:46 | - | |
| python-paramiko/ | 2019-02-26 18:25 | - | |
| python-parse/ | 2018-10-16 17:55 | - | |
| python-parse_type/ | 2018-10-16 18:03 | - | |
| python-parsedatetime/ | 2018-10-16 17:58 | - | |
| python-parso/ | 2019-02-26 18:27 | - | |
| python-passlib/ | 2016-08-12 22:18 | - | |
| python-paste-deploy/ | 2016-08-12 22:18 | - | |
| python-paste-script/ | 2018-10-16 18:08 | - | |
| python-path/ | 2018-10-16 18:11 | - | |
| python-pathlib/ | 2016-08-12 22:19 | - | |
| python-pathspec/ | 2019-02-26 18:29 | - | |
| python-pbr/ | 2019-02-26 18:31 | - | |
| python-pdfkit/ | 2016-08-12 22:21 | - | |
| python-pdfminer/ | 2019-02-26 18:33 | - | |
| python-pdfrw/ | 2018-10-16 18:20 | - | |
| python-pdir2/ | 2019-02-26 18:35 | - | |
| python-peak-rules/ | 2018-10-16 18:25 | - | |
| python-peak-util-addons/ | 2016-08-12 22:22 | - | |
| python-peak-util-assembler/ | 2016-08-14 13:58 | - | |
| python-peak-util-extremes/ | 2016-08-12 22:23 | - | |
| python-peak-util-symbols/ | 2016-08-12 22:23 | - | |
| python-pecan/ | 2016-08-12 22:24 | - | |
| python-pep8/ | 2016-08-12 22:25 | - | |
| python-pg8000/ | 2019-02-26 18:37 | - | |
| python-pgpdump/ | 2016-08-12 22:26 | - | |
| python-pid/ | 2019-02-26 18:39 | - | |
| python-pika/ | 2019-02-26 18:41 | - | |
| python-pint/ | 2016-08-12 22:27 | - | |
| python-pip/ | 2019-02-26 18:43 | - | |
| python-pivy/ | 2019-02-26 18:45 | - | |
| python-pkgconfig/ | 2019-02-26 18:56 | - | |
| python-pkginfo/ | 2018-10-16 18:41 | - | |
| python-pkgwat-api/ | 2016-08-12 22:29 | - | |
| python-pluginlib/ | 2019-02-26 18:58 | - | |
| python-plumbum/ | 2018-10-16 18:46 | - | |
| python-ply/ | 2016-08-12 22:29 | - | |
| python-pmw/ | 2016-08-12 22:30 | - | |
| python-pocketlint/ | 2019-02-26 19:00 | - | |
| python-polib/ | 2019-02-26 19:02 | - | |
| python-posix_ipc/ | 2016-08-12 22:31 | - | |
| python-pretend/ | 2019-02-26 19:04 | - | |
| python-prettytable/ | 2016-08-12 22:32 | - | |
| python-process-tests/ | 2019-02-26 19:06 | - | |
| python-productmd/ | 2019-02-26 19:08 | - | |
| python-progress/ | 2019-02-26 19:10 | - | |
| python-progressbar/ | 2016-08-12 22:33 | - | |
| python-proliantutils/ | 2016-08-12 22:34 | - | |
| python-prometheus_client/ | 2019-02-26 19:13 | - | |
| python-prompt_toolkit/ | 2019-02-26 19:16 | - | |
| python-psphere/ | 2016-08-12 22:35 | - | |
| python-psutil/ | 2019-03-21 10:35 | - | |
| python-psycogreen/ | 2018-10-16 19:06 | - | |
| python-pthreading/ | 2016-08-12 22:36 | - | |
| python-ptyprocess/ | 2019-02-26 19:20 | - | |
| python-publicsuffix/ | 2018-10-16 19:10 | - | |
| python-pyModbusTCP/ | 2018-10-16 19:51 | - | |
| python-pyarabic/ | 2016-08-12 22:38 | - | |
| python-pybeam/ | 2018-10-16 19:13 | - | |
| python-pybloomfiltermmap/ | 2016-08-12 22:38 | - | |
| python-pycha/ | 2016-08-12 22:39 | - | |
| python-pycodestyle/ | 2019-02-26 19:22 | - | |
| python-pycosat/ | 2019-03-21 10:37 | - | |
| python-pycparser/ | 2016-08-12 22:40 | - | |
| python-pycryptodomex/ | 2019-03-21 10:39 | - | |
| python-pycxx/ | 2019-02-26 19:28 | - | |
| python-pydns/ | 2018-10-16 19:20 | - | |
| python-pyev/ | 2019-03-21 10:41 | - | |
| python-pyfakefs/ | 2018-10-16 19:24 | - | |
| python-pygal/ | 2018-10-16 19:27 | - | |
| python-pygeoip/ | 2016-08-12 22:43 | - | |
| python-pygit2/ | 2018-10-16 19:30 | - | |
| python-pyglet/ | 2016-08-12 22:44 | - | |
| python-pygments-markdown-lexer/ | 2018-10-16 19:39 | - | |
| python-pygments2/ | 2018-10-16 19:36 | - | |
| python-pygraphviz/ | 2019-03-21 10:43 | - | |
| python-pyhsm/ | 2018-10-16 19:41 | - | |
| python-pylibravatar/ | 2016-08-12 22:45 | - | |
| python-pylons/ | 2017-08-02 12:50 | - | |
| python-pymediainfo/ | 2018-10-16 19:44 | - | |
| python-pymilter/ | 2019-03-21 10:45 | - | |
| python-pymod2pkg/ | 2018-10-16 19:49 | - | |
| python-pymongo/ | 2016-08-12 22:47 | - | |
| python-pymssql/ | 2019-03-21 10:47 | - | |
| python-pyngus/ | 2019-02-26 19:43 | - | |
| python-pypandoc/ | 2019-02-26 19:46 | - | |
| python-pyphen/ | 2016-08-12 22:48 | - | |
| python-pypng/ | 2016-08-12 22:49 | - | |
| python-pyprintr/ | 2016-08-12 22:50 | - | |
| python-pyquery/ | 2019-02-26 19:48 | - | |
| python-pyrad/ | 2016-08-12 22:51 | - | |
| python-pyramid-fas-openid/ | 2018-10-16 20:08 | - | |
| python-pyramid-mako/ | 2018-10-16 20:11 | - | |
| python-pyramid-tm/ | 2018-10-16 20:14 | - | |
| python-pyramid/ | 2018-10-16 20:04 | - | |
| python-pyrfc3339/ | 2018-10-16 20:17 | - | |
| python-pyroute2/ | 2019-02-26 19:50 | - | |
| python-pyrpmmd/ | 2018-10-16 20:21 | - | |
| python-pyside/ | 2019-03-21 10:49 | - | |
| python-pysocks/ | 2019-02-26 19:54 | - | |
| python-pyspf/ | 2018-10-16 20:28 | - | |
| python-pytest-cache/ | 2018-10-16 20:31 | - | |
| python-pytest-catchlog/ | 2019-02-26 19:56 | - | |
| python-pytest-cov/ | 2018-10-16 20:35 | - | |
| python-pytest-flakes/ | 2018-10-16 20:38 | - | |
| python-pytest-pep8/ | 2018-10-16 20:41 | - | |
| python-pytest-runner/ | 2019-02-26 19:58 | - | |
| python-pytest-xdist/ | 2019-02-26 20:00 | - | |
| python-pytoml/ | 2018-10-16 20:47 | - | |
| python-pyvirtualize/ | 2019-02-26 20:02 | - | |
| python-pyvmomi/ | 2019-02-26 20:04 | - | |
| python-pyxs/ | 2019-02-26 20:06 | - | |
| python-pyzabbix/ | 2016-08-12 22:57 | - | |
| python-q/ | 2018-10-16 20:54 | - | |
| python-qalsadi/ | 2016-08-12 22:58 | - | |
| python-qpid/ | 2018-10-16 20:57 | - | |
| python-qutepart/ | 2018-10-16 21:02 | - | |
| python-rarfile/ | 2016-08-12 23:01 | - | |
| python-rauth/ | 2016-08-12 23:01 | - | |
| python-raven/ | 2016-08-12 23:02 | - | |
| python-rdflib/ | 2016-08-12 23:02 | - | |
| python-re2/ | 2019-02-26 20:09 | - | |
| python-recaptcha-client/ | 2018-10-16 21:09 | - | |
| python-redis/ | 2019-02-26 20:11 | - | |
| python-regex/ | 2019-03-21 10:51 | - | |
| python-remoteobjects/ | 2016-08-12 23:05 | - | |
| python-remoto/ | 2018-10-16 21:16 | - | |
| python-rencode/ | 2019-03-21 10:53 | - | |
| python-repoze-lru/ | 2016-08-12 23:06 | - | |
| python-repoze-sphinx-autointerface/ | 2016-08-12 23:07 | - | |
| python-repoze-tm2/ | 2016-08-14 14:13 | - | |
| python-repoze-who-friendlyform/ | 2018-10-16 21:23 | - | |
| python-repoze-who-plugins-sa/ | 2018-10-16 21:26 | - | |
| python-repoze-who-testutil/ | 2018-10-16 21:28 | - | |
| python-repoze-who/ | 2018-10-16 21:20 | - | |
| python-requestbuilder/ | 2018-10-16 21:31 | - | |
| python-requests-file/ | 2018-10-16 21:34 | - | |
| python-requests-gssapi/ | 2018-10-16 21:36 | - | |
| python-requests-kerberos/ | 2016-08-12 23:10 | - | |
| python-requests-mock/ | 2018-10-16 21:39 | - | |
| python-requests-toolbelt/ | 2018-10-16 21:45 | - | |
| python-requests_ntlm/ | 2018-10-16 21:42 | - | |
| python-responses/ | 2019-02-26 20:18 | - | |
| python-resultsdb_api/ | 2019-02-26 20:20 | - | |
| python-retask/ | 2018-10-16 21:51 | - | |
| python-retrying/ | 2016-08-12 23:12 | - | |
| python-ripe-atlas-cousteau/ | 2018-10-16 21:54 | - | |
| python-ripe-atlas-sagan/ | 2018-10-16 21:57 | - | |
| python-rjsmin/ | 2018-10-16 21:59 | - | |
| python-robofab/ | 2016-08-12 23:12 | - | |
| python-robosignatory/ | 2018-10-16 22:02 | - | |
| python-rope/ | 2019-02-26 20:22 | - | |
| python-rosdep/ | 2018-10-16 22:07 | - | |
| python-rosdistro/ | 2018-10-16 22:10 | - | |
| python-rosinstall/ | 2018-10-16 22:13 | - | |
| python-rospkg/ | 2018-10-16 22:17 | - | |
| python-routes/ | 2016-08-12 23:15 | - | |
| python-rpdb/ | 2019-02-26 20:24 | - | |
| python-rpm-macros/ | 2018-10-16 22:25 | - | |
| python-rpmfluff/ | 2019-02-26 20:26 | - | |
| python-rsa/ | 2016-08-12 23:18 | - | |
| python-ruamel-ordereddict/ | 2018-10-16 22:27 | - | |
| python-ruamel-yaml/ | 2019-03-21 10:55 | - | |
| python-rxjson/ | 2016-08-12 23:18 | - | |
| python-s3transfer/ | 2018-10-16 22:32 | - | |
| python-salttesting/ | 2016-08-12 23:19 | - | |
| python-scales/ | 2017-08-02 12:50 | - | |
| python-scandir/ | 2019-03-21 10:57 | - | |
| python-scikit-image/ | 2018-10-16 22:37 | - | |
| python-scp/ | 2016-08-12 23:20 | - | |
| python-scripttest/ | 2019-02-26 20:33 | - | |
| python-scss/ | 2016-08-12 23:21 | - | |
| python-semantic_version/ | 2016-08-12 23:22 | - | |
| python-setuptools_scm/ | 2019-02-26 20:35 | - | |
| python-sh/ | 2019-02-26 20:37 | - | |
| python-shapely/ | 2018-10-16 22:56 | - | |
| python-sieve/ | 2016-08-12 23:25 | - | |
| python-simplegeneric/ | 2016-08-12 23:26 | - | |
| python-simplejson/ | 2019-03-21 10:59 | - | |
| python-simplemediawiki/ | 2016-08-12 23:27 | - | |
| python-simplepath/ | 2019-02-26 20:41 | - | |
| python-simplevisor/ | 2018-10-16 23:03 | - | |
| python-singledispatch/ | 2016-08-12 23:28 | - | |
| python-slacker/ | 2019-02-26 20:44 | - | |
| python-slugify/ | 2016-08-12 23:28 | - | |
| python-smmap/ | 2018-10-16 23:13 | - | |
| python-social-auth/ | 2016-08-12 23:29 | - | |
| python-socketIO-client/ | 2018-10-16 23:16 | - | |
| python-socksipychain/ | 2018-10-16 23:19 | - | |
| python-speaklater/ | 2016-08-12 23:30 | - | |
| python-speedtest-cli/ | 2018-10-16 23:21 | - | |
| python-sphinx-autobuild/ | 2019-02-26 20:46 | - | |
| python-sphinx-bootstrap-theme/ | 2018-10-16 23:26 | - | |
| python-sphinx-theme-alabaster/ | 2019-02-26 20:53 | - | |
| python-sphinx_rtd_theme/ | 2018-10-16 23:36 | - | |
| python-sphinxcontrib-adadomain/ | 2016-08-12 23:31 | - | |
| python-sphinxcontrib-cheeseshop/ | 2016-08-12 23:31 | - | |
| python-sphinxcontrib-httpdomain/ | 2018-10-16 23:29 | - | |
| python-sphinxcontrib-issuetracker/ | 2016-08-12 23:32 | - | |
| python-sphinxcontrib-napoleon/ | 2016-08-12 23:33 | - | |
| python-sphinxcontrib-programoutput/ | 2019-02-26 20:48 | - | |
| python-sphinxcontrib-spelling/ | 2019-02-26 20:50 | - | |
| python-spur/ | 2019-02-26 20:55 | - | |
| python-sqlalchemy_schemadisplay/ | 2018-10-16 23:43 | - | |
| python-sqlite3dbm/ | 2016-08-12 23:35 | - | |
| python-sqlobject/ | 2017-08-02 12:50 | - | |
| python-sqlparse/ | 2016-08-12 23:36 | - | |
| python-statsd/ | 2018-10-16 23:46 | - | |
| python-stem/ | 2018-10-16 23:49 | - | |
| python-stevedore/ | 2019-02-26 20:57 | - | |
| python-stomper/ | 2016-08-12 23:38 | - | |
| python-straight-plugin/ | 2016-08-12 23:39 | - | |
| python-strainer/ | 2016-08-12 23:39 | - | |
| python-string_utils/ | 2019-02-26 21:00 | - | |
| python-structlog/ | 2019-02-26 21:03 | - | |
| python-stuf/ | 2018-10-16 23:57 | - | |
| python-subprocess32/ | 2018-10-16 23:59 | - | |
| python-subvertpy/ | 2016-08-12 23:41 | - | |
| python-summershum/ | 2018-10-17 00:02 | - | |
| python-sure/ | 2016-08-12 23:42 | - | |
| python-sync2jira/ | 2018-10-17 00:06 | - | |
| python-sysv_ipc/ | 2016-08-12 23:43 | - | |
| python-tables/ | 2018-10-17 00:09 | - | |
| python-tabulate/ | 2018-10-17 00:18 | - | |
| python-tahrir-api/ | 2018-10-17 00:23 | - | |
| python-tahrir/ | 2018-10-17 00:21 | - | |
| python-tambo/ | 2018-10-17 00:27 | - | |
| python-tashaphyne/ | 2016-08-12 23:44 | - | |
| python-taskflow/ | 2017-08-02 12:50 | - | |
| python-taskw/ | 2019-02-26 21:05 | - | |
| python-tbgrep/ | 2016-08-12 23:46 | - | |
| python-terminado/ | 2019-02-26 21:08 | - | |
| python-testify/ | 2018-10-17 00:33 | - | |
| python-testinfra/ | 2019-02-26 21:10 | - | |
| python-testing.postgresql/ | 2018-10-17 00:38 | - | |
| python-testrepository/ | 2017-08-02 12:50 | - | |
| python-testresources/ | 2016-08-14 14:24 | - | |
| python-testscenarios/ | 2016-08-12 23:48 | - | |
| python-testtools/ | 2016-08-12 23:49 | - | |
| python-texttable/ | 2019-02-26 21:12 | - | |
| python-tgmochikit/ | 2016-08-12 23:49 | - | |
| python-tilestache/ | 2016-08-12 23:50 | - | |
| python-tinycss/ | 2016-08-12 23:50 | - | |
| python-tinydb/ | 2019-02-26 21:14 | - | |
| python-tldextract/ | 2018-10-17 00:45 | - | |
| python-toml/ | 2019-02-26 21:16 | - | |
| python-toolz/ | 2019-02-26 21:18 | - | |
| python-toscawidgets/ | 2016-08-12 23:52 | - | |
| python-tox/ | 2016-08-12 23:52 | - | |
| python-tqdm/ | 2018-10-17 00:52 | - | |
| python-traceback2/ | 2018-10-17 00:55 | - | |
| python-traitlets/ | 2019-02-26 21:20 | - | |
| python-transaction/ | 2016-08-12 23:54 | - | |
| python-translationstring/ | 2016-08-12 23:54 | - | |
| python-tree-format/ | 2018-10-17 00:59 | - | |
| python-trollius-redis/ | 2018-10-17 01:05 | - | |
| python-trollius/ | 2018-10-17 01:02 | - | |
| python-trololio/ | 2019-02-26 21:22 | - | |
| python-turbocheetah/ | 2018-10-17 01:10 | - | |
| python-turbojson/ | 2018-10-17 01:12 | - | |
| python-turbokid/ | 2018-10-17 01:15 | - | |
| python-tw-forms/ | 2016-08-13 00:04 | - | |
| python-tw2-core/ | 2018-10-17 01:18 | - | |
| python-tw2-dynforms/ | 2018-10-17 01:20 | - | |
| python-tw2-excanvas/ | 2018-10-17 01:23 | - | |
| python-tw2-forms/ | 2018-10-17 01:26 | - | |
| python-tw2-jit/ | 2018-10-17 01:29 | - | |
| python-tw2-jqplugins-flot/ | 2018-10-17 01:32 | - | |
| python-tw2-jqplugins-gritter/ | 2018-10-17 01:35 | - | |
| python-tw2-jqplugins-jqplot/ | 2018-10-17 01:38 | - | |
| python-tw2-jqplugins-ui/ | 2018-10-17 01:41 | - | |
| python-tw2-jquery/ | 2018-10-17 01:43 | - | |
| python-tw2-polymaps/ | 2018-10-17 01:46 | - | |
| python-tw2-slideymenu/ | 2018-10-17 01:49 | - | |
| python-tw2-sqla/ | 2018-10-17 01:52 | - | |
| python-twiggy/ | 2016-08-13 00:05 | - | |
| python-twine/ | 2018-10-17 01:55 | - | |
| python-txrequests/ | 2016-08-13 00:05 | - | |
| python-txws/ | 2016-08-13 00:06 | - | |
| python-txzmq/ | 2017-08-02 12:50 | - | |
| python-typeshed/ | 2018-10-17 01:58 | - | |
| python-typing/ | 2019-02-26 21:24 | - | |
| python-tzlocal/ | 2016-08-13 00:07 | - | |
| python-ujson/ | 2018-10-17 02:02 | - | |
| python-unicodecsv/ | 2018-10-17 02:05 | - | |
| python-unidecode/ | 2016-08-13 00:08 | - | |
| python-unidiff/ | 2019-02-26 21:26 | - | |
| python-unittest2/ | 2018-10-17 02:10 | - | |
| python-uritemplate/ | 2018-10-17 02:12 | - | |
| python-urllib2_kerberos/ | 2018-10-17 02:15 | - | |
| python-urlobject/ | 2018-10-17 02:18 | - | |
| python-usbtmc/ | 2018-10-17 02:20 | - | |
| python-vatnumber/ | 2018-10-17 02:23 | - | |
| python-vcrpy/ | 2018-10-17 02:26 | - | |
| python-vcstools/ | 2018-10-17 02:29 | - | |
| python-velruse/ | 2018-10-17 02:33 | - | |
| python-venusian/ | 2016-08-13 00:12 | - | |
| python-versiontools/ | 2016-08-13 00:13 | - | |
| python-vine/ | 2019-02-26 21:28 | - | |
| python-virtualenv-api/ | 2018-10-17 02:36 | - | |
| python-virtualenv-clone/ | 2016-08-13 00:13 | - | |
| python-virtualenvwrapper/ | 2018-10-17 02:39 | - | |
| python-vobject/ | 2016-08-13 00:14 | - | |
| python-volatility/ | 2018-10-17 02:42 | - | |
| python-voluptuous/ | 2019-02-26 21:31 | - | |
| python-vxi11/ | 2019-02-26 21:34 | - | |
| python-waitress/ | 2016-08-13 00:16 | - | |
| python-wand/ | 2016-08-13 00:17 | - | |
| python-warlock/ | 2018-10-17 02:50 | - | |
| python-wcwidth/ | 2019-02-26 21:36 | - | |
| python-webassets/ | 2019-02-26 21:38 | - | |
| python-webcolors/ | 2019-02-26 21:41 | - | |
| python-weberror/ | 2016-08-13 00:19 | - | |
| python-webflash/ | 2016-08-13 00:19 | - | |
| python-webhelpers/ | 2016-08-13 00:20 | - | |
| python-webob1.4/ | 2016-08-13 00:20 | - | |
| python-webpy/ | 2018-10-17 03:00 | - | |
| python-websockify/ | 2016-08-13 00:21 | - | |
| python-wheel/ | 2018-10-17 03:02 | - | |
| python-whisper/ | 2018-10-17 03:05 | - | |
| python-whitenoise/ | 2019-02-26 21:43 | - | |
| python-whoosh/ | 2019-02-26 21:46 | - | |
| python-wikitcms/ | 2018-10-17 03:12 | - | |
| python-winrm/ | 2018-10-17 03:15 | - | |
| python-workerpool/ | 2016-08-13 00:25 | - | |
| python-wrapt/ | 2019-03-21 11:02 | - | |
| python-wsme/ | 2016-08-13 00:26 | - | |
| python-wstool/ | 2018-10-17 03:20 | - | |
| python-wtforms/ | 2016-08-13 00:27 | - | |
| python-www-authenticate/ | 2019-02-26 21:50 | - | |
| python-x2go/ | 2018-10-17 03:26 | - | |
| python-xapp/ | 2019-02-26 21:52 | - | |
| python-xlib/ | 2016-08-13 00:28 | - | |
| python-xlrd/ | 2019-02-26 21:54 | - | |
| python-xlwt/ | 2016-08-13 00:29 | - | |
| python-xml2rfc/ | 2018-10-17 03:36 | - | |
| python-xmltodict/ | 2016-08-13 00:30 | - | |
| python-xmltramp/ | 2016-08-13 00:30 | - | |
| python-xvfbwrapper/ | 2016-08-13 00:43 | - | |
| python-yamlordereddictloader/ | 2019-02-26 21:56 | - | |
| python-yara/ | 2019-03-21 11:04 | - | |
| python-zanata2fedmsg/ | 2018-10-17 03:56 | - | |
| python-zc-buildout/ | 2016-08-14 14:54 | - | |
| python-zmq/ | 2017-08-02 12:50 | - | |
| python-zope-component/ | 2019-02-26 22:00 | - | |
| python-zope-configuration/ | 2019-02-26 22:02 | - | |
| python-zope-deprecation/ | 2016-08-13 00:46 | - | |
| python-zope-event/ | 2016-08-13 00:47 | - | |
| python-zope-exceptions/ | 2019-02-26 22:04 | - | |
| python-zope-i18nmessageid/ | 2019-03-21 11:06 | - | |
| python-zope-schema/ | 2019-02-26 22:09 | - | |
| python-zope-sqlalchemy/ | 2017-08-02 12:50 | - | |
| python-zope-testing/ | 2019-02-26 22:11 | - | |
| python2-dateutil/ | 2018-09-02 08:08 | - | |
| python2-dns/ | 2018-09-02 08:10 | - | |
| python2-docutils/ | 2018-09-02 08:13 | - | |
| python2-enum34/ | 2018-09-02 08:15 | - | |
| python2-httplib2/ | 2018-09-02 08:18 | - | |
| python2-idna/ | 2018-09-02 08:20 | - | |
| python2-lxc/ | 2018-09-02 08:23 | - | |
| python2-matplotlib/ | 2018-09-02 08:25 | - | |
| python2-numpy/ | 2018-09-02 08:28 | - | |
| python2-pytest/ | 2018-09-02 08:30 | - | |
| python2-pyyaml/ | 2018-09-02 08:33 | - | |
| python2-requests/ | 2018-09-02 08:35 | - | |
| python2-six/ | 2018-09-02 08:38 | - | |
| python2-sphinx/ | 2018-09-02 08:40 | - | |
| python2-zope-interface/ | 2018-09-02 08:43 | - | |
| python3-Cython/ | 2019-03-21 09:24 | - | |
| python3-PyYAML/ | 2019-03-21 09:45 | - | |
| python3-backports-ssl_match_hostname/ | 2019-02-25 20:20 | - | |
| python3-cairo/ | 2019-03-21 09:14 | - | |
| python3-cffi/ | 2019-03-21 09:16 | - | |
| python3-chardet/ | 2019-02-25 20:26 | - | |
| python3-coverage/ | 2019-03-21 09:18 | - | |
| python3-cryptography-vectors/ | 2019-02-25 20:33 | - | |
| python3-cryptography/ | 2019-03-21 09:20 | - | |
| python3-cups/ | 2019-03-21 09:22 | - | |
| python3-dateutil/ | 2019-02-25 20:39 | - | |
| python3-dbus/ | 2019-03-21 09:26 | - | |
| python3-decorator/ | 2019-02-25 20:43 | - | |
| python3-dns/ | 2019-02-25 20:45 | - | |
| python3-docker-pycreds/ | 2019-02-25 20:49 | - | |
| python3-docker/ | 2019-02-25 20:47 | - | |
| python3-docutils/ | 2019-02-25 20:51 | - | |
| python3-gobject3/ | 2019-03-21 09:28 | - | |
| python3-greenlet/ | 2019-03-21 09:30 | - | |
| python3-gssapi/ | 2019-03-21 09:32 | - | |
| python3-idna/ | 2019-02-25 21:00 | - | |
| python3-jinja2/ | 2019-02-25 21:02 | - | |
| python3-jwt/ | 2019-02-25 21:04 | - | |
| python3-kitchen/ | 2019-02-25 21:06 | - | |
| python3-markupsafe/ | 2019-03-21 09:35 | - | |
| python3-mock/ | 2019-02-25 21:10 | - | |
| python3-mysql/ | 2019-03-21 09:37 | - | |
| python3-netaddr/ | 2019-02-25 21:14 | - | |
| python3-nose/ | 2019-02-25 21:16 | - | |
| python3-numpy/ | 2019-03-21 09:39 | - | |
| python3-pkgversion-macros/ | 2016-08-12 18:40 | - | |
| python3-ply/ | 2019-02-25 21:21 | - | |
| python3-psycopg2/ | 2019-03-21 09:41 | - | |
| python3-py/ | 2019-02-25 21:23 | - | |
| python3-pyasn1/ | 2019-02-25 21:25 | - | |
| python3-pycparser/ | 2019-02-25 21:27 | - | |
| python3-pycurl/ | 2019-03-21 09:43 | - | |
| python3-pygments/ | 2019-02-25 21:31 | - | |
| python3-pytest-cov/ | 2019-02-25 21:35 | - | |
| python3-pytest/ | 2019-02-25 21:33 | - | |
| python3-pytz/ | 2019-02-25 21:37 | - | |
| python3-pyudev/ | 2019-02-25 21:39 | - | |
| python3-pyusb/ | 2019-02-25 21:42 | - | |
| python3-requests/ | 2019-02-25 21:46 | - | |
| python3-scipy/ | 2019-03-21 09:47 | - | |
| python3-setproctitle/ | 2019-03-21 09:49 | - | |
| python3-setuptools/ | 2019-02-25 21:52 | - | |
| python3-simplepam/ | 2019-02-25 21:54 | - | |
| python3-six/ | 2019-02-25 21:56 | - | |
| python3-sphinx/ | 2019-02-25 21:58 | - | |
| python3-sqlalchemy/ | 2019-03-21 09:51 | - | |
| python3-suds/ | 2019-02-25 22:02 | - | |
| python3-tornado/ | 2019-03-21 09:53 | - | |
| python3-urllib3/ | 2019-02-25 22:06 | - | |
| python3-virtualenv/ | 2019-02-25 22:08 | - | |
| python3-websocket-client/ | 2019-02-25 22:10 | - | |
| python3-zope-event/ | 2019-02-25 22:12 | - | |
| python3-zope-interface/ | 2019-03-21 09:55 | - | |
| python34/ | 2019-03-21 07:25 | - | |
| python36/ | 2019-03-21 08:08 | - | |
| pywebkitgtk/ | 2019-03-21 11:08 | - | |
| pyxdg/ | 2019-02-26 22:15 | - | |
| pyzor/ | 2016-08-13 00:51 | - | |
| q4wine/ | 2019-02-26 22:17 | - | |
| qbittorrent/ | 2019-02-26 22:23 | - | |
| qca/ | 2019-03-21 11:10 | - | |
| qcint/ | 2019-03-21 11:16 | - | |
| qcommandline/ | 2016-08-13 00:52 | - | |
| qconf/ | 2016-08-13 00:53 | - | |
| qd/ | 2016-08-13 00:54 | - | |
| qdigidoc/ | 2019-02-26 22:39 | - | |
| qemu/ | 2019-03-21 11:18 | - | |
| qesteidutil/ | 2019-02-26 22:46 | - | |
| qextserialport/ | 2016-08-13 00:55 | - | |
| qfaxreader/ | 2016-08-13 00:55 | - | |
| qgis/ | 2019-02-26 22:50 | - | |
| qgit/ | 2018-10-17 04:39 | - | |
| qhttpengine/ | 2019-03-21 11:20 | - | |
| qhull/ | 2016-08-13 00:58 | - | |
| qlandkartegt/ | 2019-02-26 23:27 | - | |
| qm-dsp/ | 2018-10-17 04:49 | - | |
| qm-vamp-plugins/ | 2018-10-17 05:08 | - | |
| qmapshack/ | 2019-02-26 23:35 | - | |
| qmltermwidget/ | 2018-10-17 04:53 | - | |
| qmmp-plugin-pack/ | 2018-10-17 05:04 | - | |
| qmmp/ | 2018-10-17 04:57 | - | |
| qoauth/ | 2016-08-13 01:01 | - | |
| qodem/ | 2018-10-17 05:11 | - | |
| qotd/ | 2018-10-17 05:15 | - | |
| qpdfview/ | 2018-10-17 05:18 | - | |
| qpid-cpp/ | 2019-03-21 11:23 | - | |
| qpid-dispatch/ | 2019-03-21 11:25 | - | |
| qpid-proton/ | 2019-03-21 11:27 | - | |
| qpid-qmf/ | 2018-10-17 05:39 | - | |
| qpid-tests/ | 2016-08-13 01:08 | - | |
| qpid-tools/ | 2016-08-13 01:09 | - | |
| qqc2-desktop-style/ | 2019-03-21 11:29 | - | |
| qr_mumps/ | 2017-08-02 12:50 | - | |
| qrmumps/ | 2018-10-17 05:52 | - | |
| qrupdate/ | 2016-08-13 01:10 | - | |
| qscintilla/ | 2016-08-13 01:10 | - | |
| qsstv/ | 2018-10-17 06:03 | - | |
| qstat/ | 2016-08-13 01:12 | - | |
| qt-assistant-adp/ | 2018-10-17 07:08 | - | |
| qt-creator/ | 2018-10-17 07:11 | - | |
| qt-mobility/ | 2018-10-17 08:11 | - | |
| qt5-qtaccountsservice/ | 2018-10-17 06:14 | - | |
| qt5-qtconfiguration/ | 2018-10-17 06:17 | - | |
| qt5-qtquick1/ | 2019-02-27 00:07 | - | |
| qt5-qtstyleplugins/ | 2018-10-17 06:23 | - | |
| qt5-qtwebkit/ | 2018-10-17 06:27 | - | |
| qt5ct/ | 2018-10-17 06:10 | - | |
| qtbrowserplugin/ | 2016-08-13 01:19 | - | |
| qterminal/ | 2019-03-21 11:31 | - | |
| qtermwidget/ | 2019-03-21 11:33 | - | |
| qtkeychain/ | 2019-03-21 11:37 | - | |
| qtlockedfile/ | 2018-10-17 08:08 | - | |
| qtools/ | 2018-10-17 08:21 | - | |
| qtpass/ | 2018-10-17 08:23 | - | |
| qtscriptgenerator/ | 2019-02-27 00:26 | - | |
| qtsingleapplication/ | 2018-10-17 08:29 | - | |
| qtsoap/ | 2016-08-13 01:22 | - | |
| qtwebkit/ | 2018-10-17 08:33 | - | |
| quake3/ | 2018-10-17 09:32 | - | |
| quantum-espresso/ | 2018-10-17 09:36 | - | |
| quassel-irssi/ | 2018-10-17 12:11 | - | |
| quassel/ | 2018-10-17 11:59 | - | |
| quasselc/ | 2018-10-17 12:08 | - | |
| quazip-qt5/ | 2018-10-17 12:13 | - | |
| quazip/ | 2016-08-13 01:26 | - | |
| quesoglc/ | 2018-10-17 12:17 | - | |
| quilt/ | 2016-08-13 01:28 | - | |
| quisk/ | 2018-10-17 12:21 | - | |
| quiterss/ | 2018-10-17 12:24 | - | |
| quotatool/ | 2016-08-13 01:30 | - | |
| qwt/ | 2018-10-17 12:29 | - | |
| qwtpolar/ | 2018-10-17 12:34 | - | |
| rabbitmq-java-client/ | 2016-08-13 01:36 | - | |
| rabbitmq-server/ | 2019-02-27 01:07 | - | |
| racoon2/ | 2016-08-13 01:40 | - | |
| radare2/ | 2019-03-21 11:40 | - | |
| radcli/ | 2018-10-17 12:44 | - | |
| radeontop/ | 2019-02-27 01:11 | - | |
| radicale/ | 2018-10-17 12:51 | - | |
| radiusclient-ng/ | 2016-08-13 01:45 | - | |
| ragel/ | 2018-10-17 12:54 | - | |
| rakudo-MIME-Base64/ | 2018-10-17 13:06 | - | |
| rakudo-Readline/ | 2018-10-17 13:09 | - | |
| rakudo-URI/ | 2018-10-17 13:12 | - | |
| rakudo-XML/ | 2018-10-17 13:15 | - | |
| rakudo-zef/ | 2019-02-27 01:23 | - | |
| rakudo/ | 2019-02-27 01:15 | - | |
| rancid/ | 2016-08-13 01:46 | - | |
| rapidjson/ | 2018-10-17 13:21 | - | |
| ratools/ | 2016-08-13 01:46 | - | |
| ratpoison/ | 2018-10-17 13:27 | - | |
| ratproxy/ | 2016-08-13 01:48 | - | |
| ravada/ | 2019-02-27 01:27 | - | |
| rawdog/ | 2016-08-13 01:48 | - | |
| rb_libtorrent/ | 2016-08-13 01:49 | - | |
| rbldnsd/ | 2016-08-13 01:49 | - | |
| rc/ | 2018-10-17 13:36 | - | |
| rclone/ | 2019-03-21 11:42 | - | |
| rdfind/ | 2018-10-17 13:41 | - | |
| rdiff-backup/ | 2018-10-17 13:44 | - | |
| rdopkg/ | 2019-02-27 01:31 | - | |
| re2/ | 2018-10-17 13:51 | - | |
| re2c/ | 2018-10-17 13:54 | - | |
| readosm/ | 2016-08-13 01:54 | - | |
| reaver/ | 2016-08-14 15:10 | - | |
| rebase-helper/ | 2018-10-17 13:56 | - | |
| recap/ | 2018-10-17 14:00 | - | |
| recordmydesktop/ | 2018-10-17 14:02 | - | |
| redis/ | 2019-02-27 01:35 | - | |
| rednotebook/ | 2018-10-17 14:08 | - | |
| redshift/ | 2016-08-13 01:56 | - | |
| reg/ | 2019-03-21 11:44 | - | |
| regindexer/ | 2019-02-27 01:40 | - | |
| relevation/ | 2016-08-13 01:56 | - | |
| relval/ | 2019-02-27 01:42 | - | |
| remctl/ | 2018-10-17 14:16 | - | |
| rendercheck/ | 2016-08-13 01:58 | - | |
| renrot/ | 2018-10-17 14:20 | - | |
| replacer/ | 2017-08-02 12:50 | - | |
| repodata/ | 2019-03-21 14:05 | - | |
| reposurgeon/ | 2018-10-17 14:23 | - | |
| repoview/ | 2016-08-13 02:00 | - | |
| reprepro/ | 2016-08-13 02:01 | - | |
| reptyr/ | 2016-08-13 02:01 | - | |
| resiprocate/ | 2018-10-17 14:26 | - | |
| resolv_wrapper/ | 2018-10-17 14:35 | - | |
| resultsdb/ | 2019-02-27 01:45 | - | |
| resultsdb_conventions/ | 2019-02-27 01:49 | - | |
| retrace-server/ | 2018-10-17 14:44 | - | |
| rfcdiff/ | 2017-08-02 12:50 | - | |
| rhash/ | 2018-10-17 14:50 | - | |
| rho/ | 2019-02-27 02:00 | - | |
| rhq-plugin-annotations/ | 2018-10-17 14:57 | - | |
| richacl/ | 2018-10-17 15:02 | - | |
| riemann-c-client/ | 2016-08-13 02:07 | - | |
| ripe-atlas-tools/ | 2018-10-17 15:07 | - | |
| ripright/ | 2016-08-13 02:09 | - | |
| ristretto/ | 2019-03-21 11:46 | - | |
| ritopt/ | 2016-08-13 02:10 | - | |
| rkhunter/ | 2018-10-17 15:12 | - | |
| rktime/ | 2018-10-17 15:15 | - | |
| rlog/ | 2018-10-17 15:19 | - | |
| rlwrap/ | 2018-10-17 15:23 | - | |
| rmol/ | 2019-02-27 02:18 | - | |
| robodoc/ | 2018-10-17 15:28 | - | |
| roca-detect/ | 2019-02-27 02:25 | - | |
| root/ | 2019-03-21 11:48 | - | |
| rootfs-resize/ | 2018-10-17 15:33 | - | |
| rootplot/ | 2019-03-21 11:51 | - | |
| rootsh/ | 2018-10-17 15:38 | - | |
| ros-release/ | 2016-08-13 02:14 | - | |
| roundcubemail/ | 2018-10-17 15:40 | - | |
| routino/ | 2016-08-13 02:15 | - | |
| rpkg-client/ | 2019-02-27 02:35 | - | |
| rpkg/ | 2019-02-27 02:31 | - | |
| rpmconf/ | 2016-08-13 02:16 | - | |
| rpmdeplint/ | 2018-10-17 15:50 | - | |
| rpmorphan/ | 2016-08-13 02:17 | - | |
| rpmreaper/ | 2016-08-13 02:17 | - | |
| rpmrebuild/ | 2016-08-13 02:18 | - | |
| rsibreak/ | 2016-08-13 02:21 | - | |
| rsnapshot/ | 2018-10-17 16:03 | - | |
| rss2email/ | 2016-08-13 02:22 | - | |
| rssh/ | 2018-10-17 16:06 | - | |
| rst2pdf/ | 2018-10-17 16:08 | - | |
| rsync-bpc/ | 2018-10-17 16:11 | - | |
| rtl-sdr/ | 2016-08-13 02:23 | - | |
| rtorrent/ | 2018-10-17 16:14 | - | |
| rtpproxy/ | 2018-10-17 16:18 | - | |
| rubber/ | 2018-10-17 16:21 | - | |
| rubberband/ | 2018-10-17 16:25 | - | |
| ruby-augeas/ | 2016-08-13 02:24 | - | |
| ruby-ldap/ | 2016-08-13 04:54 | - | |
| ruby-ncurses/ | 2016-08-13 04:55 | - | |
| ruby-shadow/ | 2016-08-13 04:56 | - | |
| rubygem-RedCloth/ | 2018-10-17 20:57 | - | |
| rubygem-ZenTest/ | 2016-08-13 04:53 | - | |
| rubygem-activemodel/ | 2019-02-27 03:20 | - | |
| rubygem-activerecord-deprecated_finders/ | 2016-08-13 02:25 | - | |
| rubygem-activeresource/ | 2018-10-17 16:30 | - | |
| rubygem-activesupport/ | 2018-10-17 16:33 | - | |
| rubygem-addressable/ | 2018-10-17 16:36 | - | |
| rubygem-ansi/ | 2016-08-13 02:27 | - | |
| rubygem-apipie-bindings/ | 2016-08-13 02:28 | - | |
| rubygem-appraisal/ | 2016-08-13 02:28 | - | |
| rubygem-archive-tar-minitar/ | 2016-08-13 02:29 | - | |
| rubygem-arel/ | 2016-08-14 15:22 | - | |
| rubygem-aruba/ | 2019-02-27 03:22 | - | |
| rubygem-asciidoctor/ | 2018-10-17 16:41 | - | |
| rubygem-async_sinatra/ | 2019-02-27 03:26 | - | |
| rubygem-atomic/ | 2017-08-02 12:50 | - | |
| rubygem-aws-sdk-core/ | 2018-10-17 16:46 | - | |
| rubygem-aws-sdk-resources/ | 2018-10-17 16:49 | - | |
| rubygem-aws-sigv4/ | 2018-10-17 16:52 | - | |
| rubygem-bacon/ | 2016-08-13 02:33 | - | |
| rubygem-base32/ | 2018-10-17 16:55 | - | |
| rubygem-bcrypt/ | 2018-10-17 16:58 | - | |
| rubygem-benchmark-ips/ | 2016-08-14 15:24 | - | |
| rubygem-builder/ | 2016-08-13 02:34 | - | |
| rubygem-childprocess/ | 2019-02-27 03:28 | - | |
| rubygem-coffee-script-source/ | 2018-10-17 17:05 | - | |
| rubygem-coffee-script/ | 2019-02-27 03:31 | - | |
| rubygem-colorator/ | 2018-10-17 17:08 | - | |
| rubygem-commander/ | 2018-10-17 17:11 | - | |
| rubygem-comp_tree/ | 2016-08-13 02:37 | - | |
| rubygem-configuration/ | 2018-10-17 17:14 | - | |
| rubygem-cookiejar/ | 2018-10-17 17:16 | - | |
| rubygem-coveralls/ | 2018-10-17 17:19 | - | |
| rubygem-crack/ | 2018-10-17 17:22 | - | |
| rubygem-creole/ | 2018-10-17 17:25 | - | |
| rubygem-cucumber/ | 2018-10-17 17:28 | - | |
| rubygem-curb/ | 2018-10-17 17:31 | - | |
| rubygem-daemon_controller/ | 2019-02-27 03:33 | - | |
| rubygem-daemons/ | 2018-10-17 17:37 | - | |
| rubygem-dalli/ | 2018-10-17 17:39 | - | |
| rubygem-deep_merge/ | 2018-10-17 17:42 | - | |
| rubygem-diff-lcs/ | 2018-10-17 17:45 | - | |
| rubygem-drake/ | 2018-10-17 17:47 | - | |
| rubygem-dynect_rest/ | 2018-10-17 17:50 | - | |
| rubygem-em-socksify/ | 2018-10-17 17:53 | - | |
| rubygem-em-spec/ | 2019-02-27 03:35 | - | |
| rubygem-em-worker/ | 2019-02-27 03:38 | - | |
| rubygem-erubis/ | 2018-10-17 18:00 | - | |
| rubygem-eventmachine/ | 2018-10-17 18:03 | - | |
| rubygem-excon/ | 2018-10-17 18:06 | - | |
| rubygem-execjs/ | 2019-02-27 03:41 | - | |
| rubygem-expression_parser/ | 2018-10-17 18:11 | - | |
| rubygem-fakeweb/ | 2017-08-02 12:50 | - | |
| rubygem-ffi/ | 2018-10-17 18:14 | - | |
| rubygem-flexmock/ | 2017-08-02 12:50 | - | |
| rubygem-fog-brightbox/ | 2018-10-17 18:41 | - | |
| rubygem-fog-core/ | 2018-10-17 18:44 | - | |
| rubygem-fog-json/ | 2018-10-17 18:47 | - | |
| rubygem-fog-softlayer/ | 2018-10-17 18:50 | - | |
| rubygem-fog/ | 2018-10-17 18:17 | - | |
| rubygem-formatador/ | 2016-08-13 02:57 | - | |
| rubygem-forwardable-extended/ | 2018-10-17 18:53 | - | |
| rubygem-gem2rpm/ | 2018-10-17 18:55 | - | |
| rubygem-gherkin/ | 2018-10-17 18:58 | - | |
| rubygem-git/ | 2018-10-17 19:02 | - | |
| rubygem-gssapi/ | 2016-08-13 03:00 | - | |
| rubygem-hiera-vault/ | 2018-10-17 19:05 | - | |
| rubygem-highline/ | 2016-08-13 03:01 | - | |
| rubygem-hocon/ | 2018-10-17 19:08 | - | |
| rubygem-hoe/ | 2016-08-13 03:04 | - | |
| rubygem-http_connection/ | 2016-08-13 03:07 | - | |
| rubygem-httparty/ | 2018-10-17 19:11 | - | |
| rubygem-httpclient/ | 2016-08-13 03:05 | - | |
| rubygem-i18n/ | 2017-08-02 12:50 | - | |
| rubygem-idn/ | 2016-08-13 03:09 | - | |
| rubygem-introspection/ | 2017-08-02 12:50 | - | |
| rubygem-ipaddress/ | 2018-10-17 19:14 | - | |
| rubygem-jekyll-sass-converter/ | 2018-10-17 19:16 | - | |
| rubygem-jekyll-watch/ | 2018-10-17 19:19 | - | |
| rubygem-jgrep/ | 2018-10-17 19:22 | - | |
| rubygem-jmespath/ | 2016-08-13 03:13 | - | |
| rubygem-jnunemaker-matchy/ | 2017-08-02 12:50 | - | |
| rubygem-journey/ | 2016-08-13 03:16 | - | |
| rubygem-json-schema/ | 2018-10-17 19:24 | - | |
| rubygem-json_pure/ | 2016-08-13 03:17 | - | |
| rubygem-json_spec/ | 2018-10-17 19:28 | - | |
| rubygem-kramdown/ | 2016-08-13 03:18 | - | |
| rubygem-launchy/ | 2018-10-17 19:31 | - | |
| rubygem-liquid/ | 2016-08-13 03:20 | - | |
| rubygem-logstash-event/ | 2016-08-13 03:21 | - | |
| rubygem-macaddr/ | 2017-08-02 12:50 | - | |
| rubygem-mail/ | 2018-10-17 19:33 | - | |
| rubygem-maruku/ | 2018-10-17 19:37 | - | |
| rubygem-memcache-client/ | 2017-08-02 12:50 | - | |
| rubygem-mercenary/ | 2018-10-17 19:40 | - | |
| rubygem-metaclass/ | 2016-08-13 03:27 | - | |
| rubygem-mime-types/ | 2016-08-13 03:28 | - | |
| rubygem-minitest-stub-const/ | 2016-08-13 03:30 | - | |
| rubygem-minitest5/ | 2018-10-17 19:42 | - | |
| rubygem-mizuho/ | 2016-08-13 03:31 | - | |
| rubygem-mocha/ | 2017-08-02 12:50 | - | |
| rubygem-moped/ | 2016-08-13 03:34 | - | |
| rubygem-multi_json/ | 2018-10-17 19:45 | - | |
| rubygem-multi_xml/ | 2018-10-17 19:51 | - | |
| rubygem-multipart-post/ | 2018-10-17 19:48 | - | |
| rubygem-narray/ | 2016-08-13 03:37 | - | |
| rubygem-nenv/ | 2016-08-13 03:38 | - | |
| rubygem-net-ldap/ | 2018-10-17 19:54 | - | |
| rubygem-net-ping/ | 2018-10-17 19:57 | - | |
| rubygem-net-scp/ | 2018-10-17 19:59 | - | |
| rubygem-net-ssh-gateway/ | 2018-10-17 20:05 | - | |
| rubygem-net-ssh-multi/ | 2018-10-17 20:08 | - | |
| rubygem-net-ssh/ | 2018-10-17 20:02 | - | |
| rubygem-netrc/ | 2016-08-13 03:41 | - | |
| rubygem-nokogiri/ | 2016-08-13 03:46 | - | |
| rubygem-open4/ | 2016-08-13 03:47 | - | |
| rubygem-opennebula/ | 2016-08-13 03:48 | - | |
| rubygem-openscap/ | 2019-02-27 03:43 | - | |
| rubygem-openssl_cms/ | 2016-08-13 03:51 | - | |
| rubygem-ox/ | 2018-10-17 20:13 | - | |
| rubygem-pathutil/ | 2018-10-17 20:16 | - | |
| rubygem-pg/ | 2018-10-17 20:19 | - | |
| rubygem-plist/ | 2018-10-17 20:23 | - | |
| rubygem-puppet-lint/ | 2016-08-13 03:55 | - | |
| rubygem-qpid_messaging/ | 2019-03-01 00:43 | - | |
| rubygem-qpid_proton/ | 2019-03-21 11:53 | - | |
| rubygem-rack-attack/ | 2018-10-17 20:33 | - | |
| rubygem-rack-cache/ | 2018-10-17 20:36 | - | |
| rubygem-rack-cors/ | 2018-10-17 20:38 | - | |
| rubygem-rack-protection/ | 2018-10-17 20:41 | - | |
| rubygem-rack-test/ | 2018-10-17 20:44 | - | |
| rubygem-rack/ | 2019-02-27 03:49 | - | |
| rubygem-rails-observers/ | 2017-08-02 12:50 | - | |
| rubygem-railties/ | 2018-10-17 20:47 | - | |
| rubygem-rake-compiler/ | 2018-10-17 20:50 | - | |
| rubygem-rbovirt/ | 2018-10-17 20:52 | - | |
| rubygem-rbvmomi/ | 2016-08-13 04:07 | - | |
| rubygem-rdiscount/ | 2019-03-21 11:55 | - | |
| rubygem-redcarpet/ | 2017-08-02 12:50 | - | |
| rubygem-redis/ | 2018-10-17 21:00 | - | |
| rubygem-ref/ | 2016-08-13 04:12 | - | |
| rubygem-require_all/ | 2018-10-17 21:03 | - | |
| rubygem-rest-client/ | 2018-10-17 21:06 | - | |
| rubygem-review/ | 2018-10-17 21:09 | - | |
| rubygem-rgen/ | 2016-08-13 04:15 | - | |
| rubygem-rhc/ | 2016-08-13 04:17 | - | |
| rubygem-rkerberos/ | 2018-10-17 21:15 | - | |
| rubygem-rouge/ | 2018-10-17 21:18 | - | |
| rubygem-rspec-core/ | 2016-08-13 04:19 | - | |
| rubygem-rspec-expectations/ | 2016-08-13 04:20 | - | |
| rubygem-rspec-mocks/ | 2016-08-13 04:21 | - | |
| rubygem-rspec-pending_for/ | 2018-10-17 21:24 | - | |
| rubygem-rspec/ | 2018-10-17 21:22 | - | |
| rubygem-ruby-libvirt/ | 2018-10-17 21:30 | - | |
| rubygem-ruby_engine/ | 2018-10-17 21:27 | - | |
| rubygem-ruby_version/ | 2018-10-17 21:34 | - | |
| rubygem-safe_yaml/ | 2016-08-13 04:24 | - | |
| rubygem-sass/ | 2016-08-13 04:25 | - | |
| rubygem-settingslogic/ | 2016-08-13 04:27 | - | |
| rubygem-shellany/ | 2016-08-13 04:28 | - | |
| rubygem-shindo/ | 2016-08-13 04:29 | - | |
| rubygem-shoulda/ | 2016-08-13 04:30 | - | |
| rubygem-simplecov-html/ | 2016-08-13 04:31 | - | |
| rubygem-simplecov/ | 2018-10-17 21:37 | - | |
| rubygem-sinatra/ | 2018-10-17 21:39 | - | |
| rubygem-sqlite3/ | 2016-08-13 04:33 | - | |
| rubygem-sshkey/ | 2017-08-02 12:50 | - | |
| rubygem-systemu/ | 2016-08-13 04:36 | - | |
| rubygem-term-ansicolor/ | 2016-08-13 04:37 | - | |
| rubygem-test-unit/ | 2016-08-13 04:39 | - | |
| rubygem-test_declarative/ | 2016-08-13 04:38 | - | |
| rubygem-therubyracer/ | 2019-02-27 03:53 | - | |
| rubygem-thin/ | 2019-03-21 11:57 | - | |
| rubygem-thread_safe/ | 2017-08-02 12:50 | - | |
| rubygem-tilt/ | 2019-02-27 04:02 | - | |
| rubygem-tins/ | 2018-10-17 21:51 | - | |
| rubygem-trollop/ | 2016-08-13 04:45 | - | |
| rubygem-tzinfo/ | 2017-08-02 12:50 | - | |
| rubygem-uglifier/ | 2019-02-27 04:04 | - | |
| rubygem-unicode/ | 2016-08-13 04:48 | - | |
| rubygem-uuid/ | 2018-10-17 21:56 | - | |
| rubygem-uuidtools/ | 2018-10-17 21:59 | - | |
| rubygem-vault/ | 2018-10-17 22:02 | - | |
| rubygem-vcr/ | 2016-08-13 04:50 | - | |
| rubygem-webmock/ | 2018-10-17 22:04 | - | |
| rubygem-wikicloth/ | 2018-10-17 22:07 | - | |
| rubygem-yell/ | 2018-10-17 22:10 | - | |
| rust/ | 2019-03-21 12:01 | - | |
| rxjava/ | 2017-08-02 12:50 | - | |
| rxtx/ | 2018-10-17 22:15 | - | |
| rxvt-unicode/ | 2016-08-13 04:59 | - | |
| s3cmd/ | 2018-10-17 22:21 | - | |
| s3fs-fuse/ | 2019-02-27 04:09 | - | |
| safekeep/ | 2018-10-17 22:26 | - | |
| safelease/ | 2016-08-13 05:02 | - | |
| safetyblanket/ | 2018-10-17 22:30 | - | |
| sagator/ | 2019-02-27 04:13 | - | |
| salt/ | 2018-10-17 22:35 | - | |
| samdump2/ | 2016-08-13 05:04 | - | |
| samefile/ | 2016-08-13 05:05 | - | |
| samtools/ | 2016-08-13 05:06 | - | |
| saoimage/ | 2016-08-13 05:08 | - | |
| saslwrapper/ | 2016-08-13 05:10 | - | |
| sassc/ | 2018-10-17 22:38 | - | |
| sasutils/ | 2019-02-27 04:15 | - | |
| sazanami-fonts/ | 2018-10-17 22:45 | - | |
| sbcl/ | 2019-03-21 12:03 | - | |
| scalapack/ | 2019-03-21 12:05 | - | |
| scalasca/ | 2019-02-27 04:21 | - | |
| scalpel/ | 2019-02-27 04:29 | - | |
| scamper/ | 2016-08-13 05:23 | - | |
| scap-security-guide/ | 2016-08-13 05:25 | - | |
| scapy/ | 2019-02-27 04:32 | - | |
| schroedinger/ | 2016-08-13 05:27 | - | |
| schroot/ | 2019-02-27 04:34 | - | |
| scite/ | 2016-08-13 05:31 | - | |
| scons/ | 2018-10-17 23:21 | - | |
| scorep/ | 2018-10-17 23:23 | - | |
| scotch/ | 2018-10-17 23:33 | - | |
| scponly/ | 2018-10-17 23:37 | - | |
| screengrab/ | 2018-10-17 23:40 | - | |
| scribus/ | 2016-08-13 05:37 | - | |
| scsi-target-utils/ | 2018-10-17 23:44 | - | |
| sdcc/ | 2016-08-13 05:47 | - | |
| sddm/ | 2018-10-17 23:47 | - | |
| sdformat/ | 2019-02-27 04:40 | - | |
| seamonkey/ | 2019-03-21 12:07 | - | |
| sec/ | 2019-02-27 05:23 | - | |
| secilc/ | 2019-03-21 12:23 | - | |
| sedutil/ | 2018-10-18 00:46 | - | |
| sems/ | 2017-08-02 12:50 | - | |
| sendemail/ | 2018-10-18 00:49 | - | |
| sendxmpp/ | 2016-08-13 06:09 | - | |
| sensible-utils/ | 2019-02-27 05:30 | - | |
| ser2net/ | 2018-10-18 00:54 | - | |
| seren/ | 2016-08-13 06:10 | - | |
| sevmgr/ | 2019-02-27 05:33 | - | |
| sfk/ | 2016-08-13 06:12 | - | |
| shake/ | 2019-03-21 12:26 | - | |
| shapelib/ | 2018-10-18 01:01 | - | |
| shellinabox/ | 2018-10-18 01:06 | - | |
| shflags/ | 2016-08-13 06:16 | - | |
| shiboken/ | 2019-03-21 12:30 | - | |
| shigofumi/ | 2018-10-18 01:11 | - | |
| shinken/ | 2018-10-18 01:15 | - | |
| shogun-data/ | 2018-10-18 01:17 | - | |
| shorewall/ | 2018-10-18 01:23 | - | |
| shortrpm/ | 2016-08-13 06:27 | - | |
| shrinkwrap/ | 2018-10-18 01:26 | - | |
| shtool/ | 2016-08-13 06:28 | - | |
| sicktoolbox/ | 2016-08-13 06:29 | - | |
| siege/ | 2018-10-18 01:32 | - | |
| sigil/ | 2018-10-18 01:35 | - | |
| signpost-core/ | 2016-08-13 06:33 | - | |
| sil-mingzat-fonts/ | 2018-10-18 01:46 | - | |
| silkscreen-fonts/ | 2018-10-18 01:43 | - | |
| silvia/ | 2016-08-13 06:35 | - | |
| simcrs/ | 2019-03-21 12:32 | - | |
| simfqt/ | 2019-02-27 05:48 | - | |
| simple-scan/ | 2016-08-13 06:39 | - | |
| sing/ | 2018-10-18 01:56 | - | |
| singularity/ | 2019-03-21 12:34 | - | |
| sip-redirect/ | 2016-08-13 06:43 | - | |
| sipp/ | 2018-10-18 02:01 | - | |
| sispmctl/ | 2016-08-13 06:44 | - | |
| skanlite/ | 2018-10-18 02:04 | - | |
| skeinforge/ | 2016-08-13 06:45 | - | |
| skipfish/ | 2016-08-13 06:47 | - | |
| sks/ | 2019-03-21 12:36 | - | |
| sl/ | 2018-10-18 02:13 | - | |
| sleuthkit/ | 2018-10-18 02:15 | - | |
| slf4j-jboss-logmanager/ | 2018-10-18 02:19 | - | |
| slibtool/ | 2019-02-27 06:00 | - | |
| slick-greeter/ | 2019-03-21 12:38 | - | |
| slim/ | 2019-02-27 06:07 | - | |
| sloccount/ | 2016-08-13 06:50 | - | |
| slowhttptest/ | 2016-08-13 06:51 | - | |
| slrn/ | 2018-10-18 02:35 | - | |
| slv2/ | 2018-10-18 02:38 | - | |
| smaclient/ | 2016-08-13 06:53 | - | |
| smbldap-tools/ | 2018-10-18 02:41 | - | |
| smem/ | 2018-10-18 02:44 | - | |
| smemstat/ | 2016-08-13 06:55 | - | |
| smesh/ | 2018-10-18 02:46 | - | |
| smokegen/ | 2018-10-18 02:54 | - | |
| smokeping/ | 2018-10-18 02:58 | - | |
| smokeqt/ | 2018-10-18 03:02 | - | |
| smp_utils/ | 2016-08-13 06:57 | - | |
| smstools/ | 2016-08-13 06:58 | - | |
| smtpping/ | 2018-10-18 03:10 | - | |
| snapd-glib/ | 2019-02-27 06:13 | - | |
| snapd/ | 2019-03-21 12:43 | - | |
| snapraid/ | 2018-10-18 03:13 | - | |
| sniproxy/ | 2017-08-02 12:50 | - | |
| snmpcheck/ | 2016-08-13 07:04 | - | |
| snmptt/ | 2016-08-13 07:05 | - | |
| snobol/ | 2016-08-13 07:06 | - | |
| soci/ | 2018-10-18 03:18 | - | |
| socket_wrapper/ | 2019-02-27 06:17 | - | |
| sockperf/ | 2018-10-18 03:26 | - | |
| solo3/ | 2019-03-21 12:45 | - | |
| sombok/ | 2018-10-18 03:35 | - | |
| soscleaner/ | 2016-08-13 07:18 | - | |
| soundkonverter/ | 2019-03-21 12:48 | - | |
| soxr/ | 2016-08-13 07:19 | - | |
| spacecmd/ | 2018-10-18 03:43 | - | |
| spacenavd/ | 2016-08-13 07:22 | - | |
| spacewalk-pylint/ | 2016-08-13 07:23 | - | |
| spamass-milter/ | 2018-10-18 03:48 | - | |
| spamassassin-iXhash2/ | 2018-10-18 03:46 | - | |
| spandsp/ | 2016-08-13 07:27 | - | |
| sparse/ | 2018-10-18 03:52 | - | |
| sparsehash/ | 2016-08-13 07:29 | - | |
| spasm-ng/ | 2018-10-18 03:55 | - | |
| spatial4j/ | 2018-10-18 03:58 | - | |
| spatialindex/ | 2016-08-13 07:31 | - | |
| spawn-fcgi/ | 2016-08-13 07:32 | - | |
| spdlog/ | 2018-10-18 04:04 | - | |
| spec-version-maven-plugin/ | 2018-10-18 04:09 | - | |
| spectre-meltdown-checker/ | 2019-02-27 06:26 | - | |
| spectrwm/ | 2016-08-13 07:35 | - | |
| spglib/ | 2019-03-21 12:50 | - | |
| spice-html5/ | 2018-10-18 04:16 | - | |
| spirv-tools/ | 2019-03-21 12:53 | - | |
| splint/ | 2016-08-13 07:37 | - | |
| splix/ | 2016-08-13 07:39 | - | |
| spooky-c/ | 2016-08-13 07:40 | - | |
| spyder/ | 2016-08-13 07:42 | - | |
| sqlgrey/ | 2016-08-13 07:43 | - | |
| sqlite2/ | 2016-08-13 07:44 | - | |
| sqlite3-dbf/ | 2016-08-13 07:46 | - | |
| squashfuse/ | 2019-02-27 06:31 | - | |
| squidGuard/ | 2018-10-18 04:21 | - | |
| squirrel/ | 2018-10-18 04:24 | - | |
| squirrelmail/ | 2018-10-18 04:27 | - | |
| srcpd/ | 2016-08-13 07:50 | - | |
| srecord/ | 2018-10-18 04:30 | - | |
| srm-ifce/ | 2019-03-01 01:47 | - | |
| srm/ | 2018-10-18 04:36 | - | |
| sscep/ | 2018-10-18 04:41 | - | |
| sscg/ | 2019-03-21 12:55 | - | |
| ssdeep/ | 2018-10-18 04:46 | - | |
| sshpass/ | 2018-10-18 04:48 | - | |
| sshuttle/ | 2016-08-13 07:56 | - | |
| ssldump/ | 2016-08-13 07:57 | - | |
| sslh/ | 2018-10-18 04:51 | - | |
| sslscan/ | 2016-08-13 08:01 | - | |
| sslsplit/ | 2016-08-13 08:02 | - | |
| ssm/ | 2018-10-18 04:55 | - | |
| ssmtp/ | 2016-08-13 08:03 | - | |
| standard-test-roles/ | 2018-10-18 04:57 | - | |
| statscache-plugins/ | 2018-10-18 05:03 | - | |
| statscache/ | 2018-10-18 05:00 | - | |
| statsd/ | 2018-10-18 05:06 | - | |
| staxmapper/ | 2018-10-18 05:09 | - | |
| stdair/ | 2018-10-18 05:15 | - | |
| stellarium/ | 2018-10-18 05:23 | - | |
| stgit/ | 2016-08-13 08:09 | - | |
| sticky-notes/ | 2016-08-13 08:12 | - | |
| stlink/ | 2019-03-21 12:57 | - | |
| stoken/ | 2018-10-18 05:35 | - | |
| stompclt/ | 2018-10-18 05:39 | - | |
| stomppy/ | 2018-10-18 05:42 | - | |
| stonevpn/ | 2018-10-18 05:45 | - | |
| stow/ | 2016-08-13 08:16 | - | |
| stress-ng/ | 2018-10-18 05:50 | - | |
| stress/ | 2018-10-18 05:48 | - | |
| strongswan/ | 2019-02-27 06:43 | - | |
| struts/ | 2018-10-18 06:00 | - | |
| subnetcalc/ | 2016-08-13 08:18 | - | |
| subunit/ | 2016-08-13 08:19 | - | |
| sucrack/ | 2016-08-13 08:22 | - | |
| sundials/ | 2019-03-21 13:01 | - | |
| sunwait/ | 2016-08-13 08:25 | - | |
| sunxi-tools/ | 2016-08-13 08:26 | - | |
| superlu_dist/ | 2018-10-18 06:11 | - | |
| supervisor/ | 2018-10-18 06:19 | - | |
| supybot-fedmsg/ | 2016-08-13 08:29 | - | |
| supybot-fedora/ | 2016-08-13 08:30 | - | |
| supybot-gribble/ | 2016-08-13 08:31 | - | |
| supybot-koji/ | 2016-08-13 08:32 | - | |
| supybot-meetbot/ | 2016-08-13 08:33 | - | |
| supybot-notify/ | 2018-10-18 06:22 | - | |
| suricata/ | 2019-03-21 13:07 | - | |
| svgsalamander/ | 2016-08-13 08:38 | - | |
| svn2cl/ | 2018-10-18 06:26 | - | |
| svnmailer/ | 2018-10-18 06:29 | - | |
| swaks/ | 2018-10-18 06:32 | - | |
| swatch/ | 2019-02-27 06:56 | - | |
| sword/ | 2018-10-18 06:37 | - | |
| sx/ | 2018-10-18 06:41 | - | |
| sylfilter/ | 2017-08-02 12:50 | - | |
| sylpheed/ | 2016-08-13 08:44 | - | |
| sympy/ | 2016-08-13 08:46 | - | |
| synergy/ | 2018-10-18 06:44 | - | |
| sys_basher/ | 2016-08-13 10:06 | - | |
| sysbench/ | 2018-10-18 06:49 | - | |
| syslog-ng/ | 2016-08-13 10:09 | - | |
| sysprof/ | 2016-08-13 10:11 | - | |
| sysreporter/ | 2018-10-18 06:53 | - | |
| sysusage/ | 2019-02-27 06:59 | - | |
| t1utils/ | 2016-08-13 10:13 | - | |
| tabish-eeyek-fonts/ | 2016-08-13 10:14 | - | |
| tagainijisho/ | 2016-08-13 10:16 | - | |
| taglib-extras/ | 2016-08-13 10:19 | - | |
| taglib-sharp/ | 2019-03-21 13:09 | - | |
| tangerine-fonts/ | 2016-08-13 10:21 | - | |
| tangerine/ | 2019-02-27 07:04 | - | |
| tapkee/ | 2018-10-18 07:03 | - | |
| tarantool/ | 2018-10-18 07:10 | - | |
| task/ | 2018-10-18 07:16 | - | |
| taskjuggler/ | 2018-10-18 07:20 | - | |
| tayga/ | 2016-08-13 10:25 | - | |
| tcalc/ | 2018-10-18 07:27 | - | |
| tcl-mysqltcl/ | 2016-08-13 10:28 | - | |
| tcl-tclnagios/ | 2018-10-18 07:29 | - | |
| tcl-tclreadline/ | 2016-08-13 10:30 | - | |
| tcl-togl/ | 2016-08-13 10:32 | - | |
| tcllib/ | 2016-08-13 10:27 | - | |
| tcltls/ | 2016-08-13 10:31 | - | |
| tcpcopy/ | 2016-08-13 10:34 | - | |
| tcpcrypt/ | 2016-08-13 10:35 | - | |
| tcpflow/ | 2018-10-18 07:32 | - | |
| tcpick/ | 2016-08-13 10:37 | - | |
| tcping/ | 2016-08-13 10:38 | - | |
| tcpreen/ | 2016-08-13 10:39 | - | |
| tcpreplay/ | 2019-02-27 07:06 | - | |
| tcpxtract/ | 2016-08-13 10:42 | - | |
| teeworlds/ | 2019-02-27 07:10 | - | |
| tegrarcm/ | 2018-10-18 07:44 | - | |
| terminator/ | 2016-08-13 10:47 | - | |
| terminus-fonts/ | 2016-08-13 10:49 | - | |
| teseq/ | 2016-08-13 10:50 | - | |
| tesseract/ | 2016-08-13 10:51 | - | |
| testdisk/ | 2018-10-18 07:47 | - | |
| testssl/ | 2018-10-18 07:51 | - | |
| tetex-dvipost/ | 2016-08-13 11:01 | - | |
| tetgen/ | 2016-08-13 11:03 | - | |
| texlive-extension/ | 2018-10-18 07:53 | - | |
| texmaker/ | 2018-10-18 07:57 | - | |
| textcat/ | 2016-08-13 11:11 | - | |
| texworks/ | 2018-10-18 08:03 | - | |
| tfdocgen/ | 2018-10-18 08:07 | - | |
| tharlon-fonts/ | 2016-08-13 11:12 | - | |
| thc-ipv6/ | 2016-08-13 11:13 | - | |
| the_silver_searcher/ | 2018-10-18 08:14 | - | |
| thermald/ | 2018-10-18 08:10 | - | |
| thrift/ | 2018-10-18 08:17 | - | |
| throttle/ | 2016-08-13 11:21 | - | |
| thttpd/ | 2018-10-18 08:27 | - | |
| thunar-archive-plugin/ | 2019-03-21 13:13 | - | |
| thunar-vcs-plugin/ | 2019-03-21 13:15 | - | |
| thunar-volman/ | 2019-03-21 13:17 | - | |
| thunderbird-enigmail/ | 2018-10-18 08:38 | - | |
| tidy/ | 2018-10-18 08:41 | - | |
| tidyp/ | 2016-08-13 11:27 | - | |
| tig/ | 2018-10-18 08:44 | - | |
| tilp2/ | 2019-03-01 02:11 | - | |
| timeshift/ | 2018-10-18 08:50 | - | |
| tinc/ | 2019-02-27 07:24 | - | |
| tint2/ | 2019-02-27 07:27 | - | |
| tinyca2/ | 2016-08-13 11:32 | - | |
| tinycdb/ | 2016-08-13 11:33 | - | |
| tinydir/ | 2018-10-18 09:01 | - | |
| tinyfugue/ | 2016-08-13 11:34 | - | |
| tinyproxy/ | 2016-08-13 11:36 | - | |
| tinyxml/ | 2018-10-18 09:03 | - | |
| tinyxml2/ | 2016-08-13 11:37 | - | |
| tio/ | 2018-10-18 09:06 | - | |
| tipcutils/ | 2016-08-13 11:39 | - | |
| tiptop/ | 2016-08-13 11:40 | - | |
| tito/ | 2018-10-18 09:09 | - | |
| tkcvs/ | 2016-08-13 11:43 | - | |
| tklib/ | 2018-10-18 09:12 | - | |
| tktable/ | 2016-08-13 11:44 | - | |
| tlock/ | 2018-10-18 09:15 | - | |
| tlp/ | 2018-10-18 09:18 | - | |
| tlssled/ | 2016-08-13 11:46 | - | |
| tmux-top/ | 2016-08-13 11:47 | - | |
| tnef/ | 2018-10-18 09:21 | - | |
| tnftp/ | 2016-08-13 11:49 | - | |
| tng/ | 2018-10-18 09:24 | - | |
| todocli/ | 2018-10-18 09:28 | - | |
| tofrodos/ | 2016-08-13 11:51 | - | |
| tolua++/ | 2016-08-13 11:52 | - | |
| tomcat-native/ | 2018-10-18 09:30 | - | |
| tomoe/ | 2016-08-13 11:55 | - | |
| tor/ | 2019-02-27 07:31 | - | |
| torque/ | 2018-10-18 09:39 | - | |
| torrent-file-editor/ | 2018-10-18 09:47 | - | |
| torsocks/ | 2019-02-27 07:37 | - | |
| tpm2-tools/ | 2019-03-21 13:19 | - | |
| tpm2-tss/ | 2018-10-18 09:53 | - | |
| trabajo-fonts/ | 2016-08-13 12:03 | - | |
| trac-mercurial-plugin/ | 2018-10-18 10:03 | - | |
| trac/ | 2018-10-18 09:56 | - | |
| trace-summary/ | 2016-08-13 12:04 | - | |
| tracer/ | 2019-02-27 07:42 | - | |
| trademgen/ | 2019-02-27 07:44 | - | |
| trader/ | 2018-10-18 10:08 | - | |
| trafficserver/ | 2018-10-18 10:11 | - | |
| trafshow/ | 2016-08-13 12:10 | - | |
| transifex-client/ | 2018-10-18 10:16 | - | |
| translate-toolkit/ | 2016-08-13 12:12 | - | |
| transmission/ | 2018-10-18 10:18 | - | |
| transtats-cli/ | 2018-10-18 10:25 | - | |
| travelccm/ | 2018-10-18 10:28 | - | |
| tre/ | 2018-10-18 10:34 | - | |
| treelayout/ | 2018-10-18 10:38 | - | |
| tremulous-data/ | 2018-10-18 10:47 | - | |
| tremulous/ | 2018-10-18 10:43 | - | |
| trickle/ | 2016-08-13 12:16 | - | |
| tripwire/ | 2018-10-18 10:50 | - | |
| trojita/ | 2019-03-21 13:22 | - | |
| trustedqsl/ | 2019-02-27 07:53 | - | |
| tslib/ | 2018-10-18 10:59 | - | |
| tsung/ | 2019-03-21 13:24 | - | |
| ttembed/ | 2016-08-13 12:22 | - | |
| ttf2pt1/ | 2018-10-18 11:04 | - | |
| tuladha-jejeg-fonts/ | 2016-08-13 12:25 | - | |
| tulrich-tuffy-fonts/ | 2016-08-13 12:26 | - | |
| tumbler/ | 2018-10-18 11:07 | - | |
| tunneler/ | 2016-08-13 12:29 | - | |
| tuxcut/ | 2016-08-13 12:32 | - | |
| tuxpaint/ | 2018-10-18 11:18 | - | |
| twa/ | 2019-02-27 08:01 | - | |
| tweak/ | 2016-08-13 12:34 | - | |
| twolame/ | 2019-02-27 08:04 | - | |
| tworld/ | 2018-10-18 11:22 | - | |
| txt2man/ | 2016-08-13 12:35 | - | |
| txt2regex/ | 2016-08-13 12:36 | - | |
| txt2tags/ | 2018-10-18 11:25 | - | |
| typetype-molot-fonts/ | 2018-10-18 11:28 | - | |
| uberftp/ | 2017-08-02 12:50 | - | |
| ucarp/ | 2018-10-18 11:31 | - | |
| uchardet/ | 2018-10-18 11:34 | - | |
| ucl/ | 2018-10-18 11:37 | - | |
| ucpp/ | 2016-08-13 12:40 | - | |
| ucview/ | 2018-10-18 11:40 | - | |
| ucx/ | 2019-03-21 13:26 | - | |
| udis86/ | 2019-02-27 08:09 | - | |
| udiskie/ | 2016-08-13 12:42 | - | |
| udns/ | 2016-08-13 12:44 | - | |
| udpcast/ | 2016-08-13 12:45 | - | |
| udt/ | 2018-10-18 11:46 | - | |
| udunits2/ | 2016-08-13 12:46 | - | |
| ufraw/ | 2019-02-27 08:12 | - | |
| ufw/ | 2018-10-18 11:49 | - | |
| uget/ | 2018-10-18 11:52 | - | |
| uglify-js/ | 2018-10-18 11:57 | - | |
| uglify-js1/ | 2017-08-02 12:50 | - | |
| uhd/ | 2018-10-18 11:59 | - | |
| uid_wrapper/ | 2018-10-18 12:14 | - | |
| umlgraph/ | 2018-10-18 12:17 | - | |
| unar/ | 2018-10-18 12:23 | - | |
| uncrustify/ | 2018-10-18 12:27 | - | |
| undbx/ | 2016-08-13 12:57 | - | |
| unhide/ | 2016-08-13 12:58 | - | |
| unibilium/ | 2018-10-18 12:30 | - | |
| unicornscan/ | 2018-10-18 12:33 | - | |
| unique/ | 2016-08-13 12:59 | - | |
| unison240/ | 2019-03-21 13:28 | - | |
| unittest-cpp/ | 2018-10-18 12:43 | - | |
| unpaper/ | 2016-08-13 13:01 | - | |
| unrtf/ | 2019-02-27 08:23 | - | |
| unuran/ | 2018-10-18 12:46 | - | |
| unzoo/ | 2016-08-13 13:08 | - | |
| up-imapproxy/ | 2018-10-18 12:53 | - | |
| uptimed/ | 2018-10-18 12:56 | - | |
| upx/ | 2018-10-18 12:59 | - | |
| urdfdom-headers/ | 2016-08-13 13:10 | - | |
| urdfdom/ | 2018-10-18 13:02 | - | |
| urjtag/ | 2019-03-21 13:34 | - | |
| usbsniff/ | 2016-08-13 13:11 | - | |
| userspace-rcu/ | 2016-08-13 13:12 | - | |
| ustl/ | 2019-02-27 08:28 | - | |
| utf8cpp/ | 2016-08-13 13:15 | - | |
| utf8proc/ | 2018-10-18 13:10 | - | |
| uthash/ | 2018-10-18 13:13 | - | |
| uucp/ | 2016-08-13 13:18 | - | |
| uw-imap/ | 2018-10-18 13:17 | - | |
| uwsgi/ | 2019-03-21 13:36 | - | |
| v8/ | 2018-10-18 13:22 | - | |
| vamp-plugin-sdk/ | 2016-08-13 13:23 | - | |
| vanessa_adt/ | 2017-08-02 12:50 | - | |
| vanessa_logger/ | 2016-08-13 13:25 | - | |
| vanessa_socket/ | 2017-08-02 12:50 | - | |
| varnish/ | 2018-10-18 13:37 | - | |
| vcftools/ | 2018-10-18 13:56 | - | |
| vconfig/ | 2016-08-13 13:43 | - | |
| vdpauinfo/ | 2016-08-13 13:44 | - | |
| verilator/ | 2018-10-18 13:59 | - | |
| vertica-python/ | 2018-10-18 14:06 | - | |
| vid.stab/ | 2018-10-18 14:09 | - | |
| viewvc/ | 2018-10-18 14:12 | - | |
| viking/ | 2017-08-02 12:50 | - | |
| vile/ | 2019-02-27 08:33 | - | |
| vim-fugitive/ | 2018-10-18 14:15 | - | |
| vim-go/ | 2018-10-18 14:18 | - | |
| vim-gtk-syntax/ | 2016-08-13 13:51 | - | |
| vim-jellybeans/ | 2018-10-18 14:20 | - | |
| vim-toml/ | 2018-10-18 14:23 | - | |
| vim-vimoutliner/ | 2018-10-18 14:25 | - | |
| vkd3d/ | 2019-03-21 13:38 | - | |
| vncpwd/ | 2018-10-18 14:32 | - | |
| vnstat/ | 2018-10-18 14:34 | - | |
| vodovod/ | 2018-10-18 14:37 | - | |
| voms-api-java/ | 2018-10-18 14:45 | - | |
| voms-clients-java/ | 2019-02-27 08:37 | - | |
| voms-mysql-plugin/ | 2018-10-18 14:56 | - | |
| voms/ | 2018-10-18 14:41 | - | |
| voro++/ | 2016-08-13 14:02 | - | |
| votca-csg/ | 2019-03-21 13:40 | - | |
| votca-tools/ | 2019-03-01 02:37 | - | |
| votca-xtp/ | 2019-03-21 13:42 | - | |
| vpnc/ | 2018-10-18 15:05 | - | |
| vrms-rpm/ | 2019-02-27 08:48 | - | |
| vsqlite++/ | 2016-08-13 14:03 | - | |
| vtable-dumper/ | 2016-08-13 14:05 | - | |
| vte/ | 2016-08-13 14:06 | - | |
| vtk/ | 2019-02-27 08:51 | - | |
| vtkdata/ | 2016-08-13 14:08 | - | |
| vttest/ | 2016-08-13 14:10 | - | |
| vtun/ | 2018-10-18 15:13 | - | |
| vym/ | 2018-10-18 15:16 | - | |
| w3c-markup-validator/ | 2016-08-13 14:12 | - | |
| w3m/ | 2018-10-18 15:21 | - | |
| waf/ | 2018-10-18 15:25 | - | |
| waffle/ | 2016-08-13 14:15 | - | |
| waiverdb/ | 2018-10-18 15:30 | - | |
| wammu/ | 2019-02-27 09:39 | - | |
| wannier90/ | 2018-10-18 15:37 | - | |
| warsow-data/ | 2018-10-18 15:53 | - | |
| warsow/ | 2018-10-18 15:44 | - | |
| warzone2100/ | 2018-10-18 16:01 | - | |
| wavemon/ | 2016-08-13 14:17 | - | |
| wbox/ | 2016-08-13 14:18 | - | |
| wcslib/ | 2016-08-13 14:19 | - | |
| wcstools/ | 2018-10-18 16:10 | - | |
| wdiff/ | 2018-10-18 16:14 | - | |
| weasyprint/ | 2016-08-13 14:21 | - | |
| web-assets/ | 2016-08-13 14:22 | - | |
| webalizer/ | 2018-10-18 16:17 | - | |
| webextension-token-signing/ | 2018-10-18 16:20 | - | |
| webfts/ | 2018-10-18 16:24 | - | |
| websvn/ | 2018-10-18 16:26 | - | |
| weechat/ | 2019-02-27 09:41 | - | |
| wemux/ | 2016-08-13 14:26 | - | |
| weplab/ | 2016-08-13 14:27 | - | |
| wesnoth/ | 2019-03-21 13:45 | - | |
| wgrib/ | 2018-10-18 16:41 | - | |
| wgrib2/ | 2018-10-18 16:44 | - | |
| whatsup/ | 2018-10-18 16:48 | - | |
| whereami/ | 2016-08-13 14:31 | - | |
| whowatch/ | 2018-10-18 16:52 | - | |
| wide-dhcpv6/ | 2016-08-13 14:33 | - | |
| wildfly-common/ | 2018-10-18 16:55 | - | |
| wildmagic5/ | 2018-10-18 17:01 | - | |
| wildmidi/ | 2019-02-27 09:50 | - | |
| will-crash/ | 2016-08-13 14:48 | - | |
| wine/ | 2019-03-21 13:50 | - | |
| wiredtiger/ | 2019-03-21 13:52 | - | |
| wireless-tools/ | 2016-08-13 14:51 | - | |
| wise2/ | 2016-08-13 14:52 | - | |
| withlock/ | 2016-08-13 14:54 | - | |
| wkhtmltopdf/ | 2018-10-18 17:42 | - | |
| wmctrl/ | 2018-10-18 17:46 | - | |
| woff/ | 2018-10-18 17:49 | - | |
| woffTools/ | 2018-10-18 17:51 | - | |
| wondershaper/ | 2016-08-13 14:58 | - | |
| wordpress/ | 2019-02-27 09:56 | - | |
| worker/ | 2018-10-18 17:57 | - | |
| workrave/ | 2019-03-21 13:54 | - | |
| ws-xmlschema/ | 2018-10-18 18:04 | - | |
| wsjtx/ | 2019-03-21 13:56 | - | |
| wt/ | 2018-10-18 18:10 | - | |
| wxGTK/ | 2018-10-18 18:34 | - | |
| wxGTK3/ | 2018-10-18 18:43 | - | |
| wxPython/ | 2018-10-18 19:01 | - | |
| wxmacmolplt/ | 2018-10-18 18:56 | - | |
| x2goclient/ | 2019-03-21 14:05 | - | |
| x2godesktopsharing/ | 2019-02-27 10:13 | - | |
| x2goserver/ | 2019-02-27 10:16 | - | |
| x11vnc/ | 2016-08-13 15:03 | - | |
| x509viewer/ | 2018-10-18 19:16 | - | |
| x509watch/ | 2018-10-18 19:19 | - | |
| xa/ | 2018-10-18 19:22 | - | |
| xalan-c/ | 2018-10-18 19:24 | - | |
| xapian-bindings/ | 2017-08-02 12:50 | - | |
| xapian-core/ | 2016-08-13 15:18 | - | |
| xapps/ | 2019-03-21 14:08 | - | |
| xarchiver/ | 2017-08-02 12:50 | - | |
| xawtv/ | 2018-10-18 19:33 | - | |
| xbacklight/ | 2018-10-18 19:38 | - | |
| xbae/ | 2018-10-18 19:41 | - | |
| xboxdrv/ | 2016-08-13 15:24 | - | |
| xca/ | 2018-10-18 19:44 | - | |
| xcalc/ | 2016-08-13 15:28 | - | |
| xcb-util-cursor/ | 2016-08-13 15:29 | - | |
| xclip/ | 2016-08-13 15:30 | - | |
| xdotool/ | 2016-08-13 15:32 | - | |
| xed/ | 2019-03-21 14:11 | - | |
| xedit/ | 2016-08-13 15:33 | - | |
| xemacs-packages-base/ | 2018-10-18 20:05 | - | |
| xemacs-packages-extra/ | 2018-10-18 20:08 | - | |
| xemacs/ | 2018-10-18 19:54 | - | |
| xenlism-wildfire/ | 2018-10-18 20:28 | - | |
| xfce-polkit/ | 2019-03-21 15:30 | - | |
| xfce4-appfinder/ | 2019-03-21 14:13 | - | |
| xfce4-battery-plugin/ | 2019-03-21 14:15 | - | |
| xfce4-calculator-plugin/ | 2019-03-21 14:17 | - | |
| xfce4-clipman-plugin/ | 2019-03-21 14:19 | - | |
| xfce4-cpufreq-plugin/ | 2019-03-21 14:21 | - | |
| xfce4-cpugraph-plugin/ | 2019-03-21 14:23 | - | |
| xfce4-datetime-plugin/ | 2019-03-21 14:25 | - | |
| xfce4-dev-tools/ | 2018-10-18 20:47 | - | |
| xfce4-dict/ | 2019-03-21 14:27 | - | |
| xfce4-diskperf-plugin/ | 2019-03-21 14:29 | - | |
| xfce4-equake-plugin/ | 2019-03-21 14:31 | - | |
| xfce4-eyes-plugin/ | 2019-03-21 14:33 | - | |
| xfce4-fsguard-plugin/ | 2019-03-21 14:35 | - | |
| xfce4-genmon-plugin/ | 2019-03-21 14:37 | - | |
| xfce4-hamster-plugin/ | 2019-03-21 14:40 | - | |
| xfce4-mailwatch-plugin/ | 2019-03-21 14:42 | - | |
| xfce4-mixer/ | 2019-03-21 14:44 | - | |
| xfce4-mount-plugin/ | 2019-03-21 14:46 | - | |
| xfce4-netload-plugin/ | 2019-03-21 14:48 | - | |
| xfce4-notes-plugin/ | 2019-03-21 14:50 | - | |
| xfce4-notifyd/ | 2019-03-21 14:52 | - | |
| xfce4-panel/ | 2019-03-21 14:54 | - | |
| xfce4-power-manager/ | 2019-03-21 14:56 | - | |
| xfce4-pulseaudio-plugin/ | 2019-03-21 14:58 | - | |
| xfce4-screenshooter/ | 2019-03-21 15:01 | - | |
| xfce4-sensors-plugin/ | 2019-03-21 15:03 | - | |
| xfce4-session/ | 2019-03-21 15:05 | - | |
| xfce4-settings/ | 2019-03-21 15:07 | - | |
| xfce4-smartbookmark-plugin/ | 2019-03-21 15:09 | - | |
| xfce4-systemload-plugin/ | 2019-03-21 15:11 | - | |
| xfce4-taskmanager/ | 2019-03-21 15:13 | - | |
| xfce4-terminal/ | 2019-03-21 15:15 | - | |
| xfce4-time-out-plugin/ | 2019-03-21 15:18 | - | |
| xfce4-vala/ | 2019-02-27 11:29 | - | |
| xfce4-verve-plugin/ | 2019-03-21 15:20 | - | |
| xfce4-wavelan-plugin/ | 2019-03-21 15:22 | - | |
| xfce4-weather-plugin/ | 2019-03-21 15:24 | - | |
| xfce4-whiskermenu-plugin/ | 2019-03-21 15:26 | - | |
| xfce4-xkb-plugin/ | 2019-03-21 15:28 | - | |
| xfconf/ | 2018-10-18 21:59 | - | |
| xfdashboard/ | 2019-03-21 15:32 | - | |
| xfdesktop/ | 2019-03-21 15:34 | - | |
| xfig/ | 2016-08-13 16:13 | - | |
| xfoil/ | 2016-08-13 16:15 | - | |
| xforms/ | 2016-08-13 16:17 | - | |
| xfwm4-themes/ | 2018-10-18 22:10 | - | |
| xfwm4/ | 2019-03-21 15:36 | - | |
| xiphos/ | 2018-10-18 22:13 | - | |
| xl2tpd/ | 2018-10-18 22:18 | - | |
| xloadimage/ | 2016-08-13 16:23 | - | |
| xlockmore/ | 2019-02-27 11:50 | - | |
| xlogin/ | 2016-08-13 16:27 | - | |
| xls2csv/ | 2017-08-02 12:50 | - | |
| xmakemol/ | 2018-10-18 22:25 | - | |
| xml-security-c/ | 2018-10-18 22:37 | - | |
| xml2/ | 2018-10-18 22:29 | - | |
| xmlcopyeditor/ | 2018-10-18 22:32 | - | |
| xmlsec1/ | 2016-08-13 16:30 | - | |
| xmlstarlet/ | 2016-08-13 16:32 | - | |
| xmlstreambuffer/ | 2018-10-18 22:41 | - | |
| xmms/ | 2019-02-27 11:55 | - | |
| xmonad/ | 2019-03-21 15:39 | - | |
| xmount/ | 2019-02-27 12:02 | - | |
| xmp/ | 2018-10-18 22:54 | - | |
| xmpcore/ | 2016-08-13 16:34 | - | |
| xnec2c/ | 2018-10-18 22:57 | - | |
| xom/ | 2016-08-13 16:36 | - | |
| xonotic-data/ | 2018-10-18 23:12 | - | |
| xonotic/ | 2018-10-18 23:01 | - | |
| xoreos-tools/ | 2018-10-18 23:28 | - | |
| xorg-x11-resutils/ | 2018-10-18 23:32 | - | |
| xorgxrdp/ | 2019-02-27 12:05 | - | |
| xosd/ | 2018-10-18 23:38 | - | |
| xournal/ | 2016-08-13 16:38 | - | |
| xpa/ | 2018-10-18 23:41 | - | |
| xpdf/ | 2016-08-13 16:40 | - | |
| xplanet/ | 2018-10-18 23:44 | - | |
| xplayer-plparser/ | 2018-10-18 23:50 | - | |
| xplayer/ | 2019-03-21 15:41 | - | |
| xqc/ | 2016-08-13 16:41 | - | |
| xqilla/ | 2017-08-02 12:50 | - | |
| xrdhttpvoms/ | 2019-03-21 15:43 | - | |
| xrdp/ | 2019-02-27 12:13 | - | |
| xreader/ | 2019-03-21 15:45 | - | |
| xrootd/ | 2019-03-21 15:47 | - | |
| xrotor/ | 2016-08-13 16:45 | - | |
| xscreensaver/ | 2018-10-19 00:05 | - | |
| xsd/ | 2019-02-27 12:21 | - | |
| xsel/ | 2016-08-13 16:55 | - | |
| xsensors/ | 2018-10-19 00:13 | - | |
| xsp/ | 2019-03-21 15:49 | - | |
| xtuple-csvimp/ | 2019-03-01 04:42 | - | |
| xtuple-openrpt/ | 2019-02-27 12:32 | - | |
| xviewer-plugins/ | 2019-03-21 15:51 | - | |
| xviewer/ | 2018-10-19 00:23 | - | |
| xvkbd/ | 2016-08-13 16:58 | - | |
| xxhash/ | 2018-10-19 00:32 | - | |
| yad/ | 2018-10-19 00:35 | - | |
| yadifa/ | 2018-10-19 00:40 | - | |
| yakuake/ | 2018-10-19 00:45 | - | |
| yaml-cpp/ | 2018-10-19 00:51 | - | |
| yaml-cpp03/ | 2016-08-13 17:04 | - | |
| yamllint/ | 2019-02-27 12:40 | - | |
| yapet/ | 2019-03-21 15:53 | - | |
| yara/ | 2018-10-19 01:00 | - | |
| yasm/ | 2016-08-13 17:08 | - | |
| yawn/ | 2016-08-13 17:09 | - | |
| yaws/ | 2019-03-21 15:55 | - | |
| yaz/ | 2016-08-13 17:11 | - | |
| ycssmin/ | 2018-10-19 01:05 | - | |
| yersinia/ | 2018-10-19 01:08 | - | |
| ykclient/ | 2018-10-19 01:12 | - | |
| ykpers/ | 2018-10-19 01:15 | - | |
| ykushcmd/ | 2018-10-19 01:18 | - | |
| yourls/ | 2016-08-13 17:17 | - | |
| youtube-dl/ | 2019-02-27 12:44 | - | |
| ytnef/ | 2018-10-19 01:22 | - | |
| yubico-piv-tool/ | 2018-10-19 01:25 | - | |
| yubikey-personalization-gui/ | 2018-10-19 01:28 | - | |
| yubikey-piv-manager/ | 2019-02-27 12:47 | - | |
| yuicompressor/ | 2018-10-19 01:34 | - | |
| yum-axelget/ | 2016-08-13 17:23 | - | |
| yumex/ | 2016-08-13 17:24 | - | |
| zabbix20/ | 2018-10-19 01:38 | - | |
| zabbix22/ | 2019-02-27 12:49 | - | |
| zabbix30/ | 2018-10-19 01:50 | - | |
| zanata-python-client/ | 2018-10-19 01:56 | - | |
| zarafa/ | 2018-10-19 01:59 | - | |
| zathura-djvu/ | 2018-10-19 02:19 | - | |
| zathura-pdf-poppler/ | 2018-10-19 02:23 | - | |
| zathura-ps/ | 2018-10-19 02:27 | - | |
| zathura/ | 2018-10-19 02:14 | - | |
| zbackup/ | 2019-03-21 15:57 | - | |
| zbar/ | 2018-10-19 02:33 | - | |
| zchunk/ | 2019-03-21 15:59 | - | |
| zerofree/ | 2018-10-19 02:40 | - | |
| zeromq/ | 2019-03-21 16:02 | - | |
| zeromq3/ | 2016-08-13 17:40 | - | |
| zile/ | 2018-10-19 02:47 | - | |
| zinnia/ | 2016-08-13 17:45 | - | |
| zipios++/ | 2016-08-13 17:59 | - | |
| zlib-ada/ | 2016-08-13 18:00 | - | |
| zmap/ | 2016-08-13 18:02 | - | |
| znc/ | 2019-03-21 16:06 | - | |
| zopfli/ | 2016-08-13 18:06 | - | |
| zsh-lovers/ | 2016-08-13 18:07 | - | |
| zstd/ | 2019-02-27 13:08 | - | |
| zukitwo/ | 2016-08-13 18:09 | - | |
| zulucrypt/ | 2019-03-21 16:07 | - | |
| zvbi/ | 2016-08-10 23:16 | - | |